Index: lams_central/src/java/org/lamsfoundation/lams/webservice/PresenceChatLoggerServlet.java =================================================================== RCS file: /usr/local/cvsroot/lams_central/src/java/org/lamsfoundation/lams/webservice/Attic/PresenceChatLoggerServlet.java,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/src/java/org/lamsfoundation/lams/webservice/PresenceChatLoggerServlet.java 1 Apr 2009 00:45:17 -0000 1.1 @@ -0,0 +1,96 @@ +/**************************************************************** + * Copyright (C) 2005 LAMS Foundation (http://lamsfoundation.org) + * ============================================================= + * License Information: http://lamsfoundation.org/licensing/lams/2.0/ + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2.0 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 * USA + * + * http://www.gnu.org/licenses/gpl.txt + * **************************************************************** + */ + +package org.lamsfoundation.lams.webservice; + +import java.util.Date; + +import javax.servlet.ServletContext; +import javax.servlet.ServletException; +import javax.servlet.http.HttpServlet; +import javax.servlet.http.HttpServletRequest; +import javax.servlet.http.HttpServletResponse; + +import org.apache.axis.MessageContext; +import org.apache.axis.transport.http.HTTPConstants; +import org.apache.log4j.Logger; +import org.lamsfoundation.lams.integration.service.IIntegrationService; +import org.lamsfoundation.lams.presence.service.IPresenceChatLoggerService; +import org.lamsfoundation.lams.usermanagement.service.IUserManagementService; +import org.lamsfoundation.lams.util.WebUtil; +import org.lamsfoundation.lams.web.util.HttpSessionManager; +import org.springframework.web.context.WebApplicationContext; +import org.springframework.web.context.support.WebApplicationContextUtils; + +/** + * @author pgeorges + * + * @web:servlet name="PresenceChatLoggerServlet" + * @web:servlet-mapping url-pattern="/PresenceChatLogger" + */ +public class PresenceChatLoggerServlet extends HttpServlet { + + private static Logger logger = Logger.getLogger(PresenceChatLoggerServlet.class); + + /* + private static MessageContext context = MessageContext.getCurrentContext(); + + private static IPresenceChatLoggerService presenceChatLoggerService = + (IPresenceChatLoggerService) WebApplicationContextUtils.getRequiredWebApplicationContext( + ((HttpServlet) context.getProperty(HTTPConstants.MC_HTTP_SERVLET)) + .getServletContext()).getBean("presenceChatLoggerService"); + */ + + public void doPost(HttpServletRequest request, HttpServletResponse response) + throws ServletException { + + try { + String roomName = WebUtil.readStrParam(request, "roomName"); + String from = WebUtil.readStrParam(request, "from"); + String to = WebUtil.readStrParam(request, "to"); + String dateSentString = WebUtil.readStrParam(request, "dateSent"); + String message = WebUtil.readStrParam(request, "message"); + + Date dateSent = new Date(dateSentString); + + /* + WebApplicationContext wac = WebApplicationContextUtils.getRequiredWebApplicationContext(getServletContext()); + IPresenceChatLoggerService presenceChatLoggerService = (IPresenceChatLoggerService)wac.getBean("presenceChatLoggerService"); + */ + + WebApplicationContext ctx = WebApplicationContextUtils.getWebApplicationContext(HttpSessionManager + .getInstance().getServletContext()); + IPresenceChatLoggerService presenceChatLoggerService = (IPresenceChatLoggerService) ctx.getBean("presenceChatLoggerService"); + + presenceChatLoggerService.createPresenceChatMessage(roomName, from, to, dateSent, message); + } catch (Exception e) { + logger.error(e.getMessage()); + } + } + + public void doGet(HttpServletRequest request, HttpServletResponse response) + throws ServletException { + doPost(request, response); + } + +} + \ No newline at end of file Index: lams_central/web/learner.jsp =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/Attic/learner.jsp,v diff -u -r1.17 -r1.18 --- lams_central/web/learner.jsp 25 Nov 2008 00:59:52 -0000 1.17 +++ lams_central/web/learner.jsp 1 Apr 2009 00:45:17 -0000 1.18 @@ -13,10 +13,10 @@ - &portfolioEnabled=&presenceEnabledPatch=&presenceImEnabled=&presenceUrl=&title=&mode="> + &portfolioEnabled=&presenceEnabledPatch=&presenceImEnabled=&presenceUrl=&createDateTime=&title=&mode="> - &portfolioEnabled=&presenceEnabledPatch=&presenceImEnabled=&presenceUrl=&createDateTime=&title=&mode="> + &portfolioEnabled=&presenceEnabledPatch=&presenceImEnabled=&presenceUrl=&createDateTime=&title=&mode="> Index: lams_central/web/includes/javascript/jquery-latest.pack.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/Attic/jquery-latest.pack.js,v diff -u -r1.2 -r1.3 --- lams_central/web/includes/javascript/jquery-latest.pack.js 31 Oct 2008 04:02:10 -0000 1.2 +++ lams_central/web/includes/javascript/jquery-latest.pack.js 1 Apr 2009 00:45:17 -0000 1.3 @@ -1,11 +1,19 @@ /* - * jQuery 1.2.6 - New Wave Javascript + * jQuery JavaScript Library v1.3.2 + * http://jquery.com/ * - * Copyright (c) 2008 John Resig (jquery.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. + * Copyright (c) 2009 John Resig + * Dual licensed under the MIT and GPL licenses. + * http://docs.jquery.com/License * - * $Date$ - * $Rev: 5685 $ + * Date: 2009-02-19 17:34:21 -0500 (Thu, 19 Feb 2009) + * Revision: 6246 */ -eval(function(p,a,c,k,e,r){e=function(c){return(c35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('(H(){J w=1b.4M,3m$=1b.$;J D=1b.4M=1b.$=H(a,b){I 2B D.17.5j(a,b)};J u=/^[^<]*(<(.|\\s)+>)[^>]*$|^#(\\w+)$/,62=/^.[^:#\\[\\.]*$/,12;D.17=D.44={5j:H(d,b){d=d||S;G(d.16){7[0]=d;7.K=1;I 7}G(1j d=="23"){J c=u.2D(d);G(c&&(c[1]||!b)){G(c[1])d=D.4h([c[1]],b);N{J a=S.61(c[3]);G(a){G(a.2v!=c[3])I D().2q(d);I D(a)}d=[]}}N I D(b).2q(d)}N G(D.1D(d))I D(S)[D.17.27?"27":"43"](d);I 7.6Y(D.2d(d))},5w:"1.2.6",8G:H(){I 7.K},K:0,3p:H(a){I a==12?D.2d(7):7[a]},2I:H(b){J a=D(b);a.5n=7;I a},6Y:H(a){7.K=0;2p.44.1p.1w(7,a);I 7},P:H(a,b){I D.P(7,a,b)},5i:H(b){J a=-1;I D.2L(b&&b.5w?b[0]:b,7)},1K:H(c,a,b){J d=c;G(c.1q==56)G(a===12)I 7[0]&&D[b||"1K"](7[0],c);N{d={};d[c]=a}I 7.P(H(i){R(c 1n d)D.1K(b?7.V:7,c,D.1i(7,d[c],b,i,c))})},1g:H(b,a){G((b==\'2h\'||b==\'1Z\')&&3d(a)<0)a=12;I 7.1K(b,a,"2a")},1r:H(b){G(1j b!="49"&&b!=U)I 7.4E().3v((7[0]&&7[0].2z||S).5F(b));J a="";D.P(b||7,H(){D.P(7.3t,H(){G(7.16!=8)a+=7.16!=1?7.76:D.17.1r([7])})});I a},5z:H(b){G(7[0])D(b,7[0].2z).5y().39(7[0]).2l(H(){J a=7;1B(a.1x)a=a.1x;I a}).3v(7);I 7},8Y:H(a){I 7.P(H(){D(7).6Q().5z(a)})},8R:H(a){I 7.P(H(){D(7).5z(a)})},3v:H(){I 7.3W(19,M,Q,H(a){G(7.16==1)7.3U(a)})},6F:H(){I 7.3W(19,M,M,H(a){G(7.16==1)7.39(a,7.1x)})},6E:H(){I 7.3W(19,Q,Q,H(a){7.1d.39(a,7)})},5q:H(){I 7.3W(19,Q,M,H(a){7.1d.39(a,7.2H)})},3l:H(){I 7.5n||D([])},2q:H(b){J c=D.2l(7,H(a){I D.2q(b,a)});I 7.2I(/[^+>] [^+>]/.11(b)||b.1h("..")>-1?D.4r(c):c)},5y:H(e){J f=7.2l(H(){G(D.14.1f&&!D.4n(7)){J a=7.6o(M),5h=S.3h("1v");5h.3U(a);I D.4h([5h.4H])[0]}N I 7.6o(M)});J d=f.2q("*").5c().P(H(){G(7[E]!=12)7[E]=U});G(e===M)7.2q("*").5c().P(H(i){G(7.16==3)I;J c=D.L(7,"3w");R(J a 1n c)R(J b 1n c[a])D.W.1e(d[i],a,c[a][b],c[a][b].L)});I f},1E:H(b){I 7.2I(D.1D(b)&&D.3C(7,H(a,i){I b.1k(a,i)})||D.3g(b,7))},4Y:H(b){G(b.1q==56)G(62.11(b))I 7.2I(D.3g(b,7,M));N b=D.3g(b,7);J a=b.K&&b[b.K-1]!==12&&!b.16;I 7.1E(H(){I a?D.2L(7,b)<0:7!=b})},1e:H(a){I 7.2I(D.4r(D.2R(7.3p(),1j a==\'23\'?D(a):D.2d(a))))},3F:H(a){I!!a&&D.3g(a,7).K>0},7T:H(a){I 7.3F("."+a)},6e:H(b){G(b==12){G(7.K){J c=7[0];G(D.Y(c,"2A")){J e=c.64,63=[],15=c.15,2V=c.O=="2A-2V";G(e<0)I U;R(J i=2V?e:0,2f=2V?e+1:15.K;i<2f;i++){J d=15[i];G(d.2W){b=D.14.1f&&!d.at.2x.an?d.1r:d.2x;G(2V)I b;63.1p(b)}}I 63}N I(7[0].2x||"").1o(/\\r/g,"")}I 12}G(b.1q==4L)b+=\'\';I 7.P(H(){G(7.16!=1)I;G(b.1q==2p&&/5O|5L/.11(7.O))7.4J=(D.2L(7.2x,b)>=0||D.2L(7.34,b)>=0);N G(D.Y(7,"2A")){J a=D.2d(b);D("9R",7).P(H(){7.2W=(D.2L(7.2x,a)>=0||D.2L(7.1r,a)>=0)});G(!a.K)7.64=-1}N 7.2x=b})},2K:H(a){I a==12?(7[0]?7[0].4H:U):7.4E().3v(a)},7b:H(a){I 7.5q(a).21()},79:H(i){I 7.3s(i,i+1)},3s:H(){I 7.2I(2p.44.3s.1w(7,19))},2l:H(b){I 7.2I(D.2l(7,H(a,i){I b.1k(a,i,a)}))},5c:H(){I 7.1e(7.5n)},L:H(d,b){J a=d.1R(".");a[1]=a[1]?"."+a[1]:"";G(b===12){J c=7.5C("9z"+a[1]+"!",[a[0]]);G(c===12&&7.K)c=D.L(7[0],d);I c===12&&a[1]?7.L(a[0]):c}N I 7.1P("9u"+a[1]+"!",[a[0],b]).P(H(){D.L(7,d,b)})},3b:H(a){I 7.P(H(){D.3b(7,a)})},3W:H(g,f,h,d){J e=7.K>1,3x;I 7.P(H(){G(!3x){3x=D.4h(g,7.2z);G(h)3x.9o()}J b=7;G(f&&D.Y(7,"1T")&&D.Y(3x[0],"4F"))b=7.3H("22")[0]||7.3U(7.2z.3h("22"));J c=D([]);D.P(3x,H(){J a=e?D(7).5y(M)[0]:7;G(D.Y(a,"1m"))c=c.1e(a);N{G(a.16==1)c=c.1e(D("1m",a).21());d.1k(b,a)}});c.P(6T)})}};D.17.5j.44=D.17;H 6T(i,a){G(a.4d)D.3Y({1a:a.4d,31:Q,1O:"1m"});N D.5u(a.1r||a.6O||a.4H||"");G(a.1d)a.1d.37(a)}H 1z(){I+2B 8J}D.1l=D.17.1l=H(){J b=19[0]||{},i=1,K=19.K,4x=Q,15;G(b.1q==8I){4x=b;b=19[1]||{};i=2}G(1j b!="49"&&1j b!="H")b={};G(K==i){b=7;--i}R(;i-1}},6q:H(b,c,a){J e={};R(J d 1n c){e[d]=b.V[d];b.V[d]=c[d]}a.1k(b);R(J d 1n c)b.V[d]=e[d]},1g:H(d,e,c){G(e=="2h"||e=="1Z"){J b,3X={30:"5x",5g:"1G",18:"3I"},35=e=="2h"?["5e","6k"]:["5G","6i"];H 5b(){b=e=="2h"?d.8f:d.8c;J a=0,2C=0;D.P(35,H(){a+=3d(D.2a(d,"57"+7,M))||0;2C+=3d(D.2a(d,"2C"+7+"4b",M))||0});b-=29.83(a+2C)}G(D(d).3F(":4j"))5b();N D.6q(d,3X,5b);I 29.2f(0,b)}I D.2a(d,e,c)},2a:H(f,l,k){J e,V=f.V;H 3E(b){G(!D.14.2k)I Q;J a=3P.54(b,U);I!a||a.52("3E")==""}G(l=="1y"&&D.14.1f){e=D.1K(V,"1y");I e==""?"1":e}G(D.14.2G&&l=="18"){J d=V.50;V.50="0 7Y 7W";V.50=d}G(l.1I(/4i/i))l=y;G(!k&&V&&V[l])e=V[l];N G(3P.54){G(l.1I(/4i/i))l="4i";l=l.1o(/([A-Z])/g,"-$1").3y();J c=3P.54(f,U);G(c&&!3E(f))e=c.52(l);N{J g=[],2E=[],a=f,i=0;R(;a&&3E(a);a=a.1d)2E.6h(a);R(;i<2E.K;i++)G(3E(2E[i])){g[i]=2E[i].V.18;2E[i].V.18="3I"}e=l=="18"&&g[2E.K-1]!=U?"2F":(c&&c.52(l))||"";R(i=0;i]*?)\\/>/g,H(b,a,c){I c.1I(/^(aK|4f|7E|aG|4T|7A|aB|3n|az|ay|av)$/i)?b:a+">"});J f=D.3k(d).3y(),1v=h.3h("1v");J e=!f.1h("",""]||!f.1h("",""]||f.1I(/^<(aq|22|am|ak|ai)/)&&[1,"<1T>",""]||!f.1h("<4F")&&[2,"<1T><22>",""]||(!f.1h("<22><4F>",""]||!f.1h("<7E")&&[2,"<1T><22><7q>",""]||D.14.1f&&[1,"1v<1v>",""]||[0,"",""];1v.4H=e[1]+d+e[2];1B(e[0]--)1v=1v.5T;G(D.14.1f){J g=!f.1h("<1T")&&f.1h("<22")<0?1v.1x&&1v.1x.3t:e[1]=="<1T>"&&f.1h("<22")<0?1v.3t:[];R(J j=g.K-1;j>=0;--j)G(D.Y(g[j],"22")&&!g[j].3t.K)g[j].1d.37(g[j]);G(/^\\s/.11(d))1v.39(h.5F(d.1I(/^\\s*/)[0]),1v.1x)}d=D.2d(1v.3t)}G(d.K===0&&(!D.Y(d,"3V")&&!D.Y(d,"2A")))I;G(d[0]==12||D.Y(d,"3V")||d.15)k.1p(d);N k=D.2R(k,d)});I k},1K:H(d,f,c){G(!d||d.16==3||d.16==8)I 12;J e=!D.4n(d),40=c!==12,1f=D.14.1f;f=e&&D.3X[f]||f;G(d.2j){J g=/5Q|4d|V/.11(f);G(f=="2W"&&D.14.2k)d.1d.64;G(f 1n d&&e&&!g){G(40){G(f=="O"&&D.Y(d,"4T")&&d.1d)7p"O a3 a1\'t 9V 9U";d[f]=c}G(D.Y(d,"3V")&&d.7i(f))I d.7i(f).76;I d[f]}G(1f&&e&&f=="V")I D.1K(d.V,"9T",c);G(40)d.9Q(f,""+c);J h=1f&&e&&g?d.4G(f,2):d.4G(f);I h===U?12:h}G(1f&&f=="1y"){G(40){d.6B=1;d.1E=(d.1E||"").1o(/7f\\([^)]*\\)/,"")+(3r(c)+\'\'=="9L"?"":"7f(1y="+c*7a+")")}I d.1E&&d.1E.1h("1y=")>=0?(3d(d.1E.1I(/1y=([^)]*)/)[1])/7a)+\'\':""}f=f.1o(/-([a-z])/9H,H(a,b){I b.2r()});G(40)d[f]=c;I d[f]},3k:H(a){I(a||"").1o(/^\\s+|\\s+$/g,"")},2d:H(b){J a=[];G(b!=U){J i=b.K;G(i==U||b.1R||b.4I||b.1k)a[0]=b;N 1B(i)a[--i]=b[i]}I a},2L:H(b,a){R(J i=0,K=a.K;i*",7).21();1B(7.1x)7.37(7.1x)}},H(a,b){D.17[a]=H(){I 7.P(b,19)}});D.P(["6N","4b"],H(i,c){J b=c.3y();D.17[b]=H(a){I 7[0]==1b?D.14.2G&&S.1c["5t"+c]||D.14.2k&&1b["5s"+c]||S.70=="6Z"&&S.1C["5t"+c]||S.1c["5t"+c]:7[0]==S?29.2f(29.2f(S.1c["4y"+c],S.1C["4y"+c]),29.2f(S.1c["2i"+c],S.1C["2i"+c])):a==12?(7.K?D.1g(7[0],b):U):7.1g(b,a.1q==56?a:a+"2X")}});H 25(a,b){I a[0]&&3r(D.2a(a[0],b,M),10)||0}J C=D.14.2k&&3r(D.14.5B)<8H?"(?:[\\\\w*3m-]|\\\\\\\\.)":"(?:[\\\\w\\8F-\\8E*3m-]|\\\\\\\\.)",6L=2B 4v("^>\\\\s*("+C+"+)"),6J=2B 4v("^("+C+"+)(#)("+C+"+)"),6I=2B 4v("^([#.]?)("+C+"*)");D.1l({6H:{"":H(a,i,m){I m[2]=="*"||D.Y(a,m[2])},"#":H(a,i,m){I a.4G("2v")==m[2]},":":{8D:H(a,i,m){I im[3]-0},3a:H(a,i,m){I m[3]-0==i},79:H(a,i,m){I m[3]-0==i},3o:H(a,i){I i==0},3S:H(a,i,m,r){I i==r.K-1},6D:H(a,i){I i%2==0},6C:H(a,i){I i%2},"3o-4u":H(a){I a.1d.3H("*")[0]==a},"3S-4u":H(a){I D.3a(a.1d.5T,1,"4l")==a},"8z-4u":H(a){I!D.3a(a.1d.5T,2,"4l")},6W:H(a){I a.1x},4E:H(a){I!a.1x},8y:H(a,i,m){I(a.6O||a.8x||D(a).1r()||"").1h(m[3])>=0},4j:H(a){I"1G"!=a.O&&D.1g(a,"18")!="2F"&&D.1g(a,"5g")!="1G"},1G:H(a){I"1G"==a.O||D.1g(a,"18")=="2F"||D.1g(a,"5g")=="1G"},8w:H(a){I!a.3R},3R:H(a){I a.3R},4J:H(a){I a.4J},2W:H(a){I a.2W||D.1K(a,"2W")},1r:H(a){I"1r"==a.O},5O:H(a){I"5O"==a.O},5L:H(a){I"5L"==a.O},5p:H(a){I"5p"==a.O},3Q:H(a){I"3Q"==a.O},5o:H(a){I"5o"==a.O},6A:H(a){I"6A"==a.O},6z:H(a){I"6z"==a.O},2s:H(a){I"2s"==a.O||D.Y(a,"2s")},4T:H(a){I/4T|2A|6y|2s/i.11(a.Y)},3T:H(a,i,m){I D.2q(m[3],a).K},8t:H(a){I/h\\d/i.11(a.Y)},8s:H(a){I D.3C(D.3O,H(b){I a==b.T}).K}}},6x:[/^(\\[) *@?([\\w-]+) *([!*$^~=]*) *(\'?"?)(.*?)\\4 *\\]/,/^(:)([\\w-]+)\\("?\'?(.*?(\\(.*?\\))?[^(]*?)"?\'?\\)/,2B 4v("^([:.#]*)("+C+"+)")],3g:H(a,c,b){J d,1t=[];1B(a&&a!=d){d=a;J f=D.1E(a,c,b);a=f.t.1o(/^\\s*,\\s*/,"");1t=b?c=f.r:D.2R(1t,f.r)}I 1t},2q:H(t,o){G(1j t!="23")I[t];G(o&&o.16!=1&&o.16!=9)I[];o=o||S;J d=[o],2o=[],3S,Y;1B(t&&3S!=t){J r=[];3S=t;t=D.3k(t);J l=Q,3j=6L,m=3j.2D(t);G(m){Y=m[1].2r();R(J i=0;d[i];i++)R(J c=d[i].1x;c;c=c.2H)G(c.16==1&&(Y=="*"||c.Y.2r()==Y))r.1p(c);d=r;t=t.1o(3j,"");G(t.1h(" ")==0)6M;l=M}N{3j=/^([>+~])\\s*(\\w*)/i;G((m=3j.2D(t))!=U){r=[];J k={};Y=m[2].2r();m=m[1];R(J j=0,3i=d.K;j<3i;j++){J n=m=="~"||m=="+"?d[j].2H:d[j].1x;R(;n;n=n.2H)G(n.16==1){J g=D.L(n);G(m=="~"&&k[g])1X;G(!Y||n.Y.2r()==Y){G(m=="~")k[g]=M;r.1p(n)}G(m=="+")1X}}d=r;t=D.3k(t.1o(3j,""));l=M}}G(t&&!l){G(!t.1h(",")){G(o==d[0])d.4s();2o=D.2R(2o,d);r=d=[o];t=" "+t.6v(1,t.K)}N{J h=6J;J m=h.2D(t);G(m){m=[0,m[2],m[3],m[1]]}N{h=6I;m=h.2D(t)}m[2]=m[2].1o(/\\\\/g,"");J f=d[d.K-1];G(m[1]=="#"&&f&&f.61&&!D.4n(f)){J p=f.61(m[2]);G((D.14.1f||D.14.2G)&&p&&1j p.2v=="23"&&p.2v!=m[2])p=D(\'[@2v="\'+m[2]+\'"]\',f)[0];d=r=p&&(!m[3]||D.Y(p,m[3]))?[p]:[]}N{R(J i=0;d[i];i++){J a=m[1]=="#"&&m[3]?m[3]:m[1]!=""||m[0]==""?"*":m[2];G(a=="*"&&d[i].Y.3y()=="49")a="3n";r=D.2R(r,d[i].3H(a))}G(m[1]==".")r=D.5m(r,m[2]);G(m[1]=="#"){J e=[];R(J i=0;r[i];i++)G(r[i].4G("2v")==m[2]){e=[r[i]];1X}r=e}d=r}t=t.1o(h,"")}}G(t){J b=D.1E(t,r);d=r=b.r;t=D.3k(b.t)}}G(t)d=[];G(d&&o==d[0])d.4s();2o=D.2R(2o,d);I 2o},5m:H(r,m,a){m=" "+m+" ";J c=[];R(J i=0;r[i];i++){J b=(" "+r[i].1F+" ").1h(m)>=0;G(!a&&b||a&&!b)c.1p(r[i])}I c},1E:H(t,r,h){J d;1B(t&&t!=d){d=t;J p=D.6x,m;R(J i=0;p[i];i++){m=p[i].2D(t);G(m){t=t.8r(m[0].K);m[2]=m[2].1o(/\\\\/g,"");1X}}G(!m)1X;G(m[1]==":"&&m[2]=="4Y")r=62.11(m[3])?D.1E(m[3],r,M).r:D(r).4Y(m[3]);N G(m[1]==".")r=D.5m(r,m[2],h);N G(m[1]=="["){J g=[],O=m[3];R(J i=0,3i=r.K;i<3i;i++){J a=r[i],z=a[D.3X[m[2]]||m[2]];G(z==U||/5Q|4d|2W/.11(m[2]))z=D.1K(a,m[2])||\'\';G((O==""&&!!z||O=="="&&z==m[5]||O=="!="&&z!=m[5]||O=="^="&&z&&!z.1h(m[5])||O=="$="&&z.6v(z.K-m[5].K)==m[5]||(O=="*="||O=="~=")&&z.1h(m[5])>=0)^h)g.1p(a)}r=g}N G(m[1]==":"&&m[2]=="3a-4u"){J e={},g=[],11=/(-?)(\\d*)n((?:\\+|-)?\\d*)/.2D(m[3]=="6D"&&"2n"||m[3]=="6C"&&"2n+1"||!/\\D/.11(m[3])&&"8q+"+m[3]||m[3]),3o=(11[1]+(11[2]||1))-0,d=11[3]-0;R(J i=0,3i=r.K;i<3i;i++){J j=r[i],1d=j.1d,2v=D.L(1d);G(!e[2v]){J c=1;R(J n=1d.1x;n;n=n.2H)G(n.16==1)n.4q=c++;e[2v]=M}J b=Q;G(3o==0){G(j.4q==d)b=M}N G((j.4q-d)%3o==0&&(j.4q-d)/3o>=0)b=M;G(b^h)g.1p(j)}r=g}N{J f=D.6H[m[1]];G(1j f=="49")f=f[m[2]];G(1j f=="23")f=6u("Q||H(a,i){I "+f+";}");r=D.3C(r,H(a,i){I f(a,i,m,r)},h)}}I{r:r,t:t}},4S:H(b,c){J a=[],1t=b[c];1B(1t&&1t!=S){G(1t.16==1)a.1p(1t);1t=1t[c]}I a},3a:H(a,e,c,b){e=e||1;J d=0;R(;a;a=a[c])G(a.16==1&&++d==e)1X;I a},5v:H(n,a){J r=[];R(;n;n=n.2H){G(n.16==1&&n!=a)r.1p(n)}I r}});D.W={1e:H(f,i,g,e){G(f.16==3||f.16==8)I;G(D.14.1f&&f.4I)f=1b;G(!g.24)g.24=7.24++;G(e!=12){J h=g;g=7.3M(h,H(){I h.1w(7,19)});g.L=e}J j=D.L(f,"3w")||D.L(f,"3w",{}),1H=D.L(f,"1H")||D.L(f,"1H",H(){G(1j D!="12"&&!D.W.5k)I D.W.1H.1w(19.3L.T,19)});1H.T=f;D.P(i.1R(/\\s+/),H(c,b){J a=b.1R(".");b=a[0];g.O=a[1];J d=j[b];G(!d){d=j[b]={};G(!D.W.2t[b]||D.W.2t[b].4p.1k(f)===Q){G(f.3K)f.3K(b,1H,Q);N G(f.6t)f.6t("4o"+b,1H)}}d[g.24]=g;D.W.26[b]=M});f=U},24:1,26:{},21:H(e,h,f){G(e.16==3||e.16==8)I;J i=D.L(e,"3w"),1L,5i;G(i){G(h==12||(1j h=="23"&&h.8p(0)=="."))R(J g 1n i)7.21(e,g+(h||""));N{G(h.O){f=h.2y;h=h.O}D.P(h.1R(/\\s+/),H(b,a){J c=a.1R(".");a=c[0];G(i[a]){G(f)2U i[a][f.24];N R(f 1n i[a])G(!c[1]||i[a][f].O==c[1])2U i[a][f];R(1L 1n i[a])1X;G(!1L){G(!D.W.2t[a]||D.W.2t[a].4A.1k(e)===Q){G(e.6p)e.6p(a,D.L(e,"1H"),Q);N G(e.6n)e.6n("4o"+a,D.L(e,"1H"))}1L=U;2U i[a]}}})}R(1L 1n i)1X;G(!1L){J d=D.L(e,"1H");G(d)d.T=U;D.3b(e,"3w");D.3b(e,"1H")}}},1P:H(h,c,f,g,i){c=D.2d(c);G(h.1h("!")>=0){h=h.3s(0,-1);J a=M}G(!f){G(7.26[h])D("*").1e([1b,S]).1P(h,c)}N{G(f.16==3||f.16==8)I 12;J b,1L,17=D.1D(f[h]||U),W=!c[0]||!c[0].32;G(W){c.6h({O:h,2J:f,32:H(){},3J:H(){},4C:1z()});c[0][E]=M}c[0].O=h;G(a)c[0].6m=M;J d=D.L(f,"1H");G(d)b=d.1w(f,c);G((!17||(D.Y(f,\'a\')&&h=="4V"))&&f["4o"+h]&&f["4o"+h].1w(f,c)===Q)b=Q;G(W)c.4s();G(i&&D.1D(i)){1L=i.1w(f,b==U?c:c.7d(b));G(1L!==12)b=1L}G(17&&g!==Q&&b!==Q&&!(D.Y(f,\'a\')&&h=="4V")){7.5k=M;1U{f[h]()}1V(e){}}7.5k=Q}I b},1H:H(b){J a,1L,38,5f,4m;b=19[0]=D.W.6l(b||1b.W);38=b.O.1R(".");b.O=38[0];38=38[1];5f=!38&&!b.6m;4m=(D.L(7,"3w")||{})[b.O];R(J j 1n 4m){J c=4m[j];G(5f||c.O==38){b.2y=c;b.L=c.L;1L=c.1w(7,19);G(a!==Q)a=1L;G(1L===Q){b.32();b.3J()}}}I a},6l:H(b){G(b[E]==M)I b;J d=b;b={8o:d};J c="8n 8m 8l 8k 2s 8j 47 5d 6j 5E 8i L 8h 8g 4K 2y 5a 59 8e 8b 58 6f 8a 88 4k 87 86 84 6d 2J 4C 6c O 82 81 35".1R(" ");R(J i=c.K;i;i--)b[c[i]]=d[c[i]];b[E]=M;b.32=H(){G(d.32)d.32();d.80=Q};b.3J=H(){G(d.3J)d.3J();d.7Z=M};b.4C=b.4C||1z();G(!b.2J)b.2J=b.6d||S;G(b.2J.16==3)b.2J=b.2J.1d;G(!b.4k&&b.4K)b.4k=b.4K==b.2J?b.6c:b.4K;G(b.58==U&&b.5d!=U){J a=S.1C,1c=S.1c;b.58=b.5d+(a&&a.2e||1c&&1c.2e||0)-(a.6b||0);b.6f=b.6j+(a&&a.2c||1c&&1c.2c||0)-(a.6a||0)}G(!b.35&&((b.47||b.47===0)?b.47:b.5a))b.35=b.47||b.5a;G(!b.59&&b.5E)b.59=b.5E;G(!b.35&&b.2s)b.35=(b.2s&1?1:(b.2s&2?3:(b.2s&4?2:0)));I b},3M:H(a,b){b.24=a.24=a.24||b.24||7.24++;I b},2t:{27:{4p:H(){55();I},4A:H(){I}},3D:{4p:H(){G(D.14.1f)I Q;D(7).2O("53",D.W.2t.3D.2y);I M},4A:H(){G(D.14.1f)I Q;D(7).4e("53",D.W.2t.3D.2y);I M},2y:H(a){G(F(a,7))I M;a.O="3D";I D.W.1H.1w(7,19)}},3N:{4p:H(){G(D.14.1f)I Q;D(7).2O("51",D.W.2t.3N.2y);I M},4A:H(){G(D.14.1f)I Q;D(7).4e("51",D.W.2t.3N.2y);I M},2y:H(a){G(F(a,7))I M;a.O="3N";I D.W.1H.1w(7,19)}}}};D.17.1l({2O:H(c,a,b){I c=="4X"?7.2V(c,a,b):7.P(H(){D.W.1e(7,c,b||a,b&&a)})},2V:H(d,b,c){J e=D.W.3M(c||b,H(a){D(7).4e(a,e);I(c||b).1w(7,19)});I 7.P(H(){D.W.1e(7,d,e,c&&b)})},4e:H(a,b){I 7.P(H(){D.W.21(7,a,b)})},1P:H(c,a,b){I 7.P(H(){D.W.1P(c,a,7,M,b)})},5C:H(c,a,b){I 7[0]&&D.W.1P(c,a,7[0],Q,b)},2m:H(b){J c=19,i=1;1B(i=0){J i=g.3s(e,g.K);g=g.3s(0,e)}c=c||H(){};J f="2P";G(d)G(D.1D(d)){c=d;d=U}N{d=D.3n(d);f="6g"}J h=7;D.3Y({1a:g,O:f,1O:"2K",L:d,1J:H(a,b){G(b=="1W"||b=="7J")h.2K(i?D("<1v/>").3v(a.4U.1o(/<1m(.|\\s)*?\\/1m>/g,"")).2q(i):a.4U);h.P(c,[a.4U,b,a])}});I 7},aL:H(){I D.3n(7.7I())},7I:H(){I 7.2l(H(){I D.Y(7,"3V")?D.2d(7.aH):7}).1E(H(){I 7.34&&!7.3R&&(7.4J||/2A|6y/i.11(7.Y)||/1r|1G|3Q/i.11(7.O))}).2l(H(i,c){J b=D(7).6e();I b==U?U:b.1q==2p?D.2l(b,H(a,i){I{34:c.34,2x:a}}):{34:c.34,2x:b}}).3p()}});D.P("7H,7G,7F,7D,7C,7B".1R(","),H(i,o){D.17[o]=H(f){I 7.2O(o,f)}});J B=1z();D.1l({3p:H(d,b,a,c){G(D.1D(b)){a=b;b=U}I D.3Y({O:"2P",1a:d,L:b,1W:a,1O:c})},aE:H(b,a){I D.3p(b,U,a,"1m")},aD:H(c,b,a){I D.3p(c,b,a,"3z")},aC:H(d,b,a,c){G(D.1D(b)){a=b;b={}}I D.3Y({O:"6g",1a:d,L:b,1W:a,1O:c})},aA:H(a){D.1l(D.60,a)},60:{1a:5Z.5Q,26:M,O:"2P",2T:0,7z:"4R/x-ax-3V-aw",7x:M,31:M,L:U,5Y:U,3Q:U,4Q:{2N:"4R/2N, 1r/2N",2K:"1r/2K",1m:"1r/4t, 4R/4t",3z:"4R/3z, 1r/4t",1r:"1r/as",4w:"*/*"}},4z:{},3Y:H(s){s=D.1l(M,s,D.1l(M,{},D.60,s));J g,2Z=/=\\?(&|$)/g,1u,L,O=s.O.2r();G(s.L&&s.7x&&1j s.L!="23")s.L=D.3n(s.L);G(s.1O=="4P"){G(O=="2P"){G(!s.1a.1I(2Z))s.1a+=(s.1a.1I(/\\?/)?"&":"?")+(s.4P||"7u")+"=?"}N G(!s.L||!s.L.1I(2Z))s.L=(s.L?s.L+"&":"")+(s.4P||"7u")+"=?";s.1O="3z"}G(s.1O=="3z"&&(s.L&&s.L.1I(2Z)||s.1a.1I(2Z))){g="4P"+B++;G(s.L)s.L=(s.L+"").1o(2Z,"="+g+"$1");s.1a=s.1a.1o(2Z,"="+g+"$1");s.1O="1m";1b[g]=H(a){L=a;1W();1J();1b[g]=12;1U{2U 1b[g]}1V(e){}G(i)i.37(h)}}G(s.1O=="1m"&&s.1Y==U)s.1Y=Q;G(s.1Y===Q&&O=="2P"){J j=1z();J k=s.1a.1o(/(\\?|&)3m=.*?(&|$)/,"$ap="+j+"$2");s.1a=k+((k==s.1a)?(s.1a.1I(/\\?/)?"&":"?")+"3m="+j:"")}G(s.L&&O=="2P"){s.1a+=(s.1a.1I(/\\?/)?"&":"?")+s.L;s.L=U}G(s.26&&!D.4O++)D.W.1P("7H");J n=/^(?:\\w+:)?\\/\\/([^\\/?#]+)/;G(s.1O=="1m"&&O=="2P"&&n.11(s.1a)&&n.2D(s.1a)[1]!=5Z.al){J i=S.3H("6w")[0];J h=S.3h("1m");h.4d=s.1a;G(s.7t)h.aj=s.7t;G(!g){J l=Q;h.ah=h.ag=H(){G(!l&&(!7.3f||7.3f=="68"||7.3f=="1J")){l=M;1W();1J();i.37(h)}}}i.3U(h);I 12}J m=Q;J c=1b.7s?2B 7s("ae.ac"):2B 7r();G(s.5Y)c.6R(O,s.1a,s.31,s.5Y,s.3Q);N c.6R(O,s.1a,s.31);1U{G(s.L)c.4B("ab-aa",s.7z);G(s.5S)c.4B("a9-5R-a8",D.4z[s.1a]||"a7, a6 a5 a4 5N:5N:5N a2");c.4B("X-9Z-9Y","7r");c.4B("9W",s.1O&&s.4Q[s.1O]?s.4Q[s.1O]+", */*":s.4Q.4w)}1V(e){}G(s.7m&&s.7m(c,s)===Q){s.26&&D.4O--;c.7l();I Q}G(s.26)D.W.1P("7B",[c,s]);J d=H(a){G(!m&&c&&(c.3f==4||a=="2T")){m=M;G(f){7k(f);f=U}1u=a=="2T"&&"2T"||!D.7j(c)&&"3e"||s.5S&&D.7h(c,s.1a)&&"7J"||"1W";G(1u=="1W"){1U{L=D.6X(c,s.1O,s.9S)}1V(e){1u="5J"}}G(1u=="1W"){J b;1U{b=c.5I("7g-5R")}1V(e){}G(s.5S&&b)D.4z[s.1a]=b;G(!g)1W()}N D.5H(s,c,1u);1J();G(s.31)c=U}};G(s.31){J f=4I(d,13);G(s.2T>0)3B(H(){G(c){c.7l();G(!m)d("2T")}},s.2T)}1U{c.9P(s.L)}1V(e){D.5H(s,c,U,e)}G(!s.31)d();H 1W(){G(s.1W)s.1W(L,1u);G(s.26)D.W.1P("7C",[c,s])}H 1J(){G(s.1J)s.1J(c,1u);G(s.26)D.W.1P("7F",[c,s]);G(s.26&&!--D.4O)D.W.1P("7G")}I c},5H:H(s,a,b,e){G(s.3e)s.3e(a,b,e);G(s.26)D.W.1P("7D",[a,s,e])},4O:0,7j:H(a){1U{I!a.1u&&5Z.9O=="5p:"||(a.1u>=7e&&a.1u<9N)||a.1u==7c||a.1u==9K||D.14.2k&&a.1u==12}1V(e){}I Q},7h:H(a,c){1U{J b=a.5I("7g-5R");I a.1u==7c||b==D.4z[c]||D.14.2k&&a.1u==12}1V(e){}I Q},6X:H(a,c,b){J d=a.5I("9J-O"),2N=c=="2N"||!c&&d&&d.1h("2N")>=0,L=2N?a.9I:a.4U;G(2N&&L.1C.2j=="5J")7p"5J";G(b)L=b(L,c);G(c=="1m")D.5u(L);G(c=="3z")L=6u("("+L+")");I L},3n:H(a){J s=[];G(a.1q==2p||a.5w)D.P(a,H(){s.1p(3u(7.34)+"="+3u(7.2x))});N R(J j 1n a)G(a[j]&&a[j].1q==2p)D.P(a[j],H(){s.1p(3u(j)+"="+3u(7))});N s.1p(3u(j)+"="+3u(D.1D(a[j])?a[j]():a[j]));I s.6s("&").1o(/%20/g,"+")}});D.17.1l({1N:H(c,b){I c?7.2g({1Z:"1N",2h:"1N",1y:"1N"},c,b):7.1E(":1G").P(H(){7.V.18=7.5D||"";G(D.1g(7,"18")=="2F"){J a=D("<"+7.2j+" />").6P("1c");7.V.18=a.1g("18");G(7.V.18=="2F")7.V.18="3I";a.21()}}).3l()},1M:H(b,a){I b?7.2g({1Z:"1M",2h:"1M",1y:"1M"},b,a):7.1E(":4j").P(H(){7.5D=7.5D||D.1g(7,"18");7.V.18="2F"}).3l()},78:D.17.2m,2m:H(a,b){I D.1D(a)&&D.1D(b)?7.78.1w(7,19):a?7.2g({1Z:"2m",2h:"2m",1y:"2m"},a,b):7.P(H(){D(7)[D(7).3F(":1G")?"1N":"1M"]()})},9G:H(b,a){I 7.2g({1Z:"1N"},b,a)},9F:H(b,a){I 7.2g({1Z:"1M"},b,a)},9E:H(b,a){I 7.2g({1Z:"2m"},b,a)},9D:H(b,a){I 7.2g({1y:"1N"},b,a)},9M:H(b,a){I 7.2g({1y:"1M"},b,a)},9C:H(c,a,b){I 7.2g({1y:a},c,b)},2g:H(k,j,i,g){J h=D.77(j,i,g);I 7[h.36===Q?"P":"36"](H(){G(7.16!=1)I Q;J f=D.1l({},h),p,1G=D(7).3F(":1G"),46=7;R(p 1n k){G(k[p]=="1M"&&1G||k[p]=="1N"&&!1G)I f.1J.1k(7);G(p=="1Z"||p=="2h"){f.18=D.1g(7,"18");f.33=7.V.33}}G(f.33!=U)7.V.33="1G";f.45=D.1l({},k);D.P(k,H(c,a){J e=2B D.28(46,f,c);G(/2m|1N|1M/.11(a))e[a=="2m"?1G?"1N":"1M":a](k);N{J b=a.6r().1I(/^([+-]=)?([\\d+-.]+)(.*)$/),2b=e.1t(M)||0;G(b){J d=3d(b[2]),2M=b[3]||"2X";G(2M!="2X"){46.V[c]=(d||1)+2M;2b=((d||1)/e.1t(M))*2b;46.V[c]=2b+2M}G(b[1])d=((b[1]=="-="?-1:1)*d)+2b;e.3G(2b,d,2M)}N e.3G(2b,a,"")}});I M})},36:H(a,b){G(D.1D(a)||(a&&a.1q==2p)){b=a;a="28"}G(!a||(1j a=="23"&&!b))I A(7[0],a);I 7.P(H(){G(b.1q==2p)A(7,a,b);N{A(7,a).1p(b);G(A(7,a).K==1)b.1k(7)}})},9X:H(b,c){J a=D.3O;G(b)7.36([]);7.P(H(){R(J i=a.K-1;i>=0;i--)G(a[i].T==7){G(c)a[i](M);a.7n(i,1)}});G(!c)7.5A();I 7}});J A=H(b,c,a){G(b){c=c||"28";J q=D.L(b,c+"36");G(!q||a)q=D.L(b,c+"36",D.2d(a))}I q};D.17.5A=H(a){a=a||"28";I 7.P(H(){J q=A(7,a);q.4s();G(q.K)q[0].1k(7)})};D.1l({77:H(b,a,c){J d=b&&b.1q==a0?b:{1J:c||!c&&a||D.1D(b)&&b,2u:b,41:c&&a||a&&a.1q!=9t&&a};d.2u=(d.2u&&d.2u.1q==4L?d.2u:D.28.5K[d.2u])||D.28.5K.74;d.5M=d.1J;d.1J=H(){G(d.36!==Q)D(7).5A();G(D.1D(d.5M))d.5M.1k(7)};I d},41:{73:H(p,n,b,a){I b+a*p},5P:H(p,n,b,a){I((-29.9r(p*29.9q)/2)+0.5)*a+b}},3O:[],48:U,28:H(b,c,a){7.15=c;7.T=b;7.1i=a;G(!c.3Z)c.3Z={}}});D.28.44={4D:H(){G(7.15.2Y)7.15.2Y.1k(7.T,7.1z,7);(D.28.2Y[7.1i]||D.28.2Y.4w)(7);G(7.1i=="1Z"||7.1i=="2h")7.T.V.18="3I"},1t:H(a){G(7.T[7.1i]!=U&&7.T.V[7.1i]==U)I 7.T[7.1i];J r=3d(D.1g(7.T,7.1i,a));I r&&r>-9p?r:3d(D.2a(7.T,7.1i))||0},3G:H(c,b,d){7.5V=1z();7.2b=c;7.3l=b;7.2M=d||7.2M||"2X";7.1z=7.2b;7.2S=7.4N=0;7.4D();J e=7;H t(a){I e.2Y(a)}t.T=7.T;D.3O.1p(t);G(D.48==U){D.48=4I(H(){J a=D.3O;R(J i=0;i7.15.2u+7.5V){7.1z=7.3l;7.2S=7.4N=1;7.4D();7.15.45[7.1i]=M;J b=M;R(J i 1n 7.15.45)G(7.15.45[i]!==M)b=Q;G(b){G(7.15.18!=U){7.T.V.33=7.15.33;7.T.V.18=7.15.18;G(D.1g(7.T,"18")=="2F")7.T.V.18="3I"}G(7.15.1M)7.T.V.18="2F";G(7.15.1M||7.15.1N)R(J p 1n 7.15.45)D.1K(7.T.V,p,7.15.3Z[p])}G(b)7.15.1J.1k(7.T);I Q}N{J n=t-7.5V;7.4N=n/7.15.2u;7.2S=D.41[7.15.41||(D.41.5P?"5P":"73")](7.4N,n,0,1,7.15.2u);7.1z=7.2b+((7.3l-7.2b)*7.2S);7.4D()}I M}};D.1l(D.28,{5K:{9l:9j,9i:7e,74:9g},2Y:{2e:H(a){a.T.2e=a.1z},2c:H(a){a.T.2c=a.1z},1y:H(a){D.1K(a.T.V,"1y",a.1z)},4w:H(a){a.T.V[a.1i]=a.1z+a.2M}}});D.17.2i=H(){J b=0,1S=0,T=7[0],3q;G(T)ao(D.14){J d=T.1d,4a=T,1s=T.1s,1Q=T.2z,5U=2k&&3r(5B)<9c&&!/9a/i.11(v),1g=D.2a,3c=1g(T,"30")=="3c";G(T.7y){J c=T.7y();1e(c.1A+29.2f(1Q.1C.2e,1Q.1c.2e),c.1S+29.2f(1Q.1C.2c,1Q.1c.2c));1e(-1Q.1C.6b,-1Q.1C.6a)}N{1e(T.5X,T.5W);1B(1s){1e(1s.5X,1s.5W);G(42&&!/^t(98|d|h)$/i.11(1s.2j)||2k&&!5U)2C(1s);G(!3c&&1g(1s,"30")=="3c")3c=M;4a=/^1c$/i.11(1s.2j)?4a:1s;1s=1s.1s}1B(d&&d.2j&&!/^1c|2K$/i.11(d.2j)){G(!/^96|1T.*$/i.11(1g(d,"18")))1e(-d.2e,-d.2c);G(42&&1g(d,"33")!="4j")2C(d);d=d.1d}G((5U&&(3c||1g(4a,"30")=="5x"))||(42&&1g(4a,"30")!="5x"))1e(-1Q.1c.5X,-1Q.1c.5W);G(3c)1e(29.2f(1Q.1C.2e,1Q.1c.2e),29.2f(1Q.1C.2c,1Q.1c.2c))}3q={1S:1S,1A:b}}H 2C(a){1e(D.2a(a,"6V",M),D.2a(a,"6U",M))}H 1e(l,t){b+=3r(l,10)||0;1S+=3r(t,10)||0}I 3q};D.17.1l({30:H(){J a=0,1S=0,3q;G(7[0]){J b=7.1s(),2i=7.2i(),4c=/^1c|2K$/i.11(b[0].2j)?{1S:0,1A:0}:b.2i();2i.1S-=25(7,\'94\');2i.1A-=25(7,\'aF\');4c.1S+=25(b,\'6U\');4c.1A+=25(b,\'6V\');3q={1S:2i.1S-4c.1S,1A:2i.1A-4c.1A}}I 3q},1s:H(){J a=7[0].1s;1B(a&&(!/^1c|2K$/i.11(a.2j)&&D.1g(a,\'30\')==\'93\'))a=a.1s;I D(a)}});D.P([\'5e\',\'5G\'],H(i,b){J c=\'4y\'+b;D.17[c]=H(a){G(!7[0])I;I a!=12?7.P(H(){7==1b||7==S?1b.92(!i?a:D(1b).2e(),i?a:D(1b).2c()):7[c]=a}):7[0]==1b||7[0]==S?46[i?\'aI\':\'aJ\']||D.71&&S.1C[c]||S.1c[c]:7[0][c]}});D.P(["6N","4b"],H(i,b){J c=i?"5e":"5G",4f=i?"6k":"6i";D.17["5s"+b]=H(){I 7[b.3y()]()+25(7,"57"+c)+25(7,"57"+4f)};D.17["90"+b]=H(a){I 7["5s"+b]()+25(7,"2C"+c+"4b")+25(7,"2C"+4f+"4b")+(a?25(7,"6S"+c)+25(7,"6S"+4f):0)}})})();',62,669,'|||||||this|||||||||||||||||||||||||||||||||||if|function|return|var|length|data|true|else|type|each|false|for|document|elem|null|style|event||nodeName|||test|undefined||browser|options|nodeType|fn|display|arguments|url|window|body|parentNode|add|msie|css|indexOf|prop|typeof|call|extend|script|in|replace|push|constructor|text|offsetParent|cur|status|div|apply|firstChild|opacity|now|left|while|documentElement|isFunction|filter|className|hidden|handle|match|complete|attr|ret|hide|show|dataType|trigger|doc|split|top|table|try|catch|success|break|cache|height||remove|tbody|string|guid|num|global|ready|fx|Math|curCSS|start|scrollTop|makeArray|scrollLeft|max|animate|width|offset|tagName|safari|map|toggle||done|Array|find|toUpperCase|button|special|duration|id|copy|value|handler|ownerDocument|select|new|border|exec|stack|none|opera|nextSibling|pushStack|target|html|inArray|unit|xml|bind|GET|isReady|merge|pos|timeout|delete|one|selected|px|step|jsre|position|async|preventDefault|overflow|name|which|queue|removeChild|namespace|insertBefore|nth|removeData|fixed|parseFloat|error|readyState|multiFilter|createElement|rl|re|trim|end|_|param|first|get|results|parseInt|slice|childNodes|encodeURIComponent|append|events|elems|toLowerCase|json|readyList|setTimeout|grep|mouseenter|color|is|custom|getElementsByTagName|block|stopPropagation|addEventListener|callee|proxy|mouseleave|timers|defaultView|password|disabled|last|has|appendChild|form|domManip|props|ajax|orig|set|easing|mozilla|load|prototype|curAnim|self|charCode|timerId|object|offsetChild|Width|parentOffset|src|unbind|br|currentStyle|clean|float|visible|relatedTarget|previousSibling|handlers|isXMLDoc|on|setup|nodeIndex|unique|shift|javascript|child|RegExp|_default|deep|scroll|lastModified|teardown|setRequestHeader|timeStamp|update|empty|tr|getAttribute|innerHTML|setInterval|checked|fromElement|Number|jQuery|state|active|jsonp|accepts|application|dir|input|responseText|click|styleSheets|unload|not|lastToggle|outline|mouseout|getPropertyValue|mouseover|getComputedStyle|bindReady|String|padding|pageX|metaKey|keyCode|getWH|andSelf|clientX|Left|all|visibility|container|index|init|triggered|removeAttribute|classFilter|prevObject|submit|file|after|windowData|inner|client|globalEval|sibling|jquery|absolute|clone|wrapAll|dequeue|version|triggerHandler|oldblock|ctrlKey|createTextNode|Top|handleError|getResponseHeader|parsererror|speeds|checkbox|old|00|radio|swing|href|Modified|ifModified|lastChild|safari2|startTime|offsetTop|offsetLeft|username|location|ajaxSettings|getElementById|isSimple|values|selectedIndex|runtimeStyle|rsLeft|_load|loaded|DOMContentLoaded|clientTop|clientLeft|toElement|srcElement|val|pageY|POST|unshift|Bottom|clientY|Right|fix|exclusive|detachEvent|cloneNode|removeEventListener|swap|toString|join|attachEvent|eval|substr|head|parse|textarea|reset|image|zoom|odd|even|before|prepend|exclude|expr|quickClass|quickID|uuid|quickChild|continue|Height|textContent|appendTo|contents|open|margin|evalScript|borderTopWidth|borderLeftWidth|parent|httpData|setArray|CSS1Compat|compatMode|boxModel|cssFloat|linear|def|webkit|nodeValue|speed|_toggle|eq|100|replaceWith|304|concat|200|alpha|Last|httpNotModified|getAttributeNode|httpSuccess|clearInterval|abort|beforeSend|splice|styleFloat|throw|colgroup|XMLHttpRequest|ActiveXObject|scriptCharset|callback|fieldset|multiple|processData|getBoundingClientRect|contentType|link|ajaxSend|ajaxSuccess|ajaxError|col|ajaxComplete|ajaxStop|ajaxStart|serializeArray|notmodified|keypress|keydown|change|mouseup|mousedown|dblclick|focus|blur|stylesheet|hasClass|rel|doScroll|black|hover|solid|cancelBubble|returnValue|wheelDelta|view|round|shiftKey|resize|screenY|screenX|relatedNode|mousemove|prevValue|originalTarget|offsetHeight|keyup|newValue|offsetWidth|eventPhase|detail|currentTarget|cancelable|bubbles|attrName|attrChange|altKey|originalEvent|charAt|0n|substring|animated|header|noConflict|line|enabled|innerText|contains|only|weight|font|gt|lt|uFFFF|u0128|size|417|Boolean|Date|toggleClass|removeClass|addClass|removeAttr|replaceAll|insertAfter|prependTo|wrap|contentWindow|contentDocument|iframe|children|siblings|prevAll|wrapInner|nextAll|outer|prev|scrollTo|static|marginTop|next|inline|parents|able|cellSpacing|adobeair|cellspacing|522|maxLength|maxlength|readOnly|400|readonly|fast|600|class|slow|1px|htmlFor|reverse|10000|PI|cos|compatible|Function|setData|ie|ra|it|rv|getData|userAgent|navigator|fadeTo|fadeIn|slideToggle|slideUp|slideDown|ig|responseXML|content|1223|NaN|fadeOut|300|protocol|send|setAttribute|option|dataFilter|cssText|changed|be|Accept|stop|With|Requested|Object|can|GMT|property|1970|Jan|01|Thu|Since|If|Type|Content|XMLHTTP|th|Microsoft|td|onreadystatechange|onload|cap|charset|colg|host|tfoot|specified|with|1_|thead|leg|plain|attributes|opt|embed|urlencoded|www|area|hr|ajaxSetup|meta|post|getJSON|getScript|marginLeft|img|elements|pageYOffset|pageXOffset|abbr|serialize|pixelLeft'.split('|'),0,{})) \ No newline at end of file +(function(){var l=this,g,y=l.jQuery,p=l.$,o=l.jQuery=l.$=function(E,F){return new o.fn.init(E,F)},D=/^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/,f=/^.[^:#\[\.,]*$/;o.fn=o.prototype={init:function(E,H){E=E||document;if(E.nodeType){this[0]=E;this.length=1;this.context=E;return this}if(typeof E==="string"){var G=D.exec(E);if(G&&(G[1]||!H)){if(G[1]){E=o.clean([G[1]],H)}else{var I=document.getElementById(G[3]);if(I&&I.id!=G[3]){return o().find(E)}var F=o(I||[]);F.context=document;F.selector=E;return F}}else{return o(H).find(E)}}else{if(o.isFunction(E)){return o(document).ready(E)}}if(E.selector&&E.context){this.selector=E.selector;this.context=E.context}return this.setArray(o.isArray(E)?E:o.makeArray(E))},selector:"",jquery:"1.3.2",size:function(){return this.length},get:function(E){return E===g?Array.prototype.slice.call(this):this[E]},pushStack:function(F,H,E){var G=o(F);G.prevObject=this;G.context=this.context;if(H==="find"){G.selector=this.selector+(this.selector?" ":"")+E}else{if(H){G.selector=this.selector+"."+H+"("+E+")"}}return G},setArray:function(E){this.length=0;Array.prototype.push.apply(this,E);return this},each:function(F,E){return o.each(this,F,E)},index:function(E){return o.inArray(E&&E.jquery?E[0]:E,this)},attr:function(F,H,G){var E=F;if(typeof F==="string"){if(H===g){return this[0]&&o[G||"attr"](this[0],F)}else{E={};E[F]=H}}return this.each(function(I){for(F in E){o.attr(G?this.style:this,F,o.prop(this,E[F],G,I,F))}})},css:function(E,F){if((E=="width"||E=="height")&&parseFloat(F)<0){F=g}return this.attr(E,F,"curCSS")},text:function(F){if(typeof F!=="object"&&F!=null){return this.empty().append((this[0]&&this[0].ownerDocument||document).createTextNode(F))}var E="";o.each(F||this,function(){o.each(this.childNodes,function(){if(this.nodeType!=8){E+=this.nodeType!=1?this.nodeValue:o.fn.text([this])}})});return E},wrapAll:function(E){if(this[0]){var F=o(E,this[0].ownerDocument).clone();if(this[0].parentNode){F.insertBefore(this[0])}F.map(function(){var G=this;while(G.firstChild){G=G.firstChild}return G}).append(this)}return this},wrapInner:function(E){return this.each(function(){o(this).contents().wrapAll(E)})},wrap:function(E){return this.each(function(){o(this).wrapAll(E)})},append:function(){return this.domManip(arguments,true,function(E){if(this.nodeType==1){this.appendChild(E)}})},prepend:function(){return this.domManip(arguments,true,function(E){if(this.nodeType==1){this.insertBefore(E,this.firstChild)}})},before:function(){return this.domManip(arguments,false,function(E){this.parentNode.insertBefore(E,this)})},after:function(){return this.domManip(arguments,false,function(E){this.parentNode.insertBefore(E,this.nextSibling)})},end:function(){return this.prevObject||o([])},push:[].push,sort:[].sort,splice:[].splice,find:function(E){if(this.length===1){var F=this.pushStack([],"find",E);F.length=0;o.find(E,this[0],F);return F}else{return this.pushStack(o.unique(o.map(this,function(G){return o.find(E,G)})),"find",E)}},clone:function(G){var E=this.map(function(){if(!o.support.noCloneEvent&&!o.isXMLDoc(this)){var I=this.outerHTML;if(!I){var J=this.ownerDocument.createElement("div");J.appendChild(this.cloneNode(true));I=J.innerHTML}return o.clean([I.replace(/ jQuery\d+="(?:\d+|null)"/g,"").replace(/^\s*/,"")])[0]}else{return this.cloneNode(true)}});if(G===true){var H=this.find("*").andSelf(),F=0;E.find("*").andSelf().each(function(){if(this.nodeName!==H[F].nodeName){return}var I=o.data(H[F],"events");for(var K in I){for(var J in I[K]){o.event.add(this,K,I[K][J],I[K][J].data)}}F++})}return E},filter:function(E){return this.pushStack(o.isFunction(E)&&o.grep(this,function(G,F){return E.call(G,F)})||o.multiFilter(E,o.grep(this,function(F){return F.nodeType===1})),"filter",E)},closest:function(E){var G=o.expr.match.POS.test(E)?o(E):null,F=0;return this.map(function(){var H=this;while(H&&H.ownerDocument){if(G?G.index(H)>-1:o(H).is(E)){o.data(H,"closest",F);return H}H=H.parentNode;F++}})},not:function(E){if(typeof E==="string"){if(f.test(E)){return this.pushStack(o.multiFilter(E,this,true),"not",E)}else{E=o.multiFilter(E,this)}}var F=E.length&&E[E.length-1]!==g&&!E.nodeType;return this.filter(function(){return F?o.inArray(this,E)<0:this!=E})},add:function(E){return this.pushStack(o.unique(o.merge(this.get(),typeof E==="string"?o(E):o.makeArray(E))))},is:function(E){return !!E&&o.multiFilter(E,this).length>0},hasClass:function(E){return !!E&&this.is("."+E)},val:function(K){if(K===g){var E=this[0];if(E){if(o.nodeName(E,"option")){return(E.attributes.value||{}).specified?E.value:E.text}if(o.nodeName(E,"select")){var I=E.selectedIndex,L=[],M=E.options,H=E.type=="select-one";if(I<0){return null}for(var F=H?I:0,J=H?I+1:M.length;F=0||o.inArray(this.name,K)>=0)}else{if(o.nodeName(this,"select")){var N=o.makeArray(K);o("option",this).each(function(){this.selected=(o.inArray(this.value,N)>=0||o.inArray(this.text,N)>=0)});if(!N.length){this.selectedIndex=-1}}else{this.value=K}}})},html:function(E){return E===g?(this[0]?this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g,""):null):this.empty().append(E)},replaceWith:function(E){return this.after(E).remove()},eq:function(E){return this.slice(E,+E+1)},slice:function(){return this.pushStack(Array.prototype.slice.apply(this,arguments),"slice",Array.prototype.slice.call(arguments).join(","))},map:function(E){return this.pushStack(o.map(this,function(G,F){return E.call(G,F,G)}))},andSelf:function(){return this.add(this.prevObject)},domManip:function(J,M,L){if(this[0]){var I=(this[0].ownerDocument||this[0]).createDocumentFragment(),F=o.clean(J,(this[0].ownerDocument||this[0]),I),H=I.firstChild;if(H){for(var G=0,E=this.length;G1||G>0?I.cloneNode(true):I)}}if(F){o.each(F,z)}}return this;function K(N,O){return M&&o.nodeName(N,"table")&&o.nodeName(O,"tr")?(N.getElementsByTagName("tbody")[0]||N.appendChild(N.ownerDocument.createElement("tbody"))):N}}};o.fn.init.prototype=o.fn;function z(E,F){if(F.src){o.ajax({url:F.src,async:false,dataType:"script"})}else{o.globalEval(F.text||F.textContent||F.innerHTML||"")}if(F.parentNode){F.parentNode.removeChild(F)}}function e(){return +new Date}o.extend=o.fn.extend=function(){var J=arguments[0]||{},H=1,I=arguments.length,E=false,G;if(typeof J==="boolean"){E=J;J=arguments[1]||{};H=2}if(typeof J!=="object"&&!o.isFunction(J)){J={}}if(I==H){J=this;--H}for(;H-1}},swap:function(H,G,I){var E={};for(var F in G){E[F]=H.style[F];H.style[F]=G[F]}I.call(H);for(var F in G){H.style[F]=E[F]}},css:function(H,F,J,E){if(F=="width"||F=="height"){var L,G={position:"absolute",visibility:"hidden",display:"block"},K=F=="width"?["Left","Right"]:["Top","Bottom"];function I(){L=F=="width"?H.offsetWidth:H.offsetHeight;if(E==="border"){return}o.each(K,function(){if(!E){L-=parseFloat(o.curCSS(H,"padding"+this,true))||0}if(E==="margin"){L+=parseFloat(o.curCSS(H,"margin"+this,true))||0}else{L-=parseFloat(o.curCSS(H,"border"+this+"Width",true))||0}})}if(H.offsetWidth!==0){I()}else{o.swap(H,G,I)}return Math.max(0,Math.round(L))}return o.curCSS(H,F,J)},curCSS:function(I,F,G){var L,E=I.style;if(F=="opacity"&&!o.support.opacity){L=o.attr(E,"opacity");return L==""?"1":L}if(F.match(/float/i)){F=w}if(!G&&E&&E[F]){L=E[F]}else{if(q.getComputedStyle){if(F.match(/float/i)){F="float"}F=F.replace(/([A-Z])/g,"-$1").toLowerCase();var M=q.getComputedStyle(I,null);if(M){L=M.getPropertyValue(F)}if(F=="opacity"&&L==""){L="1"}}else{if(I.currentStyle){var J=F.replace(/\-(\w)/g,function(N,O){return O.toUpperCase()});L=I.currentStyle[F]||I.currentStyle[J];if(!/^\d+(px)?$/i.test(L)&&/^\d/.test(L)){var H=E.left,K=I.runtimeStyle.left;I.runtimeStyle.left=I.currentStyle.left;E.left=L||0;L=E.pixelLeft+"px";E.left=H;I.runtimeStyle.left=K}}}}return L},clean:function(F,K,I){K=K||document;if(typeof K.createElement==="undefined"){K=K.ownerDocument||K[0]&&K[0].ownerDocument||document}if(!I&&F.length===1&&typeof F[0]==="string"){var H=/^<(\w+)\s*\/?>$/.exec(F[0]);if(H){return[K.createElement(H[1])]}}var G=[],E=[],L=K.createElement("div");o.each(F,function(P,S){if(typeof S==="number"){S+=""}if(!S){return}if(typeof S==="string"){S=S.replace(/(<(\w+)[^>]*?)\/>/g,function(U,V,T){return T.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i)?U:V+">"});var O=S.replace(/^\s+/,"").substring(0,10).toLowerCase();var Q=!O.indexOf("",""]||!O.indexOf("",""]||O.match(/^<(thead|tbody|tfoot|colg|cap)/)&&[1,"","
"]||!O.indexOf("",""]||(!O.indexOf("",""]||!O.indexOf("",""]||!o.support.htmlSerialize&&[1,"div
","
"]||[0,"",""];L.innerHTML=Q[1]+S+Q[2];while(Q[0]--){L=L.lastChild}if(!o.support.tbody){var R=/"&&!R?L.childNodes:[];for(var M=N.length-1;M>=0;--M){if(o.nodeName(N[M],"tbody")&&!N[M].childNodes.length){N[M].parentNode.removeChild(N[M])}}}if(!o.support.leadingWhitespace&&/^\s/.test(S)){L.insertBefore(K.createTextNode(S.match(/^\s*/)[0]),L.firstChild)}S=o.makeArray(L.childNodes)}if(S.nodeType){G.push(S)}else{G=o.merge(G,S)}});if(I){for(var J=0;G[J];J++){if(o.nodeName(G[J],"script")&&(!G[J].type||G[J].type.toLowerCase()==="text/javascript")){E.push(G[J].parentNode?G[J].parentNode.removeChild(G[J]):G[J])}else{if(G[J].nodeType===1){G.splice.apply(G,[J+1,0].concat(o.makeArray(G[J].getElementsByTagName("script"))))}I.appendChild(G[J])}}return E}return G},attr:function(J,G,K){if(!J||J.nodeType==3||J.nodeType==8){return g}var H=!o.isXMLDoc(J),L=K!==g;G=H&&o.props[G]||G;if(J.tagName){var F=/href|src|style/.test(G);if(G=="selected"&&J.parentNode){J.parentNode.selectedIndex}if(G in J&&H&&!F){if(L){if(G=="type"&&o.nodeName(J,"input")&&J.parentNode){throw"type property can't be changed"}J[G]=K}if(o.nodeName(J,"form")&&J.getAttributeNode(G)){return J.getAttributeNode(G).nodeValue}if(G=="tabIndex"){var I=J.getAttributeNode("tabIndex");return I&&I.specified?I.value:J.nodeName.match(/(button|input|object|select|textarea)/i)?0:J.nodeName.match(/^(a|area)$/i)&&J.href?0:g}return J[G]}if(!o.support.style&&H&&G=="style"){return o.attr(J.style,"cssText",K)}if(L){J.setAttribute(G,""+K)}var E=!o.support.hrefNormalized&&H&&F?J.getAttribute(G,2):J.getAttribute(G);return E===null?g:E}if(!o.support.opacity&&G=="opacity"){if(L){J.zoom=1;J.filter=(J.filter||"").replace(/alpha\([^)]*\)/,"")+(parseInt(K)+""=="NaN"?"":"alpha(opacity="+K*100+")")}return J.filter&&J.filter.indexOf("opacity=")>=0?(parseFloat(J.filter.match(/opacity=([^)]*)/)[1])/100)+"":""}G=G.replace(/-([a-z])/ig,function(M,N){return N.toUpperCase()});if(L){J[G]=K}return J[G]},trim:function(E){return(E||"").replace(/^\s+|\s+$/g,"")},makeArray:function(G){var E=[];if(G!=null){var F=G.length;if(F==null||typeof G==="string"||o.isFunction(G)||G.setInterval){E[0]=G}else{while(F){E[--F]=G[F]}}}return E},inArray:function(G,H){for(var E=0,F=H.length;E0?this.clone(true):this).get();o.fn[F].apply(o(L[K]),I);J=J.concat(I)}return this.pushStack(J,E,G)}});o.each({removeAttr:function(E){o.attr(this,E,"");if(this.nodeType==1){this.removeAttribute(E)}},addClass:function(E){o.className.add(this,E)},removeClass:function(E){o.className.remove(this,E)},toggleClass:function(F,E){if(typeof E!=="boolean"){E=!o.className.has(this,F)}o.className[E?"add":"remove"](this,F)},remove:function(E){if(!E||o.filter(E,[this]).length){o("*",this).add([this]).each(function(){o.event.remove(this);o.removeData(this)});if(this.parentNode){this.parentNode.removeChild(this)}}},empty:function(){o(this).children().remove();while(this.firstChild){this.removeChild(this.firstChild)}}},function(E,F){o.fn[E]=function(){return this.each(F,arguments)}});function j(E,F){return E[0]&&parseInt(o.curCSS(E[0],F,true),10)||0}var h="jQuery"+e(),v=0,A={};o.extend({cache:{},data:function(F,E,G){F=F==l?A:F;var H=F[h];if(!H){H=F[h]=++v}if(E&&!o.cache[H]){o.cache[H]={}}if(G!==g){o.cache[H][E]=G}return E?o.cache[H][E]:H},removeData:function(F,E){F=F==l?A:F;var H=F[h];if(E){if(o.cache[H]){delete o.cache[H][E];E="";for(E in o.cache[H]){break}if(!E){o.removeData(F)}}}else{try{delete F[h]}catch(G){if(F.removeAttribute){F.removeAttribute(h)}}delete o.cache[H]}},queue:function(F,E,H){if(F){E=(E||"fx")+"queue";var G=o.data(F,E);if(!G||o.isArray(H)){G=o.data(F,E,o.makeArray(H))}else{if(H){G.push(H)}}}return G},dequeue:function(H,G){var E=o.queue(H,G),F=E.shift();if(!G||G==="fx"){F=E[0]}if(F!==g){F.call(H)}}});o.fn.extend({data:function(E,G){var H=E.split(".");H[1]=H[1]?"."+H[1]:"";if(G===g){var F=this.triggerHandler("getData"+H[1]+"!",[H[0]]);if(F===g&&this.length){F=o.data(this[0],E)}return F===g&&H[1]?this.data(H[0]):F}else{return this.trigger("setData"+H[1]+"!",[H[0],G]).each(function(){o.data(this,E,G)})}},removeData:function(E){return this.each(function(){o.removeData(this,E)})},queue:function(E,F){if(typeof E!=="string"){F=E;E="fx"}if(F===g){return o.queue(this[0],E)}return this.each(function(){var G=o.queue(this,E,F);if(E=="fx"&&G.length==1){G[0].call(this)}})},dequeue:function(E){return this.each(function(){o.dequeue(this,E)})}}); +/* + * Sizzle CSS Selector Engine - v0.9.3 + * Copyright 2009, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){var R=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?/g,L=0,H=Object.prototype.toString;var F=function(Y,U,ab,ac){ab=ab||[];U=U||document;if(U.nodeType!==1&&U.nodeType!==9){return[]}if(!Y||typeof Y!=="string"){return ab}var Z=[],W,af,ai,T,ad,V,X=true;R.lastIndex=0;while((W=R.exec(Y))!==null){Z.push(W[1]);if(W[2]){V=RegExp.rightContext;break}}if(Z.length>1&&M.exec(Y)){if(Z.length===2&&I.relative[Z[0]]){af=J(Z[0]+Z[1],U)}else{af=I.relative[Z[0]]?[U]:F(Z.shift(),U);while(Z.length){Y=Z.shift();if(I.relative[Y]){Y+=Z.shift()}af=J(Y,af)}}}else{var ae=ac?{expr:Z.pop(),set:E(ac)}:F.find(Z.pop(),Z.length===1&&U.parentNode?U.parentNode:U,Q(U));af=F.filter(ae.expr,ae.set);if(Z.length>0){ai=E(af)}else{X=false}while(Z.length){var ah=Z.pop(),ag=ah;if(!I.relative[ah]){ah=""}else{ag=Z.pop()}if(ag==null){ag=U}I.relative[ah](ai,ag,Q(U))}}if(!ai){ai=af}if(!ai){throw"Syntax error, unrecognized expression: "+(ah||Y)}if(H.call(ai)==="[object Array]"){if(!X){ab.push.apply(ab,ai)}else{if(U.nodeType===1){for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&(ai[aa]===true||ai[aa].nodeType===1&&K(U,ai[aa]))){ab.push(af[aa])}}}else{for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&ai[aa].nodeType===1){ab.push(af[aa])}}}}}else{E(ai,ab)}if(V){F(V,U,ab,ac);if(G){hasDuplicate=false;ab.sort(G);if(hasDuplicate){for(var aa=1;aa":function(Z,U,aa){var X=typeof U==="string";if(X&&!/\W/.test(U)){U=aa?U:U.toUpperCase();for(var V=0,T=Z.length;V=0)){if(!V){T.push(Y)}}else{if(V){U[X]=false}}}}return false},ID:function(T){return T[1].replace(/\\/g,"")},TAG:function(U,T){for(var V=0;T[V]===false;V++){}return T[V]&&Q(T[V])?U[1]:U[1].toUpperCase()},CHILD:function(T){if(T[1]=="nth"){var U=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(T[2]=="even"&&"2n"||T[2]=="odd"&&"2n+1"||!/\D/.test(T[2])&&"0n+"+T[2]||T[2]);T[2]=(U[1]+(U[2]||1))-0;T[3]=U[3]-0}T[0]=L++;return T},ATTR:function(X,U,V,T,Y,Z){var W=X[1].replace(/\\/g,"");if(!Z&&I.attrMap[W]){X[1]=I.attrMap[W]}if(X[2]==="~="){X[4]=" "+X[4]+" "}return X},PSEUDO:function(X,U,V,T,Y){if(X[1]==="not"){if(X[3].match(R).length>1||/^\w/.test(X[3])){X[3]=F(X[3],null,null,U)}else{var W=F.filter(X[3],U,V,true^Y);if(!V){T.push.apply(T,W)}return false}}else{if(I.match.POS.test(X[0])||I.match.CHILD.test(X[0])){return true}}return X},POS:function(T){T.unshift(true);return T}},filters:{enabled:function(T){return T.disabled===false&&T.type!=="hidden"},disabled:function(T){return T.disabled===true},checked:function(T){return T.checked===true},selected:function(T){T.parentNode.selectedIndex;return T.selected===true},parent:function(T){return !!T.firstChild},empty:function(T){return !T.firstChild},has:function(V,U,T){return !!F(T[3],V).length},header:function(T){return/h\d/i.test(T.nodeName)},text:function(T){return"text"===T.type},radio:function(T){return"radio"===T.type},checkbox:function(T){return"checkbox"===T.type},file:function(T){return"file"===T.type},password:function(T){return"password"===T.type},submit:function(T){return"submit"===T.type},image:function(T){return"image"===T.type},reset:function(T){return"reset"===T.type},button:function(T){return"button"===T.type||T.nodeName.toUpperCase()==="BUTTON"},input:function(T){return/input|select|textarea|button/i.test(T.nodeName)}},setFilters:{first:function(U,T){return T===0},last:function(V,U,T,W){return U===W.length-1},even:function(U,T){return T%2===0},odd:function(U,T){return T%2===1},lt:function(V,U,T){return UT[3]-0},nth:function(V,U,T){return T[3]-0==U},eq:function(V,U,T){return T[3]-0==U}},filter:{PSEUDO:function(Z,V,W,aa){var U=V[1],X=I.filters[U];if(X){return X(Z,W,V,aa)}else{if(U==="contains"){return(Z.textContent||Z.innerText||"").indexOf(V[3])>=0}else{if(U==="not"){var Y=V[3];for(var W=0,T=Y.length;W=0)}}},ID:function(U,T){return U.nodeType===1&&U.getAttribute("id")===T},TAG:function(U,T){return(T==="*"&&U.nodeType===1)||U.nodeName===T},CLASS:function(U,T){return(" "+(U.className||U.getAttribute("class"))+" ").indexOf(T)>-1},ATTR:function(Y,W){var V=W[1],T=I.attrHandle[V]?I.attrHandle[V](Y):Y[V]!=null?Y[V]:Y.getAttribute(V),Z=T+"",X=W[2],U=W[4];return T==null?X==="!=":X==="="?Z===U:X==="*="?Z.indexOf(U)>=0:X==="~="?(" "+Z+" ").indexOf(U)>=0:!U?Z&&T!==false:X==="!="?Z!=U:X==="^="?Z.indexOf(U)===0:X==="$="?Z.substr(Z.length-U.length)===U:X==="|="?Z===U||Z.substr(0,U.length+1)===U+"-":false},POS:function(X,U,V,Y){var T=U[2],W=I.setFilters[T];if(W){return W(X,V,U,Y)}}}};var M=I.match.POS;for(var O in I.match){I.match[O]=RegExp(I.match[O].source+/(?![^\[]*\])(?![^\(]*\))/.source)}var E=function(U,T){U=Array.prototype.slice.call(U);if(T){T.push.apply(T,U);return T}return U};try{Array.prototype.slice.call(document.documentElement.childNodes)}catch(N){E=function(X,W){var U=W||[];if(H.call(X)==="[object Array]"){Array.prototype.push.apply(U,X)}else{if(typeof X.length==="number"){for(var V=0,T=X.length;V";var T=document.documentElement;T.insertBefore(U,T.firstChild);if(!!document.getElementById(V)){I.find.ID=function(X,Y,Z){if(typeof Y.getElementById!=="undefined"&&!Z){var W=Y.getElementById(X[1]);return W?W.id===X[1]||typeof W.getAttributeNode!=="undefined"&&W.getAttributeNode("id").nodeValue===X[1]?[W]:g:[]}};I.filter.ID=function(Y,W){var X=typeof Y.getAttributeNode!=="undefined"&&Y.getAttributeNode("id");return Y.nodeType===1&&X&&X.nodeValue===W}}T.removeChild(U)})();(function(){var T=document.createElement("div");T.appendChild(document.createComment(""));if(T.getElementsByTagName("*").length>0){I.find.TAG=function(U,Y){var X=Y.getElementsByTagName(U[1]);if(U[1]==="*"){var W=[];for(var V=0;X[V];V++){if(X[V].nodeType===1){W.push(X[V])}}X=W}return X}}T.innerHTML="";if(T.firstChild&&typeof T.firstChild.getAttribute!=="undefined"&&T.firstChild.getAttribute("href")!=="#"){I.attrHandle.href=function(U){return U.getAttribute("href",2)}}})();if(document.querySelectorAll){(function(){var T=F,U=document.createElement("div");U.innerHTML="

";if(U.querySelectorAll&&U.querySelectorAll(".TEST").length===0){return}F=function(Y,X,V,W){X=X||document;if(!W&&X.nodeType===9&&!Q(X)){try{return E(X.querySelectorAll(Y),V)}catch(Z){}}return T(Y,X,V,W)};F.find=T.find;F.filter=T.filter;F.selectors=T.selectors;F.matches=T.matches})()}if(document.getElementsByClassName&&document.documentElement.getElementsByClassName){(function(){var T=document.createElement("div");T.innerHTML="
";if(T.getElementsByClassName("e").length===0){return}T.lastChild.className="e";if(T.getElementsByClassName("e").length===1){return}I.order.splice(1,0,"CLASS");I.find.CLASS=function(U,V,W){if(typeof V.getElementsByClassName!=="undefined"&&!W){return V.getElementsByClassName(U[1])}}})()}function P(U,Z,Y,ad,aa,ac){var ab=U=="previousSibling"&&!ac;for(var W=0,V=ad.length;W0){X=T;break}}}T=T[U]}ad[W]=X}}}var K=document.compareDocumentPosition?function(U,T){return U.compareDocumentPosition(T)&16}:function(U,T){return U!==T&&(U.contains?U.contains(T):true)};var Q=function(T){return T.nodeType===9&&T.documentElement.nodeName!=="HTML"||!!T.ownerDocument&&Q(T.ownerDocument)};var J=function(T,aa){var W=[],X="",Y,V=aa.nodeType?[aa]:aa;while((Y=I.match.PSEUDO.exec(T))){X+=Y[0];T=T.replace(I.match.PSEUDO,"")}T=I.relative[T]?T+"*":T;for(var Z=0,U=V.length;Z0||T.offsetHeight>0};F.selectors.filters.animated=function(T){return o.grep(o.timers,function(U){return T===U.elem}).length};o.multiFilter=function(V,T,U){if(U){V=":not("+V+")"}return F.matches(V,T)};o.dir=function(V,U){var T=[],W=V[U];while(W&&W!=document){if(W.nodeType==1){T.push(W)}W=W[U]}return T};o.nth=function(X,T,V,W){T=T||1;var U=0;for(;X;X=X[V]){if(X.nodeType==1&&++U==T){break}}return X};o.sibling=function(V,U){var T=[];for(;V;V=V.nextSibling){if(V.nodeType==1&&V!=U){T.push(V)}}return T};return;l.Sizzle=F})();o.event={add:function(I,F,H,K){if(I.nodeType==3||I.nodeType==8){return}if(I.setInterval&&I!=l){I=l}if(!H.guid){H.guid=this.guid++}if(K!==g){var G=H;H=this.proxy(G);H.data=K}var E=o.data(I,"events")||o.data(I,"events",{}),J=o.data(I,"handle")||o.data(I,"handle",function(){return typeof o!=="undefined"&&!o.event.triggered?o.event.handle.apply(arguments.callee.elem,arguments):g});J.elem=I;o.each(F.split(/\s+/),function(M,N){var O=N.split(".");N=O.shift();H.type=O.slice().sort().join(".");var L=E[N];if(o.event.specialAll[N]){o.event.specialAll[N].setup.call(I,K,O)}if(!L){L=E[N]={};if(!o.event.special[N]||o.event.special[N].setup.call(I,K,O)===false){if(I.addEventListener){I.addEventListener(N,J,false)}else{if(I.attachEvent){I.attachEvent("on"+N,J)}}}}L[H.guid]=H;o.event.global[N]=true});I=null},guid:1,global:{},remove:function(K,H,J){if(K.nodeType==3||K.nodeType==8){return}var G=o.data(K,"events"),F,E;if(G){if(H===g||(typeof H==="string"&&H.charAt(0)==".")){for(var I in G){this.remove(K,I+(H||""))}}else{if(H.type){J=H.handler;H=H.type}o.each(H.split(/\s+/),function(M,O){var Q=O.split(".");O=Q.shift();var N=RegExp("(^|\\.)"+Q.slice().sort().join(".*\\.")+"(\\.|$)");if(G[O]){if(J){delete G[O][J.guid]}else{for(var P in G[O]){if(N.test(G[O][P].type)){delete G[O][P]}}}if(o.event.specialAll[O]){o.event.specialAll[O].teardown.call(K,Q)}for(F in G[O]){break}if(!F){if(!o.event.special[O]||o.event.special[O].teardown.call(K,Q)===false){if(K.removeEventListener){K.removeEventListener(O,o.data(K,"handle"),false)}else{if(K.detachEvent){K.detachEvent("on"+O,o.data(K,"handle"))}}}F=null;delete G[O]}}})}for(F in G){break}if(!F){var L=o.data(K,"handle");if(L){L.elem=null}o.removeData(K,"events");o.removeData(K,"handle")}}},trigger:function(I,K,H,E){var G=I.type||I;if(!E){I=typeof I==="object"?I[h]?I:o.extend(o.Event(G),I):o.Event(G);if(G.indexOf("!")>=0){I.type=G=G.slice(0,-1);I.exclusive=true}if(!H){I.stopPropagation();if(this.global[G]){o.each(o.cache,function(){if(this.events&&this.events[G]){o.event.trigger(I,K,this.handle.elem)}})}}if(!H||H.nodeType==3||H.nodeType==8){return g}I.result=g;I.target=H;K=o.makeArray(K);K.unshift(I)}I.currentTarget=H;var J=o.data(H,"handle");if(J){J.apply(H,K)}if((!H[G]||(o.nodeName(H,"a")&&G=="click"))&&H["on"+G]&&H["on"+G].apply(H,K)===false){I.result=false}if(!E&&H[G]&&!I.isDefaultPrevented()&&!(o.nodeName(H,"a")&&G=="click")){this.triggered=true;try{H[G]()}catch(L){}}this.triggered=false;if(!I.isPropagationStopped()){var F=H.parentNode||H.ownerDocument;if(F){o.event.trigger(I,K,F,true)}}},handle:function(K){var J,E;K=arguments[0]=o.event.fix(K||l.event);K.currentTarget=this;var L=K.type.split(".");K.type=L.shift();J=!L.length&&!K.exclusive;var I=RegExp("(^|\\.)"+L.slice().sort().join(".*\\.")+"(\\.|$)");E=(o.data(this,"events")||{})[K.type];for(var G in E){var H=E[G];if(J||I.test(H.type)){K.handler=H;K.data=H.data;var F=H.apply(this,arguments);if(F!==g){K.result=F;if(F===false){K.preventDefault();K.stopPropagation()}}if(K.isImmediatePropagationStopped()){break}}}},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(H){if(H[h]){return H}var F=H;H=o.Event(F);for(var G=this.props.length,J;G;){J=this.props[--G];H[J]=F[J]}if(!H.target){H.target=H.srcElement||document}if(H.target.nodeType==3){H.target=H.target.parentNode}if(!H.relatedTarget&&H.fromElement){H.relatedTarget=H.fromElement==H.target?H.toElement:H.fromElement}if(H.pageX==null&&H.clientX!=null){var I=document.documentElement,E=document.body;H.pageX=H.clientX+(I&&I.scrollLeft||E&&E.scrollLeft||0)-(I.clientLeft||0);H.pageY=H.clientY+(I&&I.scrollTop||E&&E.scrollTop||0)-(I.clientTop||0)}if(!H.which&&((H.charCode||H.charCode===0)?H.charCode:H.keyCode)){H.which=H.charCode||H.keyCode}if(!H.metaKey&&H.ctrlKey){H.metaKey=H.ctrlKey}if(!H.which&&H.button){H.which=(H.button&1?1:(H.button&2?3:(H.button&4?2:0)))}return H},proxy:function(F,E){E=E||function(){return F.apply(this,arguments)};E.guid=F.guid=F.guid||E.guid||this.guid++;return E},special:{ready:{setup:B,teardown:function(){}}},specialAll:{live:{setup:function(E,F){o.event.add(this,F[0],c)},teardown:function(G){if(G.length){var E=0,F=RegExp("(^|\\.)"+G[0]+"(\\.|$)");o.each((o.data(this,"events").live||{}),function(){if(F.test(this.type)){E++}});if(E<1){o.event.remove(this,G[0],c)}}}}}};o.Event=function(E){if(!this.preventDefault){return new o.Event(E)}if(E&&E.type){this.originalEvent=E;this.type=E.type}else{this.type=E}this.timeStamp=e();this[h]=true};function k(){return false}function u(){return true}o.Event.prototype={preventDefault:function(){this.isDefaultPrevented=u;var E=this.originalEvent;if(!E){return}if(E.preventDefault){E.preventDefault()}E.returnValue=false},stopPropagation:function(){this.isPropagationStopped=u;var E=this.originalEvent;if(!E){return}if(E.stopPropagation){E.stopPropagation()}E.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=u;this.stopPropagation()},isDefaultPrevented:k,isPropagationStopped:k,isImmediatePropagationStopped:k};var a=function(F){var E=F.relatedTarget;while(E&&E!=this){try{E=E.parentNode}catch(G){E=this}}if(E!=this){F.type=F.data;o.event.handle.apply(this,arguments)}};o.each({mouseover:"mouseenter",mouseout:"mouseleave"},function(F,E){o.event.special[E]={setup:function(){o.event.add(this,F,a,E)},teardown:function(){o.event.remove(this,F,a)}}});o.fn.extend({bind:function(F,G,E){return F=="unload"?this.one(F,G,E):this.each(function(){o.event.add(this,F,E||G,E&&G)})},one:function(G,H,F){var E=o.event.proxy(F||H,function(I){o(this).unbind(I,E);return(F||H).apply(this,arguments)});return this.each(function(){o.event.add(this,G,E,F&&H)})},unbind:function(F,E){return this.each(function(){o.event.remove(this,F,E)})},trigger:function(E,F){return this.each(function(){o.event.trigger(E,F,this)})},triggerHandler:function(E,G){if(this[0]){var F=o.Event(E);F.preventDefault();F.stopPropagation();o.event.trigger(F,G,this[0]);return F.result}},toggle:function(G){var E=arguments,F=1;while(F=0){var E=G.slice(I,G.length);G=G.slice(0,I)}var H="GET";if(J){if(o.isFunction(J)){K=J;J=null}else{if(typeof J==="object"){J=o.param(J);H="POST"}}}var F=this;o.ajax({url:G,type:H,dataType:"html",data:J,complete:function(M,L){if(L=="success"||L=="notmodified"){F.html(E?o("
").append(M.responseText.replace(//g,"")).find(E):M.responseText)}if(K){F.each(K,[M.responseText,L,M])}}});return this},serialize:function(){return o.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?o.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||/select|textarea/i.test(this.nodeName)||/text|hidden|password|search/i.test(this.type))}).map(function(E,F){var G=o(this).val();return G==null?null:o.isArray(G)?o.map(G,function(I,H){return{name:F.name,value:I}}):{name:F.name,value:G}}).get()}});o.each("ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","),function(E,F){o.fn[F]=function(G){return this.bind(F,G)}});var r=e();o.extend({get:function(E,G,H,F){if(o.isFunction(G)){H=G;G=null}return o.ajax({type:"GET",url:E,data:G,success:H,dataType:F})},getScript:function(E,F){return o.get(E,null,F,"script")},getJSON:function(E,F,G){return o.get(E,F,G,"json")},post:function(E,G,H,F){if(o.isFunction(G)){H=G;G={}}return o.ajax({type:"POST",url:E,data:G,success:H,dataType:F})},ajaxSetup:function(E){o.extend(o.ajaxSettings,E)},ajaxSettings:{url:location.href,global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:function(){return l.ActiveXObject?new ActiveXObject("Microsoft.XMLHTTP"):new XMLHttpRequest()},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},ajax:function(M){M=o.extend(true,M,o.extend(true,{},o.ajaxSettings,M));var W,F=/=\?(&|$)/g,R,V,G=M.type.toUpperCase();if(M.data&&M.processData&&typeof M.data!=="string"){M.data=o.param(M.data)}if(M.dataType=="jsonp"){if(G=="GET"){if(!M.url.match(F)){M.url+=(M.url.match(/\?/)?"&":"?")+(M.jsonp||"callback")+"=?"}}else{if(!M.data||!M.data.match(F)){M.data=(M.data?M.data+"&":"")+(M.jsonp||"callback")+"=?"}}M.dataType="json"}if(M.dataType=="json"&&(M.data&&M.data.match(F)||M.url.match(F))){W="jsonp"+r++;if(M.data){M.data=(M.data+"").replace(F,"="+W+"$1")}M.url=M.url.replace(F,"="+W+"$1");M.dataType="script";l[W]=function(X){V=X;I();L();l[W]=g;try{delete l[W]}catch(Y){}if(H){H.removeChild(T)}}}if(M.dataType=="script"&&M.cache==null){M.cache=false}if(M.cache===false&&G=="GET"){var E=e();var U=M.url.replace(/(\?|&)_=.*?(&|$)/,"$1_="+E+"$2");M.url=U+((U==M.url)?(M.url.match(/\?/)?"&":"?")+"_="+E:"")}if(M.data&&G=="GET"){M.url+=(M.url.match(/\?/)?"&":"?")+M.data;M.data=null}if(M.global&&!o.active++){o.event.trigger("ajaxStart")}var Q=/^(\w+:)?\/\/([^\/?#]+)/.exec(M.url);if(M.dataType=="script"&&G=="GET"&&Q&&(Q[1]&&Q[1]!=location.protocol||Q[2]!=location.host)){var H=document.getElementsByTagName("head")[0];var T=document.createElement("script");T.src=M.url;if(M.scriptCharset){T.charset=M.scriptCharset}if(!W){var O=false;T.onload=T.onreadystatechange=function(){if(!O&&(!this.readyState||this.readyState=="loaded"||this.readyState=="complete")){O=true;I();L();T.onload=T.onreadystatechange=null;H.removeChild(T)}}}H.appendChild(T);return g}var K=false;var J=M.xhr();if(M.username){J.open(G,M.url,M.async,M.username,M.password)}else{J.open(G,M.url,M.async)}try{if(M.data){J.setRequestHeader("Content-Type",M.contentType)}if(M.ifModified){J.setRequestHeader("If-Modified-Since",o.lastModified[M.url]||"Thu, 01 Jan 1970 00:00:00 GMT")}J.setRequestHeader("X-Requested-With","XMLHttpRequest");J.setRequestHeader("Accept",M.dataType&&M.accepts[M.dataType]?M.accepts[M.dataType]+", */*":M.accepts._default)}catch(S){}if(M.beforeSend&&M.beforeSend(J,M)===false){if(M.global&&!--o.active){o.event.trigger("ajaxStop")}J.abort();return false}if(M.global){o.event.trigger("ajaxSend",[J,M])}var N=function(X){if(J.readyState==0){if(P){clearInterval(P);P=null;if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}}else{if(!K&&J&&(J.readyState==4||X=="timeout")){K=true;if(P){clearInterval(P);P=null}R=X=="timeout"?"timeout":!o.httpSuccess(J)?"error":M.ifModified&&o.httpNotModified(J,M.url)?"notmodified":"success";if(R=="success"){try{V=o.httpData(J,M.dataType,M)}catch(Z){R="parsererror"}}if(R=="success"){var Y;try{Y=J.getResponseHeader("Last-Modified")}catch(Z){}if(M.ifModified&&Y){o.lastModified[M.url]=Y}if(!W){I()}}else{o.handleError(M,J,R)}L();if(X){J.abort()}if(M.async){J=null}}}};if(M.async){var P=setInterval(N,13);if(M.timeout>0){setTimeout(function(){if(J&&!K){N("timeout")}},M.timeout)}}try{J.send(M.data)}catch(S){o.handleError(M,J,null,S)}if(!M.async){N()}function I(){if(M.success){M.success(V,R)}if(M.global){o.event.trigger("ajaxSuccess",[J,M])}}function L(){if(M.complete){M.complete(J,R)}if(M.global){o.event.trigger("ajaxComplete",[J,M])}if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}return J},handleError:function(F,H,E,G){if(F.error){F.error(H,E,G)}if(F.global){o.event.trigger("ajaxError",[H,F,G])}},active:0,httpSuccess:function(F){try{return !F.status&&location.protocol=="file:"||(F.status>=200&&F.status<300)||F.status==304||F.status==1223}catch(E){}return false},httpNotModified:function(G,E){try{var H=G.getResponseHeader("Last-Modified");return G.status==304||H==o.lastModified[E]}catch(F){}return false},httpData:function(J,H,G){var F=J.getResponseHeader("content-type"),E=H=="xml"||!H&&F&&F.indexOf("xml")>=0,I=E?J.responseXML:J.responseText;if(E&&I.documentElement.tagName=="parsererror"){throw"parsererror"}if(G&&G.dataFilter){I=G.dataFilter(I,H)}if(typeof I==="string"){if(H=="script"){o.globalEval(I)}if(H=="json"){I=l["eval"]("("+I+")")}}return I},param:function(E){var G=[];function H(I,J){G[G.length]=encodeURIComponent(I)+"="+encodeURIComponent(J)}if(o.isArray(E)||E.jquery){o.each(E,function(){H(this.name,this.value)})}else{for(var F in E){if(o.isArray(E[F])){o.each(E[F],function(){H(F,this)})}else{H(F,o.isFunction(E[F])?E[F]():E[F])}}}return G.join("&").replace(/%20/g,"+")}});var m={},n,d=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];function t(F,E){var G={};o.each(d.concat.apply([],d.slice(0,E)),function(){G[this]=F});return G}o.fn.extend({show:function(J,L){if(J){return this.animate(t("show",3),J,L)}else{for(var H=0,F=this.length;H").appendTo("body");K=I.css("display");if(K==="none"){K="block"}I.remove();m[G]=K}o.data(this[H],"olddisplay",K)}}for(var H=0,F=this.length;H=0;H--){if(G[H].elem==this){if(E){G[H](true)}G.splice(H,1)}}});if(!E){this.dequeue()}return this}});o.each({slideDown:t("show",1),slideUp:t("hide",1),slideToggle:t("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(E,F){o.fn[E]=function(G,H){return this.animate(F,G,H)}});o.extend({speed:function(G,H,F){var E=typeof G==="object"?G:{complete:F||!F&&H||o.isFunction(G)&&G,duration:G,easing:F&&H||H&&!o.isFunction(H)&&H};E.duration=o.fx.off?0:typeof E.duration==="number"?E.duration:o.fx.speeds[E.duration]||o.fx.speeds._default;E.old=E.complete;E.complete=function(){if(E.queue!==false){o(this).dequeue()}if(o.isFunction(E.old)){E.old.call(this)}};return E},easing:{linear:function(G,H,E,F){return E+F*G},swing:function(G,H,E,F){return((-Math.cos(G*Math.PI)/2)+0.5)*F+E}},timers:[],fx:function(F,E,G){this.options=E;this.elem=F;this.prop=G;if(!E.orig){E.orig={}}}});o.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(o.fx.step[this.prop]||o.fx.step._default)(this);if((this.prop=="height"||this.prop=="width")&&this.elem.style){this.elem.style.display="block"}},cur:function(F){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var E=parseFloat(o.css(this.elem,this.prop,F));return E&&E>-10000?E:parseFloat(o.curCSS(this.elem,this.prop))||0},custom:function(I,H,G){this.startTime=e();this.start=I;this.end=H;this.unit=G||this.unit||"px";this.now=this.start;this.pos=this.state=0;var E=this;function F(J){return E.step(J)}F.elem=this.elem;if(F()&&o.timers.push(F)&&!n){n=setInterval(function(){var K=o.timers;for(var J=0;J=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;var E=true;for(var F in this.options.curAnim){if(this.options.curAnim[F]!==true){E=false}}if(E){if(this.options.display!=null){this.elem.style.overflow=this.options.overflow;this.elem.style.display=this.options.display;if(o.css(this.elem,"display")=="none"){this.elem.style.display="block"}}if(this.options.hide){o(this.elem).hide()}if(this.options.hide||this.options.show){for(var I in this.options.curAnim){o.attr(this.elem.style,I,this.options.orig[I])}}this.options.complete.call(this.elem)}return false}else{var J=G-this.startTime;this.state=J/this.options.duration;this.pos=o.easing[this.options.easing||(o.easing.swing?"swing":"linear")](this.state,J,0,1,this.options.duration);this.now=this.start+((this.end-this.start)*this.pos);this.update()}return true}};o.extend(o.fx,{speeds:{slow:600,fast:200,_default:400},step:{opacity:function(E){o.attr(E.elem.style,"opacity",E.now)},_default:function(E){if(E.elem.style&&E.elem.style[E.prop]!=null){E.elem.style[E.prop]=E.now+E.unit}else{E.elem[E.prop]=E.now}}}});if(document.documentElement.getBoundingClientRect){o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}var G=this[0].getBoundingClientRect(),J=this[0].ownerDocument,F=J.body,E=J.documentElement,L=E.clientTop||F.clientTop||0,K=E.clientLeft||F.clientLeft||0,I=G.top+(self.pageYOffset||o.boxModel&&E.scrollTop||F.scrollTop)-L,H=G.left+(self.pageXOffset||o.boxModel&&E.scrollLeft||F.scrollLeft)-K;return{top:I,left:H}}}else{o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}o.offset.initialized||o.offset.initialize();var J=this[0],G=J.offsetParent,F=J,O=J.ownerDocument,M,H=O.documentElement,K=O.body,L=O.defaultView,E=L.getComputedStyle(J,null),N=J.offsetTop,I=J.offsetLeft;while((J=J.parentNode)&&J!==K&&J!==H){M=L.getComputedStyle(J,null);N-=J.scrollTop,I-=J.scrollLeft;if(J===G){N+=J.offsetTop,I+=J.offsetLeft;if(o.offset.doesNotAddBorder&&!(o.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(J.tagName))){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}F=G,G=J.offsetParent}if(o.offset.subtractsBorderForOverflowNotVisible&&M.overflow!=="visible"){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}E=M}if(E.position==="relative"||E.position==="static"){N+=K.offsetTop,I+=K.offsetLeft}if(E.position==="fixed"){N+=Math.max(H.scrollTop,K.scrollTop),I+=Math.max(H.scrollLeft,K.scrollLeft)}return{top:N,left:I}}}o.offset={initialize:function(){if(this.initialized){return}var L=document.body,F=document.createElement("div"),H,G,N,I,M,E,J=L.style.marginTop,K='
';M={position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"};for(E in M){F.style[E]=M[E]}F.innerHTML=K;L.insertBefore(F,L.firstChild);H=F.firstChild,G=H.firstChild,I=H.nextSibling.firstChild.firstChild;this.doesNotAddBorder=(G.offsetTop!==5);this.doesAddBorderForTableAndCells=(I.offsetTop===5);H.style.overflow="hidden",H.style.position="relative";this.subtractsBorderForOverflowNotVisible=(G.offsetTop===-5);L.style.marginTop="1px";this.doesNotIncludeMarginInBodyOffset=(L.offsetTop===0);L.style.marginTop=J;L.removeChild(F);this.initialized=true},bodyOffset:function(E){o.offset.initialized||o.offset.initialize();var G=E.offsetTop,F=E.offsetLeft;if(o.offset.doesNotIncludeMarginInBodyOffset){G+=parseInt(o.curCSS(E,"marginTop",true),10)||0,F+=parseInt(o.curCSS(E,"marginLeft",true),10)||0}return{top:G,left:F}}};o.fn.extend({position:function(){var I=0,H=0,F;if(this[0]){var G=this.offsetParent(),J=this.offset(),E=/^body|html$/i.test(G[0].tagName)?{top:0,left:0}:G.offset();J.top-=j(this,"marginTop");J.left-=j(this,"marginLeft");E.top+=j(G,"borderTopWidth");E.left+=j(G,"borderLeftWidth");F={top:J.top-E.top,left:J.left-E.left}}return F},offsetParent:function(){var E=this[0].offsetParent||document.body;while(E&&(!/^body|html$/i.test(E.tagName)&&o.css(E,"position")=="static")){E=E.offsetParent}return o(E)}});o.each(["Left","Top"],function(F,E){var G="scroll"+E;o.fn[G]=function(H){if(!this[0]){return null}return H!==g?this.each(function(){this==l||this==document?l.scrollTo(!F?H:o(l).scrollLeft(),F?H:o(l).scrollTop()):this[G]=H}):this[0]==l||this[0]==document?self[F?"pageYOffset":"pageXOffset"]||o.boxModel&&document.documentElement[G]||document.body[G]:this[0][G]}});o.each(["Height","Width"],function(I,G){var E=I?"Left":"Top",H=I?"Right":"Bottom",F=G.toLowerCase();o.fn["inner"+G]=function(){return this[0]?o.css(this[0],F,false,"padding"):null};o.fn["outer"+G]=function(K){return this[0]?o.css(this[0],F,false,K?"margin":"border"):null};var J=G.toLowerCase();o.fn[J]=function(K){return this[0]==l?document.compatMode=="CSS1Compat"&&document.documentElement["client"+G]||document.body["client"+G]:this[0]==document?Math.max(document.documentElement["client"+G],document.body["scroll"+G],document.documentElement["scroll"+G],document.body["offset"+G],document.documentElement["offset"+G]):K===g?(this.length?o.css(this[0],J):null):this.css(J,typeof K==="string"?K:K+"px")}})})(); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/base/jquery-ui.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/jquery-ui.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/jquery-ui.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,412 @@ +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +*/ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute; left: -99999999px; } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }/* Accordion +----------------------------------*/ +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; } +.ui-accordion .ui-accordion-content-active { display: block; }@import url("ui.core.css"); + +@import url("ui.accordion.css"); +@import url("ui.datepicker.css"); +@import url("ui.dialog.css"); +@import url("ui.progressbar.css"); +@import url("ui.resizable.css"); +@import url("ui.slider.css"); +@import url("ui.tabs.css"); +/* Datepicker +----------------------------------*/ +.ui-datepicker { width: 17em; padding: .2em .2em 0; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; } +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* Dialog +----------------------------------*/ +.ui-dialog { position: relative; padding: .2em; width: 300px; } +.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* Progressbar +----------------------------------*/ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* Resizable +----------------------------------*/ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Slider +----------------------------------*/ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs +----------------------------------*/ +.ui-tabs { padding: .2em; zoom: 1; } +.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; } +.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +* To view and modify this theme, visit http://jqueryui.com/themeroller/ +*/ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_glass_75_ffffff_1x400.png)/*{bgImgUrlContent}*/ 0/*{bgContentXPos}*/ 0/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 0/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 0/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; outline: none; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; outline: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 0/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; outline: none; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; outline: none; } +.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 0/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; outline: none; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; outline: none; text-decoration: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 0/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_inset-soft_95_fef1ec_1x100.png)/*{bgImgUrlError}*/ 0/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a { color: #363636/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-right { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ none/*{bgImgUrlOverlay}*/ 0/*{bgOverlayXPos}*/ 0/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -4px/*{offsetTopShadow}*/ 0 0 -4px/*{offsetLeftShadow}*/; padding: 4px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ none/*{bgImgUrlShadow}*/ 0/*{bgShadowXPos}*/ 0/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .35;filter:Alpha(Opacity=35)/*{opacityShadow}*/; -moz-border-radius: 4px/*{cornerRadiusShadow}*/; -webkit-border-radius: 4px/*{cornerRadiusShadow}*/; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/base/ui.accordion.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/ui.accordion.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/ui.accordion.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,9 @@ +/* Accordion +----------------------------------*/ +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; } +.ui-accordion .ui-accordion-content-active { display: block; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/base/ui.all.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/ui.all.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/ui.all.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,2 @@ +@import "ui.base.css"; +@import "ui.theme.css"; Index: lams_central/web/includes/javascript/jquery-ui/themes/base/ui.base.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/ui.base.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/ui.base.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,9 @@ +@import url("ui.core.css"); + +@import url("ui.accordion.css"); +@import url("ui.datepicker.css"); +@import url("ui.dialog.css"); +@import url("ui.progressbar.css"); +@import url("ui.resizable.css"); +@import url("ui.slider.css"); +@import url("ui.tabs.css"); Index: lams_central/web/includes/javascript/jquery-ui/themes/base/ui.core.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/ui.core.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/ui.core.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,37 @@ +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +*/ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute; left: -99999999px; } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/base/ui.datepicker.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/ui.datepicker.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/ui.datepicker.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,62 @@ +/* Datepicker +----------------------------------*/ +.ui-datepicker { width: 17em; padding: .2em .2em 0; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; } +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +} \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/base/ui.dialog.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/ui.dialog.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/ui.dialog.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,13 @@ +/* Dialog +----------------------------------*/ +.ui-dialog { position: relative; padding: .2em; width: 300px; } +.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } Index: lams_central/web/includes/javascript/jquery-ui/themes/base/ui.progressbar.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/ui.progressbar.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/ui.progressbar.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,4 @@ +/* Progressbar +----------------------------------*/ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/base/ui.resizable.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/ui.resizable.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/ui.resizable.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,13 @@ +/* Resizable +----------------------------------*/ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;} \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/base/ui.slider.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/ui.slider.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/ui.slider.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,17 @@ +/* Slider +----------------------------------*/ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/base/ui.tabs.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/ui.tabs.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/ui.tabs.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,11 @@ +/* Tabs +----------------------------------*/ +.ui-tabs { padding: .2em; zoom: 1; } +.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; } +.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } Index: lams_central/web/includes/javascript/jquery-ui/themes/base/ui.theme.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/Attic/ui.theme.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/base/ui.theme.css 1 Apr 2009 00:45:10 -0000 1.1 @@ -0,0 +1,243 @@ +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +* To view and modify this theme, visit http://jqueryui.com/themeroller/ +*/ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_glass_75_ffffff_1x400.png)/*{bgImgUrlContent}*/ 0/*{bgContentXPos}*/ 0/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 0/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 0/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; outline: none; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; outline: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 0/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; outline: none; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; outline: none; } +.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 0/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; outline: none; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; outline: none; text-decoration: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 0/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_inset-soft_95_fef1ec_1x100.png)/*{bgImgUrlError}*/ 0/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a { color: #363636/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-right { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ none/*{bgImgUrlOverlay}*/ 0/*{bgOverlayXPos}*/ 0/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -4px/*{offsetTopShadow}*/ 0 0 -4px/*{offsetLeftShadow}*/; padding: 4px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ none/*{bgImgUrlShadow}*/ 0/*{bgShadowXPos}*/ 0/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .35;filter:Alpha(Opacity=35)/*{opacityShadow}*/; -moz-border-radius: 4px/*{cornerRadiusShadow}*/; -webkit-border-radius: 4px/*{cornerRadiusShadow}*/; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-bg_flat_0_aaaaaa_40x100.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-bg_glass_55_fbf9ee_1x400.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-bg_glass_65_ffffff_1x400.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-bg_glass_65_ffffff_1x400.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-bg_glass_75_dadada_1x400.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-bg_glass_75_dadada_1x400.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-bg_glass_75_e6e6e6_1x400.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-bg_glass_75_ffffff_1x400.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-bg_glass_75_ffffff_1x400.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-bg_highlight-soft_75_cccccc_1x100.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-bg_inset-soft_95_fef1ec_1x100.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-bg_inset-soft_95_fef1ec_1x100.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-icons_222222_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-icons_222222_256x240.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-icons_2e83ff_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-icons_2e83ff_256x240.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-icons_454545_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-icons_454545_256x240.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-icons_888888_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-icons_888888_256x240.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/base/images/ui-icons_cd0a0a_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/base/images/Attic/ui-icons_cd0a0a_256x240.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.accordion.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/Attic/ui.accordion.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.accordion.css 1 Apr 2009 00:45:15 -0000 1.1 @@ -0,0 +1,9 @@ +/* Accordion +----------------------------------*/ +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion li {display: inline;} +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; } +.ui-accordion .ui-accordion-content-active { display: block; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.all.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/Attic/ui.all.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.all.css 1 Apr 2009 00:45:14 -0000 1.1 @@ -0,0 +1,2 @@ +@import "ui.base.css"; +@import "ui.theme.css"; Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.base.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/Attic/ui.base.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.base.css 1 Apr 2009 00:45:14 -0000 1.1 @@ -0,0 +1,9 @@ +@import url("ui.core.css"); + +@import url("ui.accordion.css"); +@import url("ui.datepicker.css"); +@import url("ui.dialog.css"); +@import url("ui.progressbar.css"); +@import url("ui.resizable.css"); +@import url("ui.slider.css"); +@import url("ui.tabs.css"); Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.core.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/Attic/ui.core.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.core.css 1 Apr 2009 00:45:14 -0000 1.1 @@ -0,0 +1,37 @@ +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +*/ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute; left: -99999999px; } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.datepicker.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/Attic/ui.datepicker.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.datepicker.css 1 Apr 2009 00:45:15 -0000 1.1 @@ -0,0 +1,62 @@ +/* Datepicker +----------------------------------*/ +.ui-datepicker { width: 17em; padding: .2em .2em 0; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; } +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:left; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +} \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.dialog.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/Attic/ui.dialog.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.dialog.css 1 Apr 2009 00:45:15 -0000 1.1 @@ -0,0 +1,13 @@ +/* Dialog +----------------------------------*/ +.ui-dialog { position: relative; padding: .2em; width: 300px; } +.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.progressbar.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/Attic/ui.progressbar.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.progressbar.css 1 Apr 2009 00:45:15 -0000 1.1 @@ -0,0 +1,4 @@ +/* Progressbar +----------------------------------*/ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.resizable.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/Attic/ui.resizable.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.resizable.css 1 Apr 2009 00:45:15 -0000 1.1 @@ -0,0 +1,13 @@ +/* Resizable +----------------------------------*/ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;} \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.slider.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/Attic/ui.slider.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.slider.css 1 Apr 2009 00:45:14 -0000 1.1 @@ -0,0 +1,17 @@ +/* Slider +----------------------------------*/ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: 1%; display: block; border: 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.tabs.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/Attic/ui.tabs.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.tabs.css 1 Apr 2009 00:45:15 -0000 1.1 @@ -0,0 +1,11 @@ +/* Tabs +----------------------------------*/ +.ui-tabs {padding: .2em;} +.ui-tabs .ui-tabs-nav { padding: .2em .2em 0 .2em; position: relative;} +.ui-tabs .ui-tabs-nav li { float: left; border-bottom: 0 !important; margin: 0 .2em -1px 0; padding: 0; list-style: none; } +.ui-tabs .ui-tabs-nav li a { display:block; text-decoration: none; padding: .5em 1em; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: .1em; border-bottom: 0; } +.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border: 0; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +.ui-tabs .ui-tabs-wrapper { overflow: hidden } +.ui-tabs .ui-tabs-wrapped {} \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.theme.css =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/Attic/ui.theme.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/themes/cupertino/ui.theme.css 1 Apr 2009 00:45:15 -0000 1.1 @@ -0,0 +1,243 @@ + + +/* +* jQuery UI CSS Framework +* Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) +* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses. +* To view and modify this theme, visit http://ui.jquery.com/themeroller/?tr=&ffDefault=Lucida%20Grande,%20Lucida%20Sans,%20Arial,%20sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=3px&bgColorHeader=e7eef3&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=100&borderColorHeader=b2c7d7&fcHeader=222222&iconColorHeader=72a7cf&bgColorContent=f9f9f9&bgTextureContent=04_highlight_hard.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=362b36&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=80&borderColorDefault=cccccc&fcDefault=444444&iconColorDefault=888888&bgColorHover=f0f0f0&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=b2c7d7&fcHover=0b5b98&iconColorHover=2694e8&bgColorActive=99c2ff&bgTextureActive=02_glass.png&bgImgOpacityActive=50&borderColorActive=2694e8&fcActive=000000&iconColorActive=ffffff&bgColorHighlight=fbf5d0&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=f9dd34&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=444444&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=15&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=07_diagonals_small.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=0px&offsetTopShadow=4px&offsetLeftShadow=4px&cornerRadiusShadow=4px +*/ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1.1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1em; } +.ui-widget-header { border: 1px solid #b2c7d7; background: #e7eef3 url(images/ui-bg_highlight-soft_100_e7eef3_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } +.ui-widget-header a { color: #222222; } +.ui-widget-content { border: 1px solid #dddddd; background: #f9f9f9 url(images/ui-bg_highlight-hard_100_f9f9f9_1x100.png) 50% top repeat-x; color: #362b36; } +.ui-widget-content a { color: #362b36; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #cccccc; background: #e6e6e6 url(images/ui-bg_glass_80_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #444444; outline: none; } +.ui-state-default a { color: #444444; text-decoration: none; outline: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #b2c7d7; background: #f0f0f0 url(images/ui-bg_glass_100_f0f0f0_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #0b5b98; outline: none; } +.ui-state-hover a { color: #0b5b98; text-decoration: none; outline: none; } +.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #2694e8; background: #99c2ff url(images/ui-bg_glass_50_99c2ff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #000000; outline: none; } +.ui-state-active a { color: #000000; outline: none; text-decoration: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #f9dd34; background: #fbf5d0 url(images/ui-bg_glass_55_fbf5d0_1x400.png) 50% 50% repeat-x; color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_72a7cf_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_2694e8_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 3px; -webkit-border-top-left-radius: 3px; } +.ui-corner-tr { -moz-border-radius-topright: 3px; -webkit-border-top-right-radius: 3px; } +.ui-corner-bl { -moz-border-radius-bottomleft: 3px; -webkit-border-bottom-left-radius: 3px; } +.ui-corner-br { -moz-border-radius-bottomright: 3px; -webkit-border-bottom-right-radius: 3px; } +.ui-corner-top { -moz-border-radius-topleft: 3px; -webkit-border-top-left-radius: 3px; -moz-border-radius-topright: 3px; -webkit-border-top-right-radius: 3px; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 3px; -webkit-border-bottom-left-radius: 3px; -moz-border-radius-bottomright: 3px; -webkit-border-bottom-right-radius: 3px; } +.ui-corner-right { -moz-border-radius-topright: 3px; -webkit-border-top-right-radius: 3px; -moz-border-radius-bottomright: 3px; -webkit-border-bottom-right-radius: 3px; } +.ui-corner-left { -moz-border-radius-topleft: 3px; -webkit-border-top-left-radius: 3px; -moz-border-radius-bottomleft: 3px; -webkit-border-bottom-left-radius: 3px; } +.ui-corner-all { -moz-border-radius: 3px; -webkit-border-radius: 3px; } + +/* Overlays */ +.ui-widget-overlay { background: #444444 url(images/ui-bg_diagonals-thick_15_444444_40x40.png) 50% 50% repeat; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: 4px 0 0 4px; padding: 0px; background: #aaaaaa url(images/ui-bg_diagonals-small_0_aaaaaa_40x40.png) 50% 50% repeat; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 4px; -webkit-border-radius: 4px; } \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-bg_diagonals-small_0_aaaaaa_40x40.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-bg_diagonals-small_0_aaaaaa_40x40.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-bg_diagonals-thick_15_444444_40x40.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-bg_diagonals-thick_15_444444_40x40.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-bg_glass_100_f0f0f0_1x400.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-bg_glass_100_f0f0f0_1x400.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-bg_glass_50_99c2ff_1x400.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-bg_glass_50_99c2ff_1x400.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-bg_glass_55_fbf5d0_1x400.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-bg_glass_55_fbf5d0_1x400.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-bg_glass_80_e6e6e6_1x400.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-bg_glass_80_e6e6e6_1x400.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-bg_glass_95_fef1ec_1x400.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-bg_glass_95_fef1ec_1x400.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-bg_highlight-hard_100_f9f9f9_1x100.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-bg_highlight-hard_100_f9f9f9_1x100.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-bg_highlight-soft_100_e7eef3_1x100.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-bg_highlight-soft_100_e7eef3_1x100.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-icons_222222_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-icons_222222_256x240.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-icons_2694e8_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-icons_2694e8_256x240.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-icons_2e83ff_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-icons_2e83ff_256x240.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-icons_72a7cf_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-icons_72a7cf_256x240.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-icons_888888_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-icons_888888_256x240.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-icons_cd0a0a_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-icons_cd0a0a_256x240.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/ui-icons_ffffff_256x240.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/themes/cupertino/images/Attic/ui-icons_ffffff_256x240.png,v diff -u Binary files differ Fisheye: Tag 1.2 refers to a dead (removed) revision in file `lams_central/web/includes/javascript/jquery-ui/themes/flora/flora.accordion.css'. Fisheye: No comparison available. Pass `N' to diff? Fisheye: Tag 1.2 refers to a dead (removed) revision in file `lams_central/web/includes/javascript/jquery-ui/themes/flora/flora.all.css'. Fisheye: No comparison available. Pass `N' to diff? Fisheye: Tag 1.2 refers to a dead (removed) revision in file `lams_central/web/includes/javascript/jquery-ui/themes/flora/flora.css'. Fisheye: No comparison available. Pass `N' to diff? Fisheye: Tag 1.2 refers to a dead (removed) revision in file `lams_central/web/includes/javascript/jquery-ui/themes/flora/flora.datepicker.css'. Fisheye: No comparison available. Pass `N' to diff? Fisheye: Tag 1.2 refers to a dead (removed) revision in file `lams_central/web/includes/javascript/jquery-ui/themes/flora/flora.dialog.css'. Fisheye: No comparison available. Pass `N' to diff? Fisheye: Tag 1.2 refers to a dead (removed) revision in file `lams_central/web/includes/javascript/jquery-ui/themes/flora/flora.resizable.css'. Fisheye: No comparison available. Pass `N' to diff? Fisheye: Tag 1.2 refers to a dead (removed) revision in file `lams_central/web/includes/javascript/jquery-ui/themes/flora/flora.slider.css'. Fisheye: No comparison available. Pass `N' to diff? Fisheye: Tag 1.2 refers to a dead (removed) revision in file `lams_central/web/includes/javascript/jquery-ui/themes/flora/flora.tabs.css'. Fisheye: No comparison available. Pass `N' to diff? Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.blind.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.blind.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.blind.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.blind.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,49 +1,49 @@ -/* - * jQuery UI Effects Blind @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Blind - * - * Depends: - * effects.core.js - */ -(function($) { - -$.effects.blind = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','left']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var direction = o.options.direction || 'vertical'; // Default direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var ref = (direction == 'vertical') ? 'height' : 'width'; - var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); - if(mode == 'show') wrapper.css(ref, 0); // Shift - - // Animation - var animation = {}; - animation[ref] = mode == 'show' ? distance : 0; - - // Animate - wrapper.animate(animation, o.duration, o.options.easing, function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(el[0], arguments); // Callback - el.dequeue(); - }); - - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Blind 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.bounce.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.bounce.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.bounce.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.bounce.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,78 +1,78 @@ -/* - * jQuery UI Effects Bounce @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Bounce - * - * Depends: - * effects.core.js - */ -(function($) { - -$.effects.bounce = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','left']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var direction = o.options.direction || 'up'; // Default direction - var distance = o.options.distance || 20; // Default distance - var times = o.options.times || 5; // Default # of times - var speed = o.duration || 250; // Default speed per bounce - if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); - if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift - if (mode == 'hide') distance = distance / (times * 2); - if (mode != 'hide') times--; - - // Animate - if (mode == 'show') { // Show Bounce - var animation = {opacity: 1}; - animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; - el.animate(animation, speed / 2, o.options.easing); - distance = distance / 2; - times--; - }; - for (var i = 0; i < times; i++) { // Bounces - var animation1 = {}, animation2 = {}; - animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; - el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); - distance = (mode == 'hide') ? distance * 2 : distance / 2; - }; - if (mode == 'hide') { // Last Bounce - var animation = {opacity: 0}; - animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - el.animate(animation, speed / 2, o.options.easing, function(){ - el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - }); - } else { - var animation1 = {}, animation2 = {}; - animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; - el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - }); - }; - el.queue('fx', function() { el.dequeue(); }); - el.dequeue(); - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Bounce 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.clip.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.clip.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.clip.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.clip.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,54 +1,54 @@ -/* - * jQuery UI Effects Clip @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Clip - * - * Depends: - * effects.core.js - */ -(function($) { - -$.effects.clip = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','left','height','width']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var direction = o.options.direction || 'vertical'; // Default direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var animate = el[0].tagName == 'IMG' ? wrapper : el; - var ref = { - size: (direction == 'vertical') ? 'height' : 'width', - position: (direction == 'vertical') ? 'top' : 'left' - }; - var distance = (direction == 'vertical') ? animate.height() : animate.width(); - if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift - - // Animation - var animation = {}; - animation[ref.size] = mode == 'show' ? distance : 0; - animation[ref.position] = mode == 'show' ? 0 : distance / 2; - - // Animate - animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(el[0], arguments); // Callback - el.dequeue(); - }}); - - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Clip 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.core.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.core.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.core.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.core.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,509 +1,543 @@ -/* - * jQuery UI Effects @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/ - */ -;(function($) { - -$.effects = $.effects || {}; //Add the 'effects' scope - -$.extend($.effects, { - save: function(el, set) { - for(var i=0;i
'); - var wrapper = el.parent(); - if (el.css('position') == 'static'){ - wrapper.css({position: 'relative'}); - el.css({position: 'relative'}); - } else { - var top = el.css('top'); if(isNaN(parseInt(top))) top = 'auto'; - var left = el.css('left'); if(isNaN(parseInt(left))) left = 'auto'; - wrapper.css({ position: el.css('position'), top: top, left: left, zIndex: el.css('z-index') }).show(); - el.css({position: 'relative', top:0, left:0}); - } - wrapper.css(props); - return wrapper; - }, - removeWrapper: function(el) { - if (el.parent().attr('id') == 'fxWrapper') - return el.parent().replaceWith(el); - return el; - }, - setTransition: function(el, list, factor, val) { - val = val || {}; - $.each(list,function(i, x){ - unit = el.cssUnit(x); - if (unit[0] > 0) val[x] = unit[0] * factor + unit[1]; - }); - return val; - }, - animateClass: function(value, duration, easing, callback) { - - var cb = (typeof easing == "function" ? easing : (callback ? callback : null)); - var ea = (typeof easing == "object" ? easing : null); - - return this.each(function() { - - var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || ''; - if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */ - if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; } - - //Let's get a style offset - var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle)); - if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove); - var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle)); - if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove); - - // The main function to form the object for animation - for(var n in newStyle) { - if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */ - && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */ - && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */ - && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */ - && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */ - ) offset[n] = newStyle[n]; - } - - that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object - // Change style attribute back to original. For stupid IE, we need to clear the damn object. - if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr); - if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove); - if(cb) cb.apply(this, arguments); - }); - - }); - } -}); - -//Extend the methods of jQuery -$.fn.extend({ - //Save old methods - _show: $.fn.show, - _hide: $.fn.hide, - __toggle: $.fn.toggle, - _addClass: $.fn.addClass, - _removeClass: $.fn.removeClass, - _toggleClass: $.fn.toggleClass, - // New ec methods - effect: function(fx,o,speed,callback) { - return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: o || {}, duration: speed, callback: callback }) : null; - }, - show: function() { - if(!arguments[0] || (arguments[0].constructor == Number || /(slow|normal|fast)/.test(arguments[0]))) - return this._show.apply(this, arguments); - else { - var o = arguments[1] || {}; o['mode'] = 'show'; - return this.effect.apply(this, [arguments[0], o, arguments[2] || o.duration, arguments[3] || o.callback]); - } - }, - hide: function() { - if(!arguments[0] || (arguments[0].constructor == Number || /(slow|normal|fast)/.test(arguments[0]))) - return this._hide.apply(this, arguments); - else { - var o = arguments[1] || {}; o['mode'] = 'hide'; - return this.effect.apply(this, [arguments[0], o, arguments[2] || o.duration, arguments[3] || o.callback]); - } - }, - toggle: function(){ - if(!arguments[0] || (arguments[0].constructor == Number || /(slow|normal|fast)/.test(arguments[0])) || (arguments[0].constructor == Function)) - return this.__toggle.apply(this, arguments); - else { - var o = arguments[1] || {}; o['mode'] = 'toggle'; - return this.effect.apply(this, [arguments[0], o, arguments[2] || o.duration, arguments[3] || o.callback]); - } - }, - addClass: function(classNames,speed,easing,callback) { - return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); - }, - removeClass: function(classNames,speed,easing,callback) { - return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); - }, - toggleClass: function(classNames,speed,easing,callback) { - return speed ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames); - }, - morph: function(remove,add,speed,easing,callback) { - return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); - }, - switchClass: function() { - return this.morph.apply(this, arguments); - }, - // helper functions - cssUnit: function(key) { - var style = this.css(key), val = []; - $.each( ['em','px','%','pt'], function(i, unit){ - if(style.indexOf(unit) > 0) - val = [parseFloat(style), unit]; - }); - return val; - } -}); - -/* - * jQuery Color Animations - * Copyright 2007 John Resig - * Released under the MIT and GPL licenses. - */ - -// We override the animation for all of these color styles -jQuery.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){ - jQuery.fx.step[attr] = function(fx){ - if ( fx.state == 0 ) { - fx.start = getColor( fx.elem, attr ); - fx.end = getRGB( fx.end ); - } - - fx.elem.style[attr] = "rgb(" + [ - Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0]), 255), 0), - Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1]), 255), 0), - Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2]), 255), 0) - ].join(",") + ")"; - } -}); - -// Color Conversion functions from highlightFade -// By Blair Mitchelmore -// http://jquery.offput.ca/highlightFade/ - -// Parse strings looking for color tuples [255,255,255] -function getRGB(color) { - var result; - - // Check if we're already dealing with an array of colors - if ( color && color.constructor == Array && color.length == 3 ) - return color; - - // Look for rgb(num,num,num) - if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) - return [parseInt(result[1]), parseInt(result[2]), parseInt(result[3])]; - - // Look for rgb(num%,num%,num%) - if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) - return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; - - // Look for #a0b1c2 - if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) - return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; - - // Look for #fff - if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) - return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; - - // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 - if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) - return colors['transparent'] - - // Otherwise, we're most likely dealing with a named color - return colors[jQuery.trim(color).toLowerCase()]; -} - -function getColor(elem, attr) { - var color; - - do { - color = jQuery.curCSS(elem, attr); - - // Keep going until we find an element that has color, or we hit the body - if ( color != '' && color != 'transparent' || jQuery.nodeName(elem, "body") ) - break; - - attr = "backgroundColor"; - } while ( elem = elem.parentNode ); - - return getRGB(color); -}; - -// Some named colors to work with -// From Interface by Stefan Petre -// http://interface.eyecon.ro/ - -var colors = { - aqua:[0,255,255], - azure:[240,255,255], - beige:[245,245,220], - black:[0,0,0], - blue:[0,0,255], - brown:[165,42,42], - cyan:[0,255,255], - darkblue:[0,0,139], - darkcyan:[0,139,139], - darkgrey:[169,169,169], - darkgreen:[0,100,0], - darkkhaki:[189,183,107], - darkmagenta:[139,0,139], - darkolivegreen:[85,107,47], - darkorange:[255,140,0], - darkorchid:[153,50,204], - darkred:[139,0,0], - darksalmon:[233,150,122], - darkviolet:[148,0,211], - fuchsia:[255,0,255], - gold:[255,215,0], - green:[0,128,0], - indigo:[75,0,130], - khaki:[240,230,140], - lightblue:[173,216,230], - lightcyan:[224,255,255], - lightgreen:[144,238,144], - lightgrey:[211,211,211], - lightpink:[255,182,193], - lightyellow:[255,255,224], - lime:[0,255,0], - magenta:[255,0,255], - maroon:[128,0,0], - navy:[0,0,128], - olive:[128,128,0], - orange:[255,165,0], - pink:[255,192,203], - purple:[128,0,128], - violet:[128,0,128], - red:[255,0,0], - silver:[192,192,192], - white:[255,255,255], - yellow:[255,255,0], - transparent: [255,255,255] -}; - -/* - * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ - * - * Uses the built in easing capabilities added In jQuery 1.1 - * to offer multiple easing options - * - * TERMS OF USE - jQuery Easing - * - * Open source under the BSD License. - * - * Copyright © 2008 George McGinley Smith - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without modification, - * are permitted provided that the following conditions are met: - * - * Redistributions of source code must retain the above copyright notice, this list of - * conditions and the following disclaimer. - * Redistributions in binary form must reproduce the above copyright notice, this list - * of conditions and the following disclaimer in the documentation and/or other materials - * provided with the distribution. - * - * Neither the name of the author nor the names of contributors may be used to endorse - * or promote products derived from this software without specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY - * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE - * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, - * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE - * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED - * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING - * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED - * OF THE POSSIBILITY OF SUCH DAMAGE. - * -*/ - -// t: current time, b: begInnIng value, c: change In value, d: duration -jQuery.easing['jswing'] = jQuery.easing['swing']; - -jQuery.extend( jQuery.easing, -{ - def: 'easeOutQuad', - swing: function (x, t, b, c, d) { - //alert(jQuery.easing.default); - return jQuery.easing[jQuery.easing.def](x, t, b, c, d); - }, - easeInQuad: function (x, t, b, c, d) { - return c*(t/=d)*t + b; - }, - easeOutQuad: function (x, t, b, c, d) { - return -c *(t/=d)*(t-2) + b; - }, - easeInOutQuad: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t + b; - return -c/2 * ((--t)*(t-2) - 1) + b; - }, - easeInCubic: function (x, t, b, c, d) { - return c*(t/=d)*t*t + b; - }, - easeOutCubic: function (x, t, b, c, d) { - return c*((t=t/d-1)*t*t + 1) + b; - }, - easeInOutCubic: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t*t + b; - return c/2*((t-=2)*t*t + 2) + b; - }, - easeInQuart: function (x, t, b, c, d) { - return c*(t/=d)*t*t*t + b; - }, - easeOutQuart: function (x, t, b, c, d) { - return -c * ((t=t/d-1)*t*t*t - 1) + b; - }, - easeInOutQuart: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t*t*t + b; - return -c/2 * ((t-=2)*t*t*t - 2) + b; - }, - easeInQuint: function (x, t, b, c, d) { - return c*(t/=d)*t*t*t*t + b; - }, - easeOutQuint: function (x, t, b, c, d) { - return c*((t=t/d-1)*t*t*t*t + 1) + b; - }, - easeInOutQuint: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; - return c/2*((t-=2)*t*t*t*t + 2) + b; - }, - easeInSine: function (x, t, b, c, d) { - return -c * Math.cos(t/d * (Math.PI/2)) + c + b; - }, - easeOutSine: function (x, t, b, c, d) { - return c * Math.sin(t/d * (Math.PI/2)) + b; - }, - easeInOutSine: function (x, t, b, c, d) { - return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; - }, - easeInExpo: function (x, t, b, c, d) { - return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; - }, - easeOutExpo: function (x, t, b, c, d) { - return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; - }, - easeInOutExpo: function (x, t, b, c, d) { - if (t==0) return b; - if (t==d) return b+c; - if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; - return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; - }, - easeInCirc: function (x, t, b, c, d) { - return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; - }, - easeOutCirc: function (x, t, b, c, d) { - return c * Math.sqrt(1 - (t=t/d-1)*t) + b; - }, - easeInOutCirc: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; - return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; - }, - easeInElastic: function (x, t, b, c, d) { - var s=1.70158;var p=0;var a=c; - if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; - if (a < Math.abs(c)) { a=c; var s=p/4; } - else var s = p/(2*Math.PI) * Math.asin (c/a); - return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; - }, - easeOutElastic: function (x, t, b, c, d) { - var s=1.70158;var p=0;var a=c; - if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; - if (a < Math.abs(c)) { a=c; var s=p/4; } - else var s = p/(2*Math.PI) * Math.asin (c/a); - return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; - }, - easeInOutElastic: function (x, t, b, c, d) { - var s=1.70158;var p=0;var a=c; - if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); - if (a < Math.abs(c)) { a=c; var s=p/4; } - else var s = p/(2*Math.PI) * Math.asin (c/a); - if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; - return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; - }, - easeInBack: function (x, t, b, c, d, s) { - if (s == undefined) s = 1.70158; - return c*(t/=d)*t*((s+1)*t - s) + b; - }, - easeOutBack: function (x, t, b, c, d, s) { - if (s == undefined) s = 1.70158; - return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; - }, - easeInOutBack: function (x, t, b, c, d, s) { - if (s == undefined) s = 1.70158; - if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; - return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; - }, - easeInBounce: function (x, t, b, c, d) { - return c - jQuery.easing.easeOutBounce (x, d-t, 0, c, d) + b; - }, - easeOutBounce: function (x, t, b, c, d) { - if ((t/=d) < (1/2.75)) { - return c*(7.5625*t*t) + b; - } else if (t < (2/2.75)) { - return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; - } else if (t < (2.5/2.75)) { - return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; - } else { - return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; - } - }, - easeInOutBounce: function (x, t, b, c, d) { - if (t < d/2) return jQuery.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; - return jQuery.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; - } -}); - -/* - * - * TERMS OF USE - EASING EQUATIONS - * - * Open source under the BSD License. - * - * Copyright © 2001 Robert Penner - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without modification, - * are permitted provided that the following conditions are met: - * - * Redistributions of source code must retain the above copyright notice, this list of - * conditions and the following disclaimer. - * Redistributions in binary form must reproduce the above copyright notice, this list - * of conditions and the following disclaimer in the documentation and/or other materials - * provided with the distribution. - * - * Neither the name of the author nor the names of contributors may be used to endorse - * or promote products derived from this software without specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY - * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE - * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, - * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE - * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED - * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING - * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED - * OF THE POSSIBILITY OF SUCH DAMAGE. - * - */ - -})(jQuery); +/* + * jQuery UI Effects 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($) { + +$.effects = { + version: "1.7.1", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + //if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) + return element.parent(); + + //Cache width,height and float properties of the element, and create a wrapper around it + var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') }; + element.wrap('
'); + var wrapper = element.parent(); + + //Transfer the positioning of the element to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative'} ); + } else { + var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto'; + var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto'; + wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show(); + element.css({position: 'relative', top: 0, left: 0 }); + } + + wrapper.css(props); + return wrapper; + }, + + removeWrapper: function(element) { + if (element.parent().is('.ui-effects-wrapper')) + return element.parent().replaceWith(element); + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + }, + + //Base function to animate from one class to another in a seamless transition + animateClass: function(value, duration, easing, callback) { + + var cb = (typeof easing == "function" ? easing : (callback ? callback : null)); + var ea = (typeof easing == "string" ? easing : null); + + return this.each(function() { + + var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || ''; + if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */ + if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; } + + //Let's get a style offset + var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle)); + if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove); + var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle)); + if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove); + + // The main function to form the object for animation + for(var n in newStyle) { + if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */ + && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */ + && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */ + && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */ + && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */ + ) offset[n] = newStyle[n]; + } + + that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object + // Change style attribute back to original. For stupid IE, we need to clear the damn object. + if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr); + if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove); + if(cb) cb.apply(this, arguments); + }); + + }); + } +}; + + +function _normalizeArguments(a, m) { + + var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m; + var speed = a[1] && a[1].constructor != Object ? a[1] : (o.duration ? o.duration : a[2]); //either comes from options.duration or the secon/third argument + speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default; + var callback = o.callback || ( $.isFunction(a[1]) && a[1] ) || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] ); + + return [a[0], o, speed, callback]; + +} + +//Extend the methods of jQuery +$.fn.extend({ + + //Save old methods + _show: $.fn.show, + _hide: $.fn.hide, + __toggle: $.fn.toggle, + _addClass: $.fn.addClass, + _removeClass: $.fn.removeClass, + _toggleClass: $.fn.toggleClass, + + // New effect methods + effect: function(fx, options, speed, callback) { + return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null; + }, + + show: function() { + if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0]))) + return this._show.apply(this, arguments); + else { + return this.effect.apply(this, _normalizeArguments(arguments, 'show')); + } + }, + + hide: function() { + if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0]))) + return this._hide.apply(this, arguments); + else { + return this.effect.apply(this, _normalizeArguments(arguments, 'hide')); + } + }, + + toggle: function(){ + if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) || (arguments[0].constructor == Function)) + return this.__toggle.apply(this, arguments); + else { + return this.effect.apply(this, _normalizeArguments(arguments, 'toggle')); + } + }, + + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + toggleClass: function(classNames,speed,easing,callback) { + return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed); + }, + morph: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + }, + switchClass: function() { + return this.morph.apply(this, arguments); + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + +/* + * jQuery Color Animations + * Copyright 2007 John Resig + * Released under the MIT and GPL licenses. + */ + +// We override the animation for all of these color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){ + $.fx.step[attr] = function(fx) { + if ( fx.state == 0 ) { + fx.start = getColor( fx.elem, attr ); + fx.end = getRGB( fx.end ); + } + + fx.elem.style[attr] = "rgb(" + [ + Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0), + Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0), + Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0) + ].join(",") + ")"; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.drop.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.drop.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.drop.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.drop.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,50 +1,50 @@ -/* - * jQuery UI Effects Drop @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Drop - * - * Depends: - * effects.core.js - */ -(function($) { - -$.effects.drop = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','left','opacity']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var direction = o.options.direction || 'left'; // Default Direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); - if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift - - // Animation - var animation = {opacity: mode == 'show' ? 1 : 0}; - animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; - - // Animate - el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - el.dequeue(); - }}); - - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Drop 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.explode.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.explode.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.explode.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.explode.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,79 +1,79 @@ -/* - * jQuery UI Effects Explode @VERSION - * - * Copyright (c) 2008 Paul Bakaus (ui.jquery.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Explode - * - * Depends: - * effects.core.js - */ -(function($) { - -$.effects.explode = function(o) { - - return this.queue(function() { - - var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; - var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; - - o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; - var el = $(this).show().css('visibility', 'hidden'); - var offset = el.offset(); - - //Substract the margins - not fixing the problem yet. - offset.top -= parseInt(el.css("marginTop")) || 0; - offset.left -= parseInt(el.css("marginLeft")) || 0; - - var width = el.outerWidth(true); - var height = el.outerHeight(true); - - for(var i=0;i') - .css({ - position: 'absolute', - visibility: 'visible', - left: -j*(width/cells), - top: -i*(height/rows) - }) - .parent() - .addClass('effects-explode') - .css({ - position: 'absolute', - overflow: 'hidden', - width: width/cells, - height: height/rows, - left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), - top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), - opacity: o.options.mode == 'show' ? 0 : 1 - }).animate({ - left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), - top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), - opacity: o.options.mode == 'show' ? 1 : 0 - }, o.duration || 500); - } - } - - // Set a timeout, to call the callback approx. when the other animations have finished - setTimeout(function() { - - o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); - if(o.callback) o.callback.apply(el[0]); // Callback - el.dequeue(); - - $('.effects-explode').remove(); - - }, o.duration || 500); - - - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Explode 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.fold.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.fold.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.fold.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.fold.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,55 +1,56 @@ -/* - * jQuery UI Effects Fold @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Fold - * - * Depends: - * effects.core.js - */ -(function($) { - -$.effects.fold = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','left']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var size = o.options.size || 15; // Default fold size - var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var widthFirst = ((mode == 'show') != horizFirst); - var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; - var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; - var percent = /([0-9]+)%/.exec(size); - if(percent) size = parseInt(percent[1]) / 100 * distance[mode == 'hide' ? 0 : 1]; - if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift - - // Animation - var animation1 = {}, animation2 = {}; - animation1[ref[0]] = mode == 'show' ? distance[0] : size; - animation2[ref[1]] = mode == 'show' ? distance[1] : 0; - - // Animate - wrapper.animate(animation1, o.duration / 2, o.options.easing) - .animate(animation2, o.duration / 2, o.options.easing, function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(el[0], arguments); // Callback - el.dequeue(); - }); - - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Fold 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.highlight.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.highlight.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.highlight.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.highlight.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,48 +1,48 @@ -/* - * jQuery UI Effects Highlight @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Highlight - * - * Depends: - * effects.core.js - */ -;(function($) { - -$.effects.highlight = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['backgroundImage','backgroundColor','opacity']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode - var color = o.options.color || "#ffff99"; // Default highlight color - var oldColor = el.css("backgroundColor"); - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - el.css({backgroundImage: 'none', backgroundColor: color}); // Shift - - // Animation - var animation = {backgroundColor: oldColor }; - if (mode == "hide") animation['opacity'] = 0; - - // Animate - el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if(mode == "hide") el.hide(); - $.effects.restore(el, props); - if (mode == "show" && jQuery.browser.msie) this.style.removeAttribute('filter'); - if(o.callback) o.callback.apply(this, arguments); - el.dequeue(); - }}); - - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Highlight 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.highlight = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['backgroundImage','backgroundColor','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var color = o.options.color || "#ffff99"; // Default highlight color + var oldColor = el.css("backgroundColor"); + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + el.css({backgroundImage: 'none', backgroundColor: color}); // Shift + + // Animation + var animation = {backgroundColor: oldColor }; + if (mode == "hide") animation['opacity'] = 0; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == "hide") el.hide(); + $.effects.restore(el, props); + if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter'); + if(o.callback) o.callback.apply(this, arguments); + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.pulsate.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.pulsate.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.pulsate.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.pulsate.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,55 +1,56 @@ -/* - * jQuery UI Effects Pulsate @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Pulsate - * - * Depends: - * effects.core.js - */ -(function($) { - -$.effects.pulsate = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this); - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode - var times = o.options.times || 5; // Default # of times - - // Adjust - if (mode == 'hide') times--; - if (el.is(':hidden')) { // Show fadeIn - el.css('opacity', 0); - el.show(); // Show - el.animate({opacity: 1}, o.duration / 2, o.options.easing); - times = times-2; - } - - // Animate - for (var i = 0; i < times; i++) { // Pulsate - el.animate({opacity: 0}, o.duration / 2, o.options.easing).animate({opacity: 1}, o.duration / 2, o.options.easing); - }; - if (mode == 'hide') { // Last Pulse - el.animate({opacity: 0}, o.duration / 2, o.options.easing, function(){ - el.hide(); // Hide - if(o.callback) o.callback.apply(this, arguments); // Callback - }); - } else { - el.animate({opacity: 0}, o.duration / 2, o.options.easing).animate({opacity: 1}, o.duration / 2, o.options.easing, function(){ - if(o.callback) o.callback.apply(this, arguments); // Callback - }); - }; - el.queue('fx', function() { el.dequeue(); }); - el.dequeue(); - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Pulsate 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.pulsate = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var times = o.options.times || 5; // Default # of times + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + if (mode == 'hide') times--; + if (el.is(':hidden')) { // Show fadeIn + el.css('opacity', 0); + el.show(); // Show + el.animate({opacity: 1}, duration, o.options.easing); + times = times-2; + } + + // Animate + for (var i = 0; i < times; i++) { // Pulsate + el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing); + }; + if (mode == 'hide') { // Last Pulse + el.animate({opacity: 0}, duration, o.options.easing, function(){ + el.hide(); // Hide + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){ + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.scale.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.scale.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.scale.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.scale.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,180 +1,180 @@ -/* - * jQuery UI Effects Scale @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Scale - * - * Depends: - * effects.core.js - */ -(function($) { - -$.effects.puff = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this); - - // Set options - var options = $.extend(true, {}, o.options); - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var percent = parseInt(o.options.percent) || 150; // Set default puff percent - options.fade = true; // It's not a puff if it doesn't fade! :) - var original = {height: el.height(), width: el.width()}; // Save original - - // Adjust - var factor = percent / 100; - el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor}; - - // Animation - options.from = el.from; - options.percent = (mode == 'hide') ? percent : 100; - options.mode = mode; - - // Animate - el.effect('scale', options, o.duration, o.callback); - el.dequeue(); - }); - -}; - -$.effects.scale = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this); - - // Set options - var options = $.extend(true, {}, o.options); - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var percent = parseInt(o.options.percent) || (parseInt(o.options.percent) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent - var direction = o.options.direction || 'both'; // Set default axis - var origin = o.options.origin; // The origin of the scaling - if (mode != 'effect') { // Set default origin and restore for show/hide - options.origin = origin || ['middle','center']; - options.restore = true; - } - var original = {height: el.height(), width: el.width()}; // Save original - el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state - - // Adjust - var factor = { // Set scaling factor - y: direction != 'horizontal' ? (percent / 100) : 1, - x: direction != 'vertical' ? (percent / 100) : 1 - }; - el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state - - if (o.options.fade) { // Fade option to support puff - if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; - if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; - }; - - // Animation - options.from = el.from; options.to = el.to; options.mode = mode; - - // Animate - el.effect('size', options, o.duration, o.callback); - el.dequeue(); - }); - -}; - -$.effects.size = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','left','width','height','overflow','opacity']; - var props1 = ['position','top','left','overflow','opacity']; // Always restore - var props2 = ['width','height','overflow']; // Copy for children - var cProps = ['fontSize']; - var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; - var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var restore = o.options.restore || false; // Default restore - var scale = o.options.scale || 'both'; // Default scale mode - var origin = o.options.origin; // The origin of the sizing - var original = {height: el.height(), width: el.width()}; // Save original - el.from = o.options.from || original; // Default from state - el.to = o.options.to || original; // Default to state - // Adjust - if (origin) { // Calculate baseline shifts - var baseline = $.effects.getBaseline(origin, original); - el.from.top = (original.height - el.from.height) * baseline.y; - el.from.left = (original.width - el.from.width) * baseline.x; - el.to.top = (original.height - el.to.height) * baseline.y; - el.to.left = (original.width - el.to.width) * baseline.x; - }; - var factor = { // Set scaling factor - from: {y: el.from.height / original.height, x: el.from.width / original.width}, - to: {y: el.to.height / original.height, x: el.to.width / original.width} - }; - if (scale == 'box' || scale == 'both') { // Scale the css box - if (factor.from.y != factor.to.y) { // Vertical props scaling - props = props.concat(vProps); - el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); - el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); - }; - if (factor.from.x != factor.to.x) { // Horizontal props scaling - props = props.concat(hProps); - el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); - el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); - }; - }; - if (scale == 'content' || scale == 'both') { // Scale the content - if (factor.from.y != factor.to.y) { // Vertical props scaling - props = props.concat(cProps); - el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); - el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); - }; - }; - $.effects.save(el, restore ? props : props1); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - el.css('overflow','hidden').css(el.from); // Shift - - // Animate - if (scale == 'content' || scale == 'both') { // Scale the children - vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size - hProps = hProps.concat(['marginLeft','marginRight']); // Add margins - props2 = props.concat(vProps).concat(hProps); // Concat - el.find("*[width]").each(function(){ - child = $(this); - if (restore) $.effects.save(child, props2); - var c_original = {height: child.height(), width: child.width()}; // Save original - child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; - child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; - if (factor.from.y != factor.to.y) { // Vertical props scaling - child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); - child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); - }; - if (factor.from.x != factor.to.x) { // Horizontal props scaling - child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); - child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); - }; - child.css(child.from); // Shift children - child.animate(child.to, o.duration, o.options.easing, function(){ - if (restore) $.effects.restore(child, props2); // Restore children - }); // Animate children - }); - }; - - // Animate - el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - el.dequeue(); - }}); - - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Scale 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.puff = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var percent = parseInt(o.options.percent,10) || 150; // Set default puff percent + options.fade = true; // It's not a puff if it doesn't fade! :) + var original = {height: el.height(), width: el.width()}; // Save original + + // Adjust + var factor = percent / 100; + el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor}; + + // Animation + options.from = el.from; + options.percent = (mode == 'hide') ? percent : 100; + options.mode = mode; + + // Animate + el.effect('scale', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','width','height','overflow','opacity']; + var props1 = ['position','top','left','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.shake.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.shake.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.shake.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.shake.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,57 +1,57 @@ -/* - * jQuery UI Effects Shake @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Shake - * - * Depends: - * effects.core.js - */ -(function($) { - -$.effects.shake = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','left']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var direction = o.options.direction || 'left'; // Default direction - var distance = o.options.distance || 20; // Default distance - var times = o.options.times || 3; // Default # of times - var speed = o.duration || o.options.duration || 140; // Default speed per shake - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - - // Animation - var animation = {}, animation1 = {}, animation2 = {}; - animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; - animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; - - // Animate - el.animate(animation, speed, o.options.easing); - for (var i = 1; i < times; i++) { // Shakes - el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); - }; - el.animate(animation1, speed, o.options.easing). - animate(animation, speed / 2, o.options.easing, function(){ // Last shake - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - }); - el.queue('fx', function() { el.dequeue(); }); - el.dequeue(); - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Shake 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.slide.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.slide.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.slide.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.slide.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,50 +1,50 @@ -/* - * jQuery UI Effects Slide @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Slide - * - * Depends: - * effects.core.js - */ -(function($) { - -$.effects.slide = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','left']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode - var direction = o.options.direction || 'left'; // Default Direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); - if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift - - // Animation - var animation = {}; - animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; - - // Animate - el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - el.dequeue(); - }}); - - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Slide 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/effects.transfer.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/effects.transfer.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/effects.transfer.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/effects.transfer.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,59 +1,45 @@ -/* - * jQuery UI Effects Transfer @VERSION - * - * Copyright (c) 2008 Aaron Eisenberger (aaronchi@gmail.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Effects/Transfer - * - * Depends: - * effects.core.js - */ -(function($) { - -$.effects.transfer = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this); - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var target = $(o.options.to); // Find Target - var position = el.offset(); - var transfer = $('
').appendTo(document.body); - if(o.options.className) transfer.addClass(o.options.className); - - // Set target css - transfer.addClass(o.options.className); - transfer.css({ - top: position.top, - left: position.left, - height: el.outerHeight() - parseInt(transfer.css('borderTopWidth')) - parseInt(transfer.css('borderBottomWidth')), - width: el.outerWidth() - parseInt(transfer.css('borderLeftWidth')) - parseInt(transfer.css('borderRightWidth')), - position: 'absolute' - }); - - // Animation - position = target.offset(); - animation = { - top: position.top, - left: position.left, - height: target.outerHeight() - parseInt(transfer.css('borderTopWidth')) - parseInt(transfer.css('borderBottomWidth')), - width: target.outerWidth() - parseInt(transfer.css('borderLeftWidth')) - parseInt(transfer.css('borderRightWidth')) - }; - - // Animate - transfer.animate(animation, o.duration, o.options.easing, function() { - transfer.remove(); // Remove div - if(o.callback) o.callback.apply(el[0], arguments); // Callback - el.dequeue(); - }); - - }); - -}; - -})(jQuery); +/* + * jQuery UI Effects Transfer 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('
') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/jquery-ui.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/jquery-ui.js,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/ui/jquery-ui.js 1 Apr 2009 00:45:14 -0000 1.1 @@ -0,0 +1,9074 @@ +/* + * jQuery UI 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI + */ +;jQuery.ui || (function($) { + +var _remove = $.fn.remove, + isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9); + +//Helper functions and ui object +$.ui = { + version: "1.7.1", + + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function(module, option, set) { + var proto = $.ui[module].prototype; + for(var i in set) { + proto.plugins[i] = proto.plugins[i] || []; + proto.plugins[i].push([option, set[i]]); + } + }, + call: function(instance, name, args) { + var set = instance.plugins[name]; + if(!set || !instance.element[0].parentNode) { return; } + + for (var i = 0; i < set.length; i++) { + if (instance.options[set[i][0]]) { + set[i][1].apply(instance.element, args); + } + } + } + }, + + contains: function(a, b) { + return document.compareDocumentPosition + ? a.compareDocumentPosition(b) & 16 + : a !== b && a.contains(b); + }, + + hasScroll: function(el, a) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ($(el).css('overflow') == 'hidden') { return false; } + + var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop', + has = false; + + if (el[scroll] > 0) { return true; } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[scroll] = 1; + has = (el[scroll] > 0); + el[scroll] = 0; + return has; + }, + + isOverAxis: function(x, reference, size) { + //Determines when x coordinate is over "b" element axis + return (x > reference) && (x < (reference + size)); + }, + + isOver: function(y, x, top, left, height, width) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width); + }, + + keyCode: { + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38 + } +}; + +// WAI-ARIA normalization +if (isFF2) { + var attr = $.attr, + removeAttr = $.fn.removeAttr, + ariaNS = "http://www.w3.org/2005/07/aaa", + ariaState = /^aria-/, + ariaRole = /^wairole:/; + + $.attr = function(elem, name, value) { + var set = value !== undefined; + + return (name == 'role' + ? (set + ? attr.call(this, elem, name, "wairole:" + value) + : (attr.apply(this, arguments) || "").replace(ariaRole, "")) + : (ariaState.test(name) + ? (set + ? elem.setAttributeNS(ariaNS, + name.replace(ariaState, "aaa:"), value) + : attr.call(this, elem, name.replace(ariaState, "aaa:"))) + : attr.apply(this, arguments))); + }; + + $.fn.removeAttr = function(name) { + return (ariaState.test(name) + ? this.each(function() { + this.removeAttributeNS(ariaNS, name.replace(ariaState, "")); + }) : removeAttr.call(this, name)); + }; +} + +//jQuery plugins +$.fn.extend({ + remove: function() { + // Safari has a native remove event which actually removes DOM elements, + // so we have to use triggerHandler instead of trigger (#3037). + $("*", this).add(this).each(function() { + $(this).triggerHandler("remove"); + }); + return _remove.apply(this, arguments ); + }, + + enableSelection: function() { + return this + .attr('unselectable', 'off') + .css('MozUserSelect', '') + .unbind('selectstart.ui'); + }, + + disableSelection: function() { + return this + .attr('unselectable', 'on') + .css('MozUserSelect', 'none') + .bind('selectstart.ui', function() { return false; }); + }, + + scrollParent: function() { + var scrollParent; + if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + } +}); + + +//Additional selectors +$.extend($.expr[':'], { + data: function(elem, i, match) { + return !!$.data(elem, match[3]); + }, + + focusable: function(element) { + var nodeName = element.nodeName.toLowerCase(), + tabIndex = $.attr(element, 'tabindex'); + return (/input|select|textarea|button|object/.test(nodeName) + ? !element.disabled + : 'a' == nodeName || 'area' == nodeName + ? element.href || !isNaN(tabIndex) + : !isNaN(tabIndex)) + // the element and all of its ancestors must be visible + // the browser may report that the area is hidden + && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length; + }, + + tabbable: function(element) { + var tabIndex = $.attr(element, 'tabindex'); + return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable'); + } +}); + + +// $.widget is a factory to create jQuery plugins +// taking some boilerplate code out of the plugin code +function getter(namespace, plugin, method, args) { + function getMethods(type) { + var methods = $[namespace][plugin][type] || []; + return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods); + } + + var methods = getMethods('getter'); + if (args.length == 1 && typeof args[0] == 'string') { + methods = methods.concat(getMethods('getterSetter')); + } + return ($.inArray(method, methods) != -1); +} + +$.widget = function(name, prototype) { + var namespace = name.split(".")[0]; + name = name.split(".")[1]; + + // create plugin method + $.fn[name] = function(options) { + var isMethodCall = (typeof options == 'string'), + args = Array.prototype.slice.call(arguments, 1); + + // prevent calls to internal methods + if (isMethodCall && options.substring(0, 1) == '_') { + return this; + } + + // handle getter methods + if (isMethodCall && getter(namespace, name, options, args)) { + var instance = $.data(this[0], name); + return (instance ? instance[options].apply(instance, args) + : undefined); + } + + // handle initialization and non-getter methods + return this.each(function() { + var instance = $.data(this, name); + + // constructor + (!instance && !isMethodCall && + $.data(this, name, new $[namespace][name](this, options))._init()); + + // method call + (instance && isMethodCall && $.isFunction(instance[options]) && + instance[options].apply(instance, args)); + }); + }; + + // create widget constructor + $[namespace] = $[namespace] || {}; + $[namespace][name] = function(element, options) { + var self = this; + + this.namespace = namespace; + this.widgetName = name; + this.widgetEventPrefix = $[namespace][name].eventPrefix || name; + this.widgetBaseClass = namespace + '-' + name; + + this.options = $.extend({}, + $.widget.defaults, + $[namespace][name].defaults, + $.metadata && $.metadata.get(element)[name], + options); + + this.element = $(element) + .bind('setData.' + name, function(event, key, value) { + if (event.target == element) { + return self._setData(key, value); + } + }) + .bind('getData.' + name, function(event, key) { + if (event.target == element) { + return self._getData(key); + } + }) + .bind('remove', function() { + return self.destroy(); + }); + }; + + // add widget prototype + $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype); + + // TODO: merge getter and getterSetter properties from widget prototype + // and plugin prototype + $[namespace][name].getterSetter = 'option'; +}; + +$.widget.prototype = { + _init: function() {}, + destroy: function() { + this.element.removeData(this.widgetName) + .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled') + .removeAttr('aria-disabled'); + }, + + option: function(key, value) { + var options = key, + self = this; + + if (typeof key == "string") { + if (value === undefined) { + return this._getData(key); + } + options = {}; + options[key] = value; + } + + $.each(options, function(key, value) { + self._setData(key, value); + }); + }, + _getData: function(key) { + return this.options[key]; + }, + _setData: function(key, value) { + this.options[key] = value; + + if (key == 'disabled') { + this.element + [value ? 'addClass' : 'removeClass']( + this.widgetBaseClass + '-disabled' + ' ' + + this.namespace + '-state-disabled') + .attr("aria-disabled", value); + } + }, + + enable: function() { + this._setData('disabled', false); + }, + disable: function() { + this._setData('disabled', true); + }, + + _trigger: function(type, event, data) { + var callback = this.options[type], + eventName = (type == this.widgetEventPrefix + ? type : this.widgetEventPrefix + type); + + event = $.Event(event); + event.type = eventName; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if (event.originalEvent) { + for (var i = $.event.props.length, prop; i;) { + prop = $.event.props[--i]; + event[prop] = event.originalEvent[prop]; + } + } + + this.element.trigger(event, data); + + return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false + || event.isDefaultPrevented()); + } +}; + +$.widget.defaults = { + disabled: false +}; + + +/** Mouse Interaction Plugin **/ + +$.ui.mouse = { + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if(self._preventClickEvent) { + self._preventClickEvent = false; + event.stopImmediatePropagation(); + return false; + } + }); + + // Prevent text selection in IE + if ($.browser.msie) { + this._mouseUnselectable = this.element.attr('unselectable'); + this.element.attr('unselectable', 'on'); + } + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + + // Restore text selection in IE + ($.browser.msie + && this.element.attr('unselectable', this._mouseUnselectable)); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + // TODO: figure out why we have to use originalEvent + event.originalEvent = event.originalEvent || {}; + if (event.originalEvent.mouseHandled) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + // preventDefault() is used to prevent the selection of text here - + // however, in Safari, this causes select boxes not to be selectable + // anymore, so this fix is needed + ($.browser.safari || event.preventDefault()); + + event.originalEvent.mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + this._preventClickEvent = (event.target == this._mouseDownEvent.target); + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}; + +$.ui.mouse.defaults = { + cancel: null, + distance: 1, + delay: 0 +}; + +})(jQuery); +/* + * jQuery UI Draggable 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.draggable", $.extend({}, $.ui.mouse, { + + _init: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + }, + + _mouseCapture: function(event) { + + var o = this.options; + + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + if(o.cursorAt) + this._adjustOffsetFromHelper(o.cursorAt); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Call plugins and callbacks + this._trigger("start", event); + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + this._trigger('drag', event, ui); + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + self._trigger("stop", event); + self._clear(); + }); + } else { + this._trigger("stop", event); + this._clear(); + } + + return false; + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; + if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; + if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + absolutePosition: this.positionAbs, //deprecated + offset: this.positionAbs + }; + } + +})); + +$.extend($.ui.draggable, { + version: "1.7.1", + eventPrefix: "drag", + defaults: { + addClasses: true, + appendTo: "parent", + axis: false, + cancel: ":input,option", + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + delay: 0, + distance: 1, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + } +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack.group)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min); + }); + + $(group).each(function(i) { + this.style.zIndex = o.stack.min + i; + }); + + this[0].style.zIndex = o.stack.min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/* + * jQuery UI Droppable 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * ui.core.js + * ui.draggable.js + */ +(function($) { + +$.widget("ui.droppable", { + + _init: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || []; + $.ui.ddmanager.droppables[this.options.scope].push(this); + + (this.options.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + }, + + _setData: function(key, value) { + + if(key == 'accept') { + this.options.accept = value && $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } else { + $.widget.prototype._setData.apply(this, arguments); + } + + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) { + childrenIntersection = true; return false; + } + }); + if(childrenIntersection) return false; + + if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + absolutePosition: c.positionAbs, //deprecated + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.7.1", + eventPrefix: 'drop', + defaults: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + } +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l < x1 && x2 < r + && t < y1 && y2 < b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope]; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event); + + if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + + $.each($.ui.ddmanager.droppables[draggable.options.scope], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + } +}; + +})(jQuery); +/* + * jQuery UI Resizable 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.resizable", $.extend({}, $.ui.mouse, { + + _init: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('
').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('
'); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.parent().append( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).end().remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + }, + + _mouseCapture: function(event) { + + var handle = false; + for(var i in this.handles) { + if($(this.handles[i])[0] == event.target) handle = true; + } + + return this.options.disabled || !!handle; + + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (data.height) data.width = (csize.height * this.aspectRatio); + else if (data.width) data.height = (csize.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('
'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +})); + +$.extend($.ui.resizable, { + version: "1.7.1", + eventPrefix: "resize", + defaults: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + cancel: ":input,option", + containment: false, + delay: 0, + distance: 1, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + } +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options; + + _store = function(exp) { + $(exp).each(function() { + $(this).data("resizable-alsoresize", { + width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10), + left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function(exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left']; + + $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + //Opera fixing relative position + if (/relative/.test(el.css('position')) && $.browser.opera) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"); + + //Opera fixing relative position + if (self._revertToRelativePosition && $.browser.opera) { + self._revertToRelativePosition = false; + el.css({ position: 'relative' }); + } + + $(this).removeData("resizable-alsoresize-start"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/* + * jQuery UI Selectable 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.selectable", $.extend({}, $.ui.mouse, { + + _init: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $(document.createElement('div')) + .css({border:'1px dotted black'}) + .addClass("ui-selectable-helper"); + }, + + destroy: function() { + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "z-index": 100, + "position": "absolute", + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting'); + selectee.unselecting = false; + selectee.selecting = true; + selectee.selected = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if (event.metaKey && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +})); + +$.extend($.ui.selectable, { + version: "1.7.1", + defaults: { + appendTo: 'body', + autoRefresh: true, + cancel: ":input,option", + delay: 0, + distance: 0, + filter: '*', + tolerance: 'touch' + } +}); + +})(jQuery); +/* + * jQuery UI Sortable 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.sortable", $.extend({}, $.ui.mouse, { + _init: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are floating + this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled") + .removeData("sortable") + .unbind(".sortable"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData("sortable-item"); + }, + + _mouseCapture: function(event, overrideHandle) { + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, 'sortable-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + if(o.cursorAt) + this._adjustOffsetFromHelper(o.cursorAt); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp(); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + + return true; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper"), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper"), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(sortable-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data('sortable-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + for (var i = this.containers.length - 1; i >= 0; i--){ + + if(this._intersectsWith(this.containers[i].containerCache)) { + if(!this.containers[i].containerCache.over) { + + if(this.currentContainer != this.containers[i]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[i].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[i].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[i].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + continue; + + this.currentContainer = this.containers[i]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[i].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[i]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + } + + this.containers[i]._trigger("over", event, this._uiHash(this)); + this.containers[i].containerCache.over = 1; + } + } else { + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + }; + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; + if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; + if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset cursor + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + absolutePosition: self.positionAbs, //deprecated + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +})); + +$.extend($.ui.sortable, { + getter: "serialize toArray", + version: "1.7.1", + eventPrefix: "sort", + defaults: { + appendTo: "parent", + axis: false, + cancel: ":input,option", + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + delay: 0, + distance: 1, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + } +}); + +})(jQuery); +/* + * jQuery UI Effects 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($) { + +$.effects = { + version: "1.7.1", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + //if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) + return element.parent(); + + //Cache width,height and float properties of the element, and create a wrapper around it + var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') }; + element.wrap('
'); + var wrapper = element.parent(); + + //Transfer the positioning of the element to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative'} ); + } else { + var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto'; + var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto'; + wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show(); + element.css({position: 'relative', top: 0, left: 0 }); + } + + wrapper.css(props); + return wrapper; + }, + + removeWrapper: function(element) { + if (element.parent().is('.ui-effects-wrapper')) + return element.parent().replaceWith(element); + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + }, + + //Base function to animate from one class to another in a seamless transition + animateClass: function(value, duration, easing, callback) { + + var cb = (typeof easing == "function" ? easing : (callback ? callback : null)); + var ea = (typeof easing == "string" ? easing : null); + + return this.each(function() { + + var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || ''; + if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */ + if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; } + + //Let's get a style offset + var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle)); + if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove); + var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle)); + if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove); + + // The main function to form the object for animation + for(var n in newStyle) { + if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */ + && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */ + && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */ + && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */ + && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */ + ) offset[n] = newStyle[n]; + } + + that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object + // Change style attribute back to original. For stupid IE, we need to clear the damn object. + if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr); + if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove); + if(cb) cb.apply(this, arguments); + }); + + }); + } +}; + + +function _normalizeArguments(a, m) { + + var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m; + var speed = a[1] && a[1].constructor != Object ? a[1] : (o.duration ? o.duration : a[2]); //either comes from options.duration or the secon/third argument + speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default; + var callback = o.callback || ( $.isFunction(a[1]) && a[1] ) || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] ); + + return [a[0], o, speed, callback]; + +} + +//Extend the methods of jQuery +$.fn.extend({ + + //Save old methods + _show: $.fn.show, + _hide: $.fn.hide, + __toggle: $.fn.toggle, + _addClass: $.fn.addClass, + _removeClass: $.fn.removeClass, + _toggleClass: $.fn.toggleClass, + + // New effect methods + effect: function(fx, options, speed, callback) { + return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null; + }, + + show: function() { + if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0]))) + return this._show.apply(this, arguments); + else { + return this.effect.apply(this, _normalizeArguments(arguments, 'show')); + } + }, + + hide: function() { + if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0]))) + return this._hide.apply(this, arguments); + else { + return this.effect.apply(this, _normalizeArguments(arguments, 'hide')); + } + }, + + toggle: function(){ + if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) || (arguments[0].constructor == Function)) + return this.__toggle.apply(this, arguments); + else { + return this.effect.apply(this, _normalizeArguments(arguments, 'toggle')); + } + }, + + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + toggleClass: function(classNames,speed,easing,callback) { + return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed); + }, + morph: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + }, + switchClass: function() { + return this.morph.apply(this, arguments); + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + +/* + * jQuery Color Animations + * Copyright 2007 John Resig + * Released under the MIT and GPL licenses. + */ + +// We override the animation for all of these color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){ + $.fx.step[attr] = function(fx) { + if ( fx.state == 0 ) { + fx.start = getColor( fx.elem, attr ); + fx.end = getRGB( fx.end ); + } + + fx.elem.style[attr] = "rgb(" + [ + Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0), + Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0), + Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0) + ].join(",") + ")"; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); +/* + * jQuery UI Effects Blind 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Bounce 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Clip 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Drop 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Explode 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Fold 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Highlight 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.highlight = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['backgroundImage','backgroundColor','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var color = o.options.color || "#ffff99"; // Default highlight color + var oldColor = el.css("backgroundColor"); + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + el.css({backgroundImage: 'none', backgroundColor: color}); // Shift + + // Animation + var animation = {backgroundColor: oldColor }; + if (mode == "hide") animation['opacity'] = 0; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == "hide") el.hide(); + $.effects.restore(el, props); + if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter'); + if(o.callback) o.callback.apply(this, arguments); + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Pulsate 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.pulsate = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var times = o.options.times || 5; // Default # of times + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + if (mode == 'hide') times--; + if (el.is(':hidden')) { // Show fadeIn + el.css('opacity', 0); + el.show(); // Show + el.animate({opacity: 1}, duration, o.options.easing); + times = times-2; + } + + // Animate + for (var i = 0; i < times; i++) { // Pulsate + el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing); + }; + if (mode == 'hide') { // Last Pulse + el.animate({opacity: 0}, duration, o.options.easing, function(){ + el.hide(); // Hide + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){ + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Scale 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.puff = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var percent = parseInt(o.options.percent,10) || 150; // Set default puff percent + options.fade = true; // It's not a puff if it doesn't fade! :) + var original = {height: el.height(), width: el.width()}; // Save original + + // Adjust + var factor = percent / 100; + el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor}; + + // Animation + options.from = el.from; + options.percent = (mode == 'hide') ? percent : 100; + options.mode = mode; + + // Animate + el.effect('scale', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','width','height','overflow','opacity']; + var props1 = ['position','top','left','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Shake 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Slide 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Transfer 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * effects.core.js + */ +(function($) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('
') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Accordion 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.accordion", { + + _init: function() { + + var o = this.options, self = this; + this.running = 0; + + // if the user set the alwaysOpen option on init + // then we need to set the collapsible option + // if they set both on init, collapsible will take priority + if (o.collapsible == $.ui.accordion.defaults.collapsible && + o.alwaysOpen != $.ui.accordion.defaults.alwaysOpen) { + o.collapsible = !o.alwaysOpen; + } + + if ( o.navigation ) { + var current = this.element.find("a").filter(o.navigationFilter); + if ( current.length ) { + if ( current.filter(o.header).length ) { + this.active = current; + } else { + this.active = current.parent().parent().prev(); + current.addClass("ui-accordion-content-active"); + } + } + } + + this.element.addClass("ui-accordion ui-widget ui-helper-reset"); + + // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix + if (this.element[0].nodeName == "UL") { + this.element.children("li").addClass("ui-accordion-li-fix"); + } + + this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all") + .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); }) + .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); }) + .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); }) + .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); }); + + this.headers + .next() + .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); + + this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"); + this.active.next().addClass('ui-accordion-content-active'); + + //Append icon elements + $("").addClass("ui-icon " + o.icons.header).prependTo(this.headers); + this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected); + + // IE7-/Win - Extra vertical space in lists fixed + if ($.browser.msie) { + this.element.find('a').css('zoom', '1'); + } + + this.resize(); + + //ARIA + this.element.attr('role','tablist'); + + this.headers + .attr('role','tab') + .bind('keydown', function(event) { return self._keydown(event); }) + .next() + .attr('role','tabpanel'); + + this.headers + .not(this.active || "") + .attr('aria-expanded','false') + .attr("tabIndex", "-1") + .next() + .hide(); + + // make sure at least one header is in the tab order + if (!this.active.length) { + this.headers.eq(0).attr('tabIndex','0'); + } else { + this.active + .attr('aria-expanded','true') + .attr('tabIndex', '0'); + } + + // only need links in taborder for Safari + if (!$.browser.safari) + this.headers.find('a').attr('tabIndex','-1'); + + if (o.event) { + this.headers.bind((o.event) + ".accordion", function(event) { return self._clickHandler.call(self, event, this); }); + } + + }, + + destroy: function() { + var o = this.options; + + this.element + .removeClass("ui-accordion ui-widget ui-helper-reset") + .removeAttr("role") + .unbind('.accordion') + .removeData('accordion'); + + this.headers + .unbind(".accordion") + .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top") + .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex"); + + this.headers.find("a").removeAttr("tabindex"); + this.headers.children(".ui-icon").remove(); + var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active"); + if (o.autoHeight || o.fillHeight) { + contents.css("height", ""); + } + }, + + _setData: function(key, value) { + if(key == 'alwaysOpen') { key = 'collapsible'; value = !value; } + $.widget.prototype._setData.apply(this, arguments); + }, + + _keydown: function(event) { + + var o = this.options, keyCode = $.ui.keyCode; + + if (o.disabled || event.altKey || event.ctrlKey) + return; + + var length = this.headers.length; + var currentIndex = this.headers.index(event.target); + var toFocus = false; + + switch(event.keyCode) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[(currentIndex + 1) % length]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[(currentIndex - 1 + length) % length]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + return this._clickHandler({ target: event.target }, event.target); + } + + if (toFocus) { + $(event.target).attr('tabIndex','-1'); + $(toFocus).attr('tabIndex','0'); + toFocus.focus(); + return false; + } + + return true; + + }, + + resize: function() { + + var o = this.options, maxHeight; + + if (o.fillSpace) { + + if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); } + maxHeight = this.element.parent().height(); + if($.browser.msie) { this.element.parent().css('overflow', defOverflow); } + + this.headers.each(function() { + maxHeight -= $(this).outerHeight(); + }); + + var maxPadding = 0; + this.headers.next().each(function() { + maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height()); + }).height(Math.max(0, maxHeight - maxPadding)) + .css('overflow', 'auto'); + + } else if ( o.autoHeight ) { + maxHeight = 0; + this.headers.next().each(function() { + maxHeight = Math.max(maxHeight, $(this).outerHeight()); + }).height(maxHeight); + } + + }, + + activate: function(index) { + // call clickHandler with custom event + var active = this._findActive(index)[0]; + this._clickHandler({ target: active }, active); + }, + + _findActive: function(selector) { + return selector + ? typeof selector == "number" + ? this.headers.filter(":eq(" + selector + ")") + : this.headers.not(this.headers.not(selector)) + : selector === false + ? $([]) + : this.headers.filter(":eq(0)"); + }, + + _clickHandler: function(event, target) { + + var o = this.options; + if (o.disabled) return false; + + // called only when using activate(false) to close all parts programmatically + if (!event.target && o.collapsible) { + this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all") + .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header); + this.active.next().addClass('ui-accordion-content-active'); + var toHide = this.active.next(), + data = { + options: o, + newHeader: $([]), + oldHeader: o.active, + newContent: $([]), + oldContent: toHide + }, + toShow = (this.active = $([])); + this._toggle(toShow, toHide, data); + return false; + } + + // get the click target + var clicked = $(event.currentTarget || target); + var clickedIsActive = clicked[0] == this.active[0]; + + // if animations are still active, or the active header is the target, ignore click + if (this.running || (!o.collapsible && clickedIsActive)) { + return false; + } + + // switch classes + this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all") + .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header); + this.active.next().addClass('ui-accordion-content-active'); + if (!clickedIsActive) { + clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top") + .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected); + clicked.next().addClass('ui-accordion-content-active'); + } + + // find elements to show and hide + var toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: o, + newHeader: clickedIsActive && o.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && o.collapsible ? $([]) : toShow.find('> *'), + oldContent: toHide.find('> *') + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + this.active = clickedIsActive ? $([]) : clicked; + this._toggle(toShow, toHide, data, clickedIsActive, down); + + return false; + + }, + + _toggle: function(toShow, toHide, data, clickedIsActive, down) { + + var o = this.options, self = this; + + this.toShow = toShow; + this.toHide = toHide; + this.data = data; + + var complete = function() { if(!self) return; return self._completed.apply(self, arguments); }; + + // trigger changestart event + this._trigger("changestart", null, this.data); + + // count elements to animate + this.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if (o.animated) { + + var animOptions = {}; + + if ( o.collapsible && clickedIsActive ) { + animOptions = { + toShow: $([]), + toHide: toHide, + complete: complete, + down: down, + autoHeight: o.autoHeight || o.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: o.autoHeight || o.fillSpace + }; + } + + if (!o.proxied) { + o.proxied = o.animated; + } + + if (!o.proxiedDuration) { + o.proxiedDuration = o.duration; + } + + o.animated = $.isFunction(o.proxied) ? + o.proxied(animOptions) : o.proxied; + + o.duration = $.isFunction(o.proxiedDuration) ? + o.proxiedDuration(animOptions) : o.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = o.duration, + easing = o.animated; + + if (!animations[easing]) { + animations[easing] = function(options) { + this.slide(options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[easing](animOptions); + + } else { + + if (o.collapsible && clickedIsActive) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete(true); + + } + + toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur(); + toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus(); + + }, + + _completed: function(cancel) { + + var o = this.options; + + this.running = cancel ? 0 : --this.running; + if (this.running) return; + + if (o.clearStyle) { + this.toShow.add(this.toHide).css({ + height: "", + overflow: "" + }); + } + + this._trigger('change', null, this.data); + } + +}); + + +$.extend($.ui.accordion, { + version: "1.7.1", + defaults: { + active: null, + alwaysOpen: true, //deprecated, use collapsible + animated: 'slide', + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() == location.href.toLowerCase(); + } + }, + animations: { + slide: function(options, additions) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions); + if ( !options.toHide.size() ) { + options.toShow.animate({height: "show"}, options); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({height: "hide"}, options); + return; + } + var overflow = options.toShow.css('overflow'), + percentDone, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) ); + + $.each(fxAttrs, function(i, prop) { + hideProps[prop] = 'hide'; + + var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/); + showProps[prop] = { + value: parts[1], + unit: parts[2] || 'px' + }; + }); + options.toShow.css({ height: 0, overflow: 'hidden' }).show(); + options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{ + step: function(now, settings) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if (settings.prop == 'height') { + percentDone = (settings.now - settings.start) / (settings.end - settings.start); + } + + options.toShow[0].style[settings.prop] = + (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css("height", ""); + } + options.toShow.css("width", originalWidth); + options.toShow.css({overflow: overflow}); + options.complete(); + } + }); + }, + bounceslide: function(options) { + this.slide(options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + }, + easeslide: function(options) { + this.slide(options, { + easing: "easeinout", + duration: 700 + }); + } + } +}); + +})(jQuery); +/* + * jQuery UI Datepicker 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * ui.core.js + */ + +(function($) { // hide the namespace + +$.extend($.ui, { datepicker: { version: "1.7.1" } }); + +var PROP_NAME = 'datepicker'; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false // True if right-to-left language, false if left-to-right + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'show', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearRange: '-10:+10', // Range of years to display in drop-down, + // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn) + showOtherMonths: false, // True to show dates in other months, false to leave blank + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'normal', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false // True to show button panel, false to not show it + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = $('
'); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) + target.id = 'dp' + (++this.uuid); + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + $('
'))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (appendText) + input[isRTL ? 'before' : 'after']('' + appendText + ''); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(target); + return false; + }); + } + input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst)); + this._updateDatepicker(inst); + this._updateAlternate(inst); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param dateText string - the initial date to display (in the current format) + @param onSelect function - the function(dateText) to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, dateText, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + var id = 'dp' + (++this.uuid); + this._dialogInput = $(''); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + this._dialogInput.val(dateText); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth; + var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.trigger.remove(); + $target.siblings('.' + this._appendClass).remove().end(). + removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter("button"). + each(function() { this.disabled = false; }).end(). + filter("img"). + css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter("button"). + each(function() { this.disabled = true; }).end(). + filter("img"). + css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or + @param value any - the new value for the setting (omit if above is an object) */ + _optionDatepicker: function(target, name, value) { + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + var inst = this._getInst(target); + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(null); + } + extendRemove(inst.settings, settings); + var date = new Date(); + extendRemove(inst, {rangeStart: null, // start of range + endDay: null, endMonth: null, endYear: null, // end of range + selectedDay: date.getDate(), selectedMonth: date.getMonth(), + selectedYear: date.getFullYear(), // starting point + currentDay: date.getDate(), currentMonth: date.getMonth(), + currentYear: date.getFullYear(), // current selection + drawMonth: date.getMonth(), drawYear: date.getFullYear()}); // month being drawn + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date + @param endDate Date - the new end date for a range (optional) */ + _setDateDatepicker: function(target, date, endDate) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date, endDate); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @return Date - the current date or + Date[2] - the current dates for a range */ + _getDateDatepicker: function(target) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(null, ''); + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + + ', td.' + $.datepicker._currentClass, inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + else + $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration')); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration')); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Pop-up the date picker for a given input field. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {})); + $.datepicker._hideDatepicker(null, ''); + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + inst.rangeStart = null; + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim') || 'show'; + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._datepickerShowing = true; + if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems + $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4, + height: inst.dpDiv.height() + 4}); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim](duration, postProcess); + if (duration == '') + postProcess(); + if (inst.input[0].type != 'hidden') + inst.input[0].focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var dims = {width: inst.dpDiv.width() + 4, + height: inst.dpDiv.height() + 4}; + var self = this; + inst.dpDiv.empty().append(this._generateHTML(inst)) + .find('iframe.ui-datepicker-cover'). + css({width: dims.width, height: dims.height}) + .end() + .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a') + .bind('mouseout', function(){ + $(this).removeClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover'); + }) + .bind('mouseover', function(){ + if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) { + $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + $(this).addClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover'); + } + }) + .end() + .find('.' + this._dayOverClass + ' a') + .trigger('mouseover') + .end(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + if (cols > 1) { + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + } else { + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + } + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst) + $(inst.input[0]).focus(); + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft(); + var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0; + offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0; + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) { + obj = obj.nextSibling; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker + @param duration string - the duration over which to close the date picker */ + _hideDatepicker: function(input, duration) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (inst.stayOpen) + this._selectDate('#' + inst.id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + inst.stayOpen = false; + if (this._datepickerShowing) { + duration = (duration != null ? duration : this._get(inst, 'duration')); + var showAnim = this._get(inst, 'showAnim'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if (duration != '' && $.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), + duration, postProcess); + else + inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess); + if (duration == '') + this._tidyDialog(inst); + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + this._curInst = null; + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if (($target.parents('#' + $.datepicker._mainDivId).length == 0) && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(null, ''); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst._selectingMonthYear = false; + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Restore input focus after not changing month/year. */ + _clickMonthYear: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (inst.input && inst._selectingMonthYear && !$.browser.msie) + inst.input[0].focus(); + inst._selectingMonthYear = !inst._selectingMonthYear; + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + if (inst.stayOpen) { + inst.endDay = inst.endMonth = inst.endYear = null; + } + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + if (inst.stayOpen) { + inst.rangeStart = this._daylightSavingAdjust( + new Date(inst.currentYear, inst.currentMonth, inst.currentDay)); + this._updateDatepicker(inst); + } + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + inst.stayOpen = false; + inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null; + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else if (!inst.stayOpen) { + this._hideDatepicker(null, this._get(inst, 'duration')); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input[0].focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate()); + var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan + var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7 + firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday + if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary + checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year + return $.datepicker.iso8601Week(checkDate); + } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year + firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7; + if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary + return 1; + } + } + return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + lookAhead(match); + var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2))); + var size = origSize; + var num = 0; + while (size > 0 && iValue < value.length && + value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') { + num = num * 10 + parseInt(value.charAt(iValue++),10); + size--; + } + if (size == origSize) + throw 'Missing number at position ' + iValue; + return num; + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = (lookAhead(match) ? longNames : shortNames); + var size = 0; + for (var j = 0; j < names.length; j++) + size = Math.max(size, names[j].length); + var name = ''; + var iInit = iValue; + while (size > 0 && iValue < value.length) { + name += value.charAt(iValue++); + for (var i = 0; i < names.length; i++) + if (name == names[i]) + return i + 1; + size--; + } + throw 'Unknown name at position ' + iInit; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/* + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + var doy = date.getDate(); + for (var m = date.getMonth() - 1; m >= 0; m--) + doy += this._getDaysInMonth(date.getFullYear(), m); + output += formatNumber('o', doy, 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst) { + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.input ? inst.input.val() : null; + inst.endDay = inst.endMonth = inst.endYear = null; + var date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + date = defaultDate; + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + var date = this._determineDate(this._get(inst, 'defaultDate'), new Date()); + var minDate = this._getMinMaxDate(inst, 'min', true); + var maxDate = this._getMinMaxDate(inst, 'max'); + date = (minDate && date < minDate ? minDate : date); + date = (maxDate && date > maxDate ? maxDate : date); + return date; + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset, getDaysInMonth) { + var date = new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + date = (date == null ? defaultDate : + (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date))); + date = (date && date.toString() == 'Invalid Date' ? defaultDate : date); + if (date) { + date.setHours(0); + date.setMinutes(0); + date.setSeconds(0); + date.setMilliseconds(0); + } + return this._daylightSavingAdjust(date); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, endDate) { + var clear = !(date); + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + date = this._determineDate(date, new Date()); + inst.selectedDay = inst.currentDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear(); + if (origMonth != inst.selectedMonth || origYear != inst.selectedYear) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var stepBigMonths = this._get(inst, 'stepBigMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min', true); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var endDate = inst.endDay ? this._daylightSavingAdjust( + new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
'; + } + calender += '
' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
' + + ''; + var thead = ''; + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = ''; + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = otherMonth || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display for this month + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
' + // actions + (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
' + (isMultiMonth ? '
' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + selectedDate, secondary, monthNames, monthNamesShort) { + minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate); + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ' '; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? ' ' : ''); + // year selection + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var year = 0; + var endYear = 0; + if (years.length != 2) { + year = drawYear - 10; + endYear = drawYear + 10; + } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') { + year = drawYear + parseInt(years[0], 10); + endYear = drawYear + parseInt(years[1], 10); + } else { + year = parseInt(years[0], 10); + endYear = parseInt(years[1], 10); + } + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + html += ''; + } + if (showMonthAfterYear) + html += (secondary || changeMonth || changeYear ? ' ' : '') + monthHtml; + html += '
'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._daylightSavingAdjust(new Date(year, month, day)); + // ensure it is within the bounds set + var minDate = this._getMinMaxDate(inst, 'min', true); + var maxDate = this._getMinMaxDate(inst, 'max'); + date = (minDate && date < minDate ? minDate : date); + date = (maxDate && date > maxDate ? maxDate : date); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */ + _getMinMaxDate: function(inst, minMax, checkRange) { + var date = this._determineDate(this._get(inst, minMax + 'Date'), null); + return (!checkRange || !inst.rangeStart ? date : + (!date || inst.rangeStart > date ? inst.rangeStart : date)); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - new Date(year, month, 32).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date( + curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + // during range selection, use minimum of selected date and range start + var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust( + new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay))); + newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate); + var minDate = newMinDate || this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate)); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.7.1"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window.DP_jQuery = $; + +})(jQuery); +/* + * jQuery UI Dialog 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * ui.core.js + * ui.draggable.js + * ui.resizable.js + */ +(function($) { + +var setDataSwitch = { + dragStart: "start.draggable", + drag: "drag.draggable", + dragStop: "stop.draggable", + maxHeight: "maxHeight.resizable", + minHeight: "minHeight.resizable", + maxWidth: "maxWidth.resizable", + minWidth: "minWidth.resizable", + resizeStart: "start.resizable", + resize: "drag.resizable", + resizeStop: "stop.resizable" + }, + + uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all '; + +$.widget("ui.dialog", { + + _init: function() { + this.originalTitle = this.element.attr('title'); + + var self = this, + options = this.options, + + title = options.title || this.originalTitle || ' ', + titleId = $.ui.dialog.getTitleId(this.element), + + uiDialog = (this.uiDialog = $('
')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + position: 'absolute', + overflow: 'hidden', + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + (options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event)); + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = this.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (this.uiDialogTitlebar = $('
')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .mousedown(function(ev) { + ev.stopPropagation(); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + (options.draggable && $.fn.draggable && this._makeDraggable()); + (options.resizable && $.fn.resizable && this._makeResizable()); + + this._createButtons(options.buttons); + this._isOpen = false; + + (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe()); + (options.autoOpen && this.open()); + + }, + + destroy: function() { + (this.overlay && this.overlay.destroy()); + this.uiDialog.hide(); + this.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + this.uiDialog.remove(); + + (this.originalTitle && this.element.attr('title', this.originalTitle)); + }, + + close: function(event) { + var self = this; + + if (false === self._trigger('beforeclose', event)) { + return; + } + + (self.overlay && self.overlay.destroy()); + self.uiDialog.unbind('keypress.ui-dialog'); + + (self.options.hide + ? self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }) + : self.uiDialog.hide() && self._trigger('close', event)); + + $.ui.dialog.overlay.resize(); + + self._isOpen = false; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + + if ((this.options.modal && !force) + || (!this.options.stack && !this.options.modal)) { + return this._trigger('focus', event); + } + + if (this.options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = this.options.zIndex; + } + (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ)); + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') }; + this.uiDialog.css('z-index', ++$.ui.dialog.maxZ); + this.element.attr(saveScroll); + this._trigger('focus', event); + }, + + open: function() { + if (this._isOpen) { return; } + + var options = this.options, + uiDialog = this.uiDialog; + + this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null; + (uiDialog.next().length && uiDialog.appendTo('body')); + this._size(); + this._position(options.position); + uiDialog.show(options.show); + this.moveToTop(true); + + // prevent tabbing out of modal dialogs + (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode != $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first')[0], + last = tabbables.filter(':last')[0]; + + if (event.target == last && !event.shiftKey) { + setTimeout(function() { + first.focus(); + }, 1); + } else if (event.target == first && event.shiftKey) { + setTimeout(function() { + last.focus(); + }, 1); + } + })); + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $([]) + .add(uiDialog.find('.ui-dialog-content :tabbable:first')) + .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first')) + .add(uiDialog) + .filter(':first') + .focus(); + + this._trigger('open'); + this._isOpen = true; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ); + + // if we already have a button pane, remove it + this.uiDialog.find('.ui-dialog-buttonpane').remove(); + + (typeof buttons == 'object' && buttons !== null && + $.each(buttons, function() { return !(hasButtons = true); })); + if (hasButtons) { + $.each(buttons, function(name, fn) { + $('') + .addClass( + 'ui-state-default ' + + 'ui-corner-all' + ) + .text(name) + .click(function() { fn.apply(self.element[0], arguments); }) + .hover( + function() { + $(this).addClass('ui-state-hover'); + }, + function() { + $(this).removeClass('ui-state-hover'); + } + ) + .focus(function() { + $(this).addClass('ui-state-focus'); + }) + .blur(function() { + $(this).removeClass('ui-state-focus'); + }) + .appendTo(uiDialogButtonPane); + }); + uiDialogButtonPane.appendTo(this.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = this.options, + heightBeforeDrag; + + this.uiDialog.draggable({ + cancel: '.ui-dialog-content', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function() { + heightBeforeDrag = options.height; + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + (options.dragStart && options.dragStart.apply(self.element[0], arguments)); + }, + drag: function() { + (options.drag && options.drag.apply(self.element[0], arguments)); + }, + stop: function() { + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + (options.dragStop && options.dragStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = this.options, + resizeHandles = typeof handles == 'string' + ? handles + : 'n,e,s,w,se,sw,ne,nw'; + + this.uiDialog.resizable({ + cancel: '.ui-dialog-content', + alsoResize: this.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: options.minHeight, + start: function() { + $(this).addClass("ui-dialog-resizing"); + (options.resizeStart && options.resizeStart.apply(self.element[0], arguments)); + }, + resize: function() { + (options.resize && options.resize.apply(self.element[0], arguments)); + }, + handles: resizeHandles, + stop: function() { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + (options.resizeStop && options.resizeStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _position: function(pos) { + var wnd = $(window), doc = $(document), + pTop = doc.scrollTop(), pLeft = doc.scrollLeft(), + minTop = pTop; + + if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) { + pos = [ + pos == 'right' || pos == 'left' ? pos : 'center', + pos == 'top' || pos == 'bottom' ? pos : 'middle' + ]; + } + if (pos.constructor != Array) { + pos = ['center', 'middle']; + } + if (pos[0].constructor == Number) { + pLeft += pos[0]; + } else { + switch (pos[0]) { + case 'left': + pLeft += 0; + break; + case 'right': + pLeft += wnd.width() - this.uiDialog.outerWidth(); + break; + default: + case 'center': + pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2; + } + } + if (pos[1].constructor == Number) { + pTop += pos[1]; + } else { + switch (pos[1]) { + case 'top': + pTop += 0; + break; + case 'bottom': + pTop += wnd.height() - this.uiDialog.outerHeight(); + break; + default: + case 'middle': + pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2; + } + } + + // prevent the dialog from being too high (make sure the titlebar + // is accessible) + pTop = Math.max(pTop, minTop); + this.uiDialog.css({top: pTop, left: pLeft}); + }, + + _setData: function(key, value){ + (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value)); + switch (key) { + case "buttons": + this._createButtons(value); + break; + case "closeText": + this.uiDialogTitlebarCloseText.text(value); + break; + case "dialogClass": + this.uiDialog + .removeClass(this.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "draggable": + (value + ? this._makeDraggable() + : this.uiDialog.draggable('destroy')); + break; + case "height": + this.uiDialog.height(value); + break; + case "position": + this._position(value); + break; + case "resizable": + var uiDialog = this.uiDialog, + isResizable = this.uiDialog.is(':data(resizable)'); + + // currently resizable, becoming non-resizable + (isResizable && !value && uiDialog.resizable('destroy')); + + // currently resizable, changing handles + (isResizable && typeof value == 'string' && + uiDialog.resizable('option', 'handles', value)); + + // currently non-resizable, becoming resizable + (isResizable || this._makeResizable(value)); + break; + case "title": + $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' '); + break; + case "width": + this.uiDialog.width(value); + break; + } + + $.widget.prototype._setData.apply(this, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options; + + // reset content sizing + this.element.css({ + height: 0, + minHeight: 0, + width: 'auto' + }); + + // reset wrapper sizing + // determine the height of all the non-content elements + var nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + + this.element + .css({ + minHeight: Math.max(options.minHeight - nonContentHeight, 0), + height: options.height == 'auto' + ? 'auto' + : Math.max(options.height - nonContentHeight, 0) + }); + } +}); + +$.extend($.ui.dialog, { + version: "1.7.1", + defaults: { + autoOpen: true, + bgiframe: false, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: 'center', + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + getter: 'isOpen', + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid); + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + $(document).bind($.ui.dialog.overlay.events, function(event) { + var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0; + return (dialogZ > $.ui.dialog.overlay.maxZ); + }); + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + (dialog.options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event)); + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = $('
').appendTo(document.body) + .addClass('ui-widget-overlay').css({ + width: this.width(), + height: this.height() + }); + + (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe()); + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + this.instances.splice($.inArray(this.instances, $el), 1); + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + }, + + height: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + var offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + var offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +})(jQuery); +/* + * jQuery UI Progressbar 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.progressbar", { + + _init: function() { + + this.element + .addClass("ui-progressbar" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all") + .attr({ + role: "progressbar", + "aria-valuemin": this._valueMin(), + "aria-valuemax": this._valueMax(), + "aria-valuenow": this._value() + }); + + this.valueDiv = $('
').appendTo(this.element); + + this._refreshValue(); + + }, + + destroy: function() { + + this.element + .removeClass("ui-progressbar" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all") + .removeAttr("role") + .removeAttr("aria-valuemin") + .removeAttr("aria-valuemax") + .removeAttr("aria-valuenow") + .removeData("progressbar") + .unbind(".progressbar"); + + this.valueDiv.remove(); + + $.widget.prototype.destroy.apply(this, arguments); + + }, + + value: function(newValue) { + arguments.length && this._setData("value", newValue); + return this._value(); + }, + + _setData: function(key, value) { + + switch (key) { + case 'value': + this.options.value = value; + this._refreshValue(); + this._trigger('change', null, {}); + break; + } + + $.widget.prototype._setData.apply(this, arguments); + + }, + + _value: function() { + + var val = this.options.value; + if (val < this._valueMin()) val = this._valueMin(); + if (val > this._valueMax()) val = this._valueMax(); + + return val; + + }, + + _valueMin: function() { + var valueMin = 0; + return valueMin; + }, + + _valueMax: function() { + var valueMax = 100; + return valueMax; + }, + + _refreshValue: function() { + var value = this.value(); + this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right"); + this.valueDiv.width(value + '%'); + this.element.attr("aria-valuenow", value); + } + +}); + +$.extend($.ui.progressbar, { + version: "1.7.1", + defaults: { + value: 0 + } +}); + +})(jQuery); +/* + * jQuery UI Slider 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * ui.core.js + */ + +(function($) { + +$.widget("ui.slider", $.extend({}, $.ui.mouse, { + + _init: function() { + + var self = this, o = this.options; + this._keySliding = false; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass("ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all"); + + this.range = $([]); + + if (o.range) { + + if (o.range === true) { + this.range = $('
'); + if (!o.values) o.values = [this._valueMin(), this._valueMin()]; + if (o.values.length && o.values.length != 2) { + o.values = [o.values[0], o.values[0]]; + } + } else { + this.range = $('
'); + } + + this.range + .appendTo(this.element) + .addClass("ui-slider-range"); + + if (o.range == "min" || o.range == "max") { + this.range.addClass("ui-slider-range-" + o.range); + } + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + this.range.addClass("ui-widget-header"); + + } + + if ($(".ui-slider-handle", this.element).length == 0) + $('
') + .appendTo(this.element) + .addClass("ui-slider-handle"); + + if (o.values && o.values.length) { + while ($(".ui-slider-handle", this.element).length < o.values.length) + $('') + .appendTo(this.element) + .addClass("ui-slider-handle"); + } + + this.handles = $(".ui-slider-handle", this.element) + .addClass("ui-state-default" + + " ui-corner-all"); + + this.handle = this.handles.eq(0); + + this.handles.add(this.range).filter("a") + .click(function(event) { event.preventDefault(); }) + .hover(function() { $(this).addClass('ui-state-hover'); }, function() { $(this).removeClass('ui-state-hover'); }) + .focus(function() { $(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus'); }) + .blur(function() { $(this).removeClass('ui-state-focus'); }); + + this.handles.each(function(i) { + $(this).data("index.ui-slider-handle", i); + }); + + this.handles.keydown(function(event) { + + var ret = true; + + var index = $(this).data("index.ui-slider-handle"); + + if (self.options.disabled) + return; + + switch (event.keyCode) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if (!self._keySliding) { + self._keySliding = true; + $(this).addClass("ui-state-active"); + self._start(event, index); + } + break; + } + + var curVal, newVal, step = self._step(); + if (self.options.values && self.options.values.length) { + curVal = newVal = self.values(index); + } else { + curVal = newVal = self.value(); + } + + switch (event.keyCode) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if(curVal == self._valueMax()) return; + newVal = curVal + step; + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if(curVal == self._valueMin()) return; + newVal = curVal - step; + break; + } + + self._slide(event, index, newVal); + + return ret; + + }).keyup(function(event) { + + var index = $(this).data("index.ui-slider-handle"); + + if (self._keySliding) { + self._stop(event, index); + self._change(event, index); + self._keySliding = false; + $(this).removeClass("ui-state-active"); + } + + }); + + this._refreshValue(); + + }, + + destroy: function() { + + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass("ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all") + .removeData("slider") + .unbind(".slider"); + + this._mouseDestroy(); + + }, + + _mouseCapture: function(event) { + + var o = this.options; + + if (o.disabled) + return false; + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + var position = { x: event.pageX, y: event.pageY }; + var normValue = this._normValueFromMouse(position); + + var distance = this._valueMax() - this._valueMin() + 1, closestHandle; + var self = this, index; + this.handles.each(function(i) { + var thisDistance = Math.abs(normValue - self.values(i)); + if (distance > thisDistance) { + distance = thisDistance; + closestHandle = $(this); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if(o.range == true && this.values(1) == o.min) { + closestHandle = $(this.handles[++index]); + } + + this._start(event, index); + + self._handleIndex = index; + + closestHandle + .addClass("ui-state-active") + .focus(); + + var offset = closestHandle.offset(); + var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle'); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - (closestHandle.width() / 2), + top: event.pageY - offset.top + - (closestHandle.height() / 2) + - (parseInt(closestHandle.css('borderTopWidth'),10) || 0) + - (parseInt(closestHandle.css('borderBottomWidth'),10) || 0) + + (parseInt(closestHandle.css('marginTop'),10) || 0) + }; + + normValue = this._normValueFromMouse(position); + this._slide(event, index, normValue); + return true; + + }, + + _mouseStart: function(event) { + return true; + }, + + _mouseDrag: function(event) { + + var position = { x: event.pageX, y: event.pageY }; + var normValue = this._normValueFromMouse(position); + + this._slide(event, this._handleIndex, normValue); + + return false; + + }, + + _mouseStop: function(event) { + + this.handles.removeClass("ui-state-active"); + this._stop(event, this._handleIndex); + this._change(event, this._handleIndex); + this._handleIndex = null; + this._clickOffset = null; + + return false; + + }, + + _detectOrientation: function() { + this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal'; + }, + + _normValueFromMouse: function(position) { + + var pixelTotal, pixelMouse; + if ('horizontal' == this.orientation) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0); + } + + var percentMouse = (pixelMouse / pixelTotal); + if (percentMouse > 1) percentMouse = 1; + if (percentMouse < 0) percentMouse = 0; + if ('vertical' == this.orientation) + percentMouse = 1 - percentMouse; + + var valueTotal = this._valueMax() - this._valueMin(), + valueMouse = percentMouse * valueTotal, + valueMouseModStep = valueMouse % this.options.step, + normValue = this._valueMin() + valueMouse - valueMouseModStep; + + if (valueMouseModStep > (this.options.step / 2)) + normValue += this.options.step; + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat(normValue.toFixed(5)); + + }, + + _start: function(event, index) { + var uiHash = { + handle: this.handles[index], + value: this.value() + }; + if (this.options.values && this.options.values.length) { + uiHash.value = this.values(index) + uiHash.values = this.values() + } + this._trigger("start", event, uiHash); + }, + + _slide: function(event, index, newVal) { + + var handle = this.handles[index]; + + if (this.options.values && this.options.values.length) { + + var otherVal = this.values(index ? 0 : 1); + + if ((index == 0 && newVal >= otherVal) || (index == 1 && newVal <= otherVal)) + newVal = otherVal; + + if (newVal != this.values(index)) { + var newValues = this.values(); + newValues[index] = newVal; + // A slide can be canceled by returning false from the slide callback + var allowed = this._trigger("slide", event, { + handle: this.handles[index], + value: newVal, + values: newValues + }); + var otherVal = this.values(index ? 0 : 1); + if (allowed !== false) { + this.values(index, newVal, ( event.type == 'mousedown' && this.options.animate ), true); + } + } + + } else { + + if (newVal != this.value()) { + // A slide can be canceled by returning false from the slide callback + var allowed = this._trigger("slide", event, { + handle: this.handles[index], + value: newVal + }); + if (allowed !== false) { + this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate )); + } + + } + + } + + }, + + _stop: function(event, index) { + var uiHash = { + handle: this.handles[index], + value: this.value() + }; + if (this.options.values && this.options.values.length) { + uiHash.value = this.values(index) + uiHash.values = this.values() + } + this._trigger("stop", event, uiHash); + }, + + _change: function(event, index) { + var uiHash = { + handle: this.handles[index], + value: this.value() + }; + if (this.options.values && this.options.values.length) { + uiHash.value = this.values(index) + uiHash.values = this.values() + } + this._trigger("change", event, uiHash); + }, + + value: function(newValue) { + + if (arguments.length) { + this._setData("value", newValue); + this._change(null, 0); + } + + return this._value(); + + }, + + values: function(index, newValue, animated, noPropagation) { + + if (arguments.length > 1) { + this.options.values[index] = newValue; + this._refreshValue(animated); + if(!noPropagation) this._change(null, index); + } + + if (arguments.length) { + if (this.options.values && this.options.values.length) { + return this._values(index); + } else { + return this.value(); + } + } else { + return this._values(); + } + + }, + + _setData: function(key, value, animated) { + + $.widget.prototype._setData.apply(this, arguments); + + switch (key) { + case 'orientation': + + this._detectOrientation(); + + this.element + .removeClass("ui-slider-horizontal ui-slider-vertical") + .addClass("ui-slider-" + this.orientation); + this._refreshValue(animated); + break; + case 'value': + this._refreshValue(animated); + break; + } + + }, + + _step: function() { + var step = this.options.step; + return step; + }, + + _value: function() { + + var val = this.options.value; + if (val < this._valueMin()) val = this._valueMin(); + if (val > this._valueMax()) val = this._valueMax(); + + return val; + + }, + + _values: function(index) { + + if (arguments.length) { + var val = this.options.values[index]; + if (val < this._valueMin()) val = this._valueMin(); + if (val > this._valueMax()) val = this._valueMax(); + + return val; + } else { + return this.options.values; + } + + }, + + _valueMin: function() { + var valueMin = this.options.min; + return valueMin; + }, + + _valueMax: function() { + var valueMax = this.options.max; + return valueMax; + }, + + _refreshValue: function(animate) { + + var oRange = this.options.range, o = this.options, self = this; + + if (this.options.values && this.options.values.length) { + var vp0, vp1; + this.handles.each(function(i, j) { + var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100; + var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%'; + $(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate); + if (self.options.range === true) { + if (self.orientation == 'horizontal') { + (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate); + (i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate }); + } else { + (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate); + (i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate }); + } + } + lastValPercent = valPercent; + }); + } else { + var value = this.value(), + valueMin = this._valueMin(), + valueMax = this._valueMax(), + valPercent = valueMax != valueMin + ? (value - valueMin) / (valueMax - valueMin) * 100 + : 0; + var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%'; + this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate); + + (oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate); + (oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate }); + (oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate); + (oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate }); + } + + } + +})); + +$.extend($.ui.slider, { + getter: "value values", + version: "1.7.1", + eventPrefix: "slide", + defaults: { + animate: false, + delay: 0, + distance: 0, + max: 100, + min: 0, + orientation: 'horizontal', + range: false, + step: 1, + value: 0, + values: null + } +}); + +})(jQuery); +/* + * jQuery UI Tabs 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.tabs", { + + _init: function() { + if (this.options.deselectable !== undefined) { + this.options.collapsible = this.options.deselectable; + } + this._tabify(true); + }, + + _setData: function(key, value) { + if (key == 'selected') { + if (this.options.collapsible && value == this.options.selected) { + return; + } + this.select(value); + } + else { + this.options[key] = value; + if (key == 'deselectable') { + this.options.collapsible = value; + } + this._tabify(); + } + }, + + _tabId: function(a) { + return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') || + this.options.idPrefix + $.data(a); + }, + + _sanitizeSelector: function(hash) { + return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":" + }, + + _cookie: function() { + var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0])); + return $.cookie.apply(null, [cookie].concat($.makeArray(arguments))); + }, + + _ui: function(tab, panel) { + return { + tab: tab, + panel: panel, + index: this.anchors.index(tab) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter('.ui-state-processing').removeClass('ui-state-processing') + .find('span:data(label.tabs)') + .each(function() { + var el = $(this); + el.html(el.data('label.tabs')).removeData('label.tabs'); + }); + }, + + _tabify: function(init) { + + this.list = this.element.children('ul:first'); + this.lis = $('li:has(a[href])', this.list); + this.anchors = this.lis.map(function() { return $('a', this)[0]; }); + this.panels = $([]); + + var self = this, o = this.options; + + var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + this.anchors.each(function(i, a) { + var href = $(a).attr('href'); + + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split('#')[0], baseEl; + if (hrefBase && (hrefBase === location.toString().split('#')[0] || + (baseEl = $('base')[0]) && hrefBase === baseEl.href)) { + href = a.hash; + a.href = href; + } + + // inline tab + if (fragmentId.test(href)) { + self.panels = self.panels.add(self._sanitizeSelector(href)); + } + + // remote tab + else if (href != '#') { // prevent loading the page itself if href is just "#" + $.data(a, 'href.tabs', href); // required for restore on destroy + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data + + var id = self._tabId(a); + a.href = '#' + id; + var $panel = $('#' + id); + if (!$panel.length) { + $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom') + .insertAfter(self.panels[i - 1] || self.list); + $panel.data('destroy.tabs', true); + } + self.panels = self.panels.add($panel); + } + + // invalid tab href + else { + o.disabled.push(i); + } + }); + + // initialization from scratch + if (init) { + + // attach necessary classes for styling + this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all'); + this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); + this.lis.addClass('ui-state-default ui-corner-top'); + this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom'); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
  • + if (o.selected === undefined) { + if (location.hash) { + this.anchors.each(function(i, a) { + if (a.hash == location.hash) { + o.selected = i; + return false; // break + } + }); + } + if (typeof o.selected != 'number' && o.cookie) { + o.selected = parseInt(self._cookie(), 10); + } + if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) { + o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected')); + } + o.selected = o.selected || 0; + } + else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique(o.disabled.concat( + $.map(this.lis.filter('.ui-state-disabled'), + function(n, i) { return self.lis.index(n); } ) + )).sort(); + + if ($.inArray(o.selected, o.disabled) != -1) { + o.disabled.splice($.inArray(o.selected, o.disabled), 1); + } + + // highlight selected tab + this.panels.addClass('ui-tabs-hide'); + this.lis.removeClass('ui-tabs-selected ui-state-active'); + if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list + this.panels.eq(o.selected).removeClass('ui-tabs-hide'); + this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active'); + + // seems to be expected behavior that the show callback is fired + self.element.queue("tabs", function() { + self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected])); + }); + + this.load(o.selected); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + $(window).bind('unload', function() { + self.lis.add(self.anchors).unbind('.tabs'); + self.lis = self.anchors = self.panels = null; + }); + + } + // update selected after add/remove + else { + o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected')); + } + + // update collapsible + this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible'); + + // set or update cookie after init and add/remove respectively + if (o.cookie) { + this._cookie(o.selected, o.cookie); + } + + // disable tabs + for (var i = 0, li; (li = this.lis[i]); i++) { + $(li)[$.inArray(i, o.disabled) != -1 && + !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled'); + } + + // reset cache if switching from cached to not cached + if (o.cache === false) { + this.anchors.removeData('cache.tabs'); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add(this.anchors).unbind('.tabs'); + + if (o.event != 'mouseover') { + var addState = function(state, el) { + if (el.is(':not(.ui-state-disabled)')) { + el.addClass('ui-state-' + state); + } + }; + var removeState = function(state, el) { + el.removeClass('ui-state-' + state); + }; + this.lis.bind('mouseover.tabs', function() { + addState('hover', $(this)); + }); + this.lis.bind('mouseout.tabs', function() { + removeState('hover', $(this)); + }); + this.anchors.bind('focus.tabs', function() { + addState('focus', $(this).closest('li')); + }); + this.anchors.bind('blur.tabs', function() { + removeState('focus', $(this).closest('li')); + }); + } + + // set up animations + var hideFx, showFx; + if (o.fx) { + if ($.isArray(o.fx)) { + hideFx = o.fx[0]; + showFx = o.fx[1]; + } + else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle($el, fx) { + $el.css({ display: '' }); + if ($.browser.msie && fx.opacity) { + $el[0].style.removeAttribute('filter'); + } + } + + // Show a tab... + var showTab = showFx ? + function(clicked, $show) { + $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active'); + $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way + .animate(showFx, showFx.duration || 'normal', function() { + resetStyle($show, showFx); + self._trigger('show', null, self._ui(clicked, $show[0])); + }); + } : + function(clicked, $show) { + $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active'); + $show.removeClass('ui-tabs-hide'); + self._trigger('show', null, self._ui(clicked, $show[0])); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx ? + function(clicked, $hide) { + $hide.animate(hideFx, hideFx.duration || 'normal', function() { + self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default'); + $hide.addClass('ui-tabs-hide'); + resetStyle($hide, hideFx); + self.element.dequeue("tabs"); + }); + } : + function(clicked, $hide, $show) { + self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default'); + $hide.addClass('ui-tabs-hide'); + self.element.dequeue("tabs"); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind(o.event + '.tabs', function() { + var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'), + $show = $(self._sanitizeSelector(this.hash)); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if (($li.hasClass('ui-tabs-selected') && !o.collapsible) || + $li.hasClass('ui-state-disabled') || + $li.hasClass('ui-state-processing') || + self._trigger('select', null, self._ui(this, $show[0])) === false) { + this.blur(); + return false; + } + + o.selected = self.anchors.index(this); + + self.abort(); + + // if tab may be closed + if (o.collapsible) { + if ($li.hasClass('ui-tabs-selected')) { + o.selected = -1; + + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + self.element.queue("tabs", function() { + hideTab(el, $hide); + }).dequeue("tabs"); + + this.blur(); + return false; + } + else if (!$hide.length) { + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + self.element.queue("tabs", function() { + showTab(el, $show); + }); + + self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + + this.blur(); + return false; + } + } + + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + // show new tab + if ($show.length) { + if ($hide.length) { + self.element.queue("tabs", function() { + hideTab(el, $hide); + }); + } + self.element.queue("tabs", function() { + showTab(el, $show); + }); + + self.load(self.anchors.index(this)); + } + else { + throw 'jQuery UI Tabs: Mismatching fragment identifier.'; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ($.browser.msie) { + this.blur(); + } + + }); + + // disable click in any case + this.anchors.bind('click.tabs', function(){return false;}); + + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element.unbind('.tabs') + .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible') + .removeData('tabs'); + + this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); + + this.anchors.each(function() { + var href = $.data(this, 'href.tabs'); + if (href) { + this.href = href; + } + var $this = $(this).unbind('.tabs'); + $.each(['href', 'load', 'cache'], function(i, prefix) { + $this.removeData(prefix + '.tabs'); + }); + }); + + this.lis.unbind('.tabs').add(this.panels).each(function() { + if ($.data(this, 'destroy.tabs')) { + $(this).remove(); + } + else { + $(this).removeClass([ + 'ui-state-default', + 'ui-corner-top', + 'ui-tabs-selected', + 'ui-state-active', + 'ui-state-hover', + 'ui-state-focus', + 'ui-state-disabled', + 'ui-tabs-panel', + 'ui-widget-content', + 'ui-corner-bottom', + 'ui-tabs-hide' + ].join(' ')); + } + }); + + if (o.cookie) { + this._cookie(null, o.cookie); + } + }, + + add: function(url, label, index) { + if (index === undefined) { + index = this.anchors.length; // append by default + } + + var self = this, o = this.options, + $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)), + id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]); + + $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true); + + // try to find an existing element before creating a new one + var $panel = $('#' + id); + if (!$panel.length) { + $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true); + } + $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide'); + + if (index >= this.lis.length) { + $li.appendTo(this.list); + $panel.appendTo(this.list[0].parentNode); + } + else { + $li.insertBefore(this.lis[index]); + $panel.insertBefore(this.panels[index]); + } + + o.disabled = $.map(o.disabled, + function(n, i) { return n >= index ? ++n : n; }); + + this._tabify(); + + if (this.anchors.length == 1) { // after tabify + $li.addClass('ui-tabs-selected ui-state-active'); + $panel.removeClass('ui-tabs-hide'); + this.element.queue("tabs", function() { + self._trigger('show', null, self._ui(self.anchors[0], self.panels[0])); + }); + + this.load(0); + } + + // callback + this._trigger('add', null, this._ui(this.anchors[index], this.panels[index])); + }, + + remove: function(index) { + var o = this.options, $li = this.lis.eq(index).remove(), + $panel = this.panels.eq(index).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) { + this.select(index + (index + 1 < this.anchors.length ? 1 : -1)); + } + + o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }), + function(n, i) { return n >= index ? --n : n; }); + + this._tabify(); + + // callback + this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0])); + }, + + enable: function(index) { + var o = this.options; + if ($.inArray(index, o.disabled) == -1) { + return; + } + + this.lis.eq(index).removeClass('ui-state-disabled'); + o.disabled = $.grep(o.disabled, function(n, i) { return n != index; }); + + // callback + this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index])); + }, + + disable: function(index) { + var self = this, o = this.options; + if (index != o.selected) { // cannot disable already selected tab + this.lis.eq(index).addClass('ui-state-disabled'); + + o.disabled.push(index); + o.disabled.sort(); + + // callback + this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index])); + } + }, + + select: function(index) { + if (typeof index == 'string') { + index = this.anchors.index(this.anchors.filter('[href$=' + index + ']')); + } + else if (index === null) { // usage of null is deprecated, TODO remove in next release + index = -1; + } + if (index == -1 && this.options.collapsible) { + index = this.options.selected; + } + + this.anchors.eq(index).trigger(this.options.event + '.tabs'); + }, + + load: function(index) { + var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs'); + + this.abort(); + + // not remote or from cache + if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) { + this.element.dequeue("tabs"); + return; + } + + // load remote from here on + this.lis.eq(index).addClass('ui-state-processing'); + + if (o.spinner) { + var span = $('span', a); + span.data('label.tabs', span.html()).html(o.spinner); + } + + this.xhr = $.ajax($.extend({}, o.ajaxOptions, { + url: url, + success: function(r, s) { + $(self._sanitizeSelector(a.hash)).html(r); + + // take care of tab labels + self._cleanup(); + + if (o.cache) { + $.data(a, 'cache.tabs', true); // if loaded once do not load them again + } + + // callbacks + self._trigger('load', null, self._ui(self.anchors[index], self.panels[index])); + try { + o.ajaxOptions.success(r, s); + } + catch (e) {} + + // last, so that load event is fired before show... + self.element.dequeue("tabs"); + } + })); + }, + + abort: function() { + // stop possibly running animations + this.element.queue([]); + this.panels.stop(false, true); + + // terminate pending requests from other tabs + if (this.xhr) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + + }, + + url: function(index, url) { + this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url); + }, + + length: function() { + return this.anchors.length; + } + +}); + +$.extend($.ui.tabs, { + version: '1.7.1', + getter: 'length', + defaults: { + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disabled: [], + event: 'click', + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: 'ui-tabs-', + panelTemplate: '
    ', + spinner: 'Loading…', + tabTemplate: '
  • #{label}
  • ' + } +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend($.ui.tabs.prototype, { + rotation: null, + rotate: function(ms, continuing) { + + var self = this, o = this.options; + + var rotate = self._rotate || (self._rotate = function(e) { + clearTimeout(self.rotation); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms); + + if (e) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || (self._unrotate = !continuing ? + function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } : + function(e) { + t = o.selected; + rotate(); + }); + + // start rotation + if (ms) { + this.element.bind('tabsshow', rotate); + this.anchors.bind(o.event + '.tabs', stop); + rotate(); + } + // stop rotation + else { + clearTimeout(self.rotation); + this.element.unbind('tabsshow', rotate); + this.anchors.unbind(o.event + '.tabs', stop); + delete this._rotate; + delete this._unrotate; + } + } +}); + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.accordion.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.accordion.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.accordion.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.accordion.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,291 +1,477 @@ -/* - * jQuery UI Accordion @VERSION - * - * Copyright (c) 2007, 2008 Jörn Zaefferer - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Accordion - * - * Depends: - * ui.core.js - */ -(function($) { - -$.widget("ui.accordion", { - _init: function() { - var options = this.options; - - if ( options.navigation ) { - var current = this.element.find("a").filter(options.navigationFilter); - if ( current.length ) { - if ( current.filter(options.header).length ) { - options.active = current; - } else { - options.active = current.parent().parent().prev(); - current.addClass("current"); - } - } - } - - // calculate active if not specified, using the first header - options.headers = this.element.find(options.header); - options.active = findActive(options.headers, options.active); - - // IE7-/Win - Extra vertical space in Lists fixed - if ($.browser.msie) { - this.element.find('a').css('zoom', '1'); - } - - if (!this.element.hasClass("ui-accordion")) { - this.element.addClass("ui-accordion"); - $('').insertBefore(options.headers); - $('').appendTo(options.headers); - options.headers.addClass("ui-accordion-header").attr("tabindex", "0"); - } - - var maxHeight; - if ( options.fillSpace ) { - maxHeight = this.element.parent().height(); - options.headers.each(function() { - maxHeight -= $(this).outerHeight(); - }); - var maxPadding = 0; - options.headers.next().each(function() { - maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height()); - }).height(maxHeight - maxPadding); - } else if ( options.autoHeight ) { - maxHeight = 0; - options.headers.next().each(function() { - maxHeight = Math.max(maxHeight, $(this).outerHeight()); - }).height(maxHeight); - } - - options.headers - .not(options.active || "") - .next() - .hide(); - options.active.parent().andSelf().addClass(options.selectedClass); - - if (options.event) { - this.element.bind((options.event) + ".accordion", clickHandler); - } - }, - activate: function(index) { - // call clickHandler with custom event - clickHandler.call(this.element[0], { - target: findActive( this.options.headers, index )[0] - }); - }, - destroy: function() { - this.options.headers.next().css("display", ""); - if ( this.options.fillSpace || this.options.autoHeight ) { - this.options.headers.next().css("height", ""); - } - $.removeData(this.element[0], "accordion"); - this.element.removeClass("ui-accordion").unbind(".accordion"); - } -}); - -function scopeCallback(callback, scope) { - return function() { - return callback.apply(scope, arguments); - }; -}; - -function completed(cancel) { - // if removed while animated data can be empty - if (!$.data(this, "accordion")) { - return; - } - - var instance = $.data(this, "accordion"); - var options = instance.options; - options.running = cancel ? 0 : --options.running; - if ( options.running ) { - return; - } - if ( options.clearStyle ) { - options.toShow.add(options.toHide).css({ - height: "", - overflow: "" - }); - } - instance._trigger('change', null, options.data); -} - -function toggle(toShow, toHide, data, clickedActive, down) { - var options = $.data(this, "accordion").options; - options.toShow = toShow; - options.toHide = toHide; - options.data = data; - var complete = scopeCallback(completed, this); - - $.data(this, "accordion")._trigger("changestart", null, options.data); - - // count elements to animate - options.running = toHide.size() === 0 ? toShow.size() : toHide.size(); - - if ( options.animated ) { - if ( !options.alwaysOpen && clickedActive ) { - $.ui.accordion.animations[options.animated]({ - toShow: jQuery([]), - toHide: toHide, - complete: complete, - down: down, - autoHeight: options.autoHeight - }); - } else { - $.ui.accordion.animations[options.animated]({ - toShow: toShow, - toHide: toHide, - complete: complete, - down: down, - autoHeight: options.autoHeight - }); - } - } else { - if ( !options.alwaysOpen && clickedActive ) { - toShow.toggle(); - } else { - toHide.hide(); - toShow.show(); - } - complete(true); - } -} - -function clickHandler(event) { - var options = $.data(this, "accordion").options; - if (options.disabled) { - return false; - } - - // called only when using activate(false) to close all parts programmatically - if ( !event.target && !options.alwaysOpen ) { - options.active.parent().andSelf().toggleClass(options.selectedClass); - var toHide = options.active.next(), - data = { - options: options, - newHeader: jQuery([]), - oldHeader: options.active, - newContent: jQuery([]), - oldContent: toHide - }, - toShow = (options.active = $([])); - toggle.call(this, toShow, toHide, data ); - return false; - } - // get the click target - var clicked = $(event.target); - - // due to the event delegation model, we have to check if one - // of the parent elements is our actual header, and find that - // otherwise stick with the initial target - clicked = $( clicked.parents(options.header)[0] || clicked ); - - var clickedActive = clicked[0] == options.active[0]; - - // if animations are still active, or the active header is the target, ignore click - if (options.running || (options.alwaysOpen && clickedActive)) { - return false; - } - if (!clicked.is(options.header)) { - return; - } - - // switch classes - options.active.parent().andSelf().toggleClass(options.selectedClass); - if ( !clickedActive ) { - clicked.parent().andSelf().addClass(options.selectedClass); - } - - // find elements to show and hide - var toShow = clicked.next(), - toHide = options.active.next(), - data = { - options: options, - newHeader: clickedActive && !options.alwaysOpen ? $([]) : clicked, - oldHeader: options.active, - newContent: clickedActive && !options.alwaysOpen ? $([]) : toShow, - oldContent: toHide - }, - down = options.headers.index( options.active[0] ) > options.headers.index( clicked[0] ); - - options.active = clickedActive ? $([]) : clicked; - toggle.call(this, toShow, toHide, data, clickedActive, down ); - - return false; -}; - -function findActive(headers, selector) { - return selector - ? typeof selector == "number" - ? headers.filter(":eq(" + selector + ")") - : headers.not(headers.not(selector)) - : selector === false - ? $([]) - : headers.filter(":eq(0)"); -} - -$.extend($.ui.accordion, { - defaults: { - selectedClass: "selected", - alwaysOpen: true, - animated: 'slide', - event: "click", - header: "a", - autoHeight: true, - running: 0, - navigationFilter: function() { - return this.href.toLowerCase() == location.href.toLowerCase(); - } - }, - animations: { - slide: function(options, additions) { - options = $.extend({ - easing: "swing", - duration: 300 - }, options, additions); - if ( !options.toHide.size() ) { - options.toShow.animate({height: "show"}, options); - return; - } - var hideHeight = options.toHide.height(), - showHeight = options.toShow.height(), - difference = showHeight / hideHeight; - options.toShow.css({ height: 0, overflow: 'hidden' }).show(); - options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate({height:"hide"},{ - step: function(now) { - var current = (hideHeight - now) * difference; - if ($.browser.msie || $.browser.opera) { - current = Math.ceil(current); - } - options.toShow.height( current ); - }, - duration: options.duration, - easing: options.easing, - complete: function() { - if ( !options.autoHeight ) { - options.toShow.css("height", "auto"); - } - options.complete(); - } - }); - }, - bounceslide: function(options) { - this.slide(options, { - easing: options.down ? "bounceout" : "swing", - duration: options.down ? 1000 : 200 - }); - }, - easeslide: function(options) { - this.slide(options, { - easing: "easeinout", - duration: 700 - }); - } - } -}); - -})(jQuery); +/* + * jQuery UI Accordion 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.accordion", { + + _init: function() { + + var o = this.options, self = this; + this.running = 0; + + // if the user set the alwaysOpen option on init + // then we need to set the collapsible option + // if they set both on init, collapsible will take priority + if (o.collapsible == $.ui.accordion.defaults.collapsible && + o.alwaysOpen != $.ui.accordion.defaults.alwaysOpen) { + o.collapsible = !o.alwaysOpen; + } + + if ( o.navigation ) { + var current = this.element.find("a").filter(o.navigationFilter); + if ( current.length ) { + if ( current.filter(o.header).length ) { + this.active = current; + } else { + this.active = current.parent().parent().prev(); + current.addClass("ui-accordion-content-active"); + } + } + } + + this.element.addClass("ui-accordion ui-widget ui-helper-reset"); + + // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix + if (this.element[0].nodeName == "UL") { + this.element.children("li").addClass("ui-accordion-li-fix"); + } + + this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all") + .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); }) + .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); }) + .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); }) + .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); }); + + this.headers + .next() + .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); + + this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top"); + this.active.next().addClass('ui-accordion-content-active'); + + //Append icon elements + $("").addClass("ui-icon " + o.icons.header).prependTo(this.headers); + this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected); + + // IE7-/Win - Extra vertical space in lists fixed + if ($.browser.msie) { + this.element.find('a').css('zoom', '1'); + } + + this.resize(); + + //ARIA + this.element.attr('role','tablist'); + + this.headers + .attr('role','tab') + .bind('keydown', function(event) { return self._keydown(event); }) + .next() + .attr('role','tabpanel'); + + this.headers + .not(this.active || "") + .attr('aria-expanded','false') + .attr("tabIndex", "-1") + .next() + .hide(); + + // make sure at least one header is in the tab order + if (!this.active.length) { + this.headers.eq(0).attr('tabIndex','0'); + } else { + this.active + .attr('aria-expanded','true') + .attr('tabIndex', '0'); + } + + // only need links in taborder for Safari + if (!$.browser.safari) + this.headers.find('a').attr('tabIndex','-1'); + + if (o.event) { + this.headers.bind((o.event) + ".accordion", function(event) { return self._clickHandler.call(self, event, this); }); + } + + }, + + destroy: function() { + var o = this.options; + + this.element + .removeClass("ui-accordion ui-widget ui-helper-reset") + .removeAttr("role") + .unbind('.accordion') + .removeData('accordion'); + + this.headers + .unbind(".accordion") + .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top") + .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex"); + + this.headers.find("a").removeAttr("tabindex"); + this.headers.children(".ui-icon").remove(); + var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active"); + if (o.autoHeight || o.fillHeight) { + contents.css("height", ""); + } + }, + + _setData: function(key, value) { + if(key == 'alwaysOpen') { key = 'collapsible'; value = !value; } + $.widget.prototype._setData.apply(this, arguments); + }, + + _keydown: function(event) { + + var o = this.options, keyCode = $.ui.keyCode; + + if (o.disabled || event.altKey || event.ctrlKey) + return; + + var length = this.headers.length; + var currentIndex = this.headers.index(event.target); + var toFocus = false; + + switch(event.keyCode) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[(currentIndex + 1) % length]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[(currentIndex - 1 + length) % length]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + return this._clickHandler({ target: event.target }, event.target); + } + + if (toFocus) { + $(event.target).attr('tabIndex','-1'); + $(toFocus).attr('tabIndex','0'); + toFocus.focus(); + return false; + } + + return true; + + }, + + resize: function() { + + var o = this.options, maxHeight; + + if (o.fillSpace) { + + if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); } + maxHeight = this.element.parent().height(); + if($.browser.msie) { this.element.parent().css('overflow', defOverflow); } + + this.headers.each(function() { + maxHeight -= $(this).outerHeight(); + }); + + var maxPadding = 0; + this.headers.next().each(function() { + maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height()); + }).height(Math.max(0, maxHeight - maxPadding)) + .css('overflow', 'auto'); + + } else if ( o.autoHeight ) { + maxHeight = 0; + this.headers.next().each(function() { + maxHeight = Math.max(maxHeight, $(this).outerHeight()); + }).height(maxHeight); + } + + }, + + activate: function(index) { + // call clickHandler with custom event + var active = this._findActive(index)[0]; + this._clickHandler({ target: active }, active); + }, + + _findActive: function(selector) { + return selector + ? typeof selector == "number" + ? this.headers.filter(":eq(" + selector + ")") + : this.headers.not(this.headers.not(selector)) + : selector === false + ? $([]) + : this.headers.filter(":eq(0)"); + }, + + _clickHandler: function(event, target) { + + var o = this.options; + if (o.disabled) return false; + + // called only when using activate(false) to close all parts programmatically + if (!event.target && o.collapsible) { + this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all") + .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header); + this.active.next().addClass('ui-accordion-content-active'); + var toHide = this.active.next(), + data = { + options: o, + newHeader: $([]), + oldHeader: o.active, + newContent: $([]), + oldContent: toHide + }, + toShow = (this.active = $([])); + this._toggle(toShow, toHide, data); + return false; + } + + // get the click target + var clicked = $(event.currentTarget || target); + var clickedIsActive = clicked[0] == this.active[0]; + + // if animations are still active, or the active header is the target, ignore click + if (this.running || (!o.collapsible && clickedIsActive)) { + return false; + } + + // switch classes + this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all") + .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header); + this.active.next().addClass('ui-accordion-content-active'); + if (!clickedIsActive) { + clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top") + .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected); + clicked.next().addClass('ui-accordion-content-active'); + } + + // find elements to show and hide + var toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: o, + newHeader: clickedIsActive && o.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && o.collapsible ? $([]) : toShow.find('> *'), + oldContent: toHide.find('> *') + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + this.active = clickedIsActive ? $([]) : clicked; + this._toggle(toShow, toHide, data, clickedIsActive, down); + + return false; + + }, + + _toggle: function(toShow, toHide, data, clickedIsActive, down) { + + var o = this.options, self = this; + + this.toShow = toShow; + this.toHide = toHide; + this.data = data; + + var complete = function() { if(!self) return; return self._completed.apply(self, arguments); }; + + // trigger changestart event + this._trigger("changestart", null, this.data); + + // count elements to animate + this.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if (o.animated) { + + var animOptions = {}; + + if ( o.collapsible && clickedIsActive ) { + animOptions = { + toShow: $([]), + toHide: toHide, + complete: complete, + down: down, + autoHeight: o.autoHeight || o.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: o.autoHeight || o.fillSpace + }; + } + + if (!o.proxied) { + o.proxied = o.animated; + } + + if (!o.proxiedDuration) { + o.proxiedDuration = o.duration; + } + + o.animated = $.isFunction(o.proxied) ? + o.proxied(animOptions) : o.proxied; + + o.duration = $.isFunction(o.proxiedDuration) ? + o.proxiedDuration(animOptions) : o.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = o.duration, + easing = o.animated; + + if (!animations[easing]) { + animations[easing] = function(options) { + this.slide(options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[easing](animOptions); + + } else { + + if (o.collapsible && clickedIsActive) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete(true); + + } + + toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur(); + toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus(); + + }, + + _completed: function(cancel) { + + var o = this.options; + + this.running = cancel ? 0 : --this.running; + if (this.running) return; + + if (o.clearStyle) { + this.toShow.add(this.toHide).css({ + height: "", + overflow: "" + }); + } + + this._trigger('change', null, this.data); + } + +}); + + +$.extend($.ui.accordion, { + version: "1.7.1", + defaults: { + active: null, + alwaysOpen: true, //deprecated, use collapsible + animated: 'slide', + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() == location.href.toLowerCase(); + } + }, + animations: { + slide: function(options, additions) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions); + if ( !options.toHide.size() ) { + options.toShow.animate({height: "show"}, options); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({height: "hide"}, options); + return; + } + var overflow = options.toShow.css('overflow'), + percentDone, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) ); + + $.each(fxAttrs, function(i, prop) { + hideProps[prop] = 'hide'; + + var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/); + showProps[prop] = { + value: parts[1], + unit: parts[2] || 'px' + }; + }); + options.toShow.css({ height: 0, overflow: 'hidden' }).show(); + options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{ + step: function(now, settings) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if (settings.prop == 'height') { + percentDone = (settings.now - settings.start) / (settings.end - settings.start); + } + + options.toShow[0].style[settings.prop] = + (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css("height", ""); + } + options.toShow.css("width", originalWidth); + options.toShow.css({overflow: overflow}); + options.complete(); + } + }); + }, + bounceslide: function(options) { + this.slide(options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + }, + easeslide: function(options) { + this.slide(options, { + easing: "easeinout", + duration: 700 + }); + } + } +}); + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.core.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.core.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.core.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.core.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,435 +1,519 @@ -/* - * jQuery UI @VERSION - * - * Copyright (c) 2008 Paul Bakaus (ui.jquery.com) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI - */ -;(function($) { - -/** jQuery core modifications and additions **/ - -var _remove = $.fn.remove; -$.fn.remove = function() { - $("*", this).add(this).triggerHandler("remove"); - return _remove.apply(this, arguments ); -}; - -function isVisible(element) { - function checkStyles(element) { - var style = element.style; - return (style.display != 'none' && style.visibility != 'hidden'); - } - - var visible = checkStyles(element); - - (visible && $.each($.dir(element, 'parentNode'), function() { - return (visible = checkStyles(this)); - })); - - return visible; -} - -$.extend($.expr[':'], { - data: function(a, i, m) { - return $.data(a, m[3]); - }, - - // TODO: add support for object, area - tabbable: function(a, i, m) { - var nodeName = a.nodeName.toLowerCase(); - - return ( - // in tab order - a.tabIndex >= 0 && - - ( // filter node types that participate in the tab order - - // anchor tag - ('a' == nodeName && a.href) || - - // enabled form element - (/input|select|textarea|button/.test(nodeName) && - 'hidden' != a.type && !a.disabled) - ) && - - // visible on page - isVisible(a) - ); - } -}); - -$.keyCode = { - BACKSPACE: 8, - CAPS_LOCK: 20, - COMMA: 188, - CONTROL: 17, - DELETE: 46, - DOWN: 40, - END: 35, - ENTER: 13, - ESCAPE: 27, - HOME: 36, - INSERT: 45, - LEFT: 37, - NUMPAD_ADD: 107, - NUMPAD_DECIMAL: 110, - NUMPAD_DIVIDE: 111, - NUMPAD_ENTER: 108, - NUMPAD_MULTIPLY: 106, - NUMPAD_SUBTRACT: 109, - PAGE_DOWN: 34, - PAGE_UP: 33, - PERIOD: 190, - RIGHT: 39, - SHIFT: 16, - SPACE: 32, - TAB: 9, - UP: 38 -}; - -// $.widget is a factory to create jQuery plugins -// taking some boilerplate code out of the plugin code -// created by Scott González and Jörn Zaefferer -function getter(namespace, plugin, method, args) { - function getMethods(type) { - var methods = $[namespace][plugin][type] || []; - return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods); - } - - var methods = getMethods('getter'); - if (args.length == 1 && typeof args[0] == 'string') { - methods = methods.concat(getMethods('getterSetter')); - } - return ($.inArray(method, methods) != -1); -} - -$.widget = function(name, prototype) { - var namespace = name.split(".")[0]; - name = name.split(".")[1]; - - // create plugin method - $.fn[name] = function(options) { - var isMethodCall = (typeof options == 'string'), - args = Array.prototype.slice.call(arguments, 1); - - // prevent calls to internal methods - if (isMethodCall && options.substring(0, 1) == '_') { - return this; - } - - // handle getter methods - if (isMethodCall && getter(namespace, name, options, args)) { - var instance = $.data(this[0], name); - return (instance ? instance[options].apply(instance, args) - : undefined); - } - - // handle initialization and non-getter methods - return this.each(function() { - var instance = $.data(this, name); - - // constructor - (!instance && !isMethodCall && - $.data(this, name, new $[namespace][name](this, options))); - - // method call - (instance && isMethodCall && $.isFunction(instance[options]) && - instance[options].apply(instance, args)); - }); - }; - - // create widget constructor - $[namespace][name] = function(element, options) { - var self = this; - - this.widgetName = name; - this.widgetEventPrefix = $[namespace][name].eventPrefix || name; - this.widgetBaseClass = namespace + '-' + name; - - this.options = $.extend({}, - $.widget.defaults, - $[namespace][name].defaults, - $.metadata && $.metadata.get(element)[name], - options); - - this.element = $(element) - .bind('setData.' + name, function(e, key, value) { - return self._setData(key, value); - }) - .bind('getData.' + name, function(e, key) { - return self._getData(key); - }) - .bind('remove', function() { - return self.destroy(); - }); - - this._init(); - }; - - // add widget prototype - $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype); - - // TODO: merge getter and getterSetter properties from widget prototype - // and plugin prototype - $[namespace][name].getterSetter = 'option'; -}; - -$.widget.prototype = { - _init: function() {}, - destroy: function() { - this.element.removeData(this.widgetName); - }, - - option: function(key, value) { - var options = key, - self = this; - - if (typeof key == "string") { - if (value === undefined) { - return this._getData(key); - } - options = {}; - options[key] = value; - } - - $.each(options, function(key, value) { - self._setData(key, value); - }); - }, - _getData: function(key) { - return this.options[key]; - }, - _setData: function(key, value) { - this.options[key] = value; - - if (key == 'disabled') { - this.element[value ? 'addClass' : 'removeClass']( - this.widgetBaseClass + '-disabled'); - } - }, - - enable: function() { - this._setData('disabled', false); - }, - disable: function() { - this._setData('disabled', true); - }, - - _trigger: function(type, e, data) { - var eventName = (type == this.widgetEventPrefix - ? type : this.widgetEventPrefix + type); - e = e || $.event.fix({ type: eventName, target: this.element[0] }); - return this.element.triggerHandler(eventName, [e, data], this.options[type]); - } -}; - -$.widget.defaults = { - disabled: false -}; - - -/** jQuery UI core **/ - -$.ui = { - plugin: { - add: function(module, option, set) { - var proto = $.ui[module].prototype; - for(var i in set) { - proto.plugins[i] = proto.plugins[i] || []; - proto.plugins[i].push([option, set[i]]); - } - }, - call: function(instance, name, args) { - var set = instance.plugins[name]; - if(!set) { return; } - - for (var i = 0; i < set.length; i++) { - if (instance.options[set[i][0]]) { - set[i][1].apply(instance.element, args); - } - } - } - }, - cssCache: {}, - css: function(name) { - if ($.ui.cssCache[name]) { return $.ui.cssCache[name]; } - var tmp = $('
    ').addClass(name).css({position:'absolute', top:'-5000px', left:'-5000px', display:'block'}).appendTo('body'); - - //if (!$.browser.safari) - //tmp.appendTo('body'); - - //Opera and Safari set width and height to 0px instead of auto - //Safari returns rgba(0,0,0,0) when bgcolor is not set - $.ui.cssCache[name] = !!( - (!(/auto|default/).test(tmp.css('cursor')) || (/^[1-9]/).test(tmp.css('height')) || (/^[1-9]/).test(tmp.css('width')) || - !(/none/).test(tmp.css('backgroundImage')) || !(/transparent|rgba\(0, 0, 0, 0\)/).test(tmp.css('backgroundColor'))) - ); - try { $('body').get(0).removeChild(tmp.get(0)); } catch(e){} - return $.ui.cssCache[name]; - }, - disableSelection: function(el) { - return $(el) - .attr('unselectable', 'on') - .css('MozUserSelect', 'none') - .bind('selectstart.ui', function() { return false; }); - }, - enableSelection: function(el) { - return $(el) - .attr('unselectable', 'off') - .css('MozUserSelect', '') - .unbind('selectstart.ui'); - }, - hasScroll: function(e, a) { - - //If overflow is hidden, the element might have extra content, but the user wants to hide it - if ($(e).css('overflow') == 'hidden') { return false; } - - var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop', - has = false; - - if (e[scroll] > 0) { return true; } - - // TODO: determine which cases actually cause this to happen - // if the element doesn't have the scroll set, see if it's possible to - // set the scroll - e[scroll] = 1; - has = (e[scroll] > 0); - e[scroll] = 0; - return has; - } -}; - - -/** Mouse Interaction Plugin **/ - -$.ui.mouse = { - _mouseInit: function() { - var self = this; - - this.element.bind('mousedown.'+this.widgetName, function(e) { - return self._mouseDown(e); - }); - - // Prevent text selection in IE - if ($.browser.msie) { - this._mouseUnselectable = this.element.attr('unselectable'); - this.element.attr('unselectable', 'on'); - } - - this.started = false; - }, - - // TODO: make sure destroying one instance of mouse doesn't mess with - // other instances of mouse - _mouseDestroy: function() { - this.element.unbind('.'+this.widgetName); - - // Restore text selection in IE - ($.browser.msie - && this.element.attr('unselectable', this._mouseUnselectable)); - }, - - _mouseDown: function(e) { - // we may have missed mouseup (out of window) - (this._mouseStarted && this._mouseUp(e)); - - this._mouseDownEvent = e; - - var self = this, - btnIsLeft = (e.which == 1), - elIsCancel = (typeof this.options.cancel == "string" ? $(e.target).parents().add(e.target).filter(this.options.cancel).length : false); - if (!btnIsLeft || elIsCancel || !this._mouseCapture(e)) { - return true; - } - - this.mouseDelayMet = !this.options.delay; - if (!this.mouseDelayMet) { - this._mouseDelayTimer = setTimeout(function() { - self.mouseDelayMet = true; - }, this.options.delay); - } - - if (this._mouseDistanceMet(e) && this._mouseDelayMet(e)) { - this._mouseStarted = (this._mouseStart(e) !== false); - if (!this._mouseStarted) { - e.preventDefault(); - return true; - } - } - - // these delegates are required to keep context - this._mouseMoveDelegate = function(e) { - return self._mouseMove(e); - }; - this._mouseUpDelegate = function(e) { - return self._mouseUp(e); - }; - $(document) - .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) - .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); - - return false; - }, - - _mouseMove: function(e) { - // IE mouseup check - mouseup happened when mouse was out of window - if ($.browser.msie && !e.button) { - return this._mouseUp(e); - } - - if (this._mouseStarted) { - this._mouseDrag(e); - return false; - } - - if (this._mouseDistanceMet(e) && this._mouseDelayMet(e)) { - this._mouseStarted = - (this._mouseStart(this._mouseDownEvent, e) !== false); - (this._mouseStarted ? this._mouseDrag(e) : this._mouseUp(e)); - } - - return !this._mouseStarted; - }, - - _mouseUp: function(e) { - $(document) - .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) - .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); - - if (this._mouseStarted) { - this._mouseStarted = false; - this._mouseStop(e); - } - - return false; - }, - - _mouseDistanceMet: function(e) { - return (Math.max( - Math.abs(this._mouseDownEvent.pageX - e.pageX), - Math.abs(this._mouseDownEvent.pageY - e.pageY) - ) >= this.options.distance - ); - }, - - _mouseDelayMet: function(e) { - return this.mouseDelayMet; - }, - - // These are placeholder methods, to be overriden by extending plugin - _mouseStart: function(e) {}, - _mouseDrag: function(e) {}, - _mouseStop: function(e) {}, - _mouseCapture: function(e) { return true; } -}; - -$.ui.mouse.defaults = { - cancel: null, - distance: 1, - delay: 0 -}; - -})(jQuery); +/* + * jQuery UI 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI + */ +;jQuery.ui || (function($) { + +var _remove = $.fn.remove, + isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9); + +//Helper functions and ui object +$.ui = { + version: "1.7.1", + + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function(module, option, set) { + var proto = $.ui[module].prototype; + for(var i in set) { + proto.plugins[i] = proto.plugins[i] || []; + proto.plugins[i].push([option, set[i]]); + } + }, + call: function(instance, name, args) { + var set = instance.plugins[name]; + if(!set || !instance.element[0].parentNode) { return; } + + for (var i = 0; i < set.length; i++) { + if (instance.options[set[i][0]]) { + set[i][1].apply(instance.element, args); + } + } + } + }, + + contains: function(a, b) { + return document.compareDocumentPosition + ? a.compareDocumentPosition(b) & 16 + : a !== b && a.contains(b); + }, + + hasScroll: function(el, a) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ($(el).css('overflow') == 'hidden') { return false; } + + var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop', + has = false; + + if (el[scroll] > 0) { return true; } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[scroll] = 1; + has = (el[scroll] > 0); + el[scroll] = 0; + return has; + }, + + isOverAxis: function(x, reference, size) { + //Determines when x coordinate is over "b" element axis + return (x > reference) && (x < (reference + size)); + }, + + isOver: function(y, x, top, left, height, width) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width); + }, + + keyCode: { + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38 + } +}; + +// WAI-ARIA normalization +if (isFF2) { + var attr = $.attr, + removeAttr = $.fn.removeAttr, + ariaNS = "http://www.w3.org/2005/07/aaa", + ariaState = /^aria-/, + ariaRole = /^wairole:/; + + $.attr = function(elem, name, value) { + var set = value !== undefined; + + return (name == 'role' + ? (set + ? attr.call(this, elem, name, "wairole:" + value) + : (attr.apply(this, arguments) || "").replace(ariaRole, "")) + : (ariaState.test(name) + ? (set + ? elem.setAttributeNS(ariaNS, + name.replace(ariaState, "aaa:"), value) + : attr.call(this, elem, name.replace(ariaState, "aaa:"))) + : attr.apply(this, arguments))); + }; + + $.fn.removeAttr = function(name) { + return (ariaState.test(name) + ? this.each(function() { + this.removeAttributeNS(ariaNS, name.replace(ariaState, "")); + }) : removeAttr.call(this, name)); + }; +} + +//jQuery plugins +$.fn.extend({ + remove: function() { + // Safari has a native remove event which actually removes DOM elements, + // so we have to use triggerHandler instead of trigger (#3037). + $("*", this).add(this).each(function() { + $(this).triggerHandler("remove"); + }); + return _remove.apply(this, arguments ); + }, + + enableSelection: function() { + return this + .attr('unselectable', 'off') + .css('MozUserSelect', '') + .unbind('selectstart.ui'); + }, + + disableSelection: function() { + return this + .attr('unselectable', 'on') + .css('MozUserSelect', 'none') + .bind('selectstart.ui', function() { return false; }); + }, + + scrollParent: function() { + var scrollParent; + if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + } +}); + + +//Additional selectors +$.extend($.expr[':'], { + data: function(elem, i, match) { + return !!$.data(elem, match[3]); + }, + + focusable: function(element) { + var nodeName = element.nodeName.toLowerCase(), + tabIndex = $.attr(element, 'tabindex'); + return (/input|select|textarea|button|object/.test(nodeName) + ? !element.disabled + : 'a' == nodeName || 'area' == nodeName + ? element.href || !isNaN(tabIndex) + : !isNaN(tabIndex)) + // the element and all of its ancestors must be visible + // the browser may report that the area is hidden + && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length; + }, + + tabbable: function(element) { + var tabIndex = $.attr(element, 'tabindex'); + return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable'); + } +}); + + +// $.widget is a factory to create jQuery plugins +// taking some boilerplate code out of the plugin code +function getter(namespace, plugin, method, args) { + function getMethods(type) { + var methods = $[namespace][plugin][type] || []; + return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods); + } + + var methods = getMethods('getter'); + if (args.length == 1 && typeof args[0] == 'string') { + methods = methods.concat(getMethods('getterSetter')); + } + return ($.inArray(method, methods) != -1); +} + +$.widget = function(name, prototype) { + var namespace = name.split(".")[0]; + name = name.split(".")[1]; + + // create plugin method + $.fn[name] = function(options) { + var isMethodCall = (typeof options == 'string'), + args = Array.prototype.slice.call(arguments, 1); + + // prevent calls to internal methods + if (isMethodCall && options.substring(0, 1) == '_') { + return this; + } + + // handle getter methods + if (isMethodCall && getter(namespace, name, options, args)) { + var instance = $.data(this[0], name); + return (instance ? instance[options].apply(instance, args) + : undefined); + } + + // handle initialization and non-getter methods + return this.each(function() { + var instance = $.data(this, name); + + // constructor + (!instance && !isMethodCall && + $.data(this, name, new $[namespace][name](this, options))._init()); + + // method call + (instance && isMethodCall && $.isFunction(instance[options]) && + instance[options].apply(instance, args)); + }); + }; + + // create widget constructor + $[namespace] = $[namespace] || {}; + $[namespace][name] = function(element, options) { + var self = this; + + this.namespace = namespace; + this.widgetName = name; + this.widgetEventPrefix = $[namespace][name].eventPrefix || name; + this.widgetBaseClass = namespace + '-' + name; + + this.options = $.extend({}, + $.widget.defaults, + $[namespace][name].defaults, + $.metadata && $.metadata.get(element)[name], + options); + + this.element = $(element) + .bind('setData.' + name, function(event, key, value) { + if (event.target == element) { + return self._setData(key, value); + } + }) + .bind('getData.' + name, function(event, key) { + if (event.target == element) { + return self._getData(key); + } + }) + .bind('remove', function() { + return self.destroy(); + }); + }; + + // add widget prototype + $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype); + + // TODO: merge getter and getterSetter properties from widget prototype + // and plugin prototype + $[namespace][name].getterSetter = 'option'; +}; + +$.widget.prototype = { + _init: function() {}, + destroy: function() { + this.element.removeData(this.widgetName) + .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled') + .removeAttr('aria-disabled'); + }, + + option: function(key, value) { + var options = key, + self = this; + + if (typeof key == "string") { + if (value === undefined) { + return this._getData(key); + } + options = {}; + options[key] = value; + } + + $.each(options, function(key, value) { + self._setData(key, value); + }); + }, + _getData: function(key) { + return this.options[key]; + }, + _setData: function(key, value) { + this.options[key] = value; + + if (key == 'disabled') { + this.element + [value ? 'addClass' : 'removeClass']( + this.widgetBaseClass + '-disabled' + ' ' + + this.namespace + '-state-disabled') + .attr("aria-disabled", value); + } + }, + + enable: function() { + this._setData('disabled', false); + }, + disable: function() { + this._setData('disabled', true); + }, + + _trigger: function(type, event, data) { + var callback = this.options[type], + eventName = (type == this.widgetEventPrefix + ? type : this.widgetEventPrefix + type); + + event = $.Event(event); + event.type = eventName; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if (event.originalEvent) { + for (var i = $.event.props.length, prop; i;) { + prop = $.event.props[--i]; + event[prop] = event.originalEvent[prop]; + } + } + + this.element.trigger(event, data); + + return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false + || event.isDefaultPrevented()); + } +}; + +$.widget.defaults = { + disabled: false +}; + + +/** Mouse Interaction Plugin **/ + +$.ui.mouse = { + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if(self._preventClickEvent) { + self._preventClickEvent = false; + event.stopImmediatePropagation(); + return false; + } + }); + + // Prevent text selection in IE + if ($.browser.msie) { + this._mouseUnselectable = this.element.attr('unselectable'); + this.element.attr('unselectable', 'on'); + } + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + + // Restore text selection in IE + ($.browser.msie + && this.element.attr('unselectable', this._mouseUnselectable)); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + // TODO: figure out why we have to use originalEvent + event.originalEvent = event.originalEvent || {}; + if (event.originalEvent.mouseHandled) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + // preventDefault() is used to prevent the selection of text here - + // however, in Safari, this causes select boxes not to be selectable + // anymore, so this fix is needed + ($.browser.safari || event.preventDefault()); + + event.originalEvent.mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + this._preventClickEvent = (event.target == this._mouseDownEvent.target); + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}; + +$.ui.mouse.defaults = { + cancel: null, + distance: 1, + delay: 0 +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.datepicker.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.datepicker.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.datepicker.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.datepicker.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,1699 +1,1630 @@ -/* - * jQuery UI Datepicker @VERSION - * - * Copyright (c) 2006, 2007, 2008 Marc Grabanski - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Datepicker - * - * Depends: - * ui.core.js - * - * Marc Grabanski (m@marcgrabanski.com) and Keith Wood (kbwood@virginbroadband.com.au). - */ - -(function($) { // hide the namespace - -var PROP_NAME = 'datepicker'; - -/* Date picker manager. - Use the singleton instance of this class, $.datepicker, to interact with the date picker. - Settings for (groups of) date pickers are maintained in an instance object, - allowing multiple different settings on the same page. */ - -function Datepicker() { - this.debug = false; // Change this to true to start debugging - this._curInst = null; // The current instance in use - this._disabledInputs = []; // List of date picker inputs that have been disabled - this._datepickerShowing = false; // True if the popup picker is showing , false if not - this._inDialog = false; // True if showing within a "dialog", false if not - this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division - this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class - this._appendClass = 'ui-datepicker-append'; // The name of the append marker class - this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class - this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class - this._promptClass = 'ui-datepicker-prompt'; // The name of the dialog prompt marker class - this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class - this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class - this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class - this.regional = []; // Available regional settings, indexed by language code - this.regional[''] = { // Default regional settings - clearText: 'Clear', // Display text for clear link - clearStatus: 'Erase the current date', // Status text for clear link - closeText: 'Close', // Display text for close link - closeStatus: 'Close without change', // Status text for close link - prevText: '<Prev', // Display text for previous month link - prevStatus: 'Show the previous month', // Status text for previous month link - prevBigText: '<<', // Display text for previous year link - prevBigStatus: 'Show the previous year', // Status text for previous year link - nextText: 'Next>', // Display text for next month link - nextStatus: 'Show the next month', // Status text for next month link - nextBigText: '>>', // Display text for next year link - nextBigStatus: 'Show the next year', // Status text for next year link - currentText: 'Today', // Display text for current month link - currentStatus: 'Show the current month', // Status text for current month link - monthNames: ['January','February','March','April','May','June', - 'July','August','September','October','November','December'], // Names of months for drop-down and formatting - monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting - monthStatus: 'Show a different month', // Status text for selecting a month - yearStatus: 'Show a different year', // Status text for selecting a year - weekHeader: 'Wk', // Header for the week of the year column - weekStatus: 'Week of the year', // Status text for the week of the year column - dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting - dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting - dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday - dayStatus: 'Set DD as first week day', // Status text for the day of the week selection - dateStatus: 'Select DD, M d', // Status text for the date selection - dateFormat: 'mm/dd/yy', // See format options on parseDate - firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... - initStatus: 'Select a date', // Initial Status text on opening - isRTL: false // True if right-to-left language, false if left-to-right - }; - this._defaults = { // Global defaults for all the date picker instances - showOn: 'focus', // 'focus' for popup on focus, - // 'button' for trigger button, or 'both' for either - showAnim: 'show', // Name of jQuery animation for popup - showOptions: {}, // Options for enhanced animations - defaultDate: null, // Used when field is blank: actual date, - // +/-number for offset from today, null for today - appendText: '', // Display text following the input box, e.g. showing the format - buttonText: '...', // Text for trigger button - buttonImage: '', // URL for trigger button image - buttonImageOnly: false, // True if the image appears alone, false if it appears on a button - closeAtTop: true, // True to have the clear/close at the top, - // false to have them at the bottom - mandatory: false, // True to hide the Clear link, false to include it - hideIfNoPrevNext: false, // True to hide next/previous month links - // if not applicable, false to just disable them - navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links - showBigPrevNext: false, // True to show big prev/next links - gotoCurrent: false, // True if today link goes back to current selection instead - changeMonth: true, // True if month can be selected directly, false if only prev/next - changeYear: true, // True if year can be selected directly, false if only prev/next - showMonthAfterYear: false, // True if the year select precedes month, false for month then year - yearRange: '-10:+10', // Range of years to display in drop-down, - // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn) - changeFirstDay: true, // True to click on day name to change, false to remain as set - highlightWeek: false, // True to highlight the selected week - showOtherMonths: false, // True to show dates in other months, false to leave blank - showWeeks: false, // True to show week of the year, false to omit - calculateWeek: this.iso8601Week, // How to calculate the week of the year, - // takes a Date and returns the number of the week for it - shortYearCutoff: '+10', // Short year values < this are in the current century, - // > this are in the previous century, - // string value starting with '+' for current year + value - showStatus: false, // True to show status bar at bottom, false to not show it - statusForDate: this.dateStatus, // Function to provide status text for a date - - // takes date and instance as parameters, returns display text - minDate: null, // The earliest selectable date, or null for no limit - maxDate: null, // The latest selectable date, or null for no limit - duration: 'normal', // Duration of display/closure - beforeShowDay: null, // Function that takes a date and returns an array with - // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', - // [2] = cell title (optional), e.g. $.datepicker.noWeekends - beforeShow: null, // Function that takes an input field and - // returns a set of custom settings for the date picker - onSelect: null, // Define a callback function when a date is selected - onChangeMonthYear: null, // Define a callback function when the month or year is changed - onClose: null, // Define a callback function when the datepicker is closed - numberOfMonths: 1, // Number of months to show at a time - showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) - stepMonths: 1, // Number of months to step back/forward - stepBigMonths: 12, // Number of months to step back/forward for the big links - rangeSelect: false, // Allows for selecting a date range on one date picker - rangeSeparator: ' - ', // Text between two dates in a range - altField: '', // Selector for an alternate field to store selected dates into - altFormat: '' // The date format to use for the alternate field - }; - $.extend(this._defaults, this.regional['']); - this.dpDiv = $(''); -} - -$.extend(Datepicker.prototype, { - /* Class name added to elements to indicate already configured with a date picker. */ - markerClassName: 'hasDatepicker', - - /* Debug logging (if enabled). */ - log: function () { - if (this.debug) - console.log.apply('', arguments); - }, - - /* Override the default settings for all instances of the date picker. - @param settings object - the new settings to use as defaults (anonymous object) - @return the manager object */ - setDefaults: function(settings) { - extendRemove(this._defaults, settings || {}); - return this; - }, - - /* Attach the date picker to a jQuery selection. - @param target element - the target input field or division or span - @param settings object - the new settings to use for this date picker instance (anonymous) */ - _attachDatepicker: function(target, settings) { - // check for settings on the control itself - in namespace 'date:' - var inlineSettings = null; - for (attrName in this._defaults) { - var attrValue = target.getAttribute('date:' + attrName); - if (attrValue) { - inlineSettings = inlineSettings || {}; - try { - inlineSettings[attrName] = eval(attrValue); - } catch (err) { - inlineSettings[attrName] = attrValue; - } - } - } - var nodeName = target.nodeName.toLowerCase(); - var inline = (nodeName == 'div' || nodeName == 'span'); - if (!target.id) - target.id = 'dp' + (++this.uuid); - var inst = this._newInst($(target), inline); - inst.settings = $.extend({}, settings || {}, inlineSettings || {}); - if (nodeName == 'input') { - this._connectDatepicker(target, inst); - } else if (inline) { - this._inlineDatepicker(target, inst); - } - }, - - /* Create a new instance object. */ - _newInst: function(target, inline) { - var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars - return {id: id, input: target, // associated target - selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection - drawMonth: 0, drawYear: 0, // month being drawn - inline: inline, // is datepicker inline or not - dpDiv: (!inline ? this.dpDiv : // presentation div - $('
    '))}; - }, - - /* Attach the date picker to an input field. */ - _connectDatepicker: function(target, inst) { - var input = $(target); - if (input.hasClass(this.markerClassName)) - return; - var appendText = this._get(inst, 'appendText'); - var isRTL = this._get(inst, 'isRTL'); - if (appendText) - input[isRTL ? 'before' : 'after']('' + appendText + ''); - var showOn = this._get(inst, 'showOn'); - if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field - input.focus(this._showDatepicker); - if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked - var buttonText = this._get(inst, 'buttonText'); - var buttonImage = this._get(inst, 'buttonImage'); - var trigger = $(this._get(inst, 'buttonImageOnly') ? - $('').addClass(this._triggerClass). - attr({ src: buttonImage, alt: buttonText, title: buttonText }) : - $('').addClass(this._triggerClass). - html(buttonImage == '' ? buttonText : $('').attr( - { src:buttonImage, alt:buttonText, title:buttonText }))); - input[isRTL ? 'before' : 'after'](trigger); - trigger.click(function() { - if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target) - $.datepicker._hideDatepicker(); - else - $.datepicker._showDatepicker(target); - return false; - }); - } - input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress). - bind("setData.datepicker", function(event, key, value) { - inst.settings[key] = value; - }).bind("getData.datepicker", function(event, key) { - return this._get(inst, key); - }); - $.data(target, PROP_NAME, inst); - }, - - /* Attach an inline date picker to a div. */ - _inlineDatepicker: function(target, inst) { - var divSpan = $(target); - if (divSpan.hasClass(this.markerClassName)) - return; - divSpan.addClass(this.markerClassName).append(inst.dpDiv). - bind("setData.datepicker", function(event, key, value){ - inst.settings[key] = value; - }).bind("getData.datepicker", function(event, key){ - return this._get(inst, key); - }); - $.data(target, PROP_NAME, inst); - this._setDate(inst, this._getDefaultDate(inst)); - this._updateDatepicker(inst); - }, - - /* Tidy up after displaying the date picker. */ - _inlineShow: function(inst) { - var numMonths = this._getNumberOfMonths(inst); // fix width for dynamic number of date pickers - inst.dpDiv.width(numMonths[1] * $('.ui-datepicker', inst.dpDiv[0]).width()); - }, - - /* Pop-up the date picker in a "dialog" box. - @param input element - ignored - @param dateText string - the initial date to display (in the current format) - @param onSelect function - the function(dateText) to call when a date is selected - @param settings object - update the dialog date picker instance's settings (anonymous object) - @param pos int[2] - coordinates for the dialog's position within the screen or - event - with x/y coordinates or - leave empty for default (screen centre) - @return the manager object */ - _dialogDatepicker: function(input, dateText, onSelect, settings, pos) { - var inst = this._dialogInst; // internal instance - if (!inst) { - var id = 'dp' + (++this.uuid); - this._dialogInput = $(''); - this._dialogInput.keydown(this._doKeyDown); - $('body').append(this._dialogInput); - inst = this._dialogInst = this._newInst(this._dialogInput, false); - inst.settings = {}; - $.data(this._dialogInput[0], PROP_NAME, inst); - } - extendRemove(inst.settings, settings || {}); - this._dialogInput.val(dateText); - - this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); - if (!this._pos) { - var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth; - var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight; - var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; - var scrollY = document.documentElement.scrollTop || document.body.scrollTop; - this._pos = // should use actual width/height below - [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; - } - - // move input on screen for focus, but hidden behind dialog - this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px'); - inst.settings.onSelect = onSelect; - this._inDialog = true; - this.dpDiv.addClass(this._dialogClass); - this._showDatepicker(this._dialogInput[0]); - if ($.blockUI) - $.blockUI(this.dpDiv); - $.data(this._dialogInput[0], PROP_NAME, inst); - return this; - }, - - /* Detach a datepicker from its control. - @param target element - the target input field or division or span */ - _destroyDatepicker: function(target) { - var $target = $(target); - if (!$target.hasClass(this.markerClassName)) { - return; - } - var nodeName = target.nodeName.toLowerCase(); - $.removeData(target, PROP_NAME); - if (nodeName == 'input') { - $target.siblings('.' + this._appendClass).remove().end(). - siblings('.' + this._triggerClass).remove().end(). - removeClass(this.markerClassName). - unbind('focus', this._showDatepicker). - unbind('keydown', this._doKeyDown). - unbind('keypress', this._doKeyPress); - } else if (nodeName == 'div' || nodeName == 'span') - $target.removeClass(this.markerClassName).empty(); - }, - - /* Enable the date picker to a jQuery selection. - @param target element - the target input field or division or span */ - _enableDatepicker: function(target) { - var $target = $(target); - if (!$target.hasClass(this.markerClassName)) { - return; - } - var nodeName = target.nodeName.toLowerCase(); - if (nodeName == 'input') { - target.disabled = false; - $target.siblings('button.' + this._triggerClass). - each(function() { this.disabled = false; }).end(). - siblings('img.' + this._triggerClass). - css({opacity: '1.0', cursor: ''}); - } - else if (nodeName == 'div' || nodeName == 'span') { - $target.children('.' + this._disableClass).remove(); - } - this._disabledInputs = $.map(this._disabledInputs, - function(value) { return (value == target ? null : value); }); // delete entry - }, - - /* Disable the date picker to a jQuery selection. - @param target element - the target input field or division or span */ - _disableDatepicker: function(target) { - var $target = $(target); - if (!$target.hasClass(this.markerClassName)) { - return; - } - var nodeName = target.nodeName.toLowerCase(); - if (nodeName == 'input') { - target.disabled = true; - $target.siblings('button.' + this._triggerClass). - each(function() { this.disabled = true; }).end(). - siblings('img.' + this._triggerClass). - css({opacity: '0.5', cursor: 'default'}); - } - else if (nodeName == 'div' || nodeName == 'span') { - var inline = $target.children('.' + this._inlineClass); - var offset = inline.offset(); - var relOffset = {left: 0, top: 0}; - inline.parents().each(function() { - if ($(this).css('position') == 'relative') { - relOffset = $(this).offset(); - return false; - } - }); - $target.prepend('
    '); - } - this._disabledInputs = $.map(this._disabledInputs, - function(value) { return (value == target ? null : value); }); // delete entry - this._disabledInputs[this._disabledInputs.length] = target; - }, - - /* Is the first field in a jQuery collection disabled as a datepicker? - @param target element - the target input field or division or span - @return boolean - true if disabled, false if enabled */ - _isDisabledDatepicker: function(target) { - if (!target) - return false; - for (var i = 0; i < this._disabledInputs.length; i++) { - if (this._disabledInputs[i] == target) - return true; - } - return false; - }, - - /* Retrieve the instance data for the target control. - @param target element - the target input field or division or span - @return object - the associated instance data - @throws error if a jQuery problem getting data */ - _getInst: function(target) { - try { - return $.data(target, PROP_NAME); - } - catch (err) { - throw 'Missing instance data for this datepicker'; - } - }, - - /* Update the settings for a date picker attached to an input field or division. - @param target element - the target input field or division or span - @param name object - the new settings to update or - string - the name of the setting to change or - @param value any - the new value for the setting (omit if above is an object) */ - _changeDatepicker: function(target, name, value) { - var settings = name || {}; - if (typeof name == 'string') { - settings = {}; - settings[name] = value; - } - var inst = this._getInst(target); - if (inst) { - if (this._curInst == inst) { - this._hideDatepicker(null); - } - extendRemove(inst.settings, settings); - var date = new Date(); - extendRemove(inst, {rangeStart: null, // start of range - endDay: null, endMonth: null, endYear: null, // end of range - selectedDay: date.getDate(), selectedMonth: date.getMonth(), - selectedYear: date.getFullYear(), // starting point - currentDay: date.getDate(), currentMonth: date.getMonth(), - currentYear: date.getFullYear(), // current selection - drawMonth: date.getMonth(), drawYear: date.getFullYear()}); // month being drawn - this._updateDatepicker(inst); - } - }, - - /* Redraw the date picker attached to an input field or division. - @param target element - the target input field or division or span */ - _refreshDatepicker: function(target) { - var inst = this._getInst(target); - if (inst) { - this._updateDatepicker(inst); - } - }, - - /* Set the dates for a jQuery selection. - @param target element - the target input field or division or span - @param date Date - the new date - @param endDate Date - the new end date for a range (optional) */ - _setDateDatepicker: function(target, date, endDate) { - var inst = this._getInst(target); - if (inst) { - this._setDate(inst, date, endDate); - this._updateDatepicker(inst); - this._updateAlternate(inst); - } - }, - - /* Get the date(s) for the first entry in a jQuery selection. - @param target element - the target input field or division or span - @return Date - the current date or - Date[2] - the current dates for a range */ - _getDateDatepicker: function(target) { - var inst = this._getInst(target); - if (inst && !inst.inline) - this._setDateFromField(inst); - return (inst ? this._getDate(inst) : null); - }, - - /* Handle keystrokes. */ - _doKeyDown: function(e) { - var inst = $.datepicker._getInst(e.target); - var handled = true; - if ($.datepicker._datepickerShowing) - switch (e.keyCode) { - case 9: $.datepicker._hideDatepicker(null, ''); - break; // hide on tab out - case 13: $.datepicker._selectDay(e.target, inst.selectedMonth, inst.selectedYear, - $('td.ui-datepicker-days-cell-over', inst.dpDiv)[0]); - return false; // don't submit the form - break; // select the value on enter - case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration')); - break; // hide on escape - case 33: $.datepicker._adjustDate(e.target, (e.ctrlKey ? - -$.datepicker._get(inst, 'stepBigMonths') : - -$.datepicker._get(inst, 'stepMonths')), 'M'); - break; // previous month/year on page up/+ ctrl - case 34: $.datepicker._adjustDate(e.target, (e.ctrlKey ? - +$.datepicker._get(inst, 'stepBigMonths') : - +$.datepicker._get(inst, 'stepMonths')), 'M'); - break; // next month/year on page down/+ ctrl - case 35: if (e.ctrlKey) $.datepicker._clearDate(e.target); - handled = e.ctrlKey; - break; // clear on ctrl+end - case 36: if (e.ctrlKey) $.datepicker._gotoToday(e.target); - handled = e.ctrlKey; - break; // current on ctrl+home - case 37: if (e.ctrlKey) $.datepicker._adjustDate(e.target, -1, 'D'); - handled = e.ctrlKey; - break; // -1 day on ctrl+left - case 38: if (e.ctrlKey) $.datepicker._adjustDate(e.target, -7, 'D'); - handled = e.ctrlKey; - break; // -1 week on ctrl+up - case 39: if (e.ctrlKey) $.datepicker._adjustDate(e.target, +1, 'D'); - handled = e.ctrlKey; - break; // +1 day on ctrl+right - case 40: if (e.ctrlKey) $.datepicker._adjustDate(e.target, +7, 'D'); - handled = e.ctrlKey; - break; // +1 week on ctrl+down - default: handled = false; - } - else if (e.keyCode == 36 && e.ctrlKey) // display the date picker on ctrl+home - $.datepicker._showDatepicker(this); - else - handled = false; - if (handled) { - e.preventDefault(); - e.stopPropagation(); - } - }, - - /* Filter entered characters - based on date format. */ - _doKeyPress: function(e) { - var inst = $.datepicker._getInst(e.target); - var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); - var chr = String.fromCharCode(e.charCode == undefined ? e.keyCode : e.charCode); - return e.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); - }, - - /* Pop-up the date picker for a given input field. - @param input element - the input field attached to the date picker or - event - if triggered by focus */ - _showDatepicker: function(input) { - input = input.target || input; - if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger - input = $('input', input.parentNode)[0]; - if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here - return; - var inst = $.datepicker._getInst(input); - var beforeShow = $.datepicker._get(inst, 'beforeShow'); - extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {})); - $.datepicker._hideDatepicker(null, ''); - $.datepicker._lastInput = input; - $.datepicker._setDateFromField(inst); - if ($.datepicker._inDialog) // hide cursor - input.value = ''; - if (!$.datepicker._pos) { // position below input - $.datepicker._pos = $.datepicker._findPos(input); - $.datepicker._pos[1] += input.offsetHeight; // add the height - } - var isFixed = false; - $(input).parents().each(function() { - isFixed |= $(this).css('position') == 'fixed'; - return !isFixed; - }); - if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled - $.datepicker._pos[0] -= document.documentElement.scrollLeft; - $.datepicker._pos[1] -= document.documentElement.scrollTop; - } - var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; - $.datepicker._pos = null; - inst.rangeStart = null; - // determine sizing offscreen - inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); - $.datepicker._updateDatepicker(inst); - // fix width for dynamic number of date pickers - inst.dpDiv.width($.datepicker._getNumberOfMonths(inst)[1] * - $('.ui-datepicker', inst.dpDiv[0])[0].offsetWidth); - // and adjust position before showing - offset = $.datepicker._checkOffset(inst, offset, isFixed); - inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? - 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', - left: offset.left + 'px', top: offset.top + 'px'}); - if (!inst.inline) { - var showAnim = $.datepicker._get(inst, 'showAnim') || 'show'; - var duration = $.datepicker._get(inst, 'duration'); - var postProcess = function() { - $.datepicker._datepickerShowing = true; - if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems - $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4, - height: inst.dpDiv.height() + 4}); - }; - if ($.effects && $.effects[showAnim]) - inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); - else - inst.dpDiv[showAnim](duration, postProcess); - if (duration == '') - postProcess(); - if (inst.input[0].type != 'hidden') - inst.input[0].focus(); - $.datepicker._curInst = inst; - } - }, - - /* Generate the date picker content. */ - _updateDatepicker: function(inst) { - var dims = {width: inst.dpDiv.width() + 4, - height: inst.dpDiv.height() + 4}; - inst.dpDiv.empty().append(this._generateHTML(inst)). - find('iframe.ui-datepicker-cover'). - css({width: dims.width, height: dims.height}); - var numMonths = this._getNumberOfMonths(inst); - inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + - 'Class']('ui-datepicker-multi'); - inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + - 'Class']('ui-datepicker-rtl'); - if (inst.input && inst.input[0].type != 'hidden') - $(inst.input[0]).focus(); - }, - - /* Check positioning to remain on screen. */ - _checkOffset: function(inst, offset, isFixed) { - var pos = inst.input ? this._findPos(inst.input[0]) : null; - var browserWidth = window.innerWidth || document.documentElement.clientWidth; - var browserHeight = window.innerHeight || document.documentElement.clientHeight; - var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; - var scrollY = document.documentElement.scrollTop || document.body.scrollTop; - // reposition date picker horizontally if outside the browser window - if (this._get(inst, 'isRTL') || (offset.left + inst.dpDiv.width() - scrollX) > browserWidth) - offset.left = Math.max((isFixed ? 0 : scrollX), - pos[0] + (inst.input ? inst.input.width() : 0) - (isFixed ? scrollX : 0) - inst.dpDiv.width() - - (isFixed && $.browser.opera ? document.documentElement.scrollLeft : 0)); - else - offset.left -= (isFixed ? scrollX : 0); - // reposition date picker vertically if outside the browser window - if ((offset.top + inst.dpDiv.height() - scrollY) > browserHeight) - offset.top = Math.max((isFixed ? 0 : scrollY), - pos[1] - (isFixed ? scrollY : 0) - (this._inDialog ? 0 : inst.dpDiv.height()) - - (isFixed && $.browser.opera ? document.documentElement.scrollTop : 0)); - else - offset.top -= (isFixed ? scrollY : 0); - return offset; - }, - - /* Find an object's position on the screen. */ - _findPos: function(obj) { - while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) { - obj = obj.nextSibling; - } - var position = $(obj).offset(); - return [position.left, position.top]; - }, - - /* Hide the date picker from view. - @param input element - the input field attached to the date picker - @param duration string - the duration over which to close the date picker */ - _hideDatepicker: function(input, duration) { - var inst = this._curInst; - if (!inst || (input && inst != $.data(input, PROP_NAME))) - return; - var rangeSelect = this._get(inst, 'rangeSelect'); - if (rangeSelect && inst.stayOpen) - this._selectDate('#' + inst.id, this._formatDate(inst, - inst.currentDay, inst.currentMonth, inst.currentYear)); - inst.stayOpen = false; - if (this._datepickerShowing) { - duration = (duration != null ? duration : this._get(inst, 'duration')); - var showAnim = this._get(inst, 'showAnim'); - var postProcess = function() { - $.datepicker._tidyDialog(inst); - }; - if (duration != '' && $.effects && $.effects[showAnim]) - inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), - duration, postProcess); - else - inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' : - (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess); - if (duration == '') - this._tidyDialog(inst); - var onClose = this._get(inst, 'onClose'); - if (onClose) - onClose.apply((inst.input ? inst.input[0] : null), - [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback - this._datepickerShowing = false; - this._lastInput = null; - inst.settings.prompt = null; - if (this._inDialog) { - this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); - if ($.blockUI) { - $.unblockUI(); - $('body').append(this.dpDiv); - } - } - this._inDialog = false; - } - this._curInst = null; - }, - - /* Tidy up after a dialog display. */ - _tidyDialog: function(inst) { - inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker'); - $('.' + this._promptClass, inst.dpDiv).remove(); - }, - - /* Close date picker if clicked elsewhere. */ - _checkExternalClick: function(event) { - if (!$.datepicker._curInst) - return; - var $target = $(event.target); - if (($target.parents('#' + $.datepicker._mainDivId).length == 0) && - !$target.hasClass($.datepicker.markerClassName) && - !$target.hasClass($.datepicker._triggerClass) && - $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) - $.datepicker._hideDatepicker(null, ''); - }, - - /* Adjust one of the date sub-fields. */ - _adjustDate: function(id, offset, period) { - var target = $(id); - var inst = this._getInst(target[0]); - this._adjustInstDate(inst, offset, period); - this._updateDatepicker(inst); - }, - - /* Action for current link. */ - _gotoToday: function(id) { - var target = $(id); - var inst = this._getInst(target[0]); - if (this._get(inst, 'gotoCurrent') && inst.currentDay) { - inst.selectedDay = inst.currentDay; - inst.drawMonth = inst.selectedMonth = inst.currentMonth; - inst.drawYear = inst.selectedYear = inst.currentYear; - } - else { - var date = new Date(); - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); - } - this._notifyChange(inst); - this._adjustDate(target); - }, - - /* Action for selecting a new month/year. */ - _selectMonthYear: function(id, select, period) { - var target = $(id); - var inst = this._getInst(target[0]); - inst._selectingMonthYear = false; - inst['selected' + (period == 'M' ? 'Month' : 'Year')] = - inst['draw' + (period == 'M' ? 'Month' : 'Year')] = - parseInt(select.options[select.selectedIndex].value,10); - this._notifyChange(inst); - this._adjustDate(target); - }, - - /* Restore input focus after not changing month/year. */ - _clickMonthYear: function(id) { - var target = $(id); - var inst = this._getInst(target[0]); - if (inst.input && inst._selectingMonthYear && !$.browser.msie) - inst.input[0].focus(); - inst._selectingMonthYear = !inst._selectingMonthYear; - }, - - /* Action for changing the first week day. */ - _changeFirstDay: function(id, day) { - var target = $(id); - var inst = this._getInst(target[0]); - inst.settings.firstDay = day; - this._updateDatepicker(inst); - }, - - /* Action for selecting a day. */ - _selectDay: function(id, month, year, td) { - if ($(td).hasClass(this._unselectableClass)) - return; - var target = $(id); - var inst = this._getInst(target[0]); - var rangeSelect = this._get(inst, 'rangeSelect'); - if (rangeSelect) { - inst.stayOpen = !inst.stayOpen; - if (inst.stayOpen) { - $('.ui-datepicker td', inst.dpDiv).removeClass(this._currentClass); - $(td).addClass(this._currentClass); - } - } - inst.selectedDay = inst.currentDay = $('a', td).html(); - inst.selectedMonth = inst.currentMonth = month; - inst.selectedYear = inst.currentYear = year; - if (inst.stayOpen) { - inst.endDay = inst.endMonth = inst.endYear = null; - } - else if (rangeSelect) { - inst.endDay = inst.currentDay; - inst.endMonth = inst.currentMonth; - inst.endYear = inst.currentYear; - } - this._selectDate(id, this._formatDate(inst, - inst.currentDay, inst.currentMonth, inst.currentYear)); - if (inst.stayOpen) { - inst.rangeStart = new Date(inst.currentYear, inst.currentMonth, inst.currentDay); - this._updateDatepicker(inst); - } - else if (rangeSelect) { - inst.selectedDay = inst.currentDay = inst.rangeStart.getDate(); - inst.selectedMonth = inst.currentMonth = inst.rangeStart.getMonth(); - inst.selectedYear = inst.currentYear = inst.rangeStart.getFullYear(); - inst.rangeStart = null; - if (inst.inline) - this._updateDatepicker(inst); - } - }, - - /* Erase the input field and hide the date picker. */ - _clearDate: function(id) { - var target = $(id); - var inst = this._getInst(target[0]); - if (this._get(inst, 'mandatory')) - return; - inst.stayOpen = false; - inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null; - this._selectDate(target, ''); - }, - - /* Update the input field with the selected date. */ - _selectDate: function(id, dateStr) { - var target = $(id); - var inst = this._getInst(target[0]); - dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); - if (this._get(inst, 'rangeSelect') && dateStr) - dateStr = (inst.rangeStart ? this._formatDate(inst, inst.rangeStart) : - dateStr) + this._get(inst, 'rangeSeparator') + dateStr; - if (inst.input) - inst.input.val(dateStr); - this._updateAlternate(inst); - var onSelect = this._get(inst, 'onSelect'); - if (onSelect) - onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback - else if (inst.input) - inst.input.trigger('change'); // fire the change event - if (inst.inline) - this._updateDatepicker(inst); - else if (!inst.stayOpen) { - this._hideDatepicker(null, this._get(inst, 'duration')); - this._lastInput = inst.input[0]; - if (typeof(inst.input[0]) != 'object') - inst.input[0].focus(); // restore focus - this._lastInput = null; - } - }, - - /* Update any alternate field to synchronise with the main field. */ - _updateAlternate: function(inst) { - var altField = this._get(inst, 'altField'); - if (altField) { // update alternate field too - var altFormat = this._get(inst, 'altFormat'); - var date = this._getDate(inst); - dateStr = (isArray(date) ? (!date[0] && !date[1] ? '' : - this.formatDate(altFormat, date[0], this._getFormatConfig(inst)) + - this._get(inst, 'rangeSeparator') + this.formatDate( - altFormat, date[1] || date[0], this._getFormatConfig(inst))) : - this.formatDate(altFormat, date, this._getFormatConfig(inst))); - $(altField).each(function() { $(this).val(dateStr); }); - } - }, - - /* Set as beforeShowDay function to prevent selection of weekends. - @param date Date - the date to customise - @return [boolean, string] - is this date selectable?, what is its CSS class? */ - noWeekends: function(date) { - var day = date.getDay(); - return [(day > 0 && day < 6), '']; - }, - - /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. - @param date Date - the date to get the week for - @return number - the number of the week within the year that contains this date */ - iso8601Week: function(date) { - var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate(), - (date.getTimezoneOffset() / -60)); - var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan - var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7 - firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday - if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary - checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year - return $.datepicker.iso8601Week(checkDate); - } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year - firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7; - if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary - return 1; - } - } - return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date - }, - - /* Provide status text for a particular date. - @param date the date to get the status for - @param inst the current datepicker instance - @return the status display text for this date */ - dateStatus: function(date, inst) { - return $.datepicker.formatDate($.datepicker._get(inst, 'dateStatus'), - date, $.datepicker._getFormatConfig(inst)); - }, - - /* Parse a string value into a date object. - See formatDate below for the possible formats. - - @param format string - the expected format of the date - @param value string - the date in the above format - @param settings Object - attributes include: - shortYearCutoff number - the cutoff year for determining the century (optional) - dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) - dayNames string[7] - names of the days from Sunday (optional) - monthNamesShort string[12] - abbreviated names of the months (optional) - monthNames string[12] - names of the months (optional) - @return Date - the extracted date value or null if value is blank */ - parseDate: function (format, value, settings) { - if (format == null || value == null) - throw 'Invalid arguments'; - value = (typeof value == 'object' ? value.toString() : value + ''); - if (value == '') - return null; - var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; - var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; - var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; - var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; - var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; - var year = -1; - var month = -1; - var day = -1; - var doy = -1; - var literal = false; - // Check whether a format character is doubled - var lookAhead = function(match) { - var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); - if (matches) - iFormat++; - return matches; - }; - // Extract a number from the string value - var getNumber = function(match) { - lookAhead(match); - var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2))); - var size = origSize; - var num = 0; - while (size > 0 && iValue < value.length && - value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') { - num = num * 10 + parseInt(value.charAt(iValue++),10); - size--; - } - if (size == origSize) - throw 'Missing number at position ' + iValue; - return num; - }; - // Extract a name from the string value and convert to an index - var getName = function(match, shortNames, longNames) { - var names = (lookAhead(match) ? longNames : shortNames); - var size = 0; - for (var j = 0; j < names.length; j++) - size = Math.max(size, names[j].length); - var name = ''; - var iInit = iValue; - while (size > 0 && iValue < value.length) { - name += value.charAt(iValue++); - for (var i = 0; i < names.length; i++) - if (name == names[i]) - return i + 1; - size--; - } - throw 'Unknown name at position ' + iInit; - }; - // Confirm that a literal character matches the string value - var checkLiteral = function() { - if (value.charAt(iValue) != format.charAt(iFormat)) - throw 'Unexpected literal at position ' + iValue; - iValue++; - }; - var iValue = 0; - for (var iFormat = 0; iFormat < format.length; iFormat++) { - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - checkLiteral(); - else - switch (format.charAt(iFormat)) { - case 'd': - day = getNumber('d'); - break; - case 'D': - getName('D', dayNamesShort, dayNames); - break; - case 'o': - doy = getNumber('o'); - break; - case 'm': - month = getNumber('m'); - break; - case 'M': - month = getName('M', monthNamesShort, monthNames); - break; - case 'y': - year = getNumber('y'); - break; - case '@': - var date = new Date(getNumber('@')); - year = date.getFullYear(); - month = date.getMonth() + 1; - day = date.getDate(); - break; - case "'": - if (lookAhead("'")) - checkLiteral(); - else - literal = true; - break; - default: - checkLiteral(); - } - } - if (year < 100) - year += new Date().getFullYear() - new Date().getFullYear() % 100 + - (year <= shortYearCutoff ? 0 : -100); - if (doy > -1) { - month = 1; - day = doy; - do { - var dim = this._getDaysInMonth(year, month - 1); - if (day <= dim) - break; - month++; - day -= dim; - } while (true); - } - var date = new Date(year, month - 1, day); - if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) - throw 'Invalid date'; // E.g. 31/02/* - return date; - }, - - /* Standard date formats. */ - ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) - COOKIE: 'D, dd M yy', - ISO_8601: 'yy-mm-dd', - RFC_822: 'D, d M y', - RFC_850: 'DD, dd-M-y', - RFC_1036: 'D, d M y', - RFC_1123: 'D, d M yy', - RFC_2822: 'D, d M yy', - RSS: 'D, d M y', // RFC 822 - TIMESTAMP: '@', - W3C: 'yy-mm-dd', // ISO 8601 - - /* Format a date object into a string value. - The format can be combinations of the following: - d - day of month (no leading zero) - dd - day of month (two digit) - o - day of year (no leading zeros) - oo - day of year (three digit) - D - day name short - DD - day name long - m - month of year (no leading zero) - mm - month of year (two digit) - M - month name short - MM - month name long - y - year (two digit) - yy - year (four digit) - @ - Unix timestamp (ms since 01/01/1970) - '...' - literal text - '' - single quote - - @param format string - the desired format of the date - @param date Date - the date value to format - @param settings Object - attributes include: - dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) - dayNames string[7] - names of the days from Sunday (optional) - monthNamesShort string[12] - abbreviated names of the months (optional) - monthNames string[12] - names of the months (optional) - @return string - the date in the above format */ - formatDate: function (format, date, settings) { - if (!date) - return ''; - var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; - var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; - var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; - var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; - // Check whether a format character is doubled - var lookAhead = function(match) { - var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); - if (matches) - iFormat++; - return matches; - }; - // Format a number, with leading zero if necessary - var formatNumber = function(match, value, len) { - var num = '' + value; - if (lookAhead(match)) - while (num.length < len) - num = '0' + num; - return num; - }; - // Format a name, short or long as requested - var formatName = function(match, value, shortNames, longNames) { - return (lookAhead(match) ? longNames[value] : shortNames[value]); - }; - var output = ''; - var literal = false; - if (date) - for (var iFormat = 0; iFormat < format.length; iFormat++) { - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - output += format.charAt(iFormat); - else - switch (format.charAt(iFormat)) { - case 'd': - output += formatNumber('d', date.getDate(), 2); - break; - case 'D': - output += formatName('D', date.getDay(), dayNamesShort, dayNames); - break; - case 'o': - var doy = date.getDate(); - for (var m = date.getMonth() - 1; m >= 0; m--) - doy += this._getDaysInMonth(date.getFullYear(), m); - output += formatNumber('o', doy, 3); - break; - case 'm': - output += formatNumber('m', date.getMonth() + 1, 2); - break; - case 'M': - output += formatName('M', date.getMonth(), monthNamesShort, monthNames); - break; - case 'y': - output += (lookAhead('y') ? date.getFullYear() : - (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); - break; - case '@': - output += date.getTime(); - break; - case "'": - if (lookAhead("'")) - output += "'"; - else - literal = true; - break; - default: - output += format.charAt(iFormat); - } - } - return output; - }, - - /* Extract all possible characters from the date format. */ - _possibleChars: function (format) { - var chars = ''; - var literal = false; - for (var iFormat = 0; iFormat < format.length; iFormat++) - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - chars += format.charAt(iFormat); - else - switch (format.charAt(iFormat)) { - case 'd': case 'm': case 'y': case '@': - chars += '0123456789'; - break; - case 'D': case 'M': - return null; // Accept anything - case "'": - if (lookAhead("'")) - chars += "'"; - else - literal = true; - break; - default: - chars += format.charAt(iFormat); - } - return chars; - }, - - /* Get a setting value, defaulting if necessary. */ - _get: function(inst, name) { - return inst.settings[name] !== undefined ? - inst.settings[name] : this._defaults[name]; - }, - - /* Parse existing date and initialise date picker. */ - _setDateFromField: function(inst) { - var dateFormat = this._get(inst, 'dateFormat'); - var dates = inst.input ? inst.input.val().split(this._get(inst, 'rangeSeparator')) : null; - inst.endDay = inst.endMonth = inst.endYear = null; - var date = defaultDate = this._getDefaultDate(inst); - if (dates.length > 0) { - var settings = this._getFormatConfig(inst); - if (dates.length > 1) { - date = this.parseDate(dateFormat, dates[1], settings) || defaultDate; - inst.endDay = date.getDate(); - inst.endMonth = date.getMonth(); - inst.endYear = date.getFullYear(); - } - try { - date = this.parseDate(dateFormat, dates[0], settings) || defaultDate; - } catch (e) { - this.log(e); - date = defaultDate; - } - } - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); - inst.currentDay = (dates[0] ? date.getDate() : 0); - inst.currentMonth = (dates[0] ? date.getMonth() : 0); - inst.currentYear = (dates[0] ? date.getFullYear() : 0); - this._adjustInstDate(inst); - }, - - /* Retrieve the default date shown on opening. */ - _getDefaultDate: function(inst) { - var date = this._determineDate(this._get(inst, 'defaultDate'), new Date()); - var minDate = this._getMinMaxDate(inst, 'min', true); - var maxDate = this._getMinMaxDate(inst, 'max'); - date = (minDate && date < minDate ? minDate : date); - date = (maxDate && date > maxDate ? maxDate : date); - return date; - }, - - /* A date may be specified as an exact value or a relative one. */ - _determineDate: function(date, defaultDate) { - var offsetNumeric = function(offset) { - var date = new Date(); - date.setUTCDate(date.getUTCDate() + offset); - return date; - }; - var offsetString = function(offset, getDaysInMonth) { - var date = new Date(); - var year = date.getFullYear(); - var month = date.getMonth(); - var day = date.getDate(); - var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; - var matches = pattern.exec(offset); - while (matches) { - switch (matches[2] || 'd') { - case 'd' : case 'D' : - day += parseInt(matches[1],10); break; - case 'w' : case 'W' : - day += parseInt(matches[1],10) * 7; break; - case 'm' : case 'M' : - month += parseInt(matches[1],10); - day = Math.min(day, getDaysInMonth(year, month)); - break; - case 'y': case 'Y' : - year += parseInt(matches[1],10); - day = Math.min(day, getDaysInMonth(year, month)); - break; - } - matches = pattern.exec(offset); - } - return new Date(year, month, day); - }; - date = (date == null ? defaultDate : - (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) : - (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date))); - return (date && date.toString() == 'Invalid Date' ? defaultDate : date); - }, - - /* Set the date(s) directly. */ - _setDate: function(inst, date, endDate) { - var clear = !(date); - var origMonth = inst.selectedMonth; - var origYear = inst.selectedYear; - date = this._determineDate(date, new Date()); - inst.selectedDay = inst.currentDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear(); - if (this._get(inst, 'rangeSelect')) { - if (endDate) { - endDate = this._determineDate(endDate, null); - inst.endDay = endDate.getDate(); - inst.endMonth = endDate.getMonth(); - inst.endYear = endDate.getFullYear(); - } else { - inst.endDay = inst.currentDay; - inst.endMonth = inst.currentMonth; - inst.endYear = inst.currentYear; - } - } - if (origMonth != inst.selectedMonth || origYear != inst.selectedYear) - this._notifyChange(inst); - this._adjustInstDate(inst); - if (inst.input) - inst.input.val(clear ? '' : this._formatDate(inst) + - (!this._get(inst, 'rangeSelect') ? '' : this._get(inst, 'rangeSeparator') + - this._formatDate(inst, inst.endDay, inst.endMonth, inst.endYear))); - }, - - /* Retrieve the date(s) directly. */ - _getDate: function(inst) { - var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : - new Date(inst.currentYear, inst.currentMonth, inst.currentDay)); - if (this._get(inst, 'rangeSelect')) { - return [inst.rangeStart || startDate, - (!inst.endYear ? inst.rangeStart || startDate : - new Date(inst.endYear, inst.endMonth, inst.endDay))]; - } else - return startDate; - }, - - /* Generate the HTML for the current state of the date picker. */ - _generateHTML: function(inst) { - var today = new Date(); - today = new Date(today.getFullYear(), today.getMonth(), today.getDate()); // clear time - var showStatus = this._get(inst, 'showStatus'); - var initStatus = this._get(inst, 'initStatus') || ' '; - var isRTL = this._get(inst, 'isRTL'); - // build the date picker HTML - var clear = (this._get(inst, 'mandatory') ? '' : - ''); - var controls = '
    ' + (isRTL ? '' : clear) + - '' + (isRTL ? clear : '') + '
    '; - var prompt = this._get(inst, 'prompt'); - var closeAtTop = this._get(inst, 'closeAtTop'); - var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); - var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); - var showBigPrevNext = this._get(inst, 'showBigPrevNext'); - var numMonths = this._getNumberOfMonths(inst); - var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); - var stepMonths = this._get(inst, 'stepMonths'); - var stepBigMonths = this._get(inst, 'stepBigMonths'); - var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); - var currentDate = (!inst.currentDay ? new Date(9999, 9, 9) : - new Date(inst.currentYear, inst.currentMonth, inst.currentDay)); - var minDate = this._getMinMaxDate(inst, 'min', true); - var maxDate = this._getMinMaxDate(inst, 'max'); - var drawMonth = inst.drawMonth - showCurrentAtPos; - var drawYear = inst.drawYear; - if (drawMonth < 0) { - drawMonth += 12; - drawYear--; - } - if (maxDate) { - var maxDraw = new Date(maxDate.getFullYear(), - maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate()); - maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); - while (new Date(drawYear, drawMonth, 1) > maxDraw) { - drawMonth--; - if (drawMonth < 0) { - drawMonth = 11; - drawYear--; - } - } - } - // controls and links - var prevText = this._get(inst, 'prevText'); - prevText = (!navigationAsDateFormat ? prevText : this.formatDate( - prevText, new Date(drawYear, drawMonth - stepMonths, 1), this._getFormatConfig(inst))); - var prevBigText = (showBigPrevNext ? this._get(inst, 'prevBigText') : ''); - prevBigText = (!navigationAsDateFormat ? prevBigText : this.formatDate( - prevBigText, new Date(drawYear, drawMonth - stepBigMonths, 1), this._getFormatConfig(inst))); - var prev = '
    ' + (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? - (showBigPrevNext ? '' + prevBigText + '' : '') + - '' + prevText + '' : - (hideIfNoPrevNext ? '' : '')) + '
    '; - var nextText = this._get(inst, 'nextText'); - nextText = (!navigationAsDateFormat ? nextText : this.formatDate( - nextText, new Date(drawYear, drawMonth + stepMonths, 1), this._getFormatConfig(inst))); - var nextBigText = (showBigPrevNext ? this._get(inst, 'nextBigText') : ''); - nextBigText = (!navigationAsDateFormat ? nextBigText : this.formatDate( - nextBigText, new Date(drawYear, drawMonth + stepBigMonths, 1), this._getFormatConfig(inst))); - var next = '
    ' + (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? - '' + nextText + '' + - (showBigPrevNext ? '' + nextBigText + '' : '') : - (hideIfNoPrevNext ? '' : '')) + '
    '; - var currentText = this._get(inst, 'currentText'); - var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); - currentText = (!navigationAsDateFormat ? currentText : - this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); - var html = (prompt ? '
    ' + prompt + '
    ' : '') + - (closeAtTop && !inst.inline ? controls : '') + - ''; - var firstDay = this._get(inst, 'firstDay'); - var changeFirstDay = this._get(inst, 'changeFirstDay'); - var dayNames = this._get(inst, 'dayNames'); - var dayNamesShort = this._get(inst, 'dayNamesShort'); - var dayNamesMin = this._get(inst, 'dayNamesMin'); - var monthNames = this._get(inst, 'monthNames'); - var beforeShowDay = this._get(inst, 'beforeShowDay'); - var highlightWeek = this._get(inst, 'highlightWeek'); - var showOtherMonths = this._get(inst, 'showOtherMonths'); - var showWeeks = this._get(inst, 'showWeeks'); - var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; - var weekStatus = this._get(inst, 'weekStatus'); - var status = (showStatus ? this._get(inst, 'dayStatus') || initStatus : ''); - var dateStatus = this._get(inst, 'statusForDate') || this.dateStatus; - var endDate = inst.endDay ? new Date(inst.endYear, inst.endMonth, inst.endDay) : currentDate; - for (var row = 0; row < numMonths[0]; row++) - for (var col = 0; col < numMonths[1]; col++) { - var selectedDate = new Date(drawYear, drawMonth, inst.selectedDay); - html += '
    ' + - this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, - selectedDate, row > 0 || col > 0, showStatus, initStatus, monthNames) + // draw month headers - '' + - '' + - (showWeeks ? '' + - this._get(inst, 'weekHeader') + '' : ''); - for (var dow = 0; dow < 7; dow++) { // days of the week - var day = (dow + firstDay) % 7; - var dayStatus = (status.indexOf('DD') > -1 ? status.replace(/DD/, dayNames[day]) : - status.replace(/D/, dayNamesShort[day])); - html += '= 5 ? ' class="ui-datepicker-week-end-cell"' : '') + '>' + - (!changeFirstDay ? '' + - dayNamesMin[day] + (changeFirstDay ? '' : '') + ''; - } - html += ''; - var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); - if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) - inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); - var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; - var tzDate = new Date(drawYear, drawMonth, 1 - leadDays); - var utcDate = new Date(drawYear, drawMonth, 1 - leadDays); - var printDate = utcDate; - var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate - for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows - html += '' + - (showWeeks ? '' : ''); - for (var dow = 0; dow < 7; dow++) { // create date picker days - var daySettings = (beforeShowDay ? - beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); - var otherMonth = (printDate.getMonth() != drawMonth); - var unselectable = otherMonth || !daySettings[0] || - (minDate && printDate < minDate) || (maxDate && printDate > maxDate); - html += ''; // display for this month - tzDate.setDate(tzDate.getDate() + 1); - utcDate.setUTCDate(utcDate.getUTCDate() + 1); - printDate = (tzDate > utcDate ? tzDate : utcDate); - } - html += ''; - } - drawMonth++; - if (drawMonth > 11) { - drawMonth = 0; - drawYear++; - } - html += '
    ' + - calculateWeek(printDate) + '' + // actions - (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months - (unselectable ? printDate.getDate() : '' + printDate.getDate() + '')) + '
    '; - } - html += (showStatus ? '
    ' + initStatus + '
    ' : '') + - (!closeAtTop && !inst.inline ? controls : '') + - '
    ' + - ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? - '' : ''); - return html; - }, - - /* Generate the month and year header. */ - _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, - selectedDate, secondary, showStatus, initStatus, monthNames) { - minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate); - var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); - var html = '
    '; - var monthHtml = ''; - // month selection - if (secondary || !this._get(inst, 'changeMonth')) - monthHtml += monthNames[drawMonth] + ' '; - else { - var inMinYear = (minDate && minDate.getFullYear() == drawYear); - var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); - monthHtml += ''; - } - if (!showMonthAfterYear) - html += monthHtml; - // year selection - if (secondary || !this._get(inst, 'changeYear')) - html += drawYear; - else { - // determine range of years to display - var years = this._get(inst, 'yearRange').split(':'); - var year = 0; - var endYear = 0; - if (years.length != 2) { - year = drawYear - 10; - endYear = drawYear + 10; - } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') { - year = endYear = new Date().getFullYear(); - year += parseInt(years[0], 10); - endYear += parseInt(years[1], 10); - } else { - year = parseInt(years[0], 10); - endYear = parseInt(years[1], 10); - } - year = (minDate ? Math.max(year, minDate.getFullYear()) : year); - endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); - html += ''; - } - if (showMonthAfterYear) - html += monthHtml; - html += '
    '; // Close datepicker_header - return html; - }, - - /* Provide code to set and clear the status panel. */ - _addStatus: function(showStatus, id, text, initStatus) { - return (showStatus ? ' onmouseover="jQuery(\'#ui-datepicker-status-' + id + - '\').html(\'' + (text || initStatus) + '\');" ' + - 'onmouseout="jQuery(\'#ui-datepicker-status-' + id + - '\').html(\'' + initStatus + '\');"' : ''); - }, - - /* Adjust one of the date sub-fields. */ - _adjustInstDate: function(inst, offset, period) { - var year = inst.drawYear + (period == 'Y' ? offset : 0); - var month = inst.drawMonth + (period == 'M' ? offset : 0); - var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + - (period == 'D' ? offset : 0); - var date = new Date(year, month, day); - // ensure it is within the bounds set - var minDate = this._getMinMaxDate(inst, 'min', true); - var maxDate = this._getMinMaxDate(inst, 'max'); - date = (minDate && date < minDate ? minDate : date); - date = (maxDate && date > maxDate ? maxDate : date); - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); - if (period == 'M' || period == 'Y') - this._notifyChange(inst); - }, - - /* Notify change of month/year. */ - _notifyChange: function(inst) { - var onChange = this._get(inst, 'onChangeMonthYear'); - if (onChange) - onChange.apply((inst.input ? inst.input[0] : null), - [inst.selectedYear, inst.selectedMonth + 1, inst]); - }, - - /* Determine the number of months to show. */ - _getNumberOfMonths: function(inst) { - var numMonths = this._get(inst, 'numberOfMonths'); - return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); - }, - - /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */ - _getMinMaxDate: function(inst, minMax, checkRange) { - var date = this._determineDate(this._get(inst, minMax + 'Date'), null); - if (date) { - date.setHours(0); - date.setMinutes(0); - date.setSeconds(0); - date.setMilliseconds(0); - } - return (!checkRange || !inst.rangeStart ? date : - (!date || inst.rangeStart > date ? inst.rangeStart : date)); - }, - - /* Find the number of days in a given month. */ - _getDaysInMonth: function(year, month) { - return 32 - new Date(year, month, 32).getDate(); - }, - - /* Find the day of the week of the first of a month. */ - _getFirstDayOfMonth: function(year, month) { - return new Date(year, month, 1).getDay(); - }, - - /* Determines if we should allow a "next/prev" month display change. */ - _canAdjustMonth: function(inst, offset, curYear, curMonth) { - var numMonths = this._getNumberOfMonths(inst); - var date = new Date(curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1); - if (offset < 0) - date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); - return this._isInRange(inst, date); - }, - - /* Is the given date in the accepted range? */ - _isInRange: function(inst, date) { - // during range selection, use minimum of selected date and range start - var newMinDate = (!inst.rangeStart ? null : - new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay)); - newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate); - var minDate = newMinDate || this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate)); - }, - - /* Provide the configuration settings for formatting/parsing. */ - _getFormatConfig: function(inst) { - var shortYearCutoff = this._get(inst, 'shortYearCutoff'); - shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : - new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); - return {shortYearCutoff: shortYearCutoff, - dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), - monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; - }, - - /* Format the given date for display. */ - _formatDate: function(inst, day, month, year) { - if (!day) { - inst.currentDay = inst.selectedDay; - inst.currentMonth = inst.selectedMonth; - inst.currentYear = inst.selectedYear; - } - var date = (day ? (typeof day == 'object' ? day : new Date(year, month, day)) : - new Date(inst.currentYear, inst.currentMonth, inst.currentDay)); - return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); - } -}); - -/* jQuery extend now ignores nulls! */ -function extendRemove(target, props) { - $.extend(target, props); - for (var name in props) - if (props[name] == null || props[name] == undefined) - target[name] = props[name]; - return target; -}; - -/* Determine whether an object is an array. */ -function isArray(a) { - return (a && (($.browser.safari && typeof a == 'object' && a.length) || - (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); -}; - -/* Invoke the datepicker functionality. - @param options string - a command, optionally followed by additional parameters or - Object - settings for attaching new datepicker functionality - @return jQuery object */ -$.fn.datepicker = function(options){ - - /* Initialise the date picker. */ - if (!$.datepicker.initialized) { - $(document.body).append($.datepicker.dpDiv). - mousedown($.datepicker._checkExternalClick); - $.datepicker.initialized = true; - } - - var otherArgs = Array.prototype.slice.call(arguments, 1); - if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate')) - return $.datepicker['_' + options + 'Datepicker']. - apply($.datepicker, [this[0]].concat(otherArgs)); - return this.each(function() { - typeof options == 'string' ? - $.datepicker['_' + options + 'Datepicker']. - apply($.datepicker, [this].concat(otherArgs)) : - $.datepicker._attachDatepicker(this, options); - }); -}; - -$.datepicker = new Datepicker(); // singleton instance -$.datepicker.initialized = false; -$.datepicker.uuid = new Date().getTime(); - -})(jQuery); +/* + * jQuery UI Datepicker 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * ui.core.js + */ + +(function($) { // hide the namespace + +$.extend($.ui, { datepicker: { version: "1.7.1" } }); + +var PROP_NAME = 'datepicker'; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false // True if right-to-left language, false if left-to-right + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'show', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearRange: '-10:+10', // Range of years to display in drop-down, + // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn) + showOtherMonths: false, // True to show dates in other months, false to leave blank + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'normal', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false // True to show button panel, false to not show it + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = $('
    '); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) + target.id = 'dp' + (++this.uuid); + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + $('
    '))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (appendText) + input[isRTL ? 'before' : 'after']('' + appendText + ''); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(target); + return false; + }); + } + input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst)); + this._updateDatepicker(inst); + this._updateAlternate(inst); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param dateText string - the initial date to display (in the current format) + @param onSelect function - the function(dateText) to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, dateText, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + var id = 'dp' + (++this.uuid); + this._dialogInput = $(''); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + this._dialogInput.val(dateText); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth; + var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.trigger.remove(); + $target.siblings('.' + this._appendClass).remove().end(). + removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter("button"). + each(function() { this.disabled = false; }).end(). + filter("img"). + css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter("button"). + each(function() { this.disabled = true; }).end(). + filter("img"). + css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or + @param value any - the new value for the setting (omit if above is an object) */ + _optionDatepicker: function(target, name, value) { + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + var inst = this._getInst(target); + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(null); + } + extendRemove(inst.settings, settings); + var date = new Date(); + extendRemove(inst, {rangeStart: null, // start of range + endDay: null, endMonth: null, endYear: null, // end of range + selectedDay: date.getDate(), selectedMonth: date.getMonth(), + selectedYear: date.getFullYear(), // starting point + currentDay: date.getDate(), currentMonth: date.getMonth(), + currentYear: date.getFullYear(), // current selection + drawMonth: date.getMonth(), drawYear: date.getFullYear()}); // month being drawn + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date + @param endDate Date - the new end date for a range (optional) */ + _setDateDatepicker: function(target, date, endDate) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date, endDate); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @return Date - the current date or + Date[2] - the current dates for a range */ + _getDateDatepicker: function(target) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(null, ''); + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + + ', td.' + $.datepicker._currentClass, inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + else + $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration')); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration')); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Pop-up the date picker for a given input field. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {})); + $.datepicker._hideDatepicker(null, ''); + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + inst.rangeStart = null; + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim') || 'show'; + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._datepickerShowing = true; + if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems + $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4, + height: inst.dpDiv.height() + 4}); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim](duration, postProcess); + if (duration == '') + postProcess(); + if (inst.input[0].type != 'hidden') + inst.input[0].focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var dims = {width: inst.dpDiv.width() + 4, + height: inst.dpDiv.height() + 4}; + var self = this; + inst.dpDiv.empty().append(this._generateHTML(inst)) + .find('iframe.ui-datepicker-cover'). + css({width: dims.width, height: dims.height}) + .end() + .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a') + .bind('mouseout', function(){ + $(this).removeClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover'); + }) + .bind('mouseover', function(){ + if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) { + $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + $(this).addClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover'); + } + }) + .end() + .find('.' + this._dayOverClass + ' a') + .trigger('mouseover') + .end(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + if (cols > 1) { + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + } else { + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + } + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst) + $(inst.input[0]).focus(); + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft(); + var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0; + offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0; + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) { + obj = obj.nextSibling; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker + @param duration string - the duration over which to close the date picker */ + _hideDatepicker: function(input, duration) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (inst.stayOpen) + this._selectDate('#' + inst.id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + inst.stayOpen = false; + if (this._datepickerShowing) { + duration = (duration != null ? duration : this._get(inst, 'duration')); + var showAnim = this._get(inst, 'showAnim'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if (duration != '' && $.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), + duration, postProcess); + else + inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess); + if (duration == '') + this._tidyDialog(inst); + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + this._curInst = null; + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if (($target.parents('#' + $.datepicker._mainDivId).length == 0) && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(null, ''); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst._selectingMonthYear = false; + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Restore input focus after not changing month/year. */ + _clickMonthYear: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (inst.input && inst._selectingMonthYear && !$.browser.msie) + inst.input[0].focus(); + inst._selectingMonthYear = !inst._selectingMonthYear; + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + if (inst.stayOpen) { + inst.endDay = inst.endMonth = inst.endYear = null; + } + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + if (inst.stayOpen) { + inst.rangeStart = this._daylightSavingAdjust( + new Date(inst.currentYear, inst.currentMonth, inst.currentDay)); + this._updateDatepicker(inst); + } + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + inst.stayOpen = false; + inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null; + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else if (!inst.stayOpen) { + this._hideDatepicker(null, this._get(inst, 'duration')); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input[0].focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate()); + var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan + var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7 + firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday + if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary + checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year + return $.datepicker.iso8601Week(checkDate); + } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year + firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7; + if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary + return 1; + } + } + return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + lookAhead(match); + var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2))); + var size = origSize; + var num = 0; + while (size > 0 && iValue < value.length && + value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') { + num = num * 10 + parseInt(value.charAt(iValue++),10); + size--; + } + if (size == origSize) + throw 'Missing number at position ' + iValue; + return num; + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = (lookAhead(match) ? longNames : shortNames); + var size = 0; + for (var j = 0; j < names.length; j++) + size = Math.max(size, names[j].length); + var name = ''; + var iInit = iValue; + while (size > 0 && iValue < value.length) { + name += value.charAt(iValue++); + for (var i = 0; i < names.length; i++) + if (name == names[i]) + return i + 1; + size--; + } + throw 'Unknown name at position ' + iInit; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/* + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + var doy = date.getDate(); + for (var m = date.getMonth() - 1; m >= 0; m--) + doy += this._getDaysInMonth(date.getFullYear(), m); + output += formatNumber('o', doy, 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst) { + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.input ? inst.input.val() : null; + inst.endDay = inst.endMonth = inst.endYear = null; + var date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + date = defaultDate; + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + var date = this._determineDate(this._get(inst, 'defaultDate'), new Date()); + var minDate = this._getMinMaxDate(inst, 'min', true); + var maxDate = this._getMinMaxDate(inst, 'max'); + date = (minDate && date < minDate ? minDate : date); + date = (maxDate && date > maxDate ? maxDate : date); + return date; + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset, getDaysInMonth) { + var date = new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + date = (date == null ? defaultDate : + (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date))); + date = (date && date.toString() == 'Invalid Date' ? defaultDate : date); + if (date) { + date.setHours(0); + date.setMinutes(0); + date.setSeconds(0); + date.setMilliseconds(0); + } + return this._daylightSavingAdjust(date); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, endDate) { + var clear = !(date); + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + date = this._determineDate(date, new Date()); + inst.selectedDay = inst.currentDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear(); + if (origMonth != inst.selectedMonth || origYear != inst.selectedYear) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var stepBigMonths = this._get(inst, 'stepBigMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min', true); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
    ' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
    ' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var endDate = inst.endDay ? this._daylightSavingAdjust( + new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
    '; + } + calender += '
    ' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
    ' + + ''; + var thead = ''; + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = ''; + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = otherMonth || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display for this month + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
    ' + // actions + (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
    ' + (isMultiMonth ? '
    ' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
    ' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + selectedDate, secondary, monthNames, monthNamesShort) { + minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate); + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
    '; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ' '; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? ' ' : ''); + // year selection + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var year = 0; + var endYear = 0; + if (years.length != 2) { + year = drawYear - 10; + endYear = drawYear + 10; + } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') { + year = drawYear + parseInt(years[0], 10); + endYear = drawYear + parseInt(years[1], 10); + } else { + year = parseInt(years[0], 10); + endYear = parseInt(years[1], 10); + } + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + html += ''; + } + if (showMonthAfterYear) + html += (secondary || changeMonth || changeYear ? ' ' : '') + monthHtml; + html += '
    '; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._daylightSavingAdjust(new Date(year, month, day)); + // ensure it is within the bounds set + var minDate = this._getMinMaxDate(inst, 'min', true); + var maxDate = this._getMinMaxDate(inst, 'max'); + date = (minDate && date < minDate ? minDate : date); + date = (maxDate && date > maxDate ? maxDate : date); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */ + _getMinMaxDate: function(inst, minMax, checkRange) { + var date = this._determineDate(this._get(inst, minMax + 'Date'), null); + return (!checkRange || !inst.rangeStart ? date : + (!date || inst.rangeStart > date ? inst.rangeStart : date)); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - new Date(year, month, 32).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date( + curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + // during range selection, use minimum of selected date and range start + var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust( + new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay))); + newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate); + var minDate = newMinDate || this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate)); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.7.1"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window.DP_jQuery = $; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.dialog.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.dialog.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.dialog.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.dialog.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,584 +1,650 @@ -/* - * jQuery UI Dialog @VERSION - * - * Copyright (c) 2008 Richard D. Worth (rdworth.org) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Dialog - * - * Depends: - * ui.core.js - * ui.draggable.js - * ui.resizable.js - */ -(function($) { - -var setDataSwitch = { - dragStart: "start.draggable", - drag: "drag.draggable", - dragStop: "stop.draggable", - maxHeight: "maxHeight.resizable", - minHeight: "minHeight.resizable", - maxWidth: "maxWidth.resizable", - minWidth: "minWidth.resizable", - resizeStart: "start.resizable", - resize: "drag.resizable", - resizeStop: "stop.resizable" -}; - -$.widget("ui.dialog", { - _init: function() { - this.originalTitle = this.element.attr('title'); - this.options.title = this.options.title || this.originalTitle; - - var self = this, - options = this.options, - - uiDialogContent = this.element - .removeAttr('title') - .addClass('ui-dialog-content') - .wrap('
    ') - .wrap('
    '), - - uiDialogContainer = (this.uiDialogContainer = uiDialogContent.parent()) - .addClass('ui-dialog-container') - .css({ - position: 'relative', - width: '100%', - height: '100%' - }), - - uiDialogTitlebar = (this.uiDialogTitlebar = $('
    ')) - .addClass('ui-dialog-titlebar') - .append('X') - .prependTo(uiDialogContainer), - - title = options.title || ' ', - titleId = $.ui.dialog.getTitleId(this.element), - uiDialogTitle = $('') - .addClass('ui-dialog-title') - .attr('id', titleId) - .html(title) - .prependTo(uiDialogTitlebar), - - uiDialog = (this.uiDialog = uiDialogContainer.parent()) - .appendTo(document.body) - .hide() - .addClass('ui-dialog') - .addClass(options.dialogClass) - // add content classes to dialog - // to inherit theme at top level of element - .addClass(uiDialogContent.attr('className')) - .removeClass('ui-dialog-content') - .css({ - position: 'absolute', - width: options.width, - height: options.height, - overflow: 'hidden', - zIndex: options.zIndex - }) - // setting tabIndex makes the div focusable - // setting outline to 0 prevents a border on focus in Mozilla - .attr('tabIndex', -1).css('outline', 0).keydown(function(ev) { - (options.closeOnEscape && ev.keyCode - && ev.keyCode == $.keyCode.ESCAPE && self.close()); - }) - .mousedown(function() { - self._moveToTop(); - }), - - uiDialogButtonPane = (this.uiDialogButtonPane = $('
    ')) - .addClass('ui-dialog-buttonpane') - .css({ - position: 'absolute', - bottom: 0 - }) - .appendTo(uiDialog); - - this.uiDialogTitlebarClose = $('.ui-dialog-titlebar-close', uiDialogTitlebar) - .hover( - function() { - $(this).addClass('ui-dialog-titlebar-close-hover'); - }, - function() { - $(this).removeClass('ui-dialog-titlebar-close-hover'); - } - ) - .mousedown(function(ev) { - ev.stopPropagation(); - }) - .click(function() { - self.close(); - return false; - }); - - uiDialogTitlebar.find("*").add(uiDialogTitlebar).each(function() { - $.ui.disableSelection(this); - }); - - (options.draggable && $.fn.draggable && this._makeDraggable()); - (options.resizable && $.fn.resizable && this._makeResizable()); - - this._createButtons(options.buttons); - this._isOpen = false; - - (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe()); - (options.autoOpen && this.open()); - }, - - destroy: function() { - (this.overlay && this.overlay.destroy()); - this.uiDialog.hide(); - this.element - .unbind('.dialog') - .removeData('dialog') - .removeClass('ui-dialog-content') - .hide().appendTo('body'); - this.uiDialog.remove(); - - (this.originalTitle && this.element.attr('title', this.originalTitle)); - }, - - close: function() { - if (false === this._trigger('beforeclose', null, { options: this.options })) { - return; - } - - (this.overlay && this.overlay.destroy()); - this.uiDialog - .hide(this.options.hide) - .unbind('keypress.ui-dialog'); - - this._trigger('close', null, { options: this.options }); - $.ui.dialog.overlay.resize(); - - this._isOpen = false; - }, - - isOpen: function() { - return this._isOpen; - }, - - open: function() { - if (this._isOpen) { return; } - - this.overlay = this.options.modal ? new $.ui.dialog.overlay(this) : null; - (this.uiDialog.next().length && this.uiDialog.appendTo('body')); - this._position(this.options.position); - this.uiDialog.show(this.options.show); - (this.options.autoResize && this._size()); - this._moveToTop(true); - - // prevent tabbing out of modal dialogs - (this.options.modal && this.uiDialog.bind('keypress.ui-dialog', function(e) { - if (e.keyCode != $.keyCode.TAB) { - return; - } - - var tabbables = $(':tabbable', this), - first = tabbables.filter(':first')[0], - last = tabbables.filter(':last')[0]; - - if (e.target == last && !e.shiftKey) { - setTimeout(function() { - first.focus(); - }, 1); - } else if (e.target == first && e.shiftKey) { - setTimeout(function() { - last.focus(); - }, 1); - } - })); - - this.uiDialog.find(':tabbable:first').focus(); - this._trigger('open', null, { options: this.options }); - this._isOpen = true; - }, - - _createButtons: function(buttons) { - var self = this, - hasButtons = false, - uiDialogButtonPane = this.uiDialogButtonPane; - - // remove any existing buttons - uiDialogButtonPane.empty().hide(); - - $.each(buttons, function() { return !(hasButtons = true); }); - if (hasButtons) { - uiDialogButtonPane.show(); - $.each(buttons, function(name, fn) { - $('') - .text(name) - .click(function() { fn.apply(self.element[0], arguments); }) - .appendTo(uiDialogButtonPane); - }); - } - }, - - _makeDraggable: function() { - var self = this, - options = this.options; - - this.uiDialog.draggable({ - cancel: '.ui-dialog-content', - helper: options.dragHelper, - handle: '.ui-dialog-titlebar', - start: function() { - self._moveToTop(); - (options.dragStart && options.dragStart.apply(self.element[0], arguments)); - }, - drag: function() { - (options.drag && options.drag.apply(self.element[0], arguments)); - }, - stop: function() { - (options.dragStop && options.dragStop.apply(self.element[0], arguments)); - $.ui.dialog.overlay.resize(); - } - }); - }, - - _makeResizable: function(handles) { - handles = (handles === undefined ? this.options.resizable : handles); - var self = this, - options = this.options, - resizeHandles = typeof handles == 'string' - ? handles - : 'n,e,s,w,se,sw,ne,nw'; - - this.uiDialog.resizable({ - cancel: '.ui-dialog-content', - helper: options.resizeHelper, - maxWidth: options.maxWidth, - maxHeight: options.maxHeight, - minWidth: options.minWidth, - minHeight: options.minHeight, - start: function() { - (options.resizeStart && options.resizeStart.apply(self.element[0], arguments)); - }, - resize: function() { - (options.autoResize && self._size.apply(self)); - (options.resize && options.resize.apply(self.element[0], arguments)); - }, - handles: resizeHandles, - stop: function() { - (options.autoResize && self._size.apply(self)); - (options.resizeStop && options.resizeStop.apply(self.element[0], arguments)); - $.ui.dialog.overlay.resize(); - } - }); - }, - - // the force parameter allows us to move modal dialogs to their correct - // position on open - _moveToTop: function(force) { - - if ((this.options.modal && !force) - || (!this.options.stack && !this.options.modal)) { - return this._trigger('focus', null, { options: this.options }); - } - - var maxZ = this.options.zIndex, options = this.options; - $('.ui-dialog:visible').each(function() { - maxZ = Math.max(maxZ, parseInt($(this).css('z-index'), 10) || options.zIndex); - }); - (this.overlay && this.overlay.$el.css('z-index', ++maxZ)); - this.uiDialog.css('z-index', ++maxZ); - - this._trigger('focus', null, { options: this.options }); - }, - - _position: function(pos) { - var wnd = $(window), doc = $(document), - pTop = doc.scrollTop(), pLeft = doc.scrollLeft(), - minTop = pTop; - - if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) { - pos = [ - pos == 'right' || pos == 'left' ? pos : 'center', - pos == 'top' || pos == 'bottom' ? pos : 'middle' - ]; - } - if (pos.constructor != Array) { - pos = ['center', 'middle']; - } - if (pos[0].constructor == Number) { - pLeft += pos[0]; - } else { - switch (pos[0]) { - case 'left': - pLeft += 0; - break; - case 'right': - pLeft += wnd.width() - this.uiDialog.width(); - break; - default: - case 'center': - pLeft += (wnd.width() - this.uiDialog.width()) / 2; - } - } - if (pos[1].constructor == Number) { - pTop += pos[1]; - } else { - switch (pos[1]) { - case 'top': - pTop += 0; - break; - case 'bottom': - pTop += wnd.height() - this.uiDialog.height(); - break; - default: - case 'middle': - pTop += (wnd.height() - this.uiDialog.height()) / 2; - } - } - - // prevent the dialog from being too high (make sure the titlebar - // is accessible) - pTop = Math.max(pTop, minTop); - this.uiDialog.css({top: pTop, left: pLeft}); - }, - - _setData: function(key, value){ - (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value)); - switch (key) { - case "buttons": - this._createButtons(value); - break; - case "draggable": - (value - ? this._makeDraggable() - : this.uiDialog.draggable('destroy')); - break; - case "height": - this.uiDialog.height(value); - break; - case "position": - this._position(value); - break; - case "resizable": - var uiDialog = this.uiDialog, - isResizable = this.uiDialog.is(':data(resizable)'); - - // currently resizable, becoming non-resizable - (isResizable && !value && uiDialog.resizable('destroy')); - - // currently resizable, changing handles - (isResizable && typeof value == 'string' && - uiDialog.resizable('option', 'handles', value)); - - // currently non-resizable, becoming resizable - (isResizable || this._makeResizable(value)); - - break; - case "title": - $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' '); - break; - case "width": - this.uiDialog.width(value); - break; - } - - $.widget.prototype._setData.apply(this, arguments); - }, - - _size: function() { - var container = this.uiDialogContainer, - titlebar = this.uiDialogTitlebar, - content = this.element, - tbMargin = (parseInt(content.css('margin-top'), 10) || 0) - + (parseInt(content.css('margin-bottom'), 10) || 0), - lrMargin = (parseInt(content.css('margin-left'), 10) || 0) - + (parseInt(content.css('margin-right'), 10) || 0); - content.height(container.height() - titlebar.outerHeight() - tbMargin); - content.width(container.width() - lrMargin); - } -}); - -$.extend($.ui.dialog, { - defaults: { - autoOpen: true, - autoResize: true, - bgiframe: false, - buttons: {}, - closeOnEscape: true, - draggable: true, - height: 200, - minHeight: 100, - minWidth: 150, - modal: false, - overlay: {}, - position: 'center', - resizable: true, - stack: true, - width: 300, - zIndex: 1000 - }, - - getter: 'isOpen', - - uuid: 0, - getTitleId: function($el) { - return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid); - }, - - overlay: function(dialog) { - this.$el = $.ui.dialog.overlay.create(dialog); - } -}); - -$.extend($.ui.dialog.overlay, { - instances: [], - events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), - function(e) { return e + '.dialog-overlay'; }).join(' '), - create: function(dialog) { - if (this.instances.length === 0) { - // prevent use of anchors and inputs - // we use a setTimeout in case the overlay is created from an - // event that we're going to be cancelling (see #2804) - setTimeout(function() { - $('a, :input').bind($.ui.dialog.overlay.events, function() { - // allow use of the element if inside a dialog and - // - there are no modal dialogs - // - there are modal dialogs, but we are in front of the topmost modal - var allow = false; - var $dialog = $(this).parents('.ui-dialog'); - if ($dialog.length) { - var $overlays = $('.ui-dialog-overlay'); - if ($overlays.length) { - var maxZ = parseInt($overlays.css('z-index'), 10); - $overlays.each(function() { - maxZ = Math.max(maxZ, parseInt($(this).css('z-index'), 10)); - }); - allow = parseInt($dialog.css('z-index'), 10) > maxZ; - } else { - allow = true; - } - } - return allow; - }); - }, 1); - - // allow closing by pressing the escape key - $(document).bind('keydown.dialog-overlay', function(e) { - (dialog.options.closeOnEscape && e.keyCode - && e.keyCode == $.keyCode.ESCAPE && dialog.close()); - }); - - // handle window resize - $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); - } - - var $el = $('
    ').appendTo(document.body) - .addClass('ui-dialog-overlay').css($.extend({ - borderWidth: 0, margin: 0, padding: 0, - position: 'absolute', top: 0, left: 0, - width: this.width(), - height: this.height() - }, dialog.options.overlay)); - - (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe()); - - this.instances.push($el); - return $el; - }, - - destroy: function($el) { - this.instances.splice($.inArray(this.instances, $el), 1); - - if (this.instances.length === 0) { - $('a, :input').add([document, window]).unbind('.dialog-overlay'); - } - - $el.remove(); - }, - - height: function() { - // handle IE 6 - if ($.browser.msie && $.browser.version < 7) { - var scrollHeight = Math.max( - document.documentElement.scrollHeight, - document.body.scrollHeight - ); - var offsetHeight = Math.max( - document.documentElement.offsetHeight, - document.body.offsetHeight - ); - - if (scrollHeight < offsetHeight) { - return $(window).height() + 'px'; - } else { - return scrollHeight + 'px'; - } - // handle Opera - } else if ($.browser.opera) { - return Math.max( - window.innerHeight, - $(document).height() - ) + 'px'; - // handle "good" browsers - } else { - return $(document).height() + 'px'; - } - }, - - width: function() { - // handle IE 6 - if ($.browser.msie && $.browser.version < 7) { - var scrollWidth = Math.max( - document.documentElement.scrollWidth, - document.body.scrollWidth - ); - var offsetWidth = Math.max( - document.documentElement.offsetWidth, - document.body.offsetWidth - ); - - if (scrollWidth < offsetWidth) { - return $(window).width() + 'px'; - } else { - return scrollWidth + 'px'; - } - // handle Opera - } else if ($.browser.opera) { - return Math.max( - window.innerWidth, - $(document).width() - ) + 'px'; - // handle "good" browsers - } else { - return $(document).width() + 'px'; - } - }, - - resize: function() { - /* If the dialog is draggable and the user drags it past the - * right edge of the window, the document becomes wider so we - * need to stretch the overlay. If the user then drags the - * dialog back to the left, the document will become narrower, - * so we need to shrink the overlay to the appropriate size. - * This is handled by shrinking the overlay before setting it - * to the full document size. - */ - var $overlays = $([]); - $.each($.ui.dialog.overlay.instances, function() { - $overlays = $overlays.add(this); - }); - - $overlays.css({ - width: 0, - height: 0 - }).css({ - width: $.ui.dialog.overlay.width(), - height: $.ui.dialog.overlay.height() - }); - } -}); - -$.extend($.ui.dialog.overlay.prototype, { - destroy: function() { - $.ui.dialog.overlay.destroy(this.$el); - } -}); - -})(jQuery); +/* + * jQuery UI Dialog 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * ui.core.js + * ui.draggable.js + * ui.resizable.js + */ +(function($) { + +var setDataSwitch = { + dragStart: "start.draggable", + drag: "drag.draggable", + dragStop: "stop.draggable", + maxHeight: "maxHeight.resizable", + minHeight: "minHeight.resizable", + maxWidth: "maxWidth.resizable", + minWidth: "minWidth.resizable", + resizeStart: "start.resizable", + resize: "drag.resizable", + resizeStop: "stop.resizable" + }, + + uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all '; + +$.widget("ui.dialog", { + + _init: function() { + this.originalTitle = this.element.attr('title'); + + var self = this, + options = this.options, + + title = options.title || this.originalTitle || ' ', + titleId = $.ui.dialog.getTitleId(this.element), + + uiDialog = (this.uiDialog = $('
    ')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + position: 'absolute', + overflow: 'hidden', + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + (options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event)); + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = this.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (this.uiDialogTitlebar = $('
    ')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .mousedown(function(ev) { + ev.stopPropagation(); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + (options.draggable && $.fn.draggable && this._makeDraggable()); + (options.resizable && $.fn.resizable && this._makeResizable()); + + this._createButtons(options.buttons); + this._isOpen = false; + + (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe()); + (options.autoOpen && this.open()); + + }, + + destroy: function() { + (this.overlay && this.overlay.destroy()); + this.uiDialog.hide(); + this.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + this.uiDialog.remove(); + + (this.originalTitle && this.element.attr('title', this.originalTitle)); + }, + + close: function(event) { + var self = this; + + if (false === self._trigger('beforeclose', event)) { + return; + } + + (self.overlay && self.overlay.destroy()); + self.uiDialog.unbind('keypress.ui-dialog'); + + (self.options.hide + ? self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }) + : self.uiDialog.hide() && self._trigger('close', event)); + + $.ui.dialog.overlay.resize(); + + self._isOpen = false; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + + if ((this.options.modal && !force) + || (!this.options.stack && !this.options.modal)) { + return this._trigger('focus', event); + } + + if (this.options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = this.options.zIndex; + } + (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ)); + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') }; + this.uiDialog.css('z-index', ++$.ui.dialog.maxZ); + this.element.attr(saveScroll); + this._trigger('focus', event); + }, + + open: function() { + if (this._isOpen) { return; } + + var options = this.options, + uiDialog = this.uiDialog; + + this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null; + (uiDialog.next().length && uiDialog.appendTo('body')); + this._size(); + this._position(options.position); + uiDialog.show(options.show); + this.moveToTop(true); + + // prevent tabbing out of modal dialogs + (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode != $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first')[0], + last = tabbables.filter(':last')[0]; + + if (event.target == last && !event.shiftKey) { + setTimeout(function() { + first.focus(); + }, 1); + } else if (event.target == first && event.shiftKey) { + setTimeout(function() { + last.focus(); + }, 1); + } + })); + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $([]) + .add(uiDialog.find('.ui-dialog-content :tabbable:first')) + .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first')) + .add(uiDialog) + .filter(':first') + .focus(); + + this._trigger('open'); + this._isOpen = true; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
    ') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ); + + // if we already have a button pane, remove it + this.uiDialog.find('.ui-dialog-buttonpane').remove(); + + (typeof buttons == 'object' && buttons !== null && + $.each(buttons, function() { return !(hasButtons = true); })); + if (hasButtons) { + $.each(buttons, function(name, fn) { + $('') + .addClass( + 'ui-state-default ' + + 'ui-corner-all' + ) + .text(name) + .click(function() { fn.apply(self.element[0], arguments); }) + .hover( + function() { + $(this).addClass('ui-state-hover'); + }, + function() { + $(this).removeClass('ui-state-hover'); + } + ) + .focus(function() { + $(this).addClass('ui-state-focus'); + }) + .blur(function() { + $(this).removeClass('ui-state-focus'); + }) + .appendTo(uiDialogButtonPane); + }); + uiDialogButtonPane.appendTo(this.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = this.options, + heightBeforeDrag; + + this.uiDialog.draggable({ + cancel: '.ui-dialog-content', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function() { + heightBeforeDrag = options.height; + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + (options.dragStart && options.dragStart.apply(self.element[0], arguments)); + }, + drag: function() { + (options.drag && options.drag.apply(self.element[0], arguments)); + }, + stop: function() { + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + (options.dragStop && options.dragStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = this.options, + resizeHandles = typeof handles == 'string' + ? handles + : 'n,e,s,w,se,sw,ne,nw'; + + this.uiDialog.resizable({ + cancel: '.ui-dialog-content', + alsoResize: this.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: options.minHeight, + start: function() { + $(this).addClass("ui-dialog-resizing"); + (options.resizeStart && options.resizeStart.apply(self.element[0], arguments)); + }, + resize: function() { + (options.resize && options.resize.apply(self.element[0], arguments)); + }, + handles: resizeHandles, + stop: function() { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + (options.resizeStop && options.resizeStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _position: function(pos) { + var wnd = $(window), doc = $(document), + pTop = doc.scrollTop(), pLeft = doc.scrollLeft(), + minTop = pTop; + + if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) { + pos = [ + pos == 'right' || pos == 'left' ? pos : 'center', + pos == 'top' || pos == 'bottom' ? pos : 'middle' + ]; + } + if (pos.constructor != Array) { + pos = ['center', 'middle']; + } + if (pos[0].constructor == Number) { + pLeft += pos[0]; + } else { + switch (pos[0]) { + case 'left': + pLeft += 0; + break; + case 'right': + pLeft += wnd.width() - this.uiDialog.outerWidth(); + break; + default: + case 'center': + pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2; + } + } + if (pos[1].constructor == Number) { + pTop += pos[1]; + } else { + switch (pos[1]) { + case 'top': + pTop += 0; + break; + case 'bottom': + pTop += wnd.height() - this.uiDialog.outerHeight(); + break; + default: + case 'middle': + pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2; + } + } + + // prevent the dialog from being too high (make sure the titlebar + // is accessible) + pTop = Math.max(pTop, minTop); + this.uiDialog.css({top: pTop, left: pLeft}); + }, + + _setData: function(key, value){ + (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value)); + switch (key) { + case "buttons": + this._createButtons(value); + break; + case "closeText": + this.uiDialogTitlebarCloseText.text(value); + break; + case "dialogClass": + this.uiDialog + .removeClass(this.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "draggable": + (value + ? this._makeDraggable() + : this.uiDialog.draggable('destroy')); + break; + case "height": + this.uiDialog.height(value); + break; + case "position": + this._position(value); + break; + case "resizable": + var uiDialog = this.uiDialog, + isResizable = this.uiDialog.is(':data(resizable)'); + + // currently resizable, becoming non-resizable + (isResizable && !value && uiDialog.resizable('destroy')); + + // currently resizable, changing handles + (isResizable && typeof value == 'string' && + uiDialog.resizable('option', 'handles', value)); + + // currently non-resizable, becoming resizable + (isResizable || this._makeResizable(value)); + break; + case "title": + $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' '); + break; + case "width": + this.uiDialog.width(value); + break; + } + + $.widget.prototype._setData.apply(this, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options; + + // reset content sizing + this.element.css({ + height: 0, + minHeight: 0, + width: 'auto' + }); + + // reset wrapper sizing + // determine the height of all the non-content elements + var nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + + this.element + .css({ + minHeight: Math.max(options.minHeight - nonContentHeight, 0), + height: options.height == 'auto' + ? 'auto' + : Math.max(options.height - nonContentHeight, 0) + }); + } +}); + +$.extend($.ui.dialog, { + version: "1.7.1", + defaults: { + autoOpen: true, + bgiframe: false, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: 'center', + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + getter: 'isOpen', + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid); + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + $(document).bind($.ui.dialog.overlay.events, function(event) { + var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0; + return (dialogZ > $.ui.dialog.overlay.maxZ); + }); + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + (dialog.options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event)); + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = $('
    ').appendTo(document.body) + .addClass('ui-widget-overlay').css({ + width: this.width(), + height: this.height() + }); + + (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe()); + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + this.instances.splice($.inArray(this.instances, $el), 1); + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + }, + + height: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + var offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + var offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.draggable.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.draggable.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.draggable.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.draggable.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,672 +1,766 @@ -/* - * jQuery UI Draggable @VERSION - * - * Copyright (c) 2008 Paul Bakaus - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Draggables - * - * Depends: - * ui.core.js - */ -(function($) { - -$.widget("ui.draggable", $.extend({}, $.ui.mouse, { - - getHandle: function(e) { - - var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; - $(this.options.handle, this.element) - .find("*") - .andSelf() - .each(function() { - if(this == e.target) handle = true; - }); - - return handle; - - }, - - createHelper: function() { - - var o = this.options; - var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [e])) : (o.helper == 'clone' ? this.element.clone() : this.element); - - if(!helper.parents('body').length) - helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); - - if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) - helper.css("position", "absolute"); - - return helper; - - }, - - - _init: function() { - - if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) - this.element[0].style.position = 'relative'; - - (this.options.cssNamespace && this.element.addClass(this.options.cssNamespace+"-draggable")); - (this.options.disabled && this.element.addClass('ui-draggable-disabled')); - - this._mouseInit(); - - }, - - _mouseCapture: function(e) { - - var o = this.options; - - if (this.helper || o.disabled || $(e.target).is('.ui-resizable-handle')) - return false; - - //Quit if we're not on a valid handle - this.handle = this.getHandle(e); - if (!this.handle) - return false; - - return true; - - }, - - _mouseStart: function(e) { - - var o = this.options; - - //Create and append the visible helper - this.helper = this.createHelper(); - - //If ddmanager is used for droppables, set the global draggable - if($.ui.ddmanager) - $.ui.ddmanager.current = this; - - /* - * - Position generation - - * This block generates everything position related - it's the core of draggables. - */ - - this.margins = { //Cache the margins - left: (parseInt(this.element.css("marginLeft"),10) || 0), - top: (parseInt(this.element.css("marginTop"),10) || 0) - }; - - this.cssPosition = this.helper.css("position"); //Store the helper's css position - this.offset = this.element.offset(); //The element's absolute position on the page - this.offset = { //Substract the margins from the element's absolute offset - top: this.offset.top - this.margins.top, - left: this.offset.left - this.margins.left - }; - - this.offset.click = { //Where the click happened, relative to the element - left: e.pageX - this.offset.left, - top: e.pageY - this.offset.top - }; - - //Calling this method cached the next parents that have scrollTop / scrollLeft attached - this.cacheScrollParents(); - - - this.offsetParent = this.helper.offsetParent(); var po = this.offsetParent.offset(); //Get the offsetParent and cache its position - if(this.offsetParent[0] == document.body && $.browser.mozilla) po = { top: 0, left: 0 }; //Ugly FF3 fix - this.offset.parent = { //Store its position plus border - top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), - left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) - }; - - //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper - if(this.cssPosition == "relative") { - var p = this.element.position(); - this.offset.relative = { - top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollTopParent.scrollTop(), - left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollLeftParent.scrollLeft() - }; - } else { - this.offset.relative = { top: 0, left: 0 }; - } - - //Generate the original position - this.originalPosition = this._generatePosition(e); - - //Cache the helper size - this.cacheHelperProportions(); - - //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied - if(o.cursorAt) - this.adjustOffsetFromHelper(o.cursorAt); - - //Cache later used stuff - $.extend(this, { - PAGEY_INCLUDES_SCROLL: (this.cssPosition == "absolute" && (!this.scrollTopParent[0].tagName || (/(html|body)/i).test(this.scrollTopParent[0].tagName))), - PAGEX_INCLUDES_SCROLL: (this.cssPosition == "absolute" && (!this.scrollLeftParent[0].tagName || (/(html|body)/i).test(this.scrollLeftParent[0].tagName))), - OFFSET_PARENT_NOT_SCROLL_PARENT_Y: this.scrollTopParent[0] != this.offsetParent[0] && !(this.scrollTopParent[0] == document && (/(body|html)/i).test(this.offsetParent[0].tagName)), - OFFSET_PARENT_NOT_SCROLL_PARENT_X: this.scrollLeftParent[0] != this.offsetParent[0] && !(this.scrollLeftParent[0] == document && (/(body|html)/i).test(this.offsetParent[0].tagName)) - }); - - if(o.containment) - this.setContainment(); - - - //Call plugins and callbacks - this._propagate("start", e); - - //Recache the helper size - this.cacheHelperProportions(); - - //Prepare the droppable offsets - if ($.ui.ddmanager && !o.dropBehaviour) - $.ui.ddmanager.prepareOffsets(this, e); - - this.helper.addClass("ui-draggable-dragging"); - this._mouseDrag(e); //Execute the drag once - this causes the helper not to be visible before getting its correct position - return true; - }, - - cacheScrollParents: function() { - - this.scrollTopParent = function(el) { - do { if(/auto|scroll/.test(el.css('overflow')) || (/auto|scroll/).test(el.css('overflow-y'))) return el; el = el.parent(); } while (el[0].parentNode); - return $(document); - }(this.helper); - this.scrollLeftParent = function(el) { - do { if(/auto|scroll/.test(el.css('overflow')) || (/auto|scroll/).test(el.css('overflow-x'))) return el; el = el.parent(); } while (el[0].parentNode); - return $(document); - }(this.helper); - - }, - - adjustOffsetFromHelper: function(obj) { - if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; - if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; - if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; - if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; - }, - - cacheHelperProportions: function() { - this.helperProportions = { - width: this.helper.outerWidth(), - height: this.helper.outerHeight() - }; - }, - - setContainment: function() { - - var o = this.options; - if(o.containment == 'parent') o.containment = this.helper[0].parentNode; - if(o.containment == 'document' || o.containment == 'window') this.containment = [ - 0 - this.offset.relative.left - this.offset.parent.left, - 0 - this.offset.relative.top - this.offset.parent.top, - $(o.containment == 'document' ? document : window).width() - this.offset.relative.left - this.offset.parent.left - this.helperProportions.width - this.margins.left - (parseInt(this.element.css("marginRight"),10) || 0), - ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.offset.relative.top - this.offset.parent.top - this.helperProportions.height - this.margins.top - (parseInt(this.element.css("marginBottom"),10) || 0) - ]; - - if(!(/^(document|window|parent)$/).test(o.containment)) { - var ce = $(o.containment)[0]; - var co = $(o.containment).offset(); - var over = ($(ce).css("overflow") != 'hidden'); - - this.containment = [ - co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) - this.offset.relative.left - this.offset.parent.left, - co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) - this.offset.relative.top - this.offset.parent.top, - co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - this.offset.relative.left - this.offset.parent.left - this.helperProportions.width - this.margins.left - (parseInt(this.element.css("marginRight"),10) || 0), - co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - this.offset.relative.top - this.offset.parent.top - this.helperProportions.height - this.margins.top - (parseInt(this.element.css("marginBottom"),10) || 0) - ]; - } - - }, - - - _convertPositionTo: function(d, pos) { - - if(!pos) pos = this.position; - var mod = d == "absolute" ? 1 : -1; - - return { - top: ( - pos.top // the calculated relative position - + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent - + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) - - (this.cssPosition == "fixed" || this.PAGEY_INCLUDES_SCROLL || this.OFFSET_PARENT_NOT_SCROLL_PARENT_Y ? 0 : this.scrollTopParent.scrollTop()) * mod // The offsetParent's scroll position, not if the element is fixed - + (this.cssPosition == "fixed" ? $(document).scrollTop() : 0) * mod - + this.margins.top * mod //Add the margin (you don't want the margin counting in intersection methods) - ), - left: ( - pos.left // the calculated relative position - + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent - + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) - - (this.cssPosition == "fixed" || this.PAGEX_INCLUDES_SCROLL || this.OFFSET_PARENT_NOT_SCROLL_PARENT_X ? 0 : this.scrollLeftParent.scrollLeft()) * mod // The offsetParent's scroll position, not if the element is fixed - + (this.cssPosition == "fixed" ? $(document).scrollLeft() : 0) * mod - + this.margins.left * mod //Add the margin (you don't want the margin counting in intersection methods) - ) - }; - }, - _generatePosition: function(e) { - - var o = this.options; - var position = { - top: ( - e.pageY // The absolute mouse position - - this.offset.click.top // Click offset (relative to the element) - - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent - - this.offset.parent.top // The offsetParent's offset without borders (offset + border) - + (this.cssPosition == "fixed" || this.PAGEY_INCLUDES_SCROLL || this.OFFSET_PARENT_NOT_SCROLL_PARENT_Y ? 0 : this.scrollTopParent.scrollTop()) // The offsetParent's scroll position, not if the element is fixed - - (this.cssPosition == "fixed" ? $(document).scrollTop() : 0) - ), - left: ( - e.pageX // The absolute mouse position - - this.offset.click.left // Click offset (relative to the element) - - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent - - this.offset.parent.left // The offsetParent's offset without borders (offset + border) - + (this.cssPosition == "fixed" || this.PAGEX_INCLUDES_SCROLL || this.OFFSET_PARENT_NOT_SCROLL_PARENT_X ? 0 : this.scrollLeftParent.scrollLeft()) // The offsetParent's scroll position, not if the element is fixed - - (this.cssPosition == "fixed" ? $(document).scrollLeft() : 0) - ) - }; - - if(!this.originalPosition) return position; //If we are not dragging yet, we won't check for options - - /* - * - Position constraining - - * Constrain the position to a mix of grid, containment. - */ - if(this.containment) { - if(position.left < this.containment[0]) position.left = this.containment[0]; - if(position.top < this.containment[1]) position.top = this.containment[1]; - if(position.left > this.containment[2]) position.left = this.containment[2]; - if(position.top > this.containment[3]) position.top = this.containment[3]; - } - - if(o.grid) { - var top = this.originalPosition.top + Math.round((position.top - this.originalPosition.top) / o.grid[1]) * o.grid[1]; - position.top = this.containment ? (!(top < this.containment[1] || top > this.containment[3]) ? top : (!(top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; - - var left = this.originalPosition.left + Math.round((position.left - this.originalPosition.left) / o.grid[0]) * o.grid[0]; - position.left = this.containment ? (!(left < this.containment[0] || left > this.containment[2]) ? left : (!(left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; - } - - return position; - }, - _mouseDrag: function(e) { - - //Compute the helpers position - this.position = this._generatePosition(e); - this.positionAbs = this._convertPositionTo("absolute"); - - //Call plugins and callbacks and use the resulting position if something is returned - this.position = this._propagate("drag", e) || this.position; - - if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; - if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; - if($.ui.ddmanager) $.ui.ddmanager.drag(this, e); - - return false; - }, - _mouseStop: function(e) { - - //If we are using droppables, inform the manager about the drop - var dropped = false; - if ($.ui.ddmanager && !this.options.dropBehaviour) - var dropped = $.ui.ddmanager.drop(this, e); - - if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { - var self = this; - $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10) || 500, function() { - self._propagate("stop", e); - self._clear(); - }); - } else { - this._propagate("stop", e); - this._clear(); - } - - return false; - }, - _clear: function() { - this.helper.removeClass("ui-draggable-dragging"); - if(this.options.helper != 'original' && !this.cancelHelperRemoval) this.helper.remove(); - //if($.ui.ddmanager) $.ui.ddmanager.current = null; - this.helper = null; - this.cancelHelperRemoval = false; - }, - - // From now on bulk stuff - mainly helpers - plugins: {}, - uiHash: function(e) { - return { - helper: this.helper, - position: this.position, - absolutePosition: this.positionAbs, - options: this.options - }; - }, - _propagate: function(n,e) { - $.ui.plugin.call(this, n, [e, this.uiHash()]); - if(n == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins - return this.element.triggerHandler(n == "drag" ? n : "drag"+n, [e, this.uiHash()], this.options[n]); - }, - destroy: function() { - if(!this.element.data('draggable')) return; - this.element.removeData("draggable").unbind(".draggable").removeClass('ui-draggable ui-draggable-dragging ui-draggable-disabled'); - this._mouseDestroy(); - } -})); - -$.extend($.ui.draggable, { - defaults: { - appendTo: "parent", - axis: false, - cancel: ":input", - delay: 0, - distance: 1, - helper: "original", - scope: "default", - cssNamespace: "ui" - } -}); - -$.ui.plugin.add("draggable", "cursor", { - start: function(e, ui) { - var t = $('body'); - if (t.css("cursor")) ui.options._cursor = t.css("cursor"); - t.css("cursor", ui.options.cursor); - }, - stop: function(e, ui) { - if (ui.options._cursor) $('body').css("cursor", ui.options._cursor); - } -}); - -$.ui.plugin.add("draggable", "zIndex", { - start: function(e, ui) { - var t = $(ui.helper); - if(t.css("zIndex")) ui.options._zIndex = t.css("zIndex"); - t.css('zIndex', ui.options.zIndex); - }, - stop: function(e, ui) { - if(ui.options._zIndex) $(ui.helper).css('zIndex', ui.options._zIndex); - } -}); - -$.ui.plugin.add("draggable", "opacity", { - start: function(e, ui) { - var t = $(ui.helper); - if(t.css("opacity")) ui.options._opacity = t.css("opacity"); - t.css('opacity', ui.options.opacity); - }, - stop: function(e, ui) { - if(ui.options._opacity) $(ui.helper).css('opacity', ui.options._opacity); - } -}); - -$.ui.plugin.add("draggable", "iframeFix", { - start: function(e, ui) { - $(ui.options.iframeFix === true ? "iframe" : ui.options.iframeFix).each(function() { - $('
    ') - .css({ - width: this.offsetWidth+"px", height: this.offsetHeight+"px", - position: "absolute", opacity: "0.001", zIndex: 1000 - }) - .css($(this).offset()) - .appendTo("body"); - }); - }, - stop: function(e, ui) { - $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers - } -}); - - - -$.ui.plugin.add("draggable", "scroll", { - start: function(e, ui) { - var o = ui.options; - var i = $(this).data("draggable"); - o.scrollSensitivity = o.scrollSensitivity || 20; - o.scrollSpeed = o.scrollSpeed || 20; - - i.overflowY = function(el) { - do { if(/auto|scroll/.test(el.css('overflow')) || (/auto|scroll/).test(el.css('overflow-y'))) return el; el = el.parent(); } while (el[0].parentNode); - return $(document); - }(this); - i.overflowX = function(el) { - do { if(/auto|scroll/.test(el.css('overflow')) || (/auto|scroll/).test(el.css('overflow-x'))) return el; el = el.parent(); } while (el[0].parentNode); - return $(document); - }(this); - - if(i.overflowY[0] != document && i.overflowY[0].tagName != 'HTML') i.overflowYOffset = i.overflowY.offset(); - if(i.overflowX[0] != document && i.overflowX[0].tagName != 'HTML') i.overflowXOffset = i.overflowX.offset(); - - }, - drag: function(e, ui) { - - var o = ui.options, scrolled = false; - var i = $(this).data("draggable"); - - if(i.overflowY[0] != document && i.overflowY[0].tagName != 'HTML') { - if((i.overflowYOffset.top + i.overflowY[0].offsetHeight) - e.pageY < o.scrollSensitivity) - i.overflowY[0].scrollTop = scrolled = i.overflowY[0].scrollTop + o.scrollSpeed; - if(e.pageY - i.overflowYOffset.top < o.scrollSensitivity) - i.overflowY[0].scrollTop = scrolled = i.overflowY[0].scrollTop - o.scrollSpeed; - - } else { - if(e.pageY - $(document).scrollTop() < o.scrollSensitivity) - scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); - if($(window).height() - (e.pageY - $(document).scrollTop()) < o.scrollSensitivity) - scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); - } - - if(i.overflowX[0] != document && i.overflowX[0].tagName != 'HTML') { - if((i.overflowXOffset.left + i.overflowX[0].offsetWidth) - e.pageX < o.scrollSensitivity) - i.overflowX[0].scrollLeft = scrolled = i.overflowX[0].scrollLeft + o.scrollSpeed; - if(e.pageX - i.overflowXOffset.left < o.scrollSensitivity) - i.overflowX[0].scrollLeft = scrolled = i.overflowX[0].scrollLeft - o.scrollSpeed; - } else { - if(e.pageX - $(document).scrollLeft() < o.scrollSensitivity) - scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); - if($(window).width() - (e.pageX - $(document).scrollLeft()) < o.scrollSensitivity) - scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); - } - - if(scrolled !== false) - $.ui.ddmanager.prepareOffsets(i, e); - - } -}); - - -$.ui.plugin.add("draggable", "snap", { - start: function(e, ui) { - - var inst = $(this).data("draggable"); - inst.snapElements = []; - - $(ui.options.snap.constructor != String ? ( ui.options.snap.items || ':data(draggable)' ) : ui.options.snap).each(function() { - var $t = $(this); var $o = $t.offset(); - if(this != inst.element[0]) inst.snapElements.push({ - item: this, - width: $t.outerWidth(), height: $t.outerHeight(), - top: $o.top, left: $o.left - }); - }); - - }, - drag: function(e, ui) { - - var inst = $(this).data("draggable"); - var d = ui.options.snapTolerance || 20; - - var x1 = ui.absolutePosition.left, x2 = x1 + inst.helperProportions.width, - y1 = ui.absolutePosition.top, y2 = y1 + inst.helperProportions.height; - - for (var i = inst.snapElements.length - 1; i >= 0; i--){ - - var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, - t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; - - //Yes, I know, this is insane ;) - if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { - if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, null, $.extend(inst.uiHash(), { snapItem: inst.snapElements[i].item }))); - inst.snapElements[i].snapping = false; - continue; - } - - if(ui.options.snapMode != 'inner') { - var ts = Math.abs(t - y2) <= d; - var bs = Math.abs(b - y1) <= d; - var ls = Math.abs(l - x2) <= d; - var rs = Math.abs(r - x1) <= d; - if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top; - if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top; - if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left; - if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left; - } - - var first = (ts || bs || ls || rs); - - if(ui.options.snapMode != 'outer') { - var ts = Math.abs(t - y1) <= d; - var bs = Math.abs(b - y2) <= d; - var ls = Math.abs(l - x1) <= d; - var rs = Math.abs(r - x2) <= d; - if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top; - if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top; - if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left; - if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left; - } - - if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) - (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, null, $.extend(inst.uiHash(), { snapItem: inst.snapElements[i].item }))); - inst.snapElements[i].snapping = (ts || bs || ls || rs || first); - - }; - - } -}); - -$.ui.plugin.add("draggable", "connectToSortable", { - start: function(e,ui) { - - var inst = $(this).data("draggable"); - inst.sortables = []; - $(ui.options.connectToSortable).each(function() { - if($.data(this, 'sortable')) { - var sortable = $.data(this, 'sortable'); - inst.sortables.push({ - instance: sortable, - shouldRevert: sortable.options.revert - }); - sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache - sortable._propagate("activate", e, inst); - } - }); - - }, - stop: function(e,ui) { - - //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper - var inst = $(this).data("draggable"); - - $.each(inst.sortables, function() { - if(this.instance.isOver) { - this.instance.isOver = 0; - inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance - this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) - if(this.shouldRevert) this.instance.options.revert = true; //revert here - this.instance._mouseStop(e); - - //Also propagate receive event, since the sortable is actually receiving a element - this.instance.element.triggerHandler("sortreceive", [e, $.extend(this.instance.ui(), { sender: inst.element })], this.instance.options["receive"]); - - this.instance.options.helper = this.instance.options._helper; - } else { - this.instance._propagate("deactivate", e, inst); - } - - }); - - }, - drag: function(e,ui) { - - var inst = $(this).data("draggable"), self = this; - - var checkPos = function(o) { - - var l = o.left, r = l + o.width, - t = o.top, b = t + o.height; - - return (l < (this.positionAbs.left + this.offset.click.left) && (this.positionAbs.left + this.offset.click.left) < r - && t < (this.positionAbs.top + this.offset.click.top) && (this.positionAbs.top + this.offset.click.top) < b); - }; - - $.each(inst.sortables, function(i) { - - if(checkPos.call(inst, this.instance.containerCache)) { - - //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once - if(!this.instance.isOver) { - this.instance.isOver = 1; - - //Now we fake the start of dragging for the sortable instance, - //by cloning the list group item, appending it to the sortable and using it as inst.currentItem - //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) - this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); - this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it - this.instance.options.helper = function() { return ui.helper[0]; }; - - e.target = this.instance.currentItem[0]; - this.instance._mouseCapture(e, true); - this.instance._mouseStart(e, true, true); - - //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes - this.instance.offset.click.top = inst.offset.click.top; - this.instance.offset.click.left = inst.offset.click.left; - this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; - this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; - - inst._propagate("toSortable", e); - - } - - //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable - if(this.instance.currentItem) this.instance._mouseDrag(e); - - } else { - - //If it doesn't intersect with the sortable, and it intersected before, - //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval - if(this.instance.isOver) { - this.instance.isOver = 0; - this.instance.cancelHelperRemoval = true; - this.instance.options.revert = false; //No revert here - this.instance._mouseStop(e, true); - this.instance.options.helper = this.instance.options._helper; - - //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size - this.instance.currentItem.remove(); - if(this.instance.placeholder) this.instance.placeholder.remove(); - - inst._propagate("fromSortable", e); - } - - }; - - }); - - } -}); - -$.ui.plugin.add("draggable", "stack", { - start: function(e,ui) { - var group = $.makeArray($(ui.options.stack.group)).sort(function(a,b) { - return (parseInt($(a).css("zIndex"),10) || ui.options.stack.min) - (parseInt($(b).css("zIndex"),10) || ui.options.stack.min); - }); - - $(group).each(function(i) { - this.style.zIndex = ui.options.stack.min + i; - }); - - this[0].style.zIndex = ui.options.stack.min + group.length; - } -}); - -})(jQuery); +/* + * jQuery UI Draggable 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.draggable", $.extend({}, $.ui.mouse, { + + _init: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + }, + + _mouseCapture: function(event) { + + var o = this.options; + + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + if(o.cursorAt) + this._adjustOffsetFromHelper(o.cursorAt); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Call plugins and callbacks + this._trigger("start", event); + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + this._trigger('drag', event, ui); + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + self._trigger("stop", event); + self._clear(); + }); + } else { + this._trigger("stop", event); + this._clear(); + } + + return false; + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; + if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; + if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + absolutePosition: this.positionAbs, //deprecated + offset: this.positionAbs + }; + } + +})); + +$.extend($.ui.draggable, { + version: "1.7.1", + eventPrefix: "drag", + defaults: { + addClasses: true, + appendTo: "parent", + axis: false, + cancel: ":input,option", + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + delay: 0, + distance: 1, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + } +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
    ') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack.group)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min); + }); + + $(group).each(function(i) { + this.style.zIndex = o.stack.min + i; + }); + + this[0].style.zIndex = o.stack.min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.droppable.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.droppable.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.droppable.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.droppable.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,300 +1,282 @@ -/* - * jQuery UI Droppable @VERSION - * - * Copyright (c) 2008 Paul Bakaus - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Droppables - * - * Depends: - * ui.core.js - * ui.draggable.js - */ -(function($) { - -$.widget("ui.droppable", { - - _setData: function(key, value) { - - if(key == 'accept') { - this.options.accept = value && $.isFunction(value) ? value : function(d) { - return d.is(accept); - }; - } else { - $.widget.prototype._setData.apply(this, arguments); - } - - }, - - _init: function() { - - var o = this.options, accept = o.accept; - this.isover = 0; this.isout = 1; - - this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) { - return d.is(accept); - }; - - //Store the droppable's proportions - this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; - - // Add the reference and positions to the manager - $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || []; - $.ui.ddmanager.droppables[this.options.scope].push(this); - - (this.options.cssNamespace && this.element.addClass(this.options.cssNamespace+"-droppable")); - - }, - plugins: {}, - ui: function(c) { - return { - draggable: (c.currentItem || c.element), - helper: c.helper, - position: c.position, - absolutePosition: c.positionAbs, - options: this.options, - element: this.element - }; - }, - destroy: function() { - var drop = $.ui.ddmanager.droppables[this.options.scope]; - for ( var i = 0; i < drop.length; i++ ) - if ( drop[i] == this ) - drop.splice(i, 1); - - this.element - .removeClass("ui-droppable-disabled") - .removeData("droppable") - .unbind(".droppable"); - }, - _over: function(e) { - - var draggable = $.ui.ddmanager.current; - if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element - - if (this.options.accept.call(this.element,(draggable.currentItem || draggable.element))) { - $.ui.plugin.call(this, 'over', [e, this.ui(draggable)]); - this.element.triggerHandler("dropover", [e, this.ui(draggable)], this.options.over); - } - - }, - _out: function(e) { - - var draggable = $.ui.ddmanager.current; - if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element - - if (this.options.accept.call(this.element,(draggable.currentItem || draggable.element))) { - $.ui.plugin.call(this, 'out', [e, this.ui(draggable)]); - this.element.triggerHandler("dropout", [e, this.ui(draggable)], this.options.out); - } - - }, - _drop: function(e,custom) { - - var draggable = custom || $.ui.ddmanager.current; - if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element - - var childrenIntersection = false; - this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { - var inst = $.data(this, 'droppable'); - if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) { - childrenIntersection = true; return false; - } - }); - if(childrenIntersection) return false; - - if(this.options.accept.call(this.element,(draggable.currentItem || draggable.element))) { - $.ui.plugin.call(this, 'drop', [e, this.ui(draggable)]); - this.element.triggerHandler("drop", [e, this.ui(draggable)], this.options.drop); - return this.element; - } - - return false; - - }, - _activate: function(e) { - - var draggable = $.ui.ddmanager.current; - $.ui.plugin.call(this, 'activate', [e, this.ui(draggable)]); - if(draggable) this.element.triggerHandler("dropactivate", [e, this.ui(draggable)], this.options.activate); - - }, - _deactivate: function(e) { - - var draggable = $.ui.ddmanager.current; - $.ui.plugin.call(this, 'deactivate', [e, this.ui(draggable)]); - if(draggable) this.element.triggerHandler("dropdeactivate", [e, this.ui(draggable)], this.options.deactivate); - - } -}); - -$.extend($.ui.droppable, { - defaults: { - disabled: false, - tolerance: 'intersect', - scope: 'default', - cssNamespace: 'ui' - } -}); - -$.ui.intersect = function(draggable, droppable, toleranceMode) { - - if (!droppable.offset) return false; - - var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, - y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; - var l = droppable.offset.left, r = l + droppable.proportions.width, - t = droppable.offset.top, b = t + droppable.proportions.height; - - switch (toleranceMode) { - case 'fit': - return (l < x1 && x2 < r - && t < y1 && y2 < b); - break; - case 'intersect': - return (l < x1 + (draggable.helperProportions.width / 2) // Right Half - && x2 - (draggable.helperProportions.width / 2) < r // Left Half - && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half - && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half - break; - case 'pointer': - return (l < ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left) && ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left) < r - && t < ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top) && ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top) < b); - break; - case 'touch': - return ( - (y1 >= t && y1 <= b) || // Top edge touching - (y2 >= t && y2 <= b) || // Bottom edge touching - (y1 < t && y2 > b) // Surrounded vertically - ) && ( - (x1 >= l && x1 <= r) || // Left edge touching - (x2 >= l && x2 <= r) || // Right edge touching - (x1 < l && x2 > r) // Surrounded horizontally - ); - break; - default: - return false; - break; - } - -}; - -/* - This manager tracks offsets of draggables and droppables -*/ -$.ui.ddmanager = { - current: null, - droppables: { 'default': [] }, - prepareOffsets: function(t, e) { - - var m = $.ui.ddmanager.droppables[t.options.scope]; - var type = e ? e.type : null; // workaround for #2317 - var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); - - droppablesLoop: for (var i = 0; i < m.length; i++) { - - if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element,(t.currentItem || t.element)))) continue; //No disabled and non-accepted - for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item - m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue - - m[i].offset = m[i].element.offset(); - m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; - - if(type == "dragstart" || type == "sortactivate") m[i]._activate.call(m[i], e); //Activate the droppable if used directly from draggables - - } - - }, - drop: function(draggable, e) { - - var dropped = false; - $.each($.ui.ddmanager.droppables[draggable.options.scope], function() { - - if(!this.options) return; - if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) - dropped = this._drop.call(this, e); - - if (!this.options.disabled && this.visible && this.options.accept.call(this.element,(draggable.currentItem || draggable.element))) { - this.isout = 1; this.isover = 0; - this._deactivate.call(this, e); - } - - }); - return dropped; - - }, - drag: function(draggable, e) { - - //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. - if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, e); - - //Run through all droppables and check their positions based on specific tolerance options - - $.each($.ui.ddmanager.droppables[draggable.options.scope], function() { - - if(this.options.disabled || this.greedyChild || !this.visible) return; - var intersects = $.ui.intersect(draggable, this, this.options.tolerance); - - var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); - if(!c) return; - - var parentInstance; - if (this.options.greedy) { - var parent = this.element.parents(':data(droppable):eq(0)'); - if (parent.length) { - parentInstance = $.data(parent[0], 'droppable'); - parentInstance.greedyChild = (c == 'isover' ? 1 : 0); - } - } - - // we just moved into a greedy child - if (parentInstance && c == 'isover') { - parentInstance['isover'] = 0; - parentInstance['isout'] = 1; - parentInstance._out.call(parentInstance, e); - } - - this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; - this[c == "isover" ? "_over" : "_out"].call(this, e); - - // we just moved out of a greedy child - if (parentInstance && c == 'isout') { - parentInstance['isout'] = 0; - parentInstance['isover'] = 1; - parentInstance._over.call(parentInstance, e); - } - }); - - } -}; - -/* - * Droppable Extensions - */ - -$.ui.plugin.add("droppable", "activeClass", { - activate: function(e, ui) { - $(this).addClass(ui.options.activeClass); - }, - deactivate: function(e, ui) { - $(this).removeClass(ui.options.activeClass); - }, - drop: function(e, ui) { - $(this).removeClass(ui.options.activeClass); - } -}); - -$.ui.plugin.add("droppable", "hoverClass", { - over: function(e, ui) { - $(this).addClass(ui.options.hoverClass); - }, - out: function(e, ui) { - $(this).removeClass(ui.options.hoverClass); - }, - drop: function(e, ui) { - $(this).removeClass(ui.options.hoverClass); - } -}); - -})(jQuery); +/* + * jQuery UI Droppable 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * ui.core.js + * ui.draggable.js + */ +(function($) { + +$.widget("ui.droppable", { + + _init: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || []; + $.ui.ddmanager.droppables[this.options.scope].push(this); + + (this.options.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + }, + + _setData: function(key, value) { + + if(key == 'accept') { + this.options.accept = value && $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } else { + $.widget.prototype._setData.apply(this, arguments); + } + + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) { + childrenIntersection = true; return false; + } + }); + if(childrenIntersection) return false; + + if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + absolutePosition: c.positionAbs, //deprecated + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.7.1", + eventPrefix: 'drop', + defaults: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + } +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l < x1 && x2 < r + && t < y1 && y2 < b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope]; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event); + + if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + + $.each($.ui.ddmanager.droppables[draggable.options.scope], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + } +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.progressbar.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.progressbar.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.progressbar.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.progressbar.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,195 +1,112 @@ /* - * jQuery UI ProgressBar @VERSION + * jQuery UI Progressbar 1.7.1 * - * Copyright (c) 2008 Eduardo Lundgren + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) * Dual licensed under the MIT (MIT-LICENSE.txt) * and GPL (GPL-LICENSE.txt) licenses. * - * http://docs.jquery.com/UI/ProgressBar + * http://docs.jquery.com/UI/Progressbar * * Depends: * ui.core.js */ (function($) { $.widget("ui.progressbar", { + _init: function() { - this._interval = this.options.interval; + this.element + .addClass("ui-progressbar" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all") + .attr({ + role: "progressbar", + "aria-valuemin": this._valueMin(), + "aria-valuemax": this._valueMax(), + "aria-valuenow": this._value() + }); - var self = this, - options = this.options, - id = (new Date()).getTime()+Math.random(), - text = options.text || '0%'; + this.valueDiv = $('
    ').appendTo(this.element); - this.element.addClass("ui-progressbar").width(options.width); + this._refreshValue(); - $.extend(this, { - active: false, - pixelState: 0, - percentState: 0, - identifier: id, - bar: $('
    ').css({ - width: '0px', overflow: 'hidden', zIndex: 100 - }), - textElement: $('
    ').html(text).css({ - width: '0px', overflow: 'hidden' - }), - textBg: $('
    ').html(text).css({ - width: this.element.width() - }), - wrapper: $('
    ') - }); - - this.wrapper - .append(this.bar.append(this.textElement.addClass(options.textClass)), this.textBg) - .appendTo(this.element); }, - plugins: {}, - ui: function(e) { - return { - instance: this, - identifier: this.identifier, - options: this.options, - element: this.bar, - textElement: this.textElement, - pixelState: this.pixelState, - percentState: this.percentState - }; - }, - - _propagate: function(n,e) { - $.ui.plugin.call(this, n, [e, this.ui()]); - this.element.triggerHandler(n == "progressbar" ? n : ["progressbar", n].join(""), [e, this.ui()], this.options[n]); - }, - destroy: function() { - this.stop(); this.element - .removeClass("ui-progressbar ui-progressbar-disabled") - .removeData("progressbar").unbind(".progressbar") - .find('.ui-progressbar-wrap').remove(); + .removeClass("ui-progressbar" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all") + .removeAttr("role") + .removeAttr("aria-valuemin") + .removeAttr("aria-valuemax") + .removeAttr("aria-valuenow") + .removeData("progressbar") + .unbind(".progressbar"); - delete jQuery.easing[this.identifier]; - }, + this.valueDiv.remove(); - enable: function() { - this.element.removeClass("ui-progressbar-disabled"); - this.disabled = false; + $.widget.prototype.destroy.apply(this, arguments); + }, - disable: function() { - this.element.addClass("ui-progressbar-disabled"); - this.disabled = true; + value: function(newValue) { + arguments.length && this._setData("value", newValue); + return this._value(); }, - start: function() { - var self = this, options = this.options; + _setData: function(key, value) { - if (this.disabled) { - return; + switch (key) { + case 'value': + this.options.value = value; + this._refreshValue(); + this._trigger('change', null, {}); + break; } - jQuery.easing[this.identifier] = function (x, t, b, c, d) { - var inc = options.increment, - width = options.width, - step = ((inc > width ? width : inc)/width), - state = Math.round(x/step)*step; - return state > 1 ? 1 : state; - }; + $.widget.prototype._setData.apply(this, arguments); - self.active = true; - - setTimeout( - function() { - self.active = false; - }, - options.duration - ); - - this._animate(); - - this._propagate('start', this.ui()); - return false; }, - _animate: function() { - var self = this, - options = this.options, - interval = options.interval; + _value: function() { - this.bar.animate( - { - width: options.width - }, - { - duration: interval, - easing: this.identifier, - step: function(step, b) { - self.progress((step/options.width)*100); - var timestamp = new Date().getTime(), elapsedTime = (timestamp - b.startTime); - options.interval = interval - elapsedTime; - }, - complete: function() { - delete jQuery.easing[self.identifier]; - self.pause(); + var val = this.options.value; + if (val < this._valueMin()) val = this._valueMin(); + if (val > this._valueMax()) val = this._valueMax(); - if (self.active) { - /*TODO*/ - } - } - } - ); - }, + return val; - pause: function() { - if (this.disabled) return; - this.bar.stop(); - this._propagate('pause', this.ui()); }, - stop: function() { - this.bar.stop(); - this.bar.width(0); - this.textElement.width(0); - this.bar.addClass('ui-hidden'); - this.options.interval = this._interval; - this._propagate('stop', this.ui()); + _valueMin: function() { + var valueMin = 0; + return valueMin; }, - text: function(text){ - this.textElement.html(text); - this.textBg.html(text); + _valueMax: function() { + var valueMax = 100; + return valueMax; }, - progress: function(percentState) { - if (this.bar.is('.ui-hidden')) { - this.bar.removeClass('ui-hidden'); - } + _refreshValue: function() { + var value = this.value(); + this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right"); + this.valueDiv.width(value + '%'); + this.element.attr("aria-valuenow", value); + } - this.percentState = percentState > 100 ? 100 : percentState; - this.pixelState = (this.percentState/100)*this.options.width; - this.bar.width(this.pixelState); - this.textElement.width(this.pixelState); +}); - if (this.options.range && !this.options.text) { - this.textElement.html(Math.round(this.percentState) + '%'); - } - this._propagate('progress', this.ui()); +$.extend($.ui.progressbar, { + version: "1.7.1", + defaults: { + value: 0 } }); -$.ui.progressbar.defaults = { - width: 300, - duration: 3000, - interval: 200, - increment: 1, - range: true, - text: '', - addClass: '', - textClass: '' -}; - -})(jQuery); \ No newline at end of file +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.resizable.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.resizable.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.resizable.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.resizable.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,779 +1,800 @@ -/* - * jQuery UI Resizable @VERSION - * - * Copyright (c) 2008 Paul Bakaus - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Resizables - * - * Depends: - * ui.core.js - */ -(function($) { - -$.widget("ui.resizable", $.extend({}, $.ui.mouse, { - _init: function() { - - var self = this, o = this.options; - - var elpos = this.element.css('position'); - - this.originalElement = this.element; - - // simulate .ui-resizable { position: relative; } - this.element.addClass("ui-resizable").css({ position: /static/.test(elpos) ? 'relative' : elpos }); - - $.extend(o, { - _aspectRatio: !!(o.aspectRatio), - helper: o.helper || o.ghost || o.animate ? o.helper || 'proxy' : null, - knobHandles: o.knobHandles === true ? 'ui-resizable-knob-handle' : o.knobHandles - }); - - //Default Theme - var aBorder = '1px solid #DEDEDE'; - - o.defaultTheme = { - 'ui-resizable': { display: 'block' }, - 'ui-resizable-handle': { position: 'absolute', background: '#F2F2F2', fontSize: '0.1px' }, - 'ui-resizable-n': { cursor: 'n-resize', height: '4px', left: '0px', right: '0px', borderTop: aBorder }, - 'ui-resizable-s': { cursor: 's-resize', height: '4px', left: '0px', right: '0px', borderBottom: aBorder }, - 'ui-resizable-e': { cursor: 'e-resize', width: '4px', top: '0px', bottom: '0px', borderRight: aBorder }, - 'ui-resizable-w': { cursor: 'w-resize', width: '4px', top: '0px', bottom: '0px', borderLeft: aBorder }, - 'ui-resizable-se': { cursor: 'se-resize', width: '4px', height: '4px', borderRight: aBorder, borderBottom: aBorder }, - 'ui-resizable-sw': { cursor: 'sw-resize', width: '4px', height: '4px', borderBottom: aBorder, borderLeft: aBorder }, - 'ui-resizable-ne': { cursor: 'ne-resize', width: '4px', height: '4px', borderRight: aBorder, borderTop: aBorder }, - 'ui-resizable-nw': { cursor: 'nw-resize', width: '4px', height: '4px', borderLeft: aBorder, borderTop: aBorder } - }; - - o.knobTheme = { - 'ui-resizable-handle': { background: '#F2F2F2', border: '1px solid #808080', height: '8px', width: '8px' }, - 'ui-resizable-n': { cursor: 'n-resize', top: '0px', left: '45%' }, - 'ui-resizable-s': { cursor: 's-resize', bottom: '0px', left: '45%' }, - 'ui-resizable-e': { cursor: 'e-resize', right: '0px', top: '45%' }, - 'ui-resizable-w': { cursor: 'w-resize', left: '0px', top: '45%' }, - 'ui-resizable-se': { cursor: 'se-resize', right: '0px', bottom: '0px' }, - 'ui-resizable-sw': { cursor: 'sw-resize', left: '0px', bottom: '0px' }, - 'ui-resizable-nw': { cursor: 'nw-resize', left: '0px', top: '0px' }, - 'ui-resizable-ne': { cursor: 'ne-resize', right: '0px', top: '0px' } - }; - - o._nodeName = this.element[0].nodeName; - - //Wrap the element if it cannot hold child nodes - if(o._nodeName.match(/canvas|textarea|input|select|button|img/i)) { - var el = this.element; - - //Opera fixing relative position - if (/relative/.test(el.css('position')) && $.browser.opera) - el.css({ position: 'relative', top: 'auto', left: 'auto' }); - - //Create a wrapper element and set the wrapper to the new current internal element - el.wrap( - $('
    ').css( { - position: el.css('position'), - width: el.outerWidth(), - height: el.outerHeight(), - top: el.css('top'), - left: el.css('left') - }) - ); - - var oel = this.element; this.element = this.element.parent(); - - // store instance on wrapper - this.element.data('resizable', this); - - //Move margins to the wrapper - this.element.css({ marginLeft: oel.css("marginLeft"), marginTop: oel.css("marginTop"), - marginRight: oel.css("marginRight"), marginBottom: oel.css("marginBottom") - }); - - oel.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); - - //Prevent Safari textarea resize - if ($.browser.safari && o.preventDefault) oel.css('resize', 'none'); - - o.proportionallyResize = oel.css({ position: 'static', zoom: 1, display: 'block' }); - - // avoid IE jump - this.element.css({ margin: oel.css('margin') }); - - // fix handlers offset - this._proportionallyResize(); - } - - if(!o.handles) o.handles = !$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }; - if(o.handles.constructor == String) { - - o.zIndex = o.zIndex || 1000; - - if(o.handles == 'all') o.handles = 'n,e,s,w,se,sw,ne,nw'; - - var n = o.handles.split(","); o.handles = {}; - - // insertions are applied when don't have theme loaded - var insertionsDefault = { - handle: 'position: absolute; display: none; overflow:hidden;', - n: 'top: 0pt; width:100%;', - e: 'right: 0pt; height:100%;', - s: 'bottom: 0pt; width:100%;', - w: 'left: 0pt; height:100%;', - se: 'bottom: 0pt; right: 0px;', - sw: 'bottom: 0pt; left: 0px;', - ne: 'top: 0pt; right: 0px;', - nw: 'top: 0pt; left: 0px;' - }; - - for(var i = 0; i < n.length; i++) { - var handle = $.trim(n[i]), dt = o.defaultTheme, hname = 'ui-resizable-'+handle, loadDefault = !$.ui.css(hname) && !o.knobHandles, userKnobClass = $.ui.css('ui-resizable-knob-handle'), - allDefTheme = $.extend(dt[hname], dt['ui-resizable-handle']), allKnobTheme = $.extend(o.knobTheme[hname], !userKnobClass ? o.knobTheme['ui-resizable-handle'] : {}); - - // increase zIndex of sw, se, ne, nw axis - var applyZIndex = /sw|se|ne|nw/.test(handle) ? { zIndex: ++o.zIndex } : {}; - - var defCss = (loadDefault ? insertionsDefault[handle] : ''), - axis = $(['
    '].join('')).css( applyZIndex ); - o.handles[handle] = '.ui-resizable-'+handle; - - this.element.append( - //Theme detection, if not loaded, load o.defaultTheme - axis.css( loadDefault ? allDefTheme : {} ) - // Load the knobHandle css, fix width, height, top, left... - .css( o.knobHandles ? allKnobTheme : {} ).addClass(o.knobHandles ? 'ui-resizable-knob-handle' : '').addClass(o.knobHandles) - ); - } - - if (o.knobHandles) this.element.addClass('ui-resizable-knob').css( !$.ui.css('ui-resizable-knob') ? { /*border: '1px #fff dashed'*/ } : {} ); - } - - this._renderAxis = function(target) { - target = target || this.element; - - for(var i in o.handles) { - if(o.handles[i].constructor == String) - o.handles[i] = $(o.handles[i], this.element).show(); - - if (o.transparent) - o.handles[i].css({opacity:0}); - - //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) - if (this.element.is('.ui-wrapper') && - o._nodeName.match(/textarea|input|select|button/i)) { - - var axis = $(o.handles[i], this.element), padWrapper = 0; - - //Checking the correct pad and border - padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); - - //The padding type i have to apply... - var padPos = [ 'padding', - /ne|nw|n/.test(i) ? 'Top' : - /se|sw|s/.test(i) ? 'Bottom' : - /^e$/.test(i) ? 'Right' : 'Left' ].join(""); - - if (!o.transparent) - target.css(padPos, padWrapper); - - this._proportionallyResize(); - } - if(!$(o.handles[i]).length) continue; - } - }; - - this._renderAxis(this.element); - o._handles = $('.ui-resizable-handle', self.element); - - if (o.disableSelection) - o._handles.each(function(i, e) { $.ui.disableSelection(e); }); - - //Matching axis name - o._handles.mouseover(function() { - if (!o.resizing) { - if (this.className) - var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); - //Axis, default = se - self.axis = o.axis = axis && axis[1] ? axis[1] : 'se'; - } - }); - - //If we want to auto hide the elements - if (o.autoHide) { - o._handles.hide(); - $(self.element).addClass("ui-resizable-autohide").hover(function() { - $(this).removeClass("ui-resizable-autohide"); - o._handles.show(); - }, - function(){ - if (!o.resizing) { - $(this).addClass("ui-resizable-autohide"); - o._handles.hide(); - } - }); - } - - this._mouseInit(); - }, - plugins: {}, - ui: function() { - return { - originalElement: this.originalElement, - element: this.element, - helper: this.helper, - position: this.position, - size: this.size, - options: this.options, - originalSize: this.originalSize, - originalPosition: this.originalPosition - }; - }, - _propagate: function(n,e) { - $.ui.plugin.call(this, n, [e, this.ui()]); - if (n != "resize") this.element.triggerHandler(["resize", n].join(""), [e, this.ui()], this.options[n]); - }, - destroy: function() { - var el = this.element, wrapped = el.children(".ui-resizable").get(0); - - this._mouseDestroy(); - - var _destroy = function(exp) { - $(exp).removeClass("ui-resizable ui-resizable-disabled") - .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); - }; - - _destroy(el); - - if (el.is('.ui-wrapper') && wrapped) { - el.parent().append( - $(wrapped).css({ - position: el.css('position'), - width: el.outerWidth(), - height: el.outerHeight(), - top: el.css('top'), - left: el.css('left') - }) - ).end().remove(); - - _destroy(wrapped); - } - }, - - _mouseCapture: function(e) { - - if(this.options.disabled) return false; - - var handle = false; - for(var i in this.options.handles) { - if($(this.options.handles[i])[0] == e.target) handle = true; - } - if (!handle) return false; - - return true; - - }, - - _mouseStart: function(e) { - - var o = this.options, iniPos = this.element.position(), el = this.element, - num = function(v) { return parseInt(v, 10) || 0; }, ie6 = $.browser.msie && $.browser.version < 7; - o.resizing = true; - o.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; - - // bugfix #1749 - if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { - - // sOffset decides if document scrollOffset will be added to the top/left of the resizable element - var sOffset = $.browser.msie && !o.containment && (/absolute/).test(el.css('position')) && !(/relative/).test(el.parent().css('position')); - var dscrollt = sOffset ? o.documentScroll.top : 0, dscrolll = sOffset ? o.documentScroll.left : 0; - - el.css({ position: 'absolute', top: (iniPos.top + dscrollt), left: (iniPos.left + dscrolll) }); - } - - //Opera fixing relative position - if ($.browser.opera && /relative/.test(el.css('position'))) - el.css({ position: 'relative', top: 'auto', left: 'auto' }); - - this._renderProxy(); - - var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); - - if (o.containment) { - curleft += $(o.containment).scrollLeft()||0; - curtop += $(o.containment).scrollTop()||0; - } - - //Store needed variables - this.offset = this.helper.offset(); - this.position = { left: curleft, top: curtop }; - this.size = o.helper || ie6 ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; - this.originalSize = o.helper || ie6 ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; - this.originalPosition = { left: curleft, top: curtop }; - this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; - this.originalMousePosition = { left: e.pageX, top: e.pageY }; - - //Aspect Ratio - o.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height)||1); - - if (o.preserveCursor) - $('body').css('cursor', this.axis + '-resize'); - - this._propagate("start", e); - return true; - }, - _mouseDrag: function(e) { - - //Increase performance, avoid regex - var el = this.helper, o = this.options, props = {}, - self = this, smp = this.originalMousePosition, a = this.axis; - - var dx = (e.pageX-smp.left)||0, dy = (e.pageY-smp.top)||0; - var trigger = this._change[a]; - if (!trigger) return false; - - // Calculate the attrs that will be change - var data = trigger.apply(this, [e, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; - - if (o._aspectRatio || e.shiftKey) - data = this._updateRatio(data, e); - - data = this._respectSize(data, e); - - // plugins callbacks need to be called first - this._propagate("resize", e); - - el.css({ - top: this.position.top + "px", left: this.position.left + "px", - width: this.size.width + "px", height: this.size.height + "px" - }); - - if (!o.helper && o.proportionallyResize) - this._proportionallyResize(); - - this._updateCache(data); - - // calling the user callback at the end - this.element.triggerHandler("resize", [e, this.ui()], this.options["resize"]); - - return false; - }, - _mouseStop: function(e) { - - this.options.resizing = false; - var o = this.options, num = function(v) { return parseInt(v, 10) || 0; }, self = this; - - if(o.helper) { - var pr = o.proportionallyResize, ista = pr && (/textarea/i).test(pr.get(0).nodeName), - soffseth = ista && $.ui.hasScroll(pr.get(0), 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, - soffsetw = ista ? 0 : self.sizeDiff.width; - - var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, - left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, - top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; - - if (!o.animate) - this.element.css($.extend(s, { top: top, left: left })); - - if (o.helper && !o.animate) this._proportionallyResize(); - } - - if (o.preserveCursor) - $('body').css('cursor', 'auto'); - - this._propagate("stop", e); - - if (o.helper) this.helper.remove(); - - return false; - }, - _updateCache: function(data) { - var o = this.options; - this.offset = this.helper.offset(); - if (data.left) this.position.left = data.left; - if (data.top) this.position.top = data.top; - if (data.height) this.size.height = data.height; - if (data.width) this.size.width = data.width; - }, - _updateRatio: function(data, e) { - - var o = this.options, cpos = this.position, csize = this.size, a = this.axis; - - if (data.height) data.width = (csize.height * o.aspectRatio); - else if (data.width) data.height = (csize.width / o.aspectRatio); - - if (a == 'sw') { - data.left = cpos.left + (csize.width - data.width); - data.top = null; - } - if (a == 'nw') { - data.top = cpos.top + (csize.height - data.height); - data.left = cpos.left + (csize.width - data.width); - } - - return data; - }, - _respectSize: function(data, e) { - - var el = this.helper, o = this.options, pRatio = o._aspectRatio || e.shiftKey, a = this.axis, - ismaxw = data.width && o.maxWidth && o.maxWidth < data.width, ismaxh = data.height && o.maxHeight && o.maxHeight < data.height, - isminw = data.width && o.minWidth && o.minWidth > data.width, isminh = data.height && o.minHeight && o.minHeight > data.height; - - if (isminw) data.width = o.minWidth; - if (isminh) data.height = o.minHeight; - if (ismaxw) data.width = o.maxWidth; - if (ismaxh) data.height = o.maxHeight; - - var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; - var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); - - if (isminw && cw) data.left = dw - o.minWidth; - if (ismaxw && cw) data.left = dw - o.maxWidth; - if (isminh && ch) data.top = dh - o.minHeight; - if (ismaxh && ch) data.top = dh - o.maxHeight; - - // fixing jump error on top/left - bug #2330 - var isNotwh = !data.width && !data.height; - if (isNotwh && !data.left && data.top) data.top = null; - else if (isNotwh && !data.top && data.left) data.left = null; - - return data; - }, - _proportionallyResize: function() { - var o = this.options; - if (!o.proportionallyResize) return; - var prel = o.proportionallyResize, el = this.helper || this.element; - - if (!o.borderDif) { - var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], - p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; - - o.borderDif = $.map(b, function(v, i) { - var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; - return border + padding; - }); - } - prel.css({ - height: (el.height() - o.borderDif[0] - o.borderDif[2]) + "px", - width: (el.width() - o.borderDif[1] - o.borderDif[3]) + "px" - }); - }, - _renderProxy: function() { - var el = this.element, o = this.options; - this.elementOffset = el.offset(); - - if(o.helper) { - this.helper = this.helper || $('
    '); - - // fix ie6 offset - var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), - pxyoffset = ( ie6 ? 2 : -1 ); - - this.helper.addClass(o.helper).css({ - width: el.outerWidth() + pxyoffset, - height: el.outerHeight() + pxyoffset, - position: 'absolute', - left: this.elementOffset.left - ie6offset +'px', - top: this.elementOffset.top - ie6offset +'px', - zIndex: ++o.zIndex - }); - - this.helper.appendTo("body"); - - if (o.disableSelection) - $.ui.disableSelection(this.helper.get(0)); - - } else { - this.helper = el; - } - }, - _change: { - e: function(e, dx, dy) { - return { width: this.originalSize.width + dx }; - }, - w: function(e, dx, dy) { - var o = this.options, cs = this.originalSize, sp = this.originalPosition; - return { left: sp.left + dx, width: cs.width - dx }; - }, - n: function(e, dx, dy) { - var o = this.options, cs = this.originalSize, sp = this.originalPosition; - return { top: sp.top + dy, height: cs.height - dy }; - }, - s: function(e, dx, dy) { - return { height: this.originalSize.height + dy }; - }, - se: function(e, dx, dy) { - return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [e, dx, dy])); - }, - sw: function(e, dx, dy) { - return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [e, dx, dy])); - }, - ne: function(e, dx, dy) { - return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [e, dx, dy])); - }, - nw: function(e, dx, dy) { - return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [e, dx, dy])); - } - } -})); - -$.extend($.ui.resizable, { - defaults: { - cancel: ":input", - distance: 1, - delay: 0, - preventDefault: true, - transparent: false, - minWidth: 10, - minHeight: 10, - aspectRatio: false, - disableSelection: true, - preserveCursor: true, - autoHide: false, - knobHandles: false - } -}); - -/* - * Resizable Extensions - */ - -$.ui.plugin.add("resizable", "containment", { - - start: function(e, ui) { - var o = ui.options, self = $(this).data("resizable"), el = self.element; - var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; - if (!ce) return; - - self.containerElement = $(ce); - - if (/document/.test(oc) || oc == document) { - self.containerOffset = { left: 0, top: 0 }; - self.containerPosition = { left: 0, top: 0 }; - - self.parentData = { - element: $(document), left: 0, top: 0, - width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight - }; - } - - - // i'm a node, so compute top, left, right, bottom - else{ - self.containerOffset = $(ce).offset(); - self.containerPosition = $(ce).position(); - self.containerSize = { height: $(ce).innerHeight(), width: $(ce).innerWidth() }; - - var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, - width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); - - self.parentData = { - element: ce, left: co.left, top: co.top, width: width, height: height - }; - } - }, - - resize: function(e, ui) { - var o = ui.options, self = $(this).data("resizable"), - ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, - pRatio = o._aspectRatio || e.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; - - if (ce[0] != document && /static/.test(ce.css('position'))) - cop = self.containerPosition; - - if (cp.left < (o.helper ? co.left : cop.left)) { - self.size.width = self.size.width + (o.helper ? (self.position.left - co.left) : (self.position.left - cop.left)); - if (pRatio) self.size.height = self.size.width / o.aspectRatio; - self.position.left = o.helper ? co.left : cop.left; - } - - if (cp.top < (o.helper ? co.top : 0)) { - self.size.height = self.size.height + (o.helper ? (self.position.top - co.top) : self.position.top); - if (pRatio) self.size.width = self.size.height * o.aspectRatio; - self.position.top = o.helper ? co.top : 0; - } - - var woset = (o.helper ? self.offset.left - co.left : (self.position.left - cop.left)) + self.sizeDiff.width, - hoset = (o.helper ? self.offset.top - co.top : self.position.top) + self.sizeDiff.height; - - if (woset + self.size.width >= self.parentData.width) { - self.size.width = self.parentData.width - woset; - if (pRatio) self.size.height = self.size.width / o.aspectRatio; - } - - if (hoset + self.size.height >= self.parentData.height) { - self.size.height = self.parentData.height - hoset; - if (pRatio) self.size.width = self.size.height * o.aspectRatio; - } - }, - - stop: function(e, ui){ - var o = ui.options, self = $(this).data("resizable"), cp = self.position, - co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; - - var helper = $(self.helper), ho = helper.offset(), w = helper.innerWidth(), h = helper.innerHeight(); - - - if (o.helper && !o.animate && /relative/.test(ce.css('position'))) - $(this).css({ left: (ho.left - co.left), top: (ho.top - co.top), width: w, height: h }); - - if (o.helper && !o.animate && /static/.test(ce.css('position'))) - $(this).css({ left: cop.left + (ho.left - co.left), top: cop.top + (ho.top - co.top), width: w, height: h }); - - } -}); - -$.ui.plugin.add("resizable", "grid", { - - resize: function(e, ui) { - var o = ui.options, self = $(this).data("resizable"), cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || e.shiftKey; - o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; - var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); - - if (/^(se|s|e)$/.test(a)) { - self.size.width = os.width + ox; - self.size.height = os.height + oy; - } - else if (/^(ne)$/.test(a)) { - self.size.width = os.width + ox; - self.size.height = os.height + oy; - self.position.top = op.top - oy; - } - else if (/^(sw)$/.test(a)) { - self.size.width = os.width + ox; - self.size.height = os.height + oy; - self.position.left = op.left - ox; - } - else { - self.size.width = os.width + ox; - self.size.height = os.height + oy; - self.position.top = op.top - oy; - self.position.left = op.left - ox; - } - } - -}); - -$.ui.plugin.add("resizable", "animate", { - - stop: function(e, ui) { - var o = ui.options, self = $(this).data("resizable"); - - var pr = o.proportionallyResize, ista = pr && (/textarea/i).test(pr.get(0).nodeName), - soffseth = ista && $.ui.hasScroll(pr.get(0), 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, - soffsetw = ista ? 0 : self.sizeDiff.width; - - var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, - left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, - top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; - - self.element.animate( - $.extend(style, top && left ? { top: top, left: left } : {}), { - duration: o.animateDuration || "slow", easing: o.animateEasing || "swing", - step: function() { - - var data = { - width: parseInt(self.element.css('width'), 10), - height: parseInt(self.element.css('height'), 10), - top: parseInt(self.element.css('top'), 10), - left: parseInt(self.element.css('left'), 10) - }; - - if (pr) pr.css({ width: data.width, height: data.height }); - - // propagating resize, and updating values for each animation step - self._updateCache(data); - self._propagate("animate", e); - - } - } - ); - } - -}); - -$.ui.plugin.add("resizable", "ghost", { - - start: function(e, ui) { - var o = ui.options, self = $(this).data("resizable"), pr = o.proportionallyResize, cs = self.size; - - if (!pr) self.ghost = self.element.clone(); - else self.ghost = pr.clone(); - - self.ghost.css( - { opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 } - ) - .addClass('ui-resizable-ghost').addClass(typeof o.ghost == 'string' ? o.ghost : ''); - - self.ghost.appendTo(self.helper); - - }, - - resize: function(e, ui){ - var o = ui.options, self = $(this).data("resizable"), pr = o.proportionallyResize; - - if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); - - }, - - stop: function(e, ui){ - var o = ui.options, self = $(this).data("resizable"), pr = o.proportionallyResize; - if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); - } - -}); - -$.ui.plugin.add("resizable", "alsoResize", { - - start: function(e, ui) { - var o = ui.options, self = $(this).data("resizable"), - - _store = function(exp) { - $(exp).each(function() { - $(this).data("resizable-alsoresize", { - width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10), - left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10) - }); - }); - }; - - if (typeof(o.alsoResize) == 'object') { - if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } - else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); } - }else{ - _store(o.alsoResize); - } - }, - - resize: function(e, ui){ - var o = ui.options, self = $(this).data("resizable"), os = self.originalSize, op = self.originalPosition; - - var delta = { - height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, - top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 - }, - - _alsoResize = function(exp, c) { - $(exp).each(function() { - var start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left']; - - $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) { - var sum = (start[prop]||0) + (delta[prop]||0); - if (sum && sum >= 0) - style[prop] = sum || null; - }); - $(this).css(style); - }); - }; - - if (typeof(o.alsoResize) == 'object') { - $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); }); - }else{ - _alsoResize(o.alsoResize); - } - }, - - stop: function(e, ui){ - $(this).removeData("resizable-alsoresize-start"); - } -}); - -})(jQuery); +/* + * jQuery UI Resizable 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.resizable", $.extend({}, $.ui.mouse, { + + _init: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('
    ').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('
    '); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.parent().append( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).end().remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + }, + + _mouseCapture: function(event) { + + var handle = false; + for(var i in this.handles) { + if($(this.handles[i])[0] == event.target) handle = true; + } + + return this.options.disabled || !!handle; + + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (data.height) data.width = (csize.height * this.aspectRatio); + else if (data.width) data.height = (csize.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('
    '); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +})); + +$.extend($.ui.resizable, { + version: "1.7.1", + eventPrefix: "resize", + defaults: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + cancel: ":input,option", + containment: false, + delay: 0, + distance: 1, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + } +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options; + + _store = function(exp) { + $(exp).each(function() { + $(this).data("resizable-alsoresize", { + width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10), + left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function(exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left']; + + $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + //Opera fixing relative position + if (/relative/.test(el.css('position')) && $.browser.opera) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"); + + //Opera fixing relative position + if (self._revertToRelativePosition && $.browser.opera) { + self._revertToRelativePosition = false; + el.css({ position: 'relative' }); + } + + $(this).removeData("resizable-alsoresize-start"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.selectable.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.selectable.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.selectable.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.selectable.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,266 +1,257 @@ -/* - * jQuery UI Selectable @VERSION - * - * Copyright (c) 2008 Richard D. Worth (rdworth.org) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Selectables - * - * Depends: - * ui.core.js - */ -(function($) { - -$.widget("ui.selectable", $.extend({}, $.ui.mouse, { - _init: function() { - var self = this; - - this.element.addClass("ui-selectable"); - - this.dragged = false; - - // cache selectee children based on filter - var selectees; - this.refresh = function() { - selectees = $(self.options.filter, self.element[0]); - selectees.each(function() { - var $this = $(this); - var pos = $this.offset(); - $.data(this, "selectable-item", { - element: this, - $element: $this, - left: pos.left, - top: pos.top, - right: pos.left + $this.width(), - bottom: pos.top + $this.height(), - startselected: false, - selected: $this.hasClass('ui-selected'), - selecting: $this.hasClass('ui-selecting'), - unselecting: $this.hasClass('ui-unselecting') - }); - }); - }; - this.refresh(); - - this.selectees = selectees.addClass("ui-selectee"); - - this._mouseInit(); - - this.helper = $(document.createElement('div')) - .css({border:'1px dotted black'}) - .addClass("ui-selectable-helper"); - }, - toggle: function() { - if(this.options.disabled){ - this.enable(); - } else { - this.disable(); - } - }, - destroy: function() { - this.element - .removeClass("ui-selectable ui-selectable-disabled") - .removeData("selectable") - .unbind(".selectable"); - this._mouseDestroy(); - }, - _mouseStart: function(e) { - var self = this; - - this.opos = [e.pageX, e.pageY]; - - if (this.options.disabled) - return; - - var options = this.options; - - this.selectees = $(options.filter, this.element[0]); - - // selectable START callback - this.element.triggerHandler("selectablestart", [e, { - "selectable": this.element[0], - "options": options - }], options.start); - - $('body').append(this.helper); - // position helper (lasso) - this.helper.css({ - "z-index": 100, - "position": "absolute", - "left": e.clientX, - "top": e.clientY, - "width": 0, - "height": 0 - }); - - if (options.autoRefresh) { - this.refresh(); - } - - this.selectees.filter('.ui-selected').each(function() { - var selectee = $.data(this, "selectable-item"); - selectee.startselected = true; - if (!e.metaKey) { - selectee.$element.removeClass('ui-selected'); - selectee.selected = false; - selectee.$element.addClass('ui-unselecting'); - selectee.unselecting = true; - // selectable UNSELECTING callback - self.element.triggerHandler("selectableunselecting", [e, { - selectable: self.element[0], - unselecting: selectee.element, - options: options - }], options.unselecting); - } - }); - - var isSelectee = false; - $(e.target).parents().andSelf().each(function() { - if($.data(this, "selectable-item")) isSelectee = true; - }); - return this.options.keyboard ? !isSelectee : true; - }, - _mouseDrag: function(e) { - var self = this; - this.dragged = true; - - if (this.options.disabled) - return; - - var options = this.options; - - var x1 = this.opos[0], y1 = this.opos[1], x2 = e.pageX, y2 = e.pageY; - if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } - if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } - this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); - - this.selectees.each(function() { - var selectee = $.data(this, "selectable-item"); - //prevent helper from being selected if appendTo: selectable - if (!selectee || selectee.element == self.element[0]) - return; - var hit = false; - if (options.tolerance == 'touch') { - hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); - } else if (options.tolerance == 'fit') { - hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); - } - - if (hit) { - // SELECT - if (selectee.selected) { - selectee.$element.removeClass('ui-selected'); - selectee.selected = false; - } - if (selectee.unselecting) { - selectee.$element.removeClass('ui-unselecting'); - selectee.unselecting = false; - } - if (!selectee.selecting) { - selectee.$element.addClass('ui-selecting'); - selectee.selecting = true; - // selectable SELECTING callback - self.element.triggerHandler("selectableselecting", [e, { - selectable: self.element[0], - selecting: selectee.element, - options: options - }], options.selecting); - } - } else { - // UNSELECT - if (selectee.selecting) { - if (e.metaKey && selectee.startselected) { - selectee.$element.removeClass('ui-selecting'); - selectee.selecting = false; - selectee.$element.addClass('ui-selected'); - selectee.selected = true; - } else { - selectee.$element.removeClass('ui-selecting'); - selectee.selecting = false; - if (selectee.startselected) { - selectee.$element.addClass('ui-unselecting'); - selectee.unselecting = true; - } - // selectable UNSELECTING callback - self.element.triggerHandler("selectableunselecting", [e, { - selectable: self.element[0], - unselecting: selectee.element, - options: options - }], options.unselecting); - } - } - if (selectee.selected) { - if (!e.metaKey && !selectee.startselected) { - selectee.$element.removeClass('ui-selected'); - selectee.selected = false; - - selectee.$element.addClass('ui-unselecting'); - selectee.unselecting = true; - // selectable UNSELECTING callback - self.element.triggerHandler("selectableunselecting", [e, { - selectable: self.element[0], - unselecting: selectee.element, - options: options - }], options.unselecting); - } - } - } - }); - - return false; - }, - _mouseStop: function(e) { - var self = this; - - this.dragged = false; - - var options = this.options; - - $('.ui-unselecting', this.element[0]).each(function() { - var selectee = $.data(this, "selectable-item"); - selectee.$element.removeClass('ui-unselecting'); - selectee.unselecting = false; - selectee.startselected = false; - self.element.triggerHandler("selectableunselected", [e, { - selectable: self.element[0], - unselected: selectee.element, - options: options - }], options.unselected); - }); - $('.ui-selecting', this.element[0]).each(function() { - var selectee = $.data(this, "selectable-item"); - selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); - selectee.selecting = false; - selectee.selected = true; - selectee.startselected = true; - self.element.triggerHandler("selectableselected", [e, { - selectable: self.element[0], - selected: selectee.element, - options: options - }], options.selected); - }); - this.element.triggerHandler("selectablestop", [e, { - selectable: self.element[0], - options: this.options - }], this.options.stop); - - this.helper.remove(); - - return false; - } -})); - -$.extend($.ui.selectable, { - defaults: { - distance: 1, - delay: 0, - cancel: ":input", - appendTo: 'body', - autoRefresh: true, - filter: '*', - tolerance: 'touch' - } -}); - -})(jQuery); +/* + * jQuery UI Selectable 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.selectable", $.extend({}, $.ui.mouse, { + + _init: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $(document.createElement('div')) + .css({border:'1px dotted black'}) + .addClass("ui-selectable-helper"); + }, + + destroy: function() { + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "z-index": 100, + "position": "absolute", + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting'); + selectee.unselecting = false; + selectee.selecting = true; + selectee.selected = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if (event.metaKey && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +})); + +$.extend($.ui.selectable, { + version: "1.7.1", + defaults: { + appendTo: 'body', + autoRefresh: true, + cancel: ":input,option", + delay: 0, + distance: 0, + filter: '*', + tolerance: 'touch' + } +}); + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.slider.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.slider.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.slider.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.slider.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,457 +1,532 @@ -/* - * jQuery UI Slider @VERSION - * - * Copyright (c) 2008 Paul Bakaus - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Slider - * - * Depends: - * ui.core.js - */ -(function($) { - -$.fn.unwrap = $.fn.unwrap || function(expr) { - return this.each(function(){ - $(this).parents(expr).eq(0).after(this).remove(); - }); -}; - -$.widget("ui.slider", { - plugins: {}, - ui: function(e) { - return { - options: this.options, - handle: this.currentHandle, - value: this.options.axis != "both" || !this.options.axis ? Math.round(this.value(null,this.options.axis == "vertical" ? "y" : "x")) : { - x: Math.round(this.value(null,"x")), - y: Math.round(this.value(null,"y")) - }, - range: this._getRange() - }; - }, - _propagate: function(n,e) { - $.ui.plugin.call(this, n, [e, this.ui()]); - this.element.triggerHandler(n == "slide" ? n : "slide"+n, [e, this.ui()], this.options[n]); - }, - destroy: function() { - - this.element - .removeClass("ui-slider ui-slider-disabled") - .removeData("slider") - .unbind(".slider"); - - if(this.handle && this.handle.length) { - this.handle - .unwrap("a"); - this.handle.each(function() { - $(this).data("mouse")._mouseDestroy(); - }); - } - - this.generated && this.generated.remove(); - - }, - _setData: function(key, value) { - $.widget.prototype._setData.apply(this, arguments); - if (/min|max|steps/.test(key)) { - this._initBoundaries(); - } - - if(key == "range") { - value ? this.handle.length == 2 && this._createRange() : this._removeRange(); - } - - }, - - _init: function() { - - var self = this; - this.element.addClass("ui-slider"); - this._initBoundaries(); - - // Initialize mouse and key events for interaction - this.handle = $(this.options.handle, this.element); - if (!this.handle.length) { - self.handle = self.generated = $(self.options.handles || [0]).map(function() { - var handle = $("
    ").addClass("ui-slider-handle").appendTo(self.element); - if (this.id) - handle.attr("id", this.id); - return handle[0]; - }); - } - - - var handleclass = function(el) { - this.element = $(el); - this.element.data("mouse", this); - this.options = self.options; - - this.element.bind("mousedown", function() { - if(self.currentHandle) this.blur(self.currentHandle); - self._focus(this, true); - }); - - this._mouseInit(); - }; - - $.extend(handleclass.prototype, $.ui.mouse, { - _mouseStart: function(e) { return self._start.call(self, e, this.element[0]); }, - _mouseStop: function(e) { return self._stop.call(self, e, this.element[0]); }, - _mouseDrag: function(e) { return self._drag.call(self, e, this.element[0]); }, - _mouseCapture: function() { return true; }, - trigger: function(e) { this._mouseDown(e); } - }); - - - $(this.handle) - .each(function() { - new handleclass(this); - }) - .wrap('') - .parent() - .bind('click', function() { return false; }) - .bind('focus', function(e) { self._focus(this.firstChild); }) - .bind('blur', function(e) { self._blur(this.firstChild); }) - .bind('keydown', function(e) { if(!self.options.noKeyboard) return self._keydown(e.keyCode, this.firstChild); }) - ; - - // Bind the click to the slider itself - this.element.bind('mousedown.slider', function(e) { - self._click.apply(self, [e]); - self.currentHandle.data("mouse").trigger(e); - self.firstValue = self.firstValue + 1; //This is for always triggering the change event - }); - - // Move the first handle to the startValue - $.each(this.options.handles || [], function(index, handle) { - self.moveTo(handle.start, index, true); - }); - if (!isNaN(this.options.startValue)) - this.moveTo(this.options.startValue, 0, true); - - this.previousHandle = $(this.handle[0]); //set the previous handle to the first to allow clicking before selecting the handle - if(this.handle.length == 2 && this.options.range) this._createRange(); - }, - _initBoundaries: function() { - - var element = this.element[0], o = this.options; - this.actualSize = { width: this.element.outerWidth() , height: this.element.outerHeight() }; - - $.extend(o, { - axis: o.axis || (element.offsetWidth < element.offsetHeight ? 'vertical' : 'horizontal'), - max: !isNaN(parseInt(o.max,10)) ? { x: parseInt(o.max, 10), y: parseInt(o.max, 10) } : ({ x: o.max && o.max.x || 100, y: o.max && o.max.y || 100 }), - min: !isNaN(parseInt(o.min,10)) ? { x: parseInt(o.min, 10), y: parseInt(o.min, 10) } : ({ x: o.min && o.min.x || 0, y: o.min && o.min.y || 0 }) - }); - //Prepare the real maxValue - o.realMax = { - x: o.max.x - o.min.x, - y: o.max.y - o.min.y - }; - //Calculate stepping based on steps - o.stepping = { - x: o.stepping && o.stepping.x || parseInt(o.stepping, 10) || (o.steps ? o.realMax.x/(o.steps.x || parseInt(o.steps, 10) || o.realMax.x) : 0), - y: o.stepping && o.stepping.y || parseInt(o.stepping, 10) || (o.steps ? o.realMax.y/(o.steps.y || parseInt(o.steps, 10) || o.realMax.y) : 0) - }; - }, - - - _keydown: function(keyCode, handle) { - var k = keyCode; - if(/(33|34|35|36|37|38|39|40)/.test(k)) { - var o = this.options, xpos, ypos; - if (/(35|36)/.test(k)) { - xpos = (k == 35) ? o.max.x : o.min.x; - ypos = (k == 35) ? o.max.y : o.min.y; - } else { - var oper = /(34|37|40)/.test(k) ? "-=" : "+="; - var step = /(37|38|39|40)/.test(k) ? "_oneStep" : "_pageStep"; - xpos = oper + this[step]("x"); - ypos = oper + this[step]("y"); - } - this.moveTo({ - x: xpos, - y: ypos - }, handle); - return false; - } - return true; - }, - _focus: function(handle,hard) { - this.currentHandle = $(handle).addClass('ui-slider-handle-active'); - if (hard) - this.currentHandle.parent()[0].focus(); - }, - _blur: function(handle) { - $(handle).removeClass('ui-slider-handle-active'); - if(this.currentHandle && this.currentHandle[0] == handle) { this.previousHandle = this.currentHandle; this.currentHandle = null; }; - }, - _click: function(e) { - // This method is only used if: - // - The user didn't click a handle - // - The Slider is not disabled - // - There is a current, or previous selected handle (otherwise we wouldn't know which one to move) - - var pointer = [e.pageX,e.pageY]; - - var clickedHandle = false; - this.handle.each(function() { - if(this == e.target) - clickedHandle = true; - }); - if (clickedHandle || this.options.disabled || !(this.currentHandle || this.previousHandle)) - return; - - // If a previous handle was focussed, focus it again - if (!this.currentHandle && this.previousHandle) - this._focus(this.previousHandle, true); - - // propagate only for distance > 0, otherwise propagation is done my drag - this.offset = this.element.offset(); - - this.moveTo({ - y: this._convertValue(e.pageY - this.offset.top - this.currentHandle[0].offsetHeight/2, "y"), - x: this._convertValue(e.pageX - this.offset.left - this.currentHandle[0].offsetWidth/2, "x") - }, null, !this.options.distance); - }, - - - - _createRange: function() { - if(this.rangeElement) return; - this.rangeElement = $('
    ') - .addClass('ui-slider-range') - .css({ position: 'absolute' }) - .appendTo(this.element); - this._updateRange(); - }, - _removeRange: function() { - this.rangeElement.remove(); - this.rangeElement = null; - }, - _updateRange: function() { - var prop = this.options.axis == "vertical" ? "top" : "left"; - var size = this.options.axis == "vertical" ? "height" : "width"; - this.rangeElement.css(prop, (parseInt($(this.handle[0]).css(prop),10) || 0) + this._handleSize(0, this.options.axis == "vertical" ? "y" : "x")/2); - this.rangeElement.css(size, (parseInt($(this.handle[1]).css(prop),10) || 0) - (parseInt($(this.handle[0]).css(prop),10) || 0)); - }, - _getRange: function() { - return this.rangeElement ? this._convertValue(parseInt(this.rangeElement.css(this.options.axis == "vertical" ? "height" : "width"),10), this.options.axis == "vertical" ? "y" : "x") : null; - }, - - _handleIndex: function() { - return this.handle.index(this.currentHandle[0]); - }, - value: function(handle, axis) { - if(this.handle.length == 1) this.currentHandle = this.handle; - if(!axis) axis = this.options.axis == "vertical" ? "y" : "x"; - - var curHandle = $(handle != undefined && handle !== null ? this.handle[handle] || handle : this.currentHandle); - - if(curHandle.data("mouse").sliderValue) { - return parseInt(curHandle.data("mouse").sliderValue[axis],10); - } else { - return parseInt(((parseInt(curHandle.css(axis == "x" ? "left" : "top"),10) / (this.actualSize[axis == "x" ? "width" : "height"] - this._handleSize(handle,axis))) * this.options.realMax[axis]) + this.options.min[axis],10); - } - - }, - _convertValue: function(value,axis) { - return this.options.min[axis] + (value / (this.actualSize[axis == "x" ? "width" : "height"] - this._handleSize(null,axis))) * this.options.realMax[axis]; - }, - - _translateValue: function(value,axis) { - return ((value - this.options.min[axis]) / this.options.realMax[axis]) * (this.actualSize[axis == "x" ? "width" : "height"] - this._handleSize(null,axis)); - }, - _translateRange: function(value,axis) { - if (this.rangeElement) { - if (this.currentHandle[0] == this.handle[0] && value >= this._translateValue(this.value(1),axis)) - value = this._translateValue(this.value(1,axis) - this._oneStep(axis), axis); - if (this.currentHandle[0] == this.handle[1] && value <= this._translateValue(this.value(0),axis)) - value = this._translateValue(this.value(0,axis) + this._oneStep(axis), axis); - } - if (this.options.handles) { - var handle = this.options.handles[this._handleIndex()]; - if (value < this._translateValue(handle.min,axis)) { - value = this._translateValue(handle.min,axis); - } else if (value > this._translateValue(handle.max,axis)) { - value = this._translateValue(handle.max,axis); - } - } - return value; - }, - _translateLimits: function(value,axis) { - if (value >= this.actualSize[axis == "x" ? "width" : "height"] - this._handleSize(null,axis)) - value = this.actualSize[axis == "x" ? "width" : "height"] - this._handleSize(null,axis); - if (value <= 0) - value = 0; - return value; - }, - _handleSize: function(handle,axis) { - return $(handle != undefined && handle !== null ? this.handle[handle] : this.currentHandle)[0]["offset"+(axis == "x" ? "Width" : "Height")]; - }, - _oneStep: function(axis) { - return this.options.stepping[axis] || 1; - }, - _pageStep: function(axis) { - return /* this.options.paging[axis] ||*/ 10; - }, - - - _start: function(e, handle) { - - var o = this.options; - if(o.disabled) return false; - - // Prepare the outer size - this.actualSize = { width: this.element.outerWidth() , height: this.element.outerHeight() }; - - // This is a especially ugly fix for strange blur events happening on mousemove events - if (!this.currentHandle) - this._focus(this.previousHandle, true); - - this.offset = this.element.offset(); - - this.handleOffset = this.currentHandle.offset(); - this.clickOffset = { top: e.pageY - this.handleOffset.top, left: e.pageX - this.handleOffset.left }; - - this.firstValue = this.value(); - - this._propagate('start', e); - this._drag(e, handle); - return true; - - }, - _stop: function(e) { - this._propagate('stop', e); - if (this.firstValue != this.value()) - this._propagate('change', e); - // This is a especially ugly fix for strange blur events happening on mousemove events - this._focus(this.currentHandle, true); - return false; - }, - _drag: function(e, handle) { - - var o = this.options; - var position = { top: e.pageY - this.offset.top - this.clickOffset.top, left: e.pageX - this.offset.left - this.clickOffset.left}; - if(!this.currentHandle) this._focus(this.previousHandle, true); //This is a especially ugly fix for strange blur events happening on mousemove events - - position.left = this._translateLimits(position.left, "x"); - position.top = this._translateLimits(position.top, "y"); - - if (o.stepping.x) { - var value = this._convertValue(position.left, "x"); - value = Math.round(value / o.stepping.x) * o.stepping.x; - position.left = this._translateValue(value, "x"); - } - if (o.stepping.y) { - var value = this._convertValue(position.top, "y"); - value = Math.round(value / o.stepping.y) * o.stepping.y; - position.top = this._translateValue(value, "y"); - } - - position.left = this._translateRange(position.left, "x"); - position.top = this._translateRange(position.top, "y"); - - if(o.axis != "vertical") this.currentHandle.css({ left: position.left }); - if(o.axis != "horizontal") this.currentHandle.css({ top: position.top }); - - //Store the slider's value - this.currentHandle.data("mouse").sliderValue = { - x: Math.round(this._convertValue(position.left, "x")) || 0, - y: Math.round(this._convertValue(position.top, "y")) || 0 - }; - - if (this.rangeElement) - this._updateRange(); - this._propagate('slide', e); - return false; - }, - - moveTo: function(value, handle, noPropagation) { - - var o = this.options; - - // Prepare the outer size - this.actualSize = { width: this.element.outerWidth() , height: this.element.outerHeight() }; - - //If no handle has been passed, no current handle is available and we have multiple handles, return false - if (handle == undefined && !this.currentHandle && this.handle.length != 1) - return false; - - //If only one handle is available, use it - if (handle == undefined && !this.currentHandle) - handle = 0; - - if (handle != undefined) - this.currentHandle = this.previousHandle = $(this.handle[handle] || handle); - - - if(value.x !== undefined && value.y !== undefined) { - var x = value.x, y = value.y; - } else { - var x = value, y = value; - } - - if(x !== undefined && x.constructor != Number) { - var me = /^\-\=/.test(x), pe = /^\+\=/.test(x); - if(me || pe) { - x = this.value(null, "x") + parseInt(x.replace(me ? '=' : '+=', ''), 10); - } else { - x = isNaN(parseInt(x, 10)) ? undefined : parseInt(x, 10); - } - } - - if(y !== undefined && y.constructor != Number) { - var me = /^\-\=/.test(y), pe = /^\+\=/.test(y); - if(me || pe) { - y = this.value(null, "y") + parseInt(y.replace(me ? '=' : '+=', ''), 10); - } else { - y = isNaN(parseInt(y, 10)) ? undefined : parseInt(y, 10); - } - } - - if(o.axis != "vertical" && x !== undefined) { - if(o.stepping.x) x = Math.round(x / o.stepping.x) * o.stepping.x; - x = this._translateValue(x, "x"); - x = this._translateLimits(x, "x"); - x = this._translateRange(x, "x"); - - o.animate ? this.currentHandle.stop().animate({ left: x }, (Math.abs(parseInt(this.currentHandle.css("left")) - x)) * (!isNaN(parseInt(o.animate)) ? o.animate : 5)) : this.currentHandle.css({ left: x }); - } - - if(o.axis != "horizontal" && y !== undefined) { - if(o.stepping.y) y = Math.round(y / o.stepping.y) * o.stepping.y; - y = this._translateValue(y, "y"); - y = this._translateLimits(y, "y"); - y = this._translateRange(y, "y"); - o.animate ? this.currentHandle.stop().animate({ top: y }, (Math.abs(parseInt(this.currentHandle.css("top")) - y)) * (!isNaN(parseInt(o.animate)) ? o.animate : 5)) : this.currentHandle.css({ top: y }); - } - - if (this.rangeElement) - this._updateRange(); - - //Store the slider's value - this.currentHandle.data("mouse").sliderValue = { - x: Math.round(this._convertValue(x, "x")) || 0, - y: Math.round(this._convertValue(y, "y")) || 0 - }; - - if (!noPropagation) { - this._propagate('start', null); - this._propagate('stop', null); - this._propagate('change', null); - this._propagate("slide", null); - } - } -}); - -$.ui.slider.getter = "value"; - -$.ui.slider.defaults = { - handle: ".ui-slider-handle", - distance: 1, - animate: false -}; - -})(jQuery); +/* + * jQuery UI Slider 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * ui.core.js + */ + +(function($) { + +$.widget("ui.slider", $.extend({}, $.ui.mouse, { + + _init: function() { + + var self = this, o = this.options; + this._keySliding = false; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass("ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all"); + + this.range = $([]); + + if (o.range) { + + if (o.range === true) { + this.range = $('
    '); + if (!o.values) o.values = [this._valueMin(), this._valueMin()]; + if (o.values.length && o.values.length != 2) { + o.values = [o.values[0], o.values[0]]; + } + } else { + this.range = $('
    '); + } + + this.range + .appendTo(this.element) + .addClass("ui-slider-range"); + + if (o.range == "min" || o.range == "max") { + this.range.addClass("ui-slider-range-" + o.range); + } + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + this.range.addClass("ui-widget-header"); + + } + + if ($(".ui-slider-handle", this.element).length == 0) + $('') + .appendTo(this.element) + .addClass("ui-slider-handle"); + + if (o.values && o.values.length) { + while ($(".ui-slider-handle", this.element).length < o.values.length) + $('') + .appendTo(this.element) + .addClass("ui-slider-handle"); + } + + this.handles = $(".ui-slider-handle", this.element) + .addClass("ui-state-default" + + " ui-corner-all"); + + this.handle = this.handles.eq(0); + + this.handles.add(this.range).filter("a") + .click(function(event) { event.preventDefault(); }) + .hover(function() { $(this).addClass('ui-state-hover'); }, function() { $(this).removeClass('ui-state-hover'); }) + .focus(function() { $(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus'); }) + .blur(function() { $(this).removeClass('ui-state-focus'); }); + + this.handles.each(function(i) { + $(this).data("index.ui-slider-handle", i); + }); + + this.handles.keydown(function(event) { + + var ret = true; + + var index = $(this).data("index.ui-slider-handle"); + + if (self.options.disabled) + return; + + switch (event.keyCode) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if (!self._keySliding) { + self._keySliding = true; + $(this).addClass("ui-state-active"); + self._start(event, index); + } + break; + } + + var curVal, newVal, step = self._step(); + if (self.options.values && self.options.values.length) { + curVal = newVal = self.values(index); + } else { + curVal = newVal = self.value(); + } + + switch (event.keyCode) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if(curVal == self._valueMax()) return; + newVal = curVal + step; + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if(curVal == self._valueMin()) return; + newVal = curVal - step; + break; + } + + self._slide(event, index, newVal); + + return ret; + + }).keyup(function(event) { + + var index = $(this).data("index.ui-slider-handle"); + + if (self._keySliding) { + self._stop(event, index); + self._change(event, index); + self._keySliding = false; + $(this).removeClass("ui-state-active"); + } + + }); + + this._refreshValue(); + + }, + + destroy: function() { + + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass("ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all") + .removeData("slider") + .unbind(".slider"); + + this._mouseDestroy(); + + }, + + _mouseCapture: function(event) { + + var o = this.options; + + if (o.disabled) + return false; + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + var position = { x: event.pageX, y: event.pageY }; + var normValue = this._normValueFromMouse(position); + + var distance = this._valueMax() - this._valueMin() + 1, closestHandle; + var self = this, index; + this.handles.each(function(i) { + var thisDistance = Math.abs(normValue - self.values(i)); + if (distance > thisDistance) { + distance = thisDistance; + closestHandle = $(this); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if(o.range == true && this.values(1) == o.min) { + closestHandle = $(this.handles[++index]); + } + + this._start(event, index); + + self._handleIndex = index; + + closestHandle + .addClass("ui-state-active") + .focus(); + + var offset = closestHandle.offset(); + var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle'); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - (closestHandle.width() / 2), + top: event.pageY - offset.top + - (closestHandle.height() / 2) + - (parseInt(closestHandle.css('borderTopWidth'),10) || 0) + - (parseInt(closestHandle.css('borderBottomWidth'),10) || 0) + + (parseInt(closestHandle.css('marginTop'),10) || 0) + }; + + normValue = this._normValueFromMouse(position); + this._slide(event, index, normValue); + return true; + + }, + + _mouseStart: function(event) { + return true; + }, + + _mouseDrag: function(event) { + + var position = { x: event.pageX, y: event.pageY }; + var normValue = this._normValueFromMouse(position); + + this._slide(event, this._handleIndex, normValue); + + return false; + + }, + + _mouseStop: function(event) { + + this.handles.removeClass("ui-state-active"); + this._stop(event, this._handleIndex); + this._change(event, this._handleIndex); + this._handleIndex = null; + this._clickOffset = null; + + return false; + + }, + + _detectOrientation: function() { + this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal'; + }, + + _normValueFromMouse: function(position) { + + var pixelTotal, pixelMouse; + if ('horizontal' == this.orientation) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0); + } + + var percentMouse = (pixelMouse / pixelTotal); + if (percentMouse > 1) percentMouse = 1; + if (percentMouse < 0) percentMouse = 0; + if ('vertical' == this.orientation) + percentMouse = 1 - percentMouse; + + var valueTotal = this._valueMax() - this._valueMin(), + valueMouse = percentMouse * valueTotal, + valueMouseModStep = valueMouse % this.options.step, + normValue = this._valueMin() + valueMouse - valueMouseModStep; + + if (valueMouseModStep > (this.options.step / 2)) + normValue += this.options.step; + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat(normValue.toFixed(5)); + + }, + + _start: function(event, index) { + var uiHash = { + handle: this.handles[index], + value: this.value() + }; + if (this.options.values && this.options.values.length) { + uiHash.value = this.values(index) + uiHash.values = this.values() + } + this._trigger("start", event, uiHash); + }, + + _slide: function(event, index, newVal) { + + var handle = this.handles[index]; + + if (this.options.values && this.options.values.length) { + + var otherVal = this.values(index ? 0 : 1); + + if ((index == 0 && newVal >= otherVal) || (index == 1 && newVal <= otherVal)) + newVal = otherVal; + + if (newVal != this.values(index)) { + var newValues = this.values(); + newValues[index] = newVal; + // A slide can be canceled by returning false from the slide callback + var allowed = this._trigger("slide", event, { + handle: this.handles[index], + value: newVal, + values: newValues + }); + var otherVal = this.values(index ? 0 : 1); + if (allowed !== false) { + this.values(index, newVal, ( event.type == 'mousedown' && this.options.animate ), true); + } + } + + } else { + + if (newVal != this.value()) { + // A slide can be canceled by returning false from the slide callback + var allowed = this._trigger("slide", event, { + handle: this.handles[index], + value: newVal + }); + if (allowed !== false) { + this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate )); + } + + } + + } + + }, + + _stop: function(event, index) { + var uiHash = { + handle: this.handles[index], + value: this.value() + }; + if (this.options.values && this.options.values.length) { + uiHash.value = this.values(index) + uiHash.values = this.values() + } + this._trigger("stop", event, uiHash); + }, + + _change: function(event, index) { + var uiHash = { + handle: this.handles[index], + value: this.value() + }; + if (this.options.values && this.options.values.length) { + uiHash.value = this.values(index) + uiHash.values = this.values() + } + this._trigger("change", event, uiHash); + }, + + value: function(newValue) { + + if (arguments.length) { + this._setData("value", newValue); + this._change(null, 0); + } + + return this._value(); + + }, + + values: function(index, newValue, animated, noPropagation) { + + if (arguments.length > 1) { + this.options.values[index] = newValue; + this._refreshValue(animated); + if(!noPropagation) this._change(null, index); + } + + if (arguments.length) { + if (this.options.values && this.options.values.length) { + return this._values(index); + } else { + return this.value(); + } + } else { + return this._values(); + } + + }, + + _setData: function(key, value, animated) { + + $.widget.prototype._setData.apply(this, arguments); + + switch (key) { + case 'orientation': + + this._detectOrientation(); + + this.element + .removeClass("ui-slider-horizontal ui-slider-vertical") + .addClass("ui-slider-" + this.orientation); + this._refreshValue(animated); + break; + case 'value': + this._refreshValue(animated); + break; + } + + }, + + _step: function() { + var step = this.options.step; + return step; + }, + + _value: function() { + + var val = this.options.value; + if (val < this._valueMin()) val = this._valueMin(); + if (val > this._valueMax()) val = this._valueMax(); + + return val; + + }, + + _values: function(index) { + + if (arguments.length) { + var val = this.options.values[index]; + if (val < this._valueMin()) val = this._valueMin(); + if (val > this._valueMax()) val = this._valueMax(); + + return val; + } else { + return this.options.values; + } + + }, + + _valueMin: function() { + var valueMin = this.options.min; + return valueMin; + }, + + _valueMax: function() { + var valueMax = this.options.max; + return valueMax; + }, + + _refreshValue: function(animate) { + + var oRange = this.options.range, o = this.options, self = this; + + if (this.options.values && this.options.values.length) { + var vp0, vp1; + this.handles.each(function(i, j) { + var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100; + var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%'; + $(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate); + if (self.options.range === true) { + if (self.orientation == 'horizontal') { + (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate); + (i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate }); + } else { + (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate); + (i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate }); + } + } + lastValPercent = valPercent; + }); + } else { + var value = this.value(), + valueMin = this._valueMin(), + valueMax = this._valueMax(), + valPercent = valueMax != valueMin + ? (value - valueMin) / (valueMax - valueMin) * 100 + : 0; + var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%'; + this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate); + + (oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate); + (oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate }); + (oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate); + (oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate }); + } + + } + +})); + +$.extend($.ui.slider, { + getter: "value values", + version: "1.7.1", + eventPrefix: "slide", + defaults: { + animate: false, + delay: 0, + distance: 0, + max: 100, + min: 0, + orientation: 'horizontal', + range: false, + step: 1, + value: 0, + values: null + } +}); + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.sortable.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.sortable.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.sortable.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.sortable.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,860 +1,1019 @@ -/* - * jQuery UI Sortable @VERSION - * - * Copyright (c) 2008 Paul Bakaus - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Sortables - * - * Depends: - * ui.core.js - */ -(function($) { - -function contains(a, b) { - var safari2 = $.browser.safari && $.browser.version < 522; - if (a.contains && !safari2) { - return a.contains(b); - } - if (a.compareDocumentPosition) - return !!(a.compareDocumentPosition(b) & 16); - while (b = b.parentNode) - if (b == a) return true; - return false; -}; - -$.widget("ui.sortable", $.extend({}, $.ui.mouse, { - _init: function() { - - var o = this.options; - this.containerCache = {}; - this.element.addClass("ui-sortable"); - - //Get the items - this.refresh(); - - //Let's determine if the items are floating - this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false; - - //Let's determine the parent's offset - this.offset = this.element.offset(); - - //Initialize mouse events for interaction - this._mouseInit(); - - }, - plugins: {}, - ui: function(inst) { - return { - helper: (inst || this)["helper"], - placeholder: (inst || this)["placeholder"] || $([]), - position: (inst || this)["position"], - absolutePosition: (inst || this)["positionAbs"], - options: this.options, - element: this.element, - item: (inst || this)["currentItem"], - sender: inst ? inst.element : null - }; - }, - - _propagate: function(n,e,inst, noPropagation) { - $.ui.plugin.call(this, n, [e, this.ui(inst)]); - if(!noPropagation) this.element.triggerHandler(n == "sort" ? n : "sort"+n, [e, this.ui(inst)], this.options[n]); - }, - - serialize: function(o) { - - var items = this._getItemsAsjQuery(o && o.connected); - var str = []; o = o || {}; - - $(items).each(function() { - var res = ($(this.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); - if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); - }); - - return str.join('&'); - - }, - - toArray: function(o) { - - var items = this._getItemsAsjQuery(o && o.connected); - var ret = []; - - items.each(function() { ret.push($(this).attr(o.attr || 'id')); }); - return ret; - - }, - - /* Be careful with the following core functions */ - _intersectsWith: function(item) { - var x1 = this.positionAbs.left, x2 = x1 + this.helperProportions.width, - y1 = this.positionAbs.top, y2 = y1 + this.helperProportions.height; - var l = item.left, r = l + item.width, - t = item.top, b = t + item.height; - - var dyClick = this.offset.click.top, dxClick = this.offset.click.left; - var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; - - if(this.options.tolerance == "pointer" || this.options.forcePointerForContainers || (this.options.tolerance == "guess" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])) { - return isOverElement; - } else { - - return (l < x1 + (this.helperProportions.width / 2) // Right Half - && x2 - (this.helperProportions.width / 2) < r // Left Half - && t < y1 + (this.helperProportions.height / 2) // Bottom Half - && y2 - (this.helperProportions.height / 2) < b ); // Top Half - - } - }, - - _intersectsWithEdge: function(item) { - var x1 = this.positionAbs.left, x2 = x1 + this.helperProportions.width, - y1 = this.positionAbs.top, y2 = y1 + this.helperProportions.height; - - var l = item.left, r = l + item.width, - t = item.top, b = t + item.height; - - var dyClick = this.offset.click.top, dxClick = this.offset.click.left; - var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; - - if(this.options.tolerance == "pointer" || (this.options.tolerance == "guess" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])) { - if(!isOverElement) return false; - - if(this.floating) { - if ((x1 + dxClick) > l && (x1 + dxClick) < l + item.width/2) return 2; - if ((x1 + dxClick) > l + item.width/2 && (x1 + dxClick) < r) return 1; - } else { - var height = item.height; - var direction = y1 - this.updateOriginalPosition.top < 0 ? 2 : 1; // 2 = up - - if (direction == 1 && (y1 + dyClick) < t + height/2) { return 2; } // up - else if (direction == 2 && (y1 + dyClick) > t + height/2) { return 1; } // down - } - - } else { - if (!(l < x1 + (this.helperProportions.width / 2) // Right Half - && x2 - (this.helperProportions.width / 2) < r // Left Half - && t < y1 + (this.helperProportions.height / 2) // Bottom Half - && y2 - (this.helperProportions.height / 2) < b )) return false; // Top Half - - if(this.floating) { - if(x2 > l && x1 < l) return 2; //Crosses left edge - if(x1 < r && x2 > r) return 1; //Crosses right edge - } else { - if(y2 > t && y1 < t) return 1; //Crosses top edge - if(y1 < b && y2 > b) return 2; //Crosses bottom edge - } - } - - return false; - - }, - - refresh: function() { - this._refreshItems(); - this.refreshPositions(); - }, - - _getItemsAsjQuery: function(connected) { - - var self = this; - var items = []; - var queries = []; - - if(this.options.connectWith && connected) { - for (var i = this.options.connectWith.length - 1; i >= 0; i--){ - var cur = $(this.options.connectWith[i]); - for (var j = cur.length - 1; j >= 0; j--){ - var inst = $.data(cur[j], 'sortable'); - if(inst && inst != this && !inst.options.disabled) { - queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper"), inst]); - } - }; - }; - } - - queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper"), this]); - - for (var i = queries.length - 1; i >= 0; i--){ - queries[i][0].each(function() { - items.push(this); - }); - }; - - return $(items); - - }, - - _removeCurrentsFromItems: function() { - - var list = this.currentItem.find(":data(sortable-item)"); - - for (var i=0; i < this.items.length; i++) { - - for (var j=0; j < list.length; j++) { - if(list[j] == this.items[i].item[0]) - this.items.splice(i,1); - }; - - }; - - }, - - _refreshItems: function() { - - this.items = []; - this.containers = [this]; - var items = this.items; - var self = this; - var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element), this]]; - - if(this.options.connectWith) { - for (var i = this.options.connectWith.length - 1; i >= 0; i--){ - var cur = $(this.options.connectWith[i]); - for (var j = cur.length - 1; j >= 0; j--){ - var inst = $.data(cur[j], 'sortable'); - if(inst && inst != this && !inst.options.disabled) { - queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element), inst]); - this.containers.push(inst); - } - }; - }; - } - - for (var i = queries.length - 1; i >= 0; i--){ - queries[i][0].each(function() { - $.data(this, 'sortable-item', queries[i][1]); // Data for target checking (mouse manager) - items.push({ - item: $(this), - instance: queries[i][1], - width: 0, height: 0, - left: 0, top: 0 - }); - }); - }; - - }, - - refreshPositions: function(fast) { - - //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change - if(this.offsetParent) { - var po = this.offsetParent.offset(); - this.offset.parent = { top: po.top + this.offsetParentBorders.top, left: po.left + this.offsetParentBorders.left }; - } - - for (var i = this.items.length - 1; i >= 0; i--){ - - //We ignore calculating positions of all connected containers when we're not over them - if(this.items[i].instance != this.currentContainer && this.currentContainer && this.items[i].item[0] != this.currentItem[0]) - continue; - - var t = this.options.toleranceElement ? $(this.options.toleranceElement, this.items[i].item) : this.items[i].item; - - if(!fast) { - this.items[i].width = t[0].offsetWidth; - this.items[i].height = t[0].offsetHeight; - } - - var p = t.offset(); - this.items[i].left = p.left; - this.items[i].top = p.top; - - }; - - if(this.options.custom && this.options.custom.refreshContainers) { - this.options.custom.refreshContainers.call(this); - } else { - for (var i = this.containers.length - 1; i >= 0; i--){ - var p =this.containers[i].element.offset(); - this.containers[i].containerCache.left = p.left; - this.containers[i].containerCache.top = p.top; - this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); - this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); - }; - } - - }, - - destroy: function() { - this.element - .removeClass("ui-sortable ui-sortable-disabled") - .removeData("sortable") - .unbind(".sortable"); - this._mouseDestroy(); - - for ( var i = this.items.length - 1; i >= 0; i-- ) - this.items[i].item.removeData("sortable-item"); - }, - - _createPlaceholder: function(that) { - - var self = that || this, o = self.options; - - if(!o.placeholder || o.placeholder.constructor == String) { - var className = o.placeholder; - o.placeholder = { - element: function() { - var el = $(document.createElement(self.currentItem[0].nodeName)).addClass(className || "ui-sortable-placeholder")[0]; - - if(!className) { - el.style.visibility = "hidden"; - document.body.appendChild(el); - el.innerHTML = self.currentItem[0].innerHTML; - document.body.removeChild(el); - }; - - return el; - }, - update: function(container, p) { - if(className && !o.forcePlaceholderSize) return; - if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; - if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; - } - }; - } - - self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)) - self.currentItem.parent()[0].appendChild(self.placeholder[0]); - self.placeholder[0].parentNode.insertBefore(self.placeholder[0], self.currentItem[0]); - o.placeholder.update(self, self.placeholder); - }, - - _contactContainers: function(e) { - for (var i = this.containers.length - 1; i >= 0; i--){ - - if(this._intersectsWith(this.containers[i].containerCache)) { - if(!this.containers[i].containerCache.over) { - - - if(this.currentContainer != this.containers[i]) { - - //When entering a new container, we will find the item with the least distance and append our item near it - var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[i].floating ? 'left' : 'top']; - for (var j = this.items.length - 1; j >= 0; j--) { - if(!contains(this.containers[i].element[0], this.items[j].item[0])) continue; - var cur = this.items[j][this.containers[i].floating ? 'left' : 'top']; - if(Math.abs(cur - base) < dist) { - dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; - } - } - - if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled - continue; - - this.currentContainer = this.containers[i]; - itemWithLeastDistance ? this.options.sortIndicator.call(this, e, itemWithLeastDistance, null, true) : this.options.sortIndicator.call(this, e, null, this.containers[i].element, true); - this._propagate("change", e); //Call plugins and callbacks - this.containers[i]._propagate("change", e, this); //Call plugins and callbacks - - //Update the placeholder - this.options.placeholder.update(this.currentContainer, this.placeholder); - - } - - this.containers[i]._propagate("over", e, this); - this.containers[i].containerCache.over = 1; - } - } else { - if(this.containers[i].containerCache.over) { - this.containers[i]._propagate("out", e, this); - this.containers[i].containerCache.over = 0; - } - } - - }; - }, - - _mouseCapture: function(e, overrideHandle) { - - if(this.options.disabled || this.options.type == 'static') return false; - - //We have to refresh the items data once first - this._refreshItems(); - - //Find out if the clicked node (or one of its parents) is a actual item in this.items - var currentItem = null, self = this, nodes = $(e.target).parents().each(function() { - if($.data(this, 'sortable-item') == self) { - currentItem = $(this); - return false; - } - }); - if($.data(e.target, 'sortable-item') == self) currentItem = $(e.target); - - if(!currentItem) return false; - if(this.options.handle && !overrideHandle) { - var validHandle = false; - - $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == e.target) validHandle = true; }); - if(!validHandle) return false; - } - - this.currentItem = currentItem; - this._removeCurrentsFromItems(); - return true; - - }, - - createHelper: function(e) { - - var o = this.options; - var helper = typeof o.helper == 'function' ? $(o.helper.apply(this.element[0], [e, this.currentItem])) : (o.helper == "original" ? this.currentItem : this.currentItem.clone()); - - if (!helper.parents('body').length) - $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); //Add the helper to the DOM if that didn't happen already - - return helper; - - }, - - _mouseStart: function(e, overrideHandle, noActivation) { - - var o = this.options; - this.currentContainer = this; - - //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture - this.refreshPositions(); - - //Create and append the visible helper - this.helper = this.createHelper(e); - - /* - * - Position generation - - * This block generates everything position related - it's the core of draggables. - */ - - this.margins = { //Cache the margins - left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), - top: (parseInt(this.currentItem.css("marginTop"),10) || 0) - }; - - this.offset = this.currentItem.offset(); //The element's absolute position on the page - this.offset = { //Substract the margins from the element's absolute offset - top: this.offset.top - this.margins.top, - left: this.offset.left - this.margins.left - }; - - this.offset.click = { //Where the click happened, relative to the element - left: e.pageX - this.offset.left, - top: e.pageY - this.offset.top - }; - - this.offsetParent = this.helper.offsetParent(); //Get the offsetParent and cache its position - var po = this.offsetParent.offset(); - - this.offsetParentBorders = { - top: (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), - left: (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) - }; - - this.offset.parent = { //Store its position plus border - top: po.top + this.offsetParentBorders.top, - left: po.left + this.offsetParentBorders.left - }; - - this.updateOriginalPosition = this.originalPosition = this._generatePosition(e); //Generate the original position - this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; //Cache the former DOM position - - //If o.placeholder is used, create a new element at the given position with the class - this.helperProportions = { width: this.helper.outerWidth(), height: this.helper.outerHeight() };//Cache the helper size - - - if(o.helper == "original") { - this._storedCSS = { position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left"), clear: this.currentItem.css("clear") }; - } else { - this.currentItem.hide(); //Hide the original, won't cause anything bad this way - } - - //Position it absolutely and add a helper class - this.helper - .css({ position: 'absolute', clear: 'both' }) - .addClass('ui-sortable-helper'); - - //Create the placeholder - this._createPlaceholder(); - - //Call plugins and callbacks - this._propagate("start", e); - - //Recache the helper size - if(!this._preserveHelperProportions) - this.helperProportions = { width: this.helper.outerWidth(), height: this.helper.outerHeight() }; - - if(o.cursorAt) { - if(o.cursorAt.left != undefined) this.offset.click.left = o.cursorAt.left; - if(o.cursorAt.right != undefined) this.offset.click.left = this.helperProportions.width - o.cursorAt.right; - if(o.cursorAt.top != undefined) this.offset.click.top = o.cursorAt.top; - if(o.cursorAt.bottom != undefined) this.offset.click.top = this.helperProportions.height - o.cursorAt.bottom; - } - - /* - * - Position constraining - - * Here we prepare position constraining like grid and containment. - */ - - if(o.containment) { - if(o.containment == 'parent') o.containment = this.helper[0].parentNode; - if(o.containment == 'document' || o.containment == 'window') this.containment = [ - 0 - this.offset.parent.left, - 0 - this.offset.parent.top, - $(o.containment == 'document' ? document : window).width() - this.offset.parent.left - this.helperProportions.width - this.margins.left - (parseInt(this.element.css("marginRight"),10) || 0), - ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.offset.parent.top - this.helperProportions.height - this.margins.top - (parseInt(this.element.css("marginBottom"),10) || 0) - ]; - - if(!(/^(document|window|parent)$/).test(o.containment)) { - var ce = $(o.containment)[0]; - var co = $(o.containment).offset(); - var over = ($(ce).css("overflow") != 'hidden'); - - this.containment = [ - co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) - this.offset.parent.left, - co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) - this.offset.parent.top, - co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - this.offset.parent.left - this.helperProportions.width - this.margins.left - (parseInt(this.currentItem.css("marginRight"),10) || 0), - co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - this.offset.parent.top - this.helperProportions.height - this.margins.top - (parseInt(this.currentItem.css("marginBottom"),10) || 0) - ]; - } - } - - //Post 'activate' events to possible containers - if(!noActivation) { - for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._propagate("activate", e, this); } - } - - //Prepare possible droppables - if($.ui.ddmanager) - $.ui.ddmanager.current = this; - - if ($.ui.ddmanager && !o.dropBehaviour) - $.ui.ddmanager.prepareOffsets(this, e); - - this.dragging = true; - - this._mouseDrag(e); //Execute the drag once - this causes the helper not to be visible before getting its correct position - return true; - - - }, - - _convertPositionTo: function(d, pos) { - if(!pos) pos = this.position; - var mod = d == "absolute" ? 1 : -1; - return { - top: ( - pos.top // the calculated relative position - + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) - - (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) * mod // The offsetParent's scroll position - + this.margins.top * mod //Add the margin (you don't want the margin counting in intersection methods) - ), - left: ( - pos.left // the calculated relative position - + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) - - (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft) * mod // The offsetParent's scroll position - + this.margins.left * mod //Add the margin (you don't want the margin counting in intersection methods) - ) - }; - }, - - _generatePosition: function(e) { - - var o = this.options; - var position = { - top: ( - e.pageY // The absolute mouse position - - this.offset.click.top // Click offset (relative to the element) - - this.offset.parent.top // The offsetParent's offset without borders (offset + border) - + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) // The offsetParent's scroll position, not if the element is fixed - ), - left: ( - e.pageX // The absolute mouse position - - this.offset.click.left // Click offset (relative to the element) - - this.offset.parent.left // The offsetParent's offset without borders (offset + border) - + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft) // The offsetParent's scroll position, not if the element is fixed - ) - }; - - if(!this.originalPosition) return position; //If we are not dragging yet, we won't check for options - - /* - * - Position constraining - - * Constrain the position to a mix of grid, containment. - */ - if(this.containment) { - if(position.left < this.containment[0]) position.left = this.containment[0]; - if(position.top < this.containment[1]) position.top = this.containment[1]; - if(position.left > this.containment[2]) position.left = this.containment[2]; - if(position.top > this.containment[3]) position.top = this.containment[3]; - } - - if(o.grid) { - var top = this.originalPosition.top + Math.round((position.top - this.originalPosition.top) / o.grid[1]) * o.grid[1]; - position.top = this.containment ? (!(top < this.containment[1] || top > this.containment[3]) ? top : (!(top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; - - var left = this.originalPosition.left + Math.round((position.left - this.originalPosition.left) / o.grid[0]) * o.grid[0]; - position.left = this.containment ? (!(left < this.containment[0] || left > this.containment[2]) ? left : (!(left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; - } - - return position; - }, - - _mouseDrag: function(e) { - - //Compute the helpers position - this.position = this._generatePosition(e); - this.positionAbs = this._convertPositionTo("absolute"); - - //Call the internal plugins - $.ui.plugin.call(this, "sort", [e, this.ui()]); - - //Regenerate the absolute position used for position checks - this.positionAbs = this._convertPositionTo("absolute"); - - //Set the helper's position - this.helper[0].style.left = this.position.left+'px'; - this.helper[0].style.top = this.position.top+'px'; - - //Rearrange - for (var i = this.items.length - 1; i >= 0; i--) { - var intersection = this._intersectsWithEdge(this.items[i]); - if(!intersection) continue; - - if(this.items[i].item[0] != this.currentItem[0] //cannot intersect with itself - && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != this.items[i].item[0] //no useless actions that have been done before - && !contains(this.placeholder[0], this.items[i].item[0]) //no action if the item moved is the parent of the item checked - && (this.options.type == 'semi-dynamic' ? !contains(this.element[0], this.items[i].item[0]) : true) - ) { - - this.updateOriginalPosition = this._generatePosition(e); - - this.direction = intersection == 1 ? "down" : "up"; - this.options.sortIndicator.call(this, e, this.items[i]); - this._propagate("change", e); //Call plugins and callbacks - break; - } - } - - //Post events to containers - this._contactContainers(e); - - //Interconnect with droppables - if($.ui.ddmanager) $.ui.ddmanager.drag(this, e); - - //Call callbacks - this.element.triggerHandler("sort", [e, this.ui()], this.options["sort"]); - - return false; - - }, - - _rearrange: function(e, i, a, hardRefresh) { - - a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); - - //Various things done here to improve the performance: - // 1. we create a setTimeout, that calls refreshPositions - // 2. on the instance, we have a counter variable, that get's higher after every append - // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same - // 4. this lets only the last addition to the timeout stack through - this.counter = this.counter ? ++this.counter : 1; - var self = this, counter = this.counter; - - window.setTimeout(function() { - if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove - },0); - - }, - - _mouseStop: function(e, noPropagation) { - - //If we are using droppables, inform the manager about the drop - if ($.ui.ddmanager && !this.options.dropBehaviour) - $.ui.ddmanager.drop(this, e); - - if(this.options.revert) { - var self = this; - var cur = self.placeholder.offset(); - - $(this.helper).animate({ - left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), - top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) - }, parseInt(this.options.revert, 10) || 500, function() { - self._clear(e); - }); - } else { - this._clear(e, noPropagation); - } - - return false; - - }, - - _clear: function(e, noPropagation) { - - //We first have to update the dom position of the actual currentItem - if(!this._noFinalSort) this.placeholder.before(this.currentItem); - this._noFinalSort = null; - - if(this.options.helper == "original") - this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); - else - this.currentItem.show(); - - if(this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) this._propagate("update", e, null, noPropagation); //Trigger update callback if the DOM position has changed - if(!contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element - this._propagate("remove", e, null, noPropagation); - for (var i = this.containers.length - 1; i >= 0; i--){ - if(contains(this.containers[i].element[0], this.currentItem[0])) { - this.containers[i]._propagate("update", e, this, noPropagation); - this.containers[i]._propagate("receive", e, this, noPropagation); - } - }; - }; - - //Post events to containers - for (var i = this.containers.length - 1; i >= 0; i--){ - this.containers[i]._propagate("deactivate", e, this, noPropagation); - if(this.containers[i].containerCache.over) { - this.containers[i]._propagate("out", e, this); - this.containers[i].containerCache.over = 0; - } - } - - this.dragging = false; - if(this.cancelHelperRemoval) { - this._propagate("beforeStop", e, null, noPropagation); - this._propagate("stop", e, null, noPropagation); - return false; - } - - this._propagate("beforeStop", e, null, noPropagation); - - this.placeholder.remove(); - if(this.options.helper != "original") this.helper.remove(); this.helper = null; - this._propagate("stop", e, null, noPropagation); - - return true; - - } -})); - -$.extend($.ui.sortable, { - getter: "serialize toArray", - defaults: { - helper: "original", - tolerance: "guess", - distance: 1, - delay: 0, - scroll: true, - scrollSensitivity: 20, - scrollSpeed: 20, - cancel: ":input", - items: '> *', - zIndex: 1000, - dropOnEmpty: true, - appendTo: "parent", - sortIndicator: $.ui.sortable.prototype._rearrange, - scope: "default", - forcePlaceholderSize: false - } -}); - -/* - * Sortable Extensions - */ - -$.ui.plugin.add("sortable", "cursor", { - start: function(e, ui) { - var t = $('body'); - if (t.css("cursor")) ui.options._cursor = t.css("cursor"); - t.css("cursor", ui.options.cursor); - }, - beforeStop: function(e, ui) { - if (ui.options._cursor) $('body').css("cursor", ui.options._cursor); - } -}); - -$.ui.plugin.add("sortable", "zIndex", { - start: function(e, ui) { - var t = ui.helper; - if(t.css("zIndex")) ui.options._zIndex = t.css("zIndex"); - t.css('zIndex', ui.options.zIndex); - }, - beforeStop: function(e, ui) { - if(ui.options._zIndex) $(ui.helper).css('zIndex', ui.options._zIndex); - } -}); - -$.ui.plugin.add("sortable", "opacity", { - start: function(e, ui) { - var t = ui.helper; - if(t.css("opacity")) ui.options._opacity = t.css("opacity"); - t.css('opacity', ui.options.opacity); - }, - beforeStop: function(e, ui) { - if(ui.options._opacity) $(ui.helper).css('opacity', ui.options._opacity); - } -}); - -$.ui.plugin.add("sortable", "scroll", { - start: function(e, ui) { - var o = ui.options; - var i = $(this).data("sortable"); - - i.overflowY = function(el) { - do { if(/auto|scroll/.test(el.css('overflow')) || (/auto|scroll/).test(el.css('overflow-y'))) return el; el = el.parent(); } while (el[0].parentNode); - return $(document); - }(i.currentItem); - i.overflowX = function(el) { - do { if(/auto|scroll/.test(el.css('overflow')) || (/auto|scroll/).test(el.css('overflow-x'))) return el; el = el.parent(); } while (el[0].parentNode); - return $(document); - }(i.currentItem); - - if(i.overflowY[0] != document && i.overflowY[0].tagName != 'HTML') i.overflowYOffset = i.overflowY.offset(); - if(i.overflowX[0] != document && i.overflowX[0].tagName != 'HTML') i.overflowXOffset = i.overflowX.offset(); - - }, - sort: function(e, ui) { - - var o = ui.options; - var i = $(this).data("sortable"); - - if(i.overflowY[0] != document && i.overflowY[0].tagName != 'HTML') { - if((i.overflowYOffset.top + i.overflowY[0].offsetHeight) - e.pageY < o.scrollSensitivity) - i.overflowY[0].scrollTop = i.overflowY[0].scrollTop + o.scrollSpeed; - if(e.pageY - i.overflowYOffset.top < o.scrollSensitivity) - i.overflowY[0].scrollTop = i.overflowY[0].scrollTop - o.scrollSpeed; - } else { - if(e.pageY - $(document).scrollTop() < o.scrollSensitivity) - $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); - if($(window).height() - (e.pageY - $(document).scrollTop()) < o.scrollSensitivity) - $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); - } - - if(i.overflowX[0] != document && i.overflowX[0].tagName != 'HTML') { - if((i.overflowXOffset.left + i.overflowX[0].offsetWidth) - e.pageX < o.scrollSensitivity) - i.overflowX[0].scrollLeft = i.overflowX[0].scrollLeft + o.scrollSpeed; - if(e.pageX - i.overflowXOffset.left < o.scrollSensitivity) - i.overflowX[0].scrollLeft = i.overflowX[0].scrollLeft - o.scrollSpeed; - } else { - if(e.pageX - $(document).scrollLeft() < o.scrollSensitivity) - $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); - if($(window).width() - (e.pageX - $(document).scrollLeft()) < o.scrollSensitivity) - $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); - } - - } -}); - -$.ui.plugin.add("sortable", "axis", { - sort: function(e, ui) { - - var i = $(this).data("sortable"); - - if(ui.options.axis == "y") i.position.left = i.originalPosition.left; - if(ui.options.axis == "x") i.position.top = i.originalPosition.top; - - } -}); - -})(jQuery); +/* + * jQuery UI Sortable 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.sortable", $.extend({}, $.ui.mouse, { + _init: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are floating + this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled") + .removeData("sortable") + .unbind(".sortable"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData("sortable-item"); + }, + + _mouseCapture: function(event, overrideHandle) { + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, 'sortable-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + if(o.cursorAt) + this._adjustOffsetFromHelper(o.cursorAt); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp(); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + + return true; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper"), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper"), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(sortable-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data('sortable-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + for (var i = this.containers.length - 1; i >= 0; i--){ + + if(this._intersectsWith(this.containers[i].containerCache)) { + if(!this.containers[i].containerCache.over) { + + if(this.currentContainer != this.containers[i]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[i].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[i].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[i].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + continue; + + this.currentContainer = this.containers[i]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[i].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[i]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + } + + this.containers[i]._trigger("over", event, this._uiHash(this)); + this.containers[i].containerCache.over = 1; + } + } else { + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + }; + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; + if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; + if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset cursor + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + absolutePosition: self.positionAbs, //deprecated + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +})); + +$.extend($.ui.sortable, { + getter: "serialize toArray", + version: "1.7.1", + eventPrefix: "sort", + defaults: { + appendTo: "parent", + axis: false, + cancel: ":input,option", + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + delay: 0, + distance: 1, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + } +}); + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.tabs.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.tabs.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/ui.tabs.js 3 Nov 2008 03:59:27 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.tabs.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1,587 +1,685 @@ -/* - * jQuery UI Tabs @VERSION - * - * Copyright (c) 2007, 2008 Klaus Hartl (stilbuero.de) - * Dual licensed under the MIT (MIT-LICENSE.txt) - * and GPL (GPL-LICENSE.txt) licenses. - * - * http://docs.jquery.com/UI/Tabs - * - * Depends: - * ui.core.js - */ -(function($) { - -$.widget("ui.tabs", { - _init: function() { - this.options.event += '.tabs'; // namespace event - - // create tabs - this._tabify(true); - }, - _setData: function(key, value) { - if ((/^selected/).test(key)) - this.select(value); - else { - this.options[key] = value; - this._tabify(); - } - }, - length: function() { - return this.$tabs.length; - }, - _tabId: function(a) { - return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') - || this.options.idPrefix + $.data(a); - }, - ui: function(tab, panel) { - return { - options: this.options, - tab: tab, - panel: panel, - index: this.$tabs.index(tab) - }; - }, - _tabify: function(init) { - - this.$lis = $('li:has(a[href])', this.element); - this.$tabs = this.$lis.map(function() { return $('a', this)[0]; }); - this.$panels = $([]); - - var self = this, o = this.options; - - this.$tabs.each(function(i, a) { - // inline tab - if (a.hash && a.hash.replace('#', '')) // Safari 2 reports '#' for an empty hash - self.$panels = self.$panels.add(a.hash); - // remote tab - else if ($(a).attr('href') != '#') { // prevent loading the page itself if href is just "#" - $.data(a, 'href.tabs', a.href); // required for restore on destroy - $.data(a, 'load.tabs', a.href); // mutable - var id = self._tabId(a); - a.href = '#' + id; - var $panel = $('#' + id); - if (!$panel.length) { - $panel = $(o.panelTemplate).attr('id', id).addClass(o.panelClass) - .insertAfter( self.$panels[i - 1] || self.element ); - $panel.data('destroy.tabs', true); - } - self.$panels = self.$panels.add( $panel ); - } - // invalid tab href - else - o.disabled.push(i + 1); - }); - - // initialization from scratch - if (init) { - - // attach necessary classes for styling if not present - this.element.addClass(o.navClass); - this.$panels.each(function() { - var $this = $(this); - $this.addClass(o.panelClass); - }); - - // Selected tab - // use "selected" option or try to retrieve: - // 1. from fragment identifier in url - // 2. from cookie - // 3. from selected class attribute on
  • - if (o.selected === undefined) { - if (location.hash) { - this.$tabs.each(function(i, a) { - if (a.hash == location.hash) { - o.selected = i; - // prevent page scroll to fragment - if ($.browser.msie || $.browser.opera) { // && !o.remote - var $toShow = $(location.hash), toShowId = $toShow.attr('id'); - $toShow.attr('id', ''); - setTimeout(function() { - $toShow.attr('id', toShowId); // restore id - }, 500); - } - scrollTo(0, 0); - return false; // break - } - }); - } - else if (o.cookie) { - var index = parseInt($.cookie('ui-tabs-' + $.data(self.element[0])), 10); - if (index && self.$tabs[index]) - o.selected = index; - } - else if (self.$lis.filter('.' + o.selectedClass).length) - o.selected = self.$lis.index( self.$lis.filter('.' + o.selectedClass)[0] ); - } - o.selected = o.selected === null || o.selected !== undefined ? o.selected : 0; // first tab selected by default - - // Take disabling tabs via class attribute from HTML - // into account and update option properly. - // A selected tab cannot become disabled. - o.disabled = $.unique(o.disabled.concat( - $.map(this.$lis.filter('.' + o.disabledClass), - function(n, i) { return self.$lis.index(n); } ) - )).sort(); - if ($.inArray(o.selected, o.disabled) != -1) - o.disabled.splice($.inArray(o.selected, o.disabled), 1); - - // highlight selected tab - this.$panels.addClass(o.hideClass); - this.$lis.removeClass(o.selectedClass); - if (o.selected !== null) { - this.$panels.eq(o.selected).show().removeClass(o.hideClass); // use show and remove class to show in any case no matter how it has been hidden before - this.$lis.eq(o.selected).addClass(o.selectedClass); - - // seems to be expected behavior that the show callback is fired - var onShow = function() { - self._trigger('show', null, - self.ui(self.$tabs[o.selected], self.$panels[o.selected])); - }; - - // load if remote tab - if ($.data(this.$tabs[o.selected], 'load.tabs')) - this.load(o.selected, onShow); - // just trigger show event - else - onShow(); - } - - // clean up to avoid memory leaks in certain versions of IE 6 - $(window).bind('unload', function() { - self.$tabs.unbind('.tabs'); - self.$lis = self.$tabs = self.$panels = null; - }); - - } - // update selected after add/remove - else - o.selected = this.$lis.index( this.$lis.filter('.' + o.selectedClass)[0] ); - - // set or update cookie after init and add/remove respectively - if (o.cookie) - $.cookie('ui-tabs-' + $.data(self.element[0]), o.selected, o.cookie); - - // disable tabs - for (var i = 0, li; li = this.$lis[i]; i++) - $(li)[$.inArray(i, o.disabled) != -1 && !$(li).hasClass(o.selectedClass) ? 'addClass' : 'removeClass'](o.disabledClass); - - // reset cache if switching from cached to not cached - if (o.cache === false) - this.$tabs.removeData('cache.tabs'); - - // set up animations - var hideFx, showFx, baseFx = { 'min-width': 0, duration: 1 }, baseDuration = 'normal'; - if (o.fx && o.fx.constructor == Array) - hideFx = o.fx[0] || baseFx, showFx = o.fx[1] || baseFx; - else - hideFx = showFx = o.fx || baseFx; - - // reset some styles to maintain print style sheets etc. - var resetCSS = { display: '', overflow: '', height: '' }; - if (!$.browser.msie) // not in IE to prevent ClearType font issue - resetCSS.opacity = ''; - - // Hide a tab, animation prevents browser scrolling to fragment, - // $show is optional. - function hideTab(clicked, $hide, $show) { - $hide.animate(hideFx, hideFx.duration || baseDuration, function() { // - $hide.addClass(o.hideClass).css(resetCSS); // maintain flexible height and accessibility in print etc. - if ($.browser.msie && hideFx.opacity) - $hide[0].style.filter = ''; - if ($show) - showTab(clicked, $show, $hide); - }); - } - - // Show a tab, animation prevents browser scrolling to fragment, - // $hide is optional. - function showTab(clicked, $show, $hide) { - if (showFx === baseFx) - $show.css('display', 'block'); // prevent occasionally occuring flicker in Firefox cause by gap between showing and hiding the tab panels - $show.animate(showFx, showFx.duration || baseDuration, function() { - $show.removeClass(o.hideClass).css(resetCSS); // maintain flexible height and accessibility in print etc. - if ($.browser.msie && showFx.opacity) - $show[0].style.filter = ''; - - // callback - self._trigger('show', null, self.ui(clicked, $show[0])); - }); - } - - // switch a tab - function switchTab(clicked, $li, $hide, $show) { - /*if (o.bookmarkable && trueClick) { // add to history only if true click occured, not a triggered click - $.ajaxHistory.update(clicked.hash); - }*/ - $li.addClass(o.selectedClass) - .siblings().removeClass(o.selectedClass); - hideTab(clicked, $hide, $show); - } - - // attach tab event handler, unbind to avoid duplicates from former tabifying... - this.$tabs.unbind('.tabs').bind(o.event, function() { - - //var trueClick = e.clientX; // add to history only if true click occured, not a triggered click - var $li = $(this).parents('li:eq(0)'), - $hide = self.$panels.filter(':visible'), - $show = $(this.hash); - - // If tab is already selected and not unselectable or tab disabled or - // or is already loading or click callback returns false stop here. - // Check if click handler returns false last so that it is not executed - // for a disabled or loading tab! - if (($li.hasClass(o.selectedClass) && !o.unselect) - || $li.hasClass(o.disabledClass) - || $(this).hasClass(o.loadingClass) - || self._trigger('select', null, self.ui(this, $show[0])) === false - ) { - this.blur(); - return false; - } - - self.options.selected = self.$tabs.index(this); - - // if tab may be closed - if (o.unselect) { - if ($li.hasClass(o.selectedClass)) { - self.options.selected = null; - $li.removeClass(o.selectedClass); - self.$panels.stop(); - hideTab(this, $hide); - this.blur(); - return false; - } else if (!$hide.length) { - self.$panels.stop(); - var a = this; - self.load(self.$tabs.index(this), function() { - $li.addClass(o.selectedClass).addClass(o.unselectClass); - showTab(a, $show); - }); - this.blur(); - return false; - } - } - - if (o.cookie) - $.cookie('ui-tabs-' + $.data(self.element[0]), self.options.selected, o.cookie); - - // stop possibly running animations - self.$panels.stop(); - - // show new tab - if ($show.length) { - - // prevent scrollbar scrolling to 0 and than back in IE7, happens only if bookmarking/history is enabled - /*if ($.browser.msie && o.bookmarkable) { - var showId = this.hash.replace('#', ''); - $show.attr('id', ''); - setTimeout(function() { - $show.attr('id', showId); // restore id - }, 0); - }*/ - - var a = this; - self.load(self.$tabs.index(this), $hide.length ? - function() { - switchTab(a, $li, $hide, $show); - } : - function() { - $li.addClass(o.selectedClass); - showTab(a, $show); - } - ); - - // Set scrollbar to saved position - need to use timeout with 0 to prevent browser scroll to target of hash - /*var scrollX = window.pageXOffset || document.documentElement && document.documentElement.scrollLeft || document.body.scrollLeft || 0; - var scrollY = window.pageYOffset || document.documentElement && document.documentElement.scrollTop || document.body.scrollTop || 0; - setTimeout(function() { - scrollTo(scrollX, scrollY); - }, 0);*/ - - } else - throw 'jQuery UI Tabs: Mismatching fragment identifier.'; - - // Prevent IE from keeping other link focussed when using the back button - // and remove dotted border from clicked link. This is controlled in modern - // browsers via CSS, also blur removes focus from address bar in Firefox - // which can become a usability and annoying problem with tabsRotate. - if ($.browser.msie) - this.blur(); - - //return o.bookmarkable && !!trueClick; // convert trueClick == undefined to Boolean required in IE - return false; - - }); - - // disable click if event is configured to something else - if (!(/^click/).test(o.event)) - this.$tabs.bind('click.tabs', function() { return false; }); - - }, - add: function(url, label, index) { - if (index == undefined) - index = this.$tabs.length; // append by default - - var o = this.options; - var $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)); - $li.data('destroy.tabs', true); - - var id = url.indexOf('#') == 0 ? url.replace('#', '') : this._tabId( $('a:first-child', $li)[0] ); - - // try to find an existing element before creating a new one - var $panel = $('#' + id); - if (!$panel.length) { - $panel = $(o.panelTemplate).attr('id', id) - .addClass(o.hideClass) - .data('destroy.tabs', true); - } - $panel.addClass(o.panelClass); - if (index >= this.$lis.length) { - $li.appendTo(this.element); - $panel.appendTo(this.element[0].parentNode); - } else { - $li.insertBefore(this.$lis[index]); - $panel.insertBefore(this.$panels[index]); - } - - o.disabled = $.map(o.disabled, - function(n, i) { return n >= index ? ++n : n }); - - this._tabify(); - - if (this.$tabs.length == 1) { - $li.addClass(o.selectedClass); - $panel.removeClass(o.hideClass); - var href = $.data(this.$tabs[0], 'load.tabs'); - if (href) - this.load(index, href); - } - - // callback - this._trigger('add', null, this.ui(this.$tabs[index], this.$panels[index])); - }, - remove: function(index) { - var o = this.options, $li = this.$lis.eq(index).remove(), - $panel = this.$panels.eq(index).remove(); - - // If selected tab was removed focus tab to the right or - // in case the last tab was removed the tab to the left. - if ($li.hasClass(o.selectedClass) && this.$tabs.length > 1) - this.select(index + (index + 1 < this.$tabs.length ? 1 : -1)); - - o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }), - function(n, i) { return n >= index ? --n : n }); - - this._tabify(); - - // callback - this._trigger('remove', null, this.ui($li.find('a')[0], $panel[0])); - }, - enable: function(index) { - var o = this.options; - if ($.inArray(index, o.disabled) == -1) - return; - - var $li = this.$lis.eq(index).removeClass(o.disabledClass); - if ($.browser.safari) { // fix disappearing tab (that used opacity indicating disabling) after enabling in Safari 2... - $li.css('display', 'inline-block'); - setTimeout(function() { - $li.css('display', 'block'); - }, 0); - } - - o.disabled = $.grep(o.disabled, function(n, i) { return n != index; }); - - // callback - this._trigger('enable', null, this.ui(this.$tabs[index], this.$panels[index])); - }, - disable: function(index) { - var self = this, o = this.options; - if (index != o.selected) { // cannot disable already selected tab - this.$lis.eq(index).addClass(o.disabledClass); - - o.disabled.push(index); - o.disabled.sort(); - - // callback - this._trigger('disable', null, this.ui(this.$tabs[index], this.$panels[index])); - } - }, - select: function(index) { - if (typeof index == 'string') - index = this.$tabs.index( this.$tabs.filter('[href$=' + index + ']')[0] ); - this.$tabs.eq(index).trigger(this.options.event); - }, - load: function(index, callback) { // callback is for internal usage only - - var self = this, o = this.options, $a = this.$tabs.eq(index), a = $a[0], - bypassCache = callback == undefined || callback === false, url = $a.data('load.tabs'); - - callback = callback || function() {}; - - // no remote or from cache - just finish with callback - if (!url || !bypassCache && $.data(a, 'cache.tabs')) { - callback(); - return; - } - - // load remote from here on - - var inner = function(parent) { - var $parent = $(parent), $inner = $parent.find('*:last'); - return $inner.length && $inner.is(':not(img)') && $inner || $parent; - }; - var cleanup = function() { - self.$tabs.filter('.' + o.loadingClass).removeClass(o.loadingClass) - .each(function() { - if (o.spinner) - inner(this).parent().html(inner(this).data('label.tabs')); - }); - self.xhr = null; - }; - - if (o.spinner) { - var label = inner(a).html(); - inner(a).wrapInner('') - .find('em').data('label.tabs', label).html(o.spinner); - } - - var ajaxOptions = $.extend({}, o.ajaxOptions, { - url: url, - success: function(r, s) { - $(a.hash).html(r); - cleanup(); - - if (o.cache) - $.data(a, 'cache.tabs', true); // if loaded once do not load them again - - // callbacks - self._trigger('load', null, self.ui(self.$tabs[index], self.$panels[index])); - o.ajaxOptions.success && o.ajaxOptions.success(r, s); - - // This callback is required because the switch has to take - // place after loading has completed. Call last in order to - // fire load before show callback... - callback(); - } - }); - if (this.xhr) { - // terminate pending requests from other tabs and restore tab label - this.xhr.abort(); - cleanup(); - } - $a.addClass(o.loadingClass); - setTimeout(function() { // timeout is again required in IE, "wait" for id being restored - self.xhr = $.ajax(ajaxOptions); - }, 0); - - }, - url: function(index, url) { - this.$tabs.eq(index).removeData('cache.tabs').data('load.tabs', url); - }, - destroy: function() { - var o = this.options; - this.element.unbind('.tabs') - .removeClass(o.navClass).removeData('tabs'); - this.$tabs.each(function() { - var href = $.data(this, 'href.tabs'); - if (href) - this.href = href; - var $this = $(this).unbind('.tabs'); - $.each(['href', 'load', 'cache'], function(i, prefix) { - $this.removeData(prefix + '.tabs'); - }); - }); - this.$lis.add(this.$panels).each(function() { - if ($.data(this, 'destroy.tabs')) - $(this).remove(); - else - $(this).removeClass([o.selectedClass, o.unselectClass, - o.disabledClass, o.panelClass, o.hideClass].join(' ')); - }); - } -}); - -$.ui.tabs.defaults = { - // basic setup - unselect: false, - event: 'click', - disabled: [], - cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } - // TODO history: false, - - // Ajax - spinner: 'Loading…', - cache: false, - idPrefix: 'ui-tabs-', - ajaxOptions: {}, - - // animations - fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } - - // templates - tabTemplate: '
  • #{label}
  • ', - panelTemplate: '
    ', - - // CSS classes - navClass: 'ui-tabs-nav', - selectedClass: 'ui-tabs-selected', - unselectClass: 'ui-tabs-unselect', - disabledClass: 'ui-tabs-disabled', - panelClass: 'ui-tabs-panel', - hideClass: 'ui-tabs-hide', - loadingClass: 'ui-tabs-loading' -}; - -$.ui.tabs.getter = "length"; - -/* - * Tabs Extensions - */ - -/* - * Rotate - */ -$.extend($.ui.tabs.prototype, { - rotation: null, - rotate: function(ms, continuing) { - - continuing = continuing || false; - - var self = this, t = this.options.selected; - - function start() { - self.rotation = setInterval(function() { - t = ++t < self.$tabs.length ? t : 0; - self.select(t); - }, ms); - } - - function stop(e) { - if (!e || e.clientX) { // only in case of a true click - clearInterval(self.rotation); - } - } - - // start interval - if (ms) { - start(); - if (!continuing) - this.$tabs.bind(this.options.event, stop); - else - this.$tabs.bind(this.options.event, function() { - stop(); - t = self.options.selected; - start(); - }); - } - // stop interval - else { - stop(); - this.$tabs.unbind(this.options.event, stop); - } - } -}); - -})(jQuery); +/* + * jQuery UI Tabs 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.tabs", { + + _init: function() { + if (this.options.deselectable !== undefined) { + this.options.collapsible = this.options.deselectable; + } + this._tabify(true); + }, + + _setData: function(key, value) { + if (key == 'selected') { + if (this.options.collapsible && value == this.options.selected) { + return; + } + this.select(value); + } + else { + this.options[key] = value; + if (key == 'deselectable') { + this.options.collapsible = value; + } + this._tabify(); + } + }, + + _tabId: function(a) { + return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') || + this.options.idPrefix + $.data(a); + }, + + _sanitizeSelector: function(hash) { + return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":" + }, + + _cookie: function() { + var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0])); + return $.cookie.apply(null, [cookie].concat($.makeArray(arguments))); + }, + + _ui: function(tab, panel) { + return { + tab: tab, + panel: panel, + index: this.anchors.index(tab) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter('.ui-state-processing').removeClass('ui-state-processing') + .find('span:data(label.tabs)') + .each(function() { + var el = $(this); + el.html(el.data('label.tabs')).removeData('label.tabs'); + }); + }, + + _tabify: function(init) { + + this.list = this.element.children('ul:first'); + this.lis = $('li:has(a[href])', this.list); + this.anchors = this.lis.map(function() { return $('a', this)[0]; }); + this.panels = $([]); + + var self = this, o = this.options; + + var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + this.anchors.each(function(i, a) { + var href = $(a).attr('href'); + + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split('#')[0], baseEl; + if (hrefBase && (hrefBase === location.toString().split('#')[0] || + (baseEl = $('base')[0]) && hrefBase === baseEl.href)) { + href = a.hash; + a.href = href; + } + + // inline tab + if (fragmentId.test(href)) { + self.panels = self.panels.add(self._sanitizeSelector(href)); + } + + // remote tab + else if (href != '#') { // prevent loading the page itself if href is just "#" + $.data(a, 'href.tabs', href); // required for restore on destroy + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data + + var id = self._tabId(a); + a.href = '#' + id; + var $panel = $('#' + id); + if (!$panel.length) { + $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom') + .insertAfter(self.panels[i - 1] || self.list); + $panel.data('destroy.tabs', true); + } + self.panels = self.panels.add($panel); + } + + // invalid tab href + else { + o.disabled.push(i); + } + }); + + // initialization from scratch + if (init) { + + // attach necessary classes for styling + this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all'); + this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); + this.lis.addClass('ui-state-default ui-corner-top'); + this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom'); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
  • + if (o.selected === undefined) { + if (location.hash) { + this.anchors.each(function(i, a) { + if (a.hash == location.hash) { + o.selected = i; + return false; // break + } + }); + } + if (typeof o.selected != 'number' && o.cookie) { + o.selected = parseInt(self._cookie(), 10); + } + if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) { + o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected')); + } + o.selected = o.selected || 0; + } + else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique(o.disabled.concat( + $.map(this.lis.filter('.ui-state-disabled'), + function(n, i) { return self.lis.index(n); } ) + )).sort(); + + if ($.inArray(o.selected, o.disabled) != -1) { + o.disabled.splice($.inArray(o.selected, o.disabled), 1); + } + + // highlight selected tab + this.panels.addClass('ui-tabs-hide'); + this.lis.removeClass('ui-tabs-selected ui-state-active'); + if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list + this.panels.eq(o.selected).removeClass('ui-tabs-hide'); + this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active'); + + // seems to be expected behavior that the show callback is fired + self.element.queue("tabs", function() { + self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected])); + }); + + this.load(o.selected); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + $(window).bind('unload', function() { + self.lis.add(self.anchors).unbind('.tabs'); + self.lis = self.anchors = self.panels = null; + }); + + } + // update selected after add/remove + else { + o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected')); + } + + // update collapsible + this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible'); + + // set or update cookie after init and add/remove respectively + if (o.cookie) { + this._cookie(o.selected, o.cookie); + } + + // disable tabs + for (var i = 0, li; (li = this.lis[i]); i++) { + $(li)[$.inArray(i, o.disabled) != -1 && + !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled'); + } + + // reset cache if switching from cached to not cached + if (o.cache === false) { + this.anchors.removeData('cache.tabs'); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add(this.anchors).unbind('.tabs'); + + if (o.event != 'mouseover') { + var addState = function(state, el) { + if (el.is(':not(.ui-state-disabled)')) { + el.addClass('ui-state-' + state); + } + }; + var removeState = function(state, el) { + el.removeClass('ui-state-' + state); + }; + this.lis.bind('mouseover.tabs', function() { + addState('hover', $(this)); + }); + this.lis.bind('mouseout.tabs', function() { + removeState('hover', $(this)); + }); + this.anchors.bind('focus.tabs', function() { + addState('focus', $(this).closest('li')); + }); + this.anchors.bind('blur.tabs', function() { + removeState('focus', $(this).closest('li')); + }); + } + + // set up animations + var hideFx, showFx; + if (o.fx) { + if ($.isArray(o.fx)) { + hideFx = o.fx[0]; + showFx = o.fx[1]; + } + else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle($el, fx) { + $el.css({ display: '' }); + if ($.browser.msie && fx.opacity) { + $el[0].style.removeAttribute('filter'); + } + } + + // Show a tab... + var showTab = showFx ? + function(clicked, $show) { + $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active'); + $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way + .animate(showFx, showFx.duration || 'normal', function() { + resetStyle($show, showFx); + self._trigger('show', null, self._ui(clicked, $show[0])); + }); + } : + function(clicked, $show) { + $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active'); + $show.removeClass('ui-tabs-hide'); + self._trigger('show', null, self._ui(clicked, $show[0])); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx ? + function(clicked, $hide) { + $hide.animate(hideFx, hideFx.duration || 'normal', function() { + self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default'); + $hide.addClass('ui-tabs-hide'); + resetStyle($hide, hideFx); + self.element.dequeue("tabs"); + }); + } : + function(clicked, $hide, $show) { + self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default'); + $hide.addClass('ui-tabs-hide'); + self.element.dequeue("tabs"); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind(o.event + '.tabs', function() { + var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'), + $show = $(self._sanitizeSelector(this.hash)); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if (($li.hasClass('ui-tabs-selected') && !o.collapsible) || + $li.hasClass('ui-state-disabled') || + $li.hasClass('ui-state-processing') || + self._trigger('select', null, self._ui(this, $show[0])) === false) { + this.blur(); + return false; + } + + o.selected = self.anchors.index(this); + + self.abort(); + + // if tab may be closed + if (o.collapsible) { + if ($li.hasClass('ui-tabs-selected')) { + o.selected = -1; + + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + self.element.queue("tabs", function() { + hideTab(el, $hide); + }).dequeue("tabs"); + + this.blur(); + return false; + } + else if (!$hide.length) { + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + self.element.queue("tabs", function() { + showTab(el, $show); + }); + + self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + + this.blur(); + return false; + } + } + + if (o.cookie) { + self._cookie(o.selected, o.cookie); + } + + // show new tab + if ($show.length) { + if ($hide.length) { + self.element.queue("tabs", function() { + hideTab(el, $hide); + }); + } + self.element.queue("tabs", function() { + showTab(el, $show); + }); + + self.load(self.anchors.index(this)); + } + else { + throw 'jQuery UI Tabs: Mismatching fragment identifier.'; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ($.browser.msie) { + this.blur(); + } + + }); + + // disable click in any case + this.anchors.bind('click.tabs', function(){return false;}); + + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element.unbind('.tabs') + .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible') + .removeData('tabs'); + + this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); + + this.anchors.each(function() { + var href = $.data(this, 'href.tabs'); + if (href) { + this.href = href; + } + var $this = $(this).unbind('.tabs'); + $.each(['href', 'load', 'cache'], function(i, prefix) { + $this.removeData(prefix + '.tabs'); + }); + }); + + this.lis.unbind('.tabs').add(this.panels).each(function() { + if ($.data(this, 'destroy.tabs')) { + $(this).remove(); + } + else { + $(this).removeClass([ + 'ui-state-default', + 'ui-corner-top', + 'ui-tabs-selected', + 'ui-state-active', + 'ui-state-hover', + 'ui-state-focus', + 'ui-state-disabled', + 'ui-tabs-panel', + 'ui-widget-content', + 'ui-corner-bottom', + 'ui-tabs-hide' + ].join(' ')); + } + }); + + if (o.cookie) { + this._cookie(null, o.cookie); + } + }, + + add: function(url, label, index) { + if (index === undefined) { + index = this.anchors.length; // append by default + } + + var self = this, o = this.options, + $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)), + id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]); + + $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true); + + // try to find an existing element before creating a new one + var $panel = $('#' + id); + if (!$panel.length) { + $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true); + } + $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide'); + + if (index >= this.lis.length) { + $li.appendTo(this.list); + $panel.appendTo(this.list[0].parentNode); + } + else { + $li.insertBefore(this.lis[index]); + $panel.insertBefore(this.panels[index]); + } + + o.disabled = $.map(o.disabled, + function(n, i) { return n >= index ? ++n : n; }); + + this._tabify(); + + if (this.anchors.length == 1) { // after tabify + $li.addClass('ui-tabs-selected ui-state-active'); + $panel.removeClass('ui-tabs-hide'); + this.element.queue("tabs", function() { + self._trigger('show', null, self._ui(self.anchors[0], self.panels[0])); + }); + + this.load(0); + } + + // callback + this._trigger('add', null, this._ui(this.anchors[index], this.panels[index])); + }, + + remove: function(index) { + var o = this.options, $li = this.lis.eq(index).remove(), + $panel = this.panels.eq(index).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) { + this.select(index + (index + 1 < this.anchors.length ? 1 : -1)); + } + + o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }), + function(n, i) { return n >= index ? --n : n; }); + + this._tabify(); + + // callback + this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0])); + }, + + enable: function(index) { + var o = this.options; + if ($.inArray(index, o.disabled) == -1) { + return; + } + + this.lis.eq(index).removeClass('ui-state-disabled'); + o.disabled = $.grep(o.disabled, function(n, i) { return n != index; }); + + // callback + this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index])); + }, + + disable: function(index) { + var self = this, o = this.options; + if (index != o.selected) { // cannot disable already selected tab + this.lis.eq(index).addClass('ui-state-disabled'); + + o.disabled.push(index); + o.disabled.sort(); + + // callback + this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index])); + } + }, + + select: function(index) { + if (typeof index == 'string') { + index = this.anchors.index(this.anchors.filter('[href$=' + index + ']')); + } + else if (index === null) { // usage of null is deprecated, TODO remove in next release + index = -1; + } + if (index == -1 && this.options.collapsible) { + index = this.options.selected; + } + + this.anchors.eq(index).trigger(this.options.event + '.tabs'); + }, + + load: function(index) { + var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs'); + + this.abort(); + + // not remote or from cache + if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) { + this.element.dequeue("tabs"); + return; + } + + // load remote from here on + this.lis.eq(index).addClass('ui-state-processing'); + + if (o.spinner) { + var span = $('span', a); + span.data('label.tabs', span.html()).html(o.spinner); + } + + this.xhr = $.ajax($.extend({}, o.ajaxOptions, { + url: url, + success: function(r, s) { + $(self._sanitizeSelector(a.hash)).html(r); + + // take care of tab labels + self._cleanup(); + + if (o.cache) { + $.data(a, 'cache.tabs', true); // if loaded once do not load them again + } + + // callbacks + self._trigger('load', null, self._ui(self.anchors[index], self.panels[index])); + try { + o.ajaxOptions.success(r, s); + } + catch (e) {} + + // last, so that load event is fired before show... + self.element.dequeue("tabs"); + } + })); + }, + + abort: function() { + // stop possibly running animations + this.element.queue([]); + this.panels.stop(false, true); + + // terminate pending requests from other tabs + if (this.xhr) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + + }, + + url: function(index, url) { + this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url); + }, + + length: function() { + return this.anchors.length; + } + +}); + +$.extend($.ui.tabs, { + version: '1.7.1', + getter: 'length', + defaults: { + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disabled: [], + event: 'click', + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: 'ui-tabs-', + panelTemplate: '
    ', + spinner: 'Loading…', + tabTemplate: '
  • #{label}
  • ' + } +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend($.ui.tabs.prototype, { + rotation: null, + rotate: function(ms, continuing) { + + var self = this, o = this.options; + + var rotate = self._rotate || (self._rotate = function(e) { + clearTimeout(self.rotation); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms); + + if (e) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || (self._unrotate = !continuing ? + function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } : + function(e) { + t = o.selected; + rotate(); + }); + + // start rotation + if (ms) { + this.element.bind('tabsshow', rotate); + this.anchors.bind(o.event + '.tabs', stop); + rotate(); + } + // stop rotation + else { + clearTimeout(self.rotation); + this.element.unbind('tabsshow', rotate); + this.anchors.unbind(o.event + '.tabs', stop); + delete this._rotate; + delete this._unrotate; + } + } +}); + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/ui.tabs.scrollable.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/Attic/ui.tabs.scrollable.js,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/ui/ui.tabs.scrollable.js 1 Apr 2009 00:45:14 -0000 1.1 @@ -0,0 +1,780 @@ +/* + * jQuery UI Tabs 1.6rc6 + * + * Copyright (c) 2009 AUTHORS.txt (http://ui.jquery.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * ui.core.js + */ + +function breakTabs(){ + var i = 0; +} + +(function($) { + +$.widget("ui.tabs", { + + _init: function() { + // create tabs + this._tabify(true); + }, + + _setData: function(key, value) { + if ((/^selected/).test(key)) + this.select(value); + else { + this.options[key] = value; + this._tabify(); + } + }, + + _tabId: function(a) { + return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') + || this.options.idPrefix + $.data(a); + }, + + _sanitizeSelector: function(hash) { + return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":" + }, + + _cookie: function() { + var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0])); + return $.cookie.apply(null, [cookie].concat($.makeArray(arguments))); + }, + + _ui: function(tab, panel) { + return { + tab: tab, + panel: panel, + index: this.$tabs.index(tab) + }; + }, + + _tabify: function(init) { + + var self = this, o = this.options; + + if(o.scrollable){ + this.wrapper = $('#tabWrapper'); + this.list = $('#wrappedTabs'); + this.tabsHolder = $("#tabsHolder"); + this.$lis = $('li:has(a[href])', this.list); + this.$tabs = this.$lis.map(function() { return $('a', this)[0]; }); + this.tabLabels = $(".ui-tabs-label"); + this.imagesInTabs = $("img", this.list); + this.$panels = $([]); + this.leftMostScroll = 15; + } + else{ + this.list = this.element.is('div') ? this.element.children('ul:first, ol:first').eq(0) : this.element; + this.$lis = $('li:has(a[href])', this.list); + this.$tabs = this.$lis.map(function() { return $('a', this)[0]; }); + this.$panels = $([]); + } + + var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + this.$tabs.each(function(i, a) { + var href = $(a).attr('href'); + + // inline tab + if (fragmentId.test(href)) + self.$panels = self.$panels.add(self._sanitizeSelector(href)); + + // remote tab + else if (href != '#') { // prevent loading the page itself if href is just "#" + $.data(a, 'href.tabs', href); // required for restore on destroy + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data + + var id = self._tabId(a); + a.href = '#' + id; + var $panel = $('#' + id); + if (!$panel.length) { + $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom') + .insertAfter(self.$panels[i - 1] || self.list); + $panel.data('destroy.tabs', true); + } + self.$panels = self.$panels.add($panel); + } + + // invalid tab href + else + o.disabled.push(i + 1); + }); + + // initialization from scratch + if (init) { + + if(o.scrollable){ + // attach necessary classes for styling + if (this.element.is('div')) { + this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all'); + } + this.wrapper.addClass('ui-tabs-wrapper ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); + this.list.addClass('ui-tabs-wrapped'); + this.$lis.addClass('ui-state-default ui-corner-top'); + this.$panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom'); + + this.tabsHolder.animate( { scrollLeft: this.leftMostScroll}, this.scrollSpeed ) + } + else{ + // attach necessary classes for styling + if (this.element.is('div')) { + this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all'); + } + this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all'); + this.$lis.addClass('ui-state-default ui-corner-top'); + this.$panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom'); + } + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
  • + if (o.selected === undefined) { + if (location.hash) { + this.$tabs.each(function(i, a) { + if (a.hash == location.hash) { + o.selected = i; + return false; // break + } + }); + } + else if (o.cookie) + o.selected = parseInt(self._cookie(), 10); + + else if (this.$lis.filter('.ui-tabs-selected').length) + o.selected = this.$lis.index(this.$lis.filter('.ui-tabs-selected')); + + else + o.selected = 0; + + } + else if (o.selected === null) + o.selected = -1; + + // sanity check + o.selected = ((o.selected >= 0 && this.$tabs[o.selected]) || o.selected < 0) ? o.selected : 0; // default to first tab + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique(o.disabled.concat( + $.map(this.$lis.filter('.ui-state-disabled'), + function(n, i) { return self.$lis.index(n); } ) + )).sort(); + if ($.inArray(o.selected, o.disabled) != -1) + o.disabled.splice($.inArray(o.selected, o.disabled), 1); + + // highlight selected tab + this.$panels.addClass('ui-tabs-hide'); + this.$lis.removeClass('ui-tabs-selected ui-state-active'); + if (o.selected >= 0 && this.$tabs.length) { // check for length avoids error when initializing empty list + this.$panels.eq(o.selected).removeClass('ui-tabs-hide'); + var classes = ['ui-tabs-selected ui-state-active']; + if (o.deselectable) classes.push('ui-tabs-deselectable'); + this.$lis.eq(o.selected).addClass(classes.join(' ')); + + // seems to be expected behavior that the show callback is fired + var onShow = function() { + self._trigger('show', null, + self._ui(self.$tabs[o.selected], self.$panels[o.selected])); + }; + + // load if remote tab + if ($.data(this.$tabs[o.selected], 'load.tabs')) + this.load(o.selected, onShow); + // just trigger show event + else onShow(); + } + + // states + if (o.event != 'mouseover') { + var handleState = function(state, el) { + if (el.is(':not(.ui-state-disabled)')) el.toggleClass('ui-state-' + state); + }; + this.$lis.bind('mouseover.tabs mouseout.tabs', function() { + handleState('hover', $(this)); + }); + // TODO focus/blur don't seem to work with namespace + this.$tabs.bind('focus.tabs blur.tabs', function() { + handleState('focus', $(this).parents('li:first')); + }); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + $(window).bind('unload', function() { + self.$lis.add(self.$tabs).unbind('.tabs'); + self.$lis = self.$tabs = self.$panels = null; + }); + } + // update selected after add/remove + else + o.selected = this.$lis.index(this.$lis.filter('.ui-tabs-selected')); + + // set or update cookie after init and add/remove respectively + if (o.cookie) this._cookie(o.selected, o.cookie); + + // disable tabs + for (var i = 0, li; li = this.$lis[i]; i++) + $(li)[$.inArray(i, o.disabled) != -1 && !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled'); + + // reset cache if switching from cached to not cached + if (o.cache === false) this.$tabs.removeData('cache.tabs'); + + // set up animations + var hideFx, showFx; + if (o.fx) { + if ($.isArray(o.fx)) { + hideFx = o.fx[0]; + showFx = o.fx[1]; + } + else hideFx = showFx = o.fx; + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle($el, fx) { + $el.css({ display: '' }); + if ($.browser.msie && fx.opacity) $el[0].style.removeAttribute('filter'); + } + + // Show a tab... + var showTab = showFx ? + function(clicked, $show) { + $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way + .animate(showFx, 500, function() { + resetStyle($show, showFx); + self._trigger('show', null, self._ui(clicked, $show[0])); + }); + } : + function(clicked, $show) { + $show.removeClass('ui-tabs-hide'); + self._trigger('show', null, self._ui(clicked, $show[0])); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx ? + function(clicked, $hide, $show) { + $hide.animate(hideFx, hideFx.duration || 'normal', function() { + $hide.addClass('ui-tabs-hide'); + resetStyle($hide, hideFx); + if ($show) showTab(clicked, $show); + }); + } : + function(clicked, $hide, $show) { + $hide.addClass('ui-tabs-hide'); + if ($show) showTab(clicked, $show); + }; + + // Switch a tab... + function switchTab(clicked, $li, $hide, $show) { + var classes = ['ui-tabs-selected ui-state-active']; + if (o.deselectable) classes.push('ui-tabs-deselectable'); + $li.removeClass('ui-state-default').addClass(classes.join(' ')) + .siblings().removeClass(classes.join(' ')).addClass('ui-state-default'); + hideTab(clicked, $hide, $show); + } + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.$tabs.unbind('.tabs').bind(o.event + '.tabs', function() { + + var $li = $(this).parents('li:eq(0)'), + $hide = self.$panels.filter(':visible'), + $show = $(self._sanitizeSelector(this.hash)); + + // If tab is already selected and not deselectable or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if (($li.hasClass('ui-state-active') && !o.deselectable) + || $li.hasClass('ui-state-disabled') + || $(this).hasClass('ui-tabs-loading') + || self._trigger('select', null, self._ui(this, $show[0])) === false + ) { + this.blur(); + return false; + } + + o.selected = self.$tabs.index(this); + + // if tab may be closed TODO avoid redundant code in this block + if (o.deselectable) { + if ($li.hasClass('ui-state-active')) { + o.selected = -1; + if (o.cookie) self._cookie(o.selected, o.cookie); + $li.removeClass('ui-tabs-selected ui-state-active ui-tabs-deselectable') + .addClass('ui-state-default'); + self.$panels.stop(); + hideTab(this, $hide); + this.blur(); + return false; + } else if (!$hide.length) { + if (o.cookie) self._cookie(o.selected, o.cookie); + self.$panels.stop(); + var a = this; + self.load(self.$tabs.index(this), function() { + $li.addClass('ui-tabs-selected ui-state-active ui-tabs-deselectable') + .removeClass('ui-state-default'); + showTab(a, $show); + }); + this.blur(); + return false; + } + } + + if (o.cookie) self._cookie(o.selected, o.cookie); + + // stop possibly running animations + self.$panels.stop(); + + // show new tab + if ($show.length) { + var a = this; + self.load(self.$tabs.index(this), $hide.length ? + function() { + switchTab(a, $li, $hide, $show); + } : + function() { + $li.addClass('ui-tabs-selected ui-state-active').removeClass('ui-state-default'); + showTab(a, $show); + } + ); + } else + throw 'jQuery UI Tabs: Mismatching fragment identifier.'; + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ($.browser.msie) this.blur(); + + return false; + + }); + + if(o.scrollable){ + this.scrollableWidth = 0; + + for(var i = 0; i < this.tabLabels.length; i++){ + this.scrollableWidth += this.tabLabels[i].innerHTML.length * o.characterWidth; + } + + for(var i = 0; i < this.imagesInTabs.length; i++){ + this.scrollableWidth += this.imagesInTabs[i].width; + } + + this.scrollableWidth += o.margins + this.leftMostScroll; + + $(".ui-tabs-wrapped").css("width", this.scrollableWidth + "px"); + } + + // disable click if event is configured to something else + if (o.event != 'click') this.$tabs.bind('click.tabs', function(){return false;}); + }, + + _tabWidth: function(index) { + var self = this, o = this.options; + var tabWidth = 0; + if(o.scrollable){ + tabWidth += this.tabLabels[index].innerHTML.length * o.characterWidth; + + var imagesInTab = $("img", this.list[index]); + for(var i = 0; i < imagesInTab.length; i++){ + tabWidth+= imagesInTab[i].width; + } + + tabWidth += o.margins; + + return tabWidth; + } + }, + + scrollLeft: function() { + var o = this.options; + var newScrollLeft; + + //var scrollOffset = _tabWidth(this.scrolledTab - 1); + var scrollOffset = o.scrollOffset; + if(this.tabsHolder[0].scrollLeft < scrollOffset){ + newScrollLeft = this.leftMostScroll; + } + else{ + newScrollLeft = this.tabsHolder[0].scrollLeft - scrollOffset; + } + + this.tabsHolder.animate( { scrollLeft: newScrollLeft}, this.scrollSpeed ) + + }, + + scrollRight: function() { + var o = this.options; + var newScrollRight; + + //var scrollOffset = _tabWidth(scrolledTab + 1); + var scrollOffset = o.scrollOffset; + if(this.tabsHolder[0].scrollLeft + scrollOffset > this.scrollableWidth){ + newScrollRight = this.scrollableWidth; + } + else{ + newScrollRight = this.tabsHolder[0].scrollLeft + scrollOffset; + } + + this.tabsHolder.animate( { scrollLeft: newScrollRight}, this.scrollSpeed ) + }, + + destroy: function() { + var o = this.options; + + this.element + .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all'); + + this.list.unbind('.tabs') + .removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all') + .removeData('tabs'); + + this.$tabs.each(function() { + var href = $.data(this, 'href.tabs'); + if (href) + this.href = href; + var $this = $(this).unbind('.tabs'); + $.each(['href', 'load', 'cache'], function(i, prefix) { + $this.removeData(prefix + '.tabs'); + }); + }); + + this.$lis.unbind('.tabs').add(this.$panels).each(function() { + if ($.data(this, 'destroy.tabs')) + $(this).remove(); + else + $(this).removeClass( + 'ui-state-default ' + + 'ui-corner-top ' + + 'ui-tabs-selected ' + + 'ui-state-active ' + + 'ui-tabs-deselectable ' + + 'ui-state-disabled ' + + 'ui-tabs-panel ' + + 'ui-widget-content ' + + 'ui-corner-bottom ' + + 'ui-tabs-hide'); + }); + + if (o.cookie) + this._cookie(null, o.cookie); + }, + + add: function(url, label, index) { + if (index == undefined) + index = this.$tabs.length; // append by default + + var self = this, o = this.options; + var $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)); + $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true); + + var id = url.indexOf('#') == 0 ? url.replace('#', '') : this._tabId( $('a:first-child', $li)[0] ); + + // try to find an existing element before creating a new one + var $panel = $('#' + id); + if (!$panel.length) { + $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true); + } + $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide'); + + if(o.scrollable){ + if (index >= this.$lis.length) { + $li.appendTo(this.list); + $panel.appendTo(this.wrapper[0].parentNode); + } + else { + $li.insertBefore(this.$lis[index]); + $panel.insertBefore(this.wrapper[0].parentNode); + } + } + else{ + if (index >= this.$lis.length) { + $li.appendTo(this.list); + $panel.appendTo(this.list[0].parentNode); + } + else { + $li.insertBefore(this.$lis[index]); + $panel.insertBefore(this.$panels[index]); + } + } + + o.disabled = $.map(o.disabled, + function(n, i) { return n >= index ? ++n : n }); + + this._tabify(); + + if (this.$tabs.length == 1) { // after tabify + $li.addClass('ui-tabs-selected ui-state-active'); + $panel.removeClass('ui-tabs-hide'); + var href = $.data(this.$tabs[0], 'load.tabs'); + if (href) this.load(0, function() { + self._trigger('show', null, + self._ui(self.$tabs[0], self.$panels[0])); + }); + } + + // callback + this._trigger('add', null, this._ui(this.$tabs[index], this.$panels[index])); + }, + + + remove: function(index) { + var o = this.options, $li = this.$lis.eq(index).remove(), + $panel = this.$panels.eq(index).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ($li.hasClass('ui-tabs-selected') && this.$tabs.length > 1) + this.select(index + (index + 1 < this.$tabs.length ? 1 : -1)); + + o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }), + function(n, i) { return n >= index ? --n : n }); + + this._tabify(); + + // callback + this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0])); + }, + + enable: function(index) { + var o = this.options; + if ($.inArray(index, o.disabled) == -1) + return; + + this.$lis.eq(index).removeClass('ui-state-disabled'); + o.disabled = $.grep(o.disabled, function(n, i) { return n != index; }); + + // callback + this._trigger('enable', null, this._ui(this.$tabs[index], this.$panels[index])); + }, + + disable: function(index) { + var self = this, o = this.options; + if (index != o.selected) { // cannot disable already selected tab + this.$lis.eq(index).addClass('ui-state-disabled'); + + o.disabled.push(index); + o.disabled.sort(); + + // callback + this._trigger('disable', null, this._ui(this.$tabs[index], this.$panels[index])); + } + }, + + select: function(index) { + if (typeof index == 'string') + index = this.$tabs.index(this.$tabs.filter('[href$=' + index + ']')); + this.$tabs.eq(index).trigger(this.options.event + '.tabs'); + }, + + load: function(index, callback) { // callback is for internal usage only + + var self = this, o = this.options, $a = this.$tabs.eq(index), a = $a[0], + bypassCache = callback == undefined || callback === false, url = $a.data('load.tabs'); + // TODO bypassCache == false should work + + callback = callback || function() {}; + + // no remote or from cache - just finish with callback + // TODO in any case: insert cancel running load here..! + + if (!url || !bypassCache && $.data(a, 'cache.tabs')) { + callback(); + return; + } + + // load remote from here on + + var inner = function(parent) { + var $parent = $(parent), $inner = $parent.find('*:last'); + return $inner.length && $inner.is(':not(img)') && $inner || $parent; + }; + var cleanup = function() { + self.$tabs.filter('.ui-tabs-loading').removeClass('ui-tabs-loading') + .each(function() { + if (o.spinner) + inner(this).parent().html(inner(this).data('label.tabs')); + }); + self.xhr = null; + }; + + if (o.spinner) { + var label = inner(a).html(); + inner(a).wrapInner('') + .find('em').data('label.tabs', label).html(o.spinner); + } + + var ajaxOptions = $.extend({}, o.ajaxOptions, { + url: url, + success: function(r, s) { + $(self._sanitizeSelector(a.hash)).html(r); + cleanup(); + + if (o.cache) + $.data(a, 'cache.tabs', true); // if loaded once do not load them again + + // callbacks + self._trigger('load', null, self._ui(self.$tabs[index], self.$panels[index])); + try { + o.ajaxOptions.success(r, s); + } + catch (er) {} + + // This callback is required because the switch has to take + // place after loading has completed. Call last in order to + // fire load before show callback... + callback(); + } + }); + if (this.xhr) { + // terminate pending requests from other tabs and restore tab label + this.xhr.abort(); + cleanup(); + } + $a.addClass('ui-tabs-loading'); + self.xhr = $.ajax(ajaxOptions); + }, + + url: function(index, url) { + this.$tabs.eq(index).removeData('cache.tabs').data('load.tabs', url); + }, + + length: function() { + return this.$tabs.length; + } +}); + +$.extend($.ui.tabs, { + version: '1.6rc6', + getter: 'length', + defaults: { + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + deselectable: false, + disabled: [], + event: 'click', + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: 'ui-tabs-', + panelTemplate: '
    ', + spinner: 'Loading…', + tabTemplate: '
  • #{label}
  • ', + scrollable: false, + characterWidth: 10, + margins: 5, + scrollSpeed: 150, + scrollOffset: 100 + } +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend($.ui.tabs.prototype, { + rotation: null, + rotate: function(ms, continuing) { + + var self = this, t = this.options.selected; + + function rotate() { + clearTimeout(self.rotation); + self.rotation = setTimeout(function() { + t = ++t < self.$tabs.length ? t : 0; + self.select(t); + }, ms); + } + + // start rotation + if (ms) { + this.element.bind('tabsshow', rotate); // will not be attached twice + this.$tabs.bind(this.options.event + '.tabs', !continuing ? + function(e) { + if (e.clientX) { // in case of a true click + clearTimeout(self.rotation); + self.element.unbind('tabsshow', rotate); + } + } : + function(e) { + t = self.options.selected; + rotate(); + } + ); + rotate(); + } + // stop rotation + else { + clearTimeout(self.rotation); + this.element.unbind('tabsshow', rotate); + this.$tabs.unbind(this.options.event + '.tabs', stop); + } + } +}); + +$.extend($.ui.tabs.prototype, { + scrollable: function() { + this.element.each(function(options) { + options = options || { width: 200 }; + + var $this = $(this); + var width = 0; + $this.find('li').each(function() { + width += $(this).width(); + width += 2; + }); + $this.width(width + 700 /* add some constant here */); + + var $wrapper = $('
    '); + var $nav = $('
    <>
    '); + var $tabWrapper = $('
    '); + var $placeholder = $('
    '); + + $placeholder.insertBefore(this); + $tabWrapper.append(this); + $wrapper.append($nav, $tabWrapper); + $wrapper.width(options.width); + + $placeholder.replaceWith($wrapper); + + var intervalId; + $nav.find('.ui-tabs-scrollable-nav-right').mouseover(function() { + intervalId = setInterval(function() { + if ($tabWrapper.scrollLeft() < $tabWrapper.width() - 10) { + $tabWrapper.animate({ scrollLeft: $tabWrapper.scrollLeft() + 10 }, 50) + } + }, 100); + }); + + $nav.find('.ui-tabs-scrollable-nav-left').mouseover(function() { + if ($tabWrapper.scrollLeft() > 10) { + intervalId = setInterval(function() { + $tabWrapper.animate({ scrollLeft: $tabWrapper.scrollLeft() - 10 }, 50) + }, 100); + } + }); + + $nav.find('.ui-tabs-scrollable-nav-right, .ui-tabs-scrollable-nav-left').mouseout(function() { + clearTimeout(intervalId); + }); + }); + + this.tabify(); + } +}); + +})(jQuery); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/jquery-ui-i18n.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/jquery-ui-i18n.js,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/jquery-ui-i18n.js 1 Apr 2009 00:45:11 -0000 1.1 @@ -0,0 +1,771 @@ +/* Arabic Translation for jQuery UI date picker plugin. */ +/* Khaled Al Horani -- koko.dw@gmail.com */ +/* خالد الحوراني -- koko.dw@gmail.com */ +/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */ +jQuery(function($){ + $.datepicker.regional['ar'] = { + closeText: 'إغلاق', + prevText: '<السابق', + nextText: 'التالي>', + currentText: 'اليوم', + monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران', + 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'], + dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], + dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: true}; + $.datepicker.setDefaults($.datepicker.regional['ar']); +});/* Bulgarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Stoyan Kyosev (http://svest.org). */ +jQuery(function($){ + $.datepicker.regional['bg'] = { + closeText: 'затвори', + prevText: '<назад', + nextText: 'напред>', + nextBigText: '>>', + currentText: 'днес', + monthNames: ['Януари','Февруари','Март','Април','Май','Юни', + 'Юли','Август','Септември','Октомври','Ноември','Декември'], + monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни', + 'Юли','Авг','Сеп','Окт','Нов','Дек'], + dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'], + dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'], + dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['bg']); +}); +/* Inicialitzaci� en catal� per a l'extenci� 'calendar' per jQuery. */ +/* Writers: (joan.leon@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ca'] = { + closeText: 'Tancar', + prevText: '<Ant', + nextText: 'Seg>', + currentText: 'Avui', + monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny', + 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'], + monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Oct','Nov','Des'], + dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'], + dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'], + dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'], + dateFormat: 'mm/dd/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['ca']); +});/* Czech initialisation for the jQuery UI date picker plugin. */ +/* Written by Tomas Muller (tomas@tomas-muller.net). */ +jQuery(function($){ + $.datepicker.regional['cs'] = { + closeText: 'Zavřít', + prevText: '<Dříve', + nextText: 'Později>', + currentText: 'Nyní', + monthNames: ['leden','únor','březen','duben','květen','červen', + 'červenec','srpen','září','říjen','listopad','prosinec'], + monthNamesShort: ['led','úno','bře','dub','kvě','čer', + 'čvc','srp','zář','říj','lis','pro'], + dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'], + dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'], + dayNamesMin: ['ne','po','út','st','čt','pá','so'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['cs']); +}); +/* Danish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jan Christensen ( deletestuff@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['da'] = { + closeText: 'Luk', + prevText: '<Forrige', + nextText: 'Næste>', + currentText: 'Idag', + monthNames: ['Januar','Februar','Marts','April','Maj','Juni', + 'Juli','August','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], + dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], + dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], + dateFormat: 'dd-mm-yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['da']); +}); +/* German initialisation for the jQuery UI date picker plugin. */ +/* Written by Milian Wolff (mail@milianw.de). */ +jQuery(function($){ + $.datepicker.regional['de'] = { + closeText: 'schließen', + prevText: '<zurück', + nextText: 'Vor>', + currentText: 'heute', + monthNames: ['Januar','Februar','März','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Dezember'], + monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dez'], + dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'], + dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'], + dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['de']); +}); +/* Greek (el) initialisation for the jQuery UI date picker plugin. */ +/* Written by Alex Cicovic (http://www.alexcicovic.com) */ +jQuery(function($){ + $.datepicker.regional['el'] = { + closeText: 'Κλείσιμο', + prevText: 'Προηγούμενος', + nextText: 'Επόμενος', + currentText: 'Τρέχων Μήνας', + monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος', + 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'], + monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν', + 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'], + dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'], + dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'], + dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['el']); +});/* Esperanto initialisation for the jQuery UI date picker plugin. */ +/* Written by Olivier M. (olivierweb@ifrance.com). */ +jQuery(function($){ + $.datepicker.regional['eo'] = { + closeText: 'Fermi', + prevText: '<Anta', + nextText: 'Sekv>', + currentText: 'Nuna', + monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio', + 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aŭg','Sep','Okt','Nov','Dec'], + dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'], + dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['eo']); +}); +/* Inicializaci�n en espa�ol para la extensi�n 'UI date picker' para jQuery. */ +/* Traducido por Vester (xvester@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['es'] = { + closeText: 'Cerrar', + prevText: '<Ant', + nextText: 'Sig>', + currentText: 'Hoy', + monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio', + 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'], + monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun', + 'Jul','Ago','Sep','Oct','Nov','Dic'], + dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'], + dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'], + dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['es']); +});/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */ +/* Javad Mowlanezhad -- jmowla@gmail.com */ +/* Jalali calendar should supported soon! (Its implemented but I have to test it) */ +jQuery(function($) { + $.datepicker.regional['fa'] = { + closeText: 'بستن', + prevText: '<قبلي', + nextText: 'بعدي>', + currentText: 'امروز', + monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور', + 'مهر','آبان','آذر','دي','بهمن','اسفند'], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: ['يکشنبه','دوشنبه','سه‌شنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'], + dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'], + dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'], + dateFormat: 'yy/mm/dd', firstDay: 6, + isRTL: true}; + $.datepicker.setDefaults($.datepicker.regional['fa']); +});/* Finnish initialisation for the jQuery UI date picker plugin. */ +/* Written by Harri Kilpi� (harrikilpio@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['fi'] = { + closeText: 'Sulje', + prevText: '«Edellinen', + nextText: 'Seuraava»', + currentText: 'Tänään', + monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu', + 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'], + monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä', + 'Heinä','Elo','Syys','Loka','Marras','Joulu'], + dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'], + dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'], + dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['fi']); +}); +/* French initialisation for the jQuery UI date picker plugin. */ +/* Written by Keith Wood (kbwood@virginbroadband.com.au) and Stéphane Nahmani (sholby@sholby.net). */ +jQuery(function($){ + $.datepicker.regional['fr'] = { + closeText: 'Fermer', + prevText: '<Préc', + nextText: 'Suiv>', + currentText: 'Courant', + monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin', + 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'], + monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun', + 'Jul','Aoû','Sep','Oct','Nov','Déc'], + dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'], + dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['fr']); +});/* Hebrew initialisation for the UI Datepicker extension. */ +/* Written by Amir Hardon (ahardon at gmail dot com). */ +jQuery(function($){ + $.datepicker.regional['he'] = { + closeText: 'סגור', + prevText: '<הקודם', + nextText: 'הבא>', + currentText: 'היום', + monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני', + 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'], + monthNamesShort: ['1','2','3','4','5','6', + '7','8','9','10','11','12'], + dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'], + dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: true}; + $.datepicker.setDefaults($.datepicker.regional['he']); +}); +/* Croatian i18n for the jQuery UI date picker plugin. */ +/* Written by Vjekoslav Nesek. */ +jQuery(function($){ + $.datepicker.regional['hr'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipani', + 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'], + monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip', + 'Srp','Kol','Ruj','Lis','Stu','Pro'], + dayNames: ['Nedjalja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + dateFormat: 'dd.mm.yy.', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['hr']); +});/* Hungarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Istvan Karaszi (jquerycalendar@spam.raszi.hu). */ +jQuery(function($){ + $.datepicker.regional['hu'] = { + closeText: 'bezárás', + prevText: '« vissza', + nextText: 'előre »', + currentText: 'ma', + monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június', + 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'], + monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún', + 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'], + dayNames: ['Vasámap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'], + dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'], + dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'], + dateFormat: 'yy-mm-dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['hu']); +}); +/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/ +jQuery(function($){ + $.datepicker.regional['hy'] = { + closeText: 'Փակել', + prevText: '<Նախ.', + nextText: 'Հաջ.>', + currentText: 'Այսօր', + monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս', + 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'], + monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս', + 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'], + dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'], + dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['hy']); +});/* Indonesian initialisation for the jQuery UI date picker plugin. */ +/* Written by Deden Fathurahman (dedenf@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['id'] = { + closeText: 'Tutup', + prevText: '<mundur', + nextText: 'maju>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Maret','April','Mei','Juni', + 'Juli','Agustus','September','Oktober','Nopember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun', + 'Jul','Agus','Sep','Okt','Nop','Des'], + dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'], + dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'], + dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['id']); +});/* Icelandic initialisation for the jQuery UI date picker plugin. */ +/* Written by Haukur H. Thorsson (haukur@eskill.is). */ +jQuery(function($){ + $.datepicker.regional['is'] = { + closeText: 'Loka', + prevText: '< Fyrri', + nextText: 'Næsti >', + currentText: 'Í dag', + monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní', + 'Júlí','Ágúst','September','Október','Nóvember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún', + 'Júl','Ágú','Sep','Okt','Nóv','Des'], + dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'], + dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'], + dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['is']); +});/* Italian initialisation for the jQuery UI date picker plugin. */ +/* Written by Apaella (apaella@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['it'] = { + closeText: 'Chiudi', + prevText: '<Prec', + nextText: 'Succ>', + currentText: 'Oggi', + monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno', + 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'], + monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu', + 'Lug','Ago','Set','Ott','Nov','Dic'], + dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'], + dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'], + dayNamesMin: ['Do','Lu','Ma','Me','Gio','Ve','Sa'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['it']); +}); +/* Japanese initialisation for the jQuery UI date picker plugin. */ +/* Written by Kentaro SATO (kentaro@ranvis.com). */ +jQuery(function($){ + $.datepicker.regional['ja'] = { + closeText: '閉じる', + prevText: '<前', + nextText: '次>', + currentText: '今日', + monthNames: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + monthNamesShort: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'], + dayNamesShort: ['日','月','火','水','木','金','土'], + dayNamesMin: ['日','月','火','水','木','金','土'], + dateFormat: 'yy/mm/dd', firstDay: 0, + isRTL: false, + showMonthAfterYear: true}; + $.datepicker.setDefaults($.datepicker.regional['ja']); +});/* Korean initialisation for the jQuery calendar extension. */ +/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ko'] = { + closeText: '닫기', + prevText: '이전달', + nextText: '다음달', + currentText: '오늘', + monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', + '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], + monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', + '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], + dayNames: ['일','월','화','수','목','금','토'], + dayNamesShort: ['일','월','화','수','목','금','토'], + dayNamesMin: ['일','월','화','수','목','금','토'], + dateFormat: 'yy-mm-dd', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['ko']); +});/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas */ +jQuery(function($){ + $.datepicker.regional['lt'] = { + closeText: 'Uždaryti', + prevText: '<Atgal', + nextText: 'Pirmyn>', + currentText: 'Šiandien', + monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis', + 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'], + monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir', + 'Lie','Rugp','Rugs','Spa','Lap','Gru'], + dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'], + dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'], + dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'], + dateFormat: 'yy-mm-dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['lt']); +});/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas */ +jQuery(function($){ + $.datepicker.regional['lv'] = { + closeText: 'Aizvērt', + prevText: 'Iepr', + nextText: 'Nāka', + currentText: 'Šodien', + monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs', + 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn', + 'Jūl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'], + dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'], + dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'], + dateFormat: 'dd-mm-yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['lv']); +});/* Malaysian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */ +jQuery(function($){ + $.datepicker.regional['ms'] = { + closeText: 'Tutup', + prevText: '<Sebelum', + nextText: 'Selepas>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Mac','April','Mei','Jun', + 'Julai','Ogos','September','Oktober','November','Disember'], + monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun', + 'Jul','Ogo','Sep','Okt','Nov','Dis'], + dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'], + dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'], + dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['ms']); +});/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Mathias Bynens */ +jQuery(function($){ + $.datepicker.regional.nl = { + closeText: 'Sluiten', + prevText: '←', + nextText: '→', + currentText: 'Vandaag', + monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni', + 'juli', 'augustus', 'september', 'oktober', 'november', 'december'], + monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun', + 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'], + dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'], + dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'], + dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional.nl); +});/* Norwegian initialisation for the jQuery UI date picker plugin. */ +/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['no'] = { + closeText: 'Lukk', + prevText: '«Forrige', + nextText: 'Neste»', + currentText: 'I dag', + monthNames: ['Januar','Februar','Mars','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Des'], + dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], + dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], + dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], + dateFormat: 'yy-mm-dd', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['no']); +}); +/* Polish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pl'] = { + closeText: 'Zamknij', + prevText: '<Poprzedni', + nextText: 'Następny>', + currentText: 'Dziś', + monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec', + 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'], + monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze', + 'Lip','Sie','Wrz','Pa','Lis','Gru'], + dayNames: ['Niedziela','Poniedzialek','Wtorek','Środa','Czwartek','Piątek','Sobota'], + dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'], + dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'], + dateFormat: 'yy-mm-dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['pl']); +}); +/* Brazilian initialisation for the jQuery UI date picker plugin. */ +/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pt-BR'] = { + closeText: 'Fechar', + prevText: '<Anterior', + nextText: 'Próximo>', + currentText: 'Hoje', + monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho', + 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], + monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Out','Nov','Dez'], + dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'], + dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'], + dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['pt-BR']); +});/* Romanian initialisation for the jQuery UI date picker plugin. + * + * Written by Edmond L. (ll_edmond@walla.com) + * and Ionut G. Stan (ionut.g.stan@gmail.com) + */ +jQuery(function($){ + $.datepicker.regional['ro'] = { + closeText: 'Închide', + prevText: '« Luna precedentă', + nextText: 'Luna următoare »', + currentText: 'Azi', + monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie', + 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'], + monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun', + 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'], + dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'], + dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'], + dateFormat: 'dd MM yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['ro']); +}); +/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Andrew Stromnov (stromnov@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ru'] = { + closeText: 'Закрыть', + prevText: '<Пред', + nextText: 'След>', + currentText: 'Сегодня', + monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь', + 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'], + monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн', + 'Июл','Авг','Сен','Окт','Ноя','Дек'], + dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'], + dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'], + dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['ru']); +});/* Slovak initialisation for the jQuery UI date picker plugin. */ +/* Written by Vojtech Rinik (vojto@hmm.sk). */ +jQuery(function($){ + $.datepicker.regional['sk'] = { + closeText: 'Zavrieť', + prevText: '<Predchádzajúci', + nextText: 'Nasledujúci>', + currentText: 'Dnes', + monthNames: ['Január','Február','Marec','Apríl','Máj','Jún', + 'Júl','August','September','Október','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún', + 'Júl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'], + dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'], + dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'], + dateFormat: 'dd.mm.yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['sk']); +}); +/* Slovenian initialisation for the jQuery UI date picker plugin. */ +/* Written by Jaka Jancar (jaka@kubje.org). */ +/* c = č, s = š z = ž C = Č S = Š Z = Ž */ +jQuery(function($){ + $.datepicker.regional['sl'] = { + closeText: 'Zapri', + prevText: '<Prejšnji', + nextText: 'Naslednji>', + currentText: 'Trenutni', + monthNames: ['Januar','Februar','Marec','April','Maj','Junij', + 'Julij','Avgust','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Avg','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'], + dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'], + dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['sl']); +}); +/* Albanian initialisation for the jQuery UI date picker plugin. */ +/* Written by Flakron Bytyqi (flakron@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['sq'] = { + closeText: 'mbylle', + prevText: '<mbrapa', + nextText: 'Përpara>', + currentText: 'sot', + monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor', + 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'], + monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer', + 'Kor','Gus','Sht','Tet','Nën','Dhj'], + dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'], + dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'], + dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['sq']); +}); +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr-SR'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Januar','Februar','Mart','April','Maj','Jun', + 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Avg','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['sr-SR']); +}); +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr'] = { + closeText: 'Затвори', + prevText: '<', + nextText: '>', + currentText: 'Данас', + monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун', + 'Јул','Август','Септембар','Октобар','Новембар','Децембар'], + monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун', + 'Јул','Авг','Сеп','Окт','Нов','Дец'], + dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'], + dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'], + dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['sr']); +}); +/* Swedish initialisation for the jQuery UI date picker plugin. */ +/* Written by Anders Ekdahl ( anders@nomadiz.se). */ +jQuery(function($){ + $.datepicker.regional['sv'] = { + closeText: 'Stäng', + prevText: '«Förra', + nextText: 'Nästa»', + currentText: 'Idag', + monthNames: ['Januari','Februari','Mars','April','Maj','Juni', + 'Juli','Augusti','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'], + dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'], + dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'], + dateFormat: 'yy-mm-dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['sv']); +}); +/* Thai initialisation for the jQuery UI date picker plugin. */ +/* Written by pipo (pipo@sixhead.com). */ +jQuery(function($){ + $.datepicker.regional['th'] = { + closeText: 'ปิด', + prevText: '« ย้อน', + nextText: 'ถัดไป »', + currentText: 'วันนี้', + monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน', + 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'], + monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.', + 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'], + dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'], + dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['th']); +});/* Turkish initialisation for the jQuery UI date picker plugin. */ +/* Written by Izzet Emre Erkan (kara@karalamalar.net). */ +jQuery(function($){ + $.datepicker.regional['tr'] = { + closeText: 'kapat', + prevText: '<geri', + nextText: 'ileri>', + currentText: 'bugün', + monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran', + 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'], + monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz', + 'Tem','Ağu','Eyl','Eki','Kas','Ara'], + dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'], + dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['tr']); +});/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['uk'] = { + clearText: 'Очистити', clearStatus: '', + closeText: 'Закрити', closeStatus: '', + prevText: '<', prevStatus: '', + prevBigText: '<<', prevBigStatus: '', + nextText: '>', nextStatus: '', + nextBigText: '>>', nextBigStatus: '', + currentText: 'Сьогодні', currentStatus: '', + monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень', + 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'], + monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер', + 'Лип','Сер','Вер','Жов','Лис','Гру'], + monthStatus: '', yearStatus: '', + weekHeader: 'Не', weekStatus: '', + dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'], + dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'], + dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'], + dayStatus: 'DD', dateStatus: 'D, M d', + dateFormat: 'dd/mm/yy', firstDay: 1, + initStatus: '', isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['uk']); +});/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Cloudream (cloudream@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-CN'] = { + closeText: '关闭', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + dateFormat: 'yy-mm-dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['zh-CN']); +}); +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Ressol (ressol@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-TW'] = { + closeText: '關閉', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + dateFormat: 'yy/mm/dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['zh-TW']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ar.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-ar.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ar.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ar.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,26 +1,20 @@ -/* Arabic Translation for jQuery UI date picker plugin. */ -/* Khaled Al Horani -- koko.dw@gmail.com */ -/* خالد الحوراني -- koko.dw@gmail.com */ -/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */ -jQuery(function($){ - $.datepicker.regional['ar'] = { - clearText: 'مسح', clearStatus: 'امسح التاريخ الحالي', - closeText: 'إغلاق', closeStatus: 'إغلاق بدون حفظ', - prevText: '<السابق', prevStatus: 'عرض الشهر السابق', - prevBigText: '<<', prevBigStatus: '', - nextText: 'التالي>', nextStatus: 'عرض الشهر القادم', - nextBigText: '>>', nextBigStatus: '', - currentText: 'اليوم', currentStatus: 'عرض الشهر الحالي', - monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران', - 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'], - monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], - monthStatus: 'عرض شهر آخر', yearStatus: 'عرض سنة آخرى', - weekHeader: 'أسبوع', weekStatus: 'أسبوع السنة', - dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'], - dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], - dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], - dayStatus: 'اختر DD لليوم الأول من الأسبوع', dateStatus: 'اختر D, M d', - dateFormat: 'dd/mm/yy', firstDay: 0, - initStatus: 'اختر يوم', isRTL: true}; - $.datepicker.setDefaults($.datepicker.regional['ar']); +/* Arabic Translation for jQuery UI date picker plugin. */ +/* Khaled Al Horani -- koko.dw@gmail.com */ +/* خالد الحوراني -- koko.dw@gmail.com */ +/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */ +jQuery(function($){ + $.datepicker.regional['ar'] = { + closeText: 'إغلاق', + prevText: '<السابق', + nextText: 'التالي>', + currentText: 'اليوم', + monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران', + 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'], + dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], + dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: true}; + $.datepicker.setDefaults($.datepicker.regional['ar']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-bg.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-bg.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-bg.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-bg.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,20 @@ -/* Bulgarian initialisation for the jQuery UI date picker plugin. */ -/* Written by Stoyan Kyosev (http://svest.org). */ -jQuery(function($){ - $.datepicker.regional['bg'] = { - clearText: 'изчисти', clearStatus: 'изчисти актуалната дата', - closeText: 'затвори', closeStatus: 'затвори без промени', - prevText: '<назад', prevStatus: 'покажи последния месец', - prevBigText: '<<', prevBigStatus: '', - nextText: 'напред>', nextStatus: 'покажи следващия месец', - nextBigText: '>>', nextBigStatus: '', - currentText: 'днес', currentStatus: '', - monthNames: ['Януари','Февруари','Март','Април','Май','Юни', - 'Юли','Август','Септември','Октомври','Ноември','Декември'], - monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни', - 'Юли','Авг','Сеп','Окт','Нов','Дек'], - monthStatus: 'покажи друг месец', yearStatus: 'покажи друга година', - weekHeader: 'Wk', weekStatus: 'седмица от месеца', - dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'], - dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'], - dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'], - dayStatus: 'Сложи DD като първи ден от седмицата', dateStatus: 'Избери D, M d', - dateFormat: 'dd.mm.yy', firstDay: 1, - initStatus: 'Избери дата', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['bg']); -}); +/* Bulgarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Stoyan Kyosev (http://svest.org). */ +jQuery(function($){ + $.datepicker.regional['bg'] = { + closeText: 'затвори', + prevText: '<назад', + nextText: 'напред>', + nextBigText: '>>', + currentText: 'днес', + monthNames: ['Януари','Февруари','Март','Април','Май','Юни', + 'Юли','Август','Септември','Октомври','Ноември','Декември'], + monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни', + 'Юли','Авг','Сеп','Окт','Нов','Дек'], + dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'], + dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'], + dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['bg']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ca.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-ca.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ca.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ca.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Inicialitzaci� en catal� per a l'extenci� 'calendar' per jQuery. */ -/* Writers: (joan.leon@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['ca'] = { - clearText: 'Netejar', clearStatus: '', - closeText: 'Tancar', closeStatus: '', - prevText: '<Ant', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Seg>', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Avui', currentStatus: '', - monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny', - 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'], - monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun', - 'Jul','Ago','Set','Oct','Nov','Des'], - monthStatus: '', yearStatus: '', - weekHeader: 'Sm', weekStatus: '', - dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'], - dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'], - dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'mm/dd/yy', firstDay: 0, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['ca']); +/* Inicialitzaci� en catal� per a l'extenci� 'calendar' per jQuery. */ +/* Writers: (joan.leon@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ca'] = { + closeText: 'Tancar', + prevText: '<Ant', + nextText: 'Seg>', + currentText: 'Avui', + monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny', + 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'], + monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Oct','Nov','Des'], + dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'], + dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'], + dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'], + dateFormat: 'mm/dd/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['ca']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-cs.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-cs.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-cs.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-cs.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Czech initialisation for the jQuery UI date picker plugin. */ -/* Written by Tomas Muller (tomas@tomas-muller.net). */ -jQuery(function($){ - $.datepicker.regional['cs'] = { - clearText: 'Vymazat', clearStatus: 'Vymaže zadané datum', - closeText: 'Zavřít', closeStatus: 'Zavře kalendář beze změny', - prevText: '<Dříve', prevStatus: 'Přejít na předchozí měsí', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Později>', nextStatus: 'Přejít na další měsíc', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Nyní', currentStatus: 'Přejde na aktuální měsíc', - monthNames: ['leden','únor','březen','duben','květen','červen', - 'červenec','srpen','září','říjen','listopad','prosinec'], - monthNamesShort: ['led','úno','bře','dub','kvě','čer', - 'čvc','srp','zář','říj','lis','pro'], - monthStatus: 'Přejít na jiný měsíc', yearStatus: 'Přejít na jiný rok', - weekHeader: 'Týd', weekStatus: 'Týden v roce', - dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'], - dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'], - dayNamesMin: ['ne','po','út','st','čt','pá','so'], - dayStatus: 'Nastavit DD jako první den v týdnu', dateStatus: '\'Vyber\' DD, M d', - dateFormat: 'dd.mm.yy', firstDay: 1, - initStatus: 'Vyberte datum', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['cs']); -}); +/* Czech initialisation for the jQuery UI date picker plugin. */ +/* Written by Tomas Muller (tomas@tomas-muller.net). */ +jQuery(function($){ + $.datepicker.regional['cs'] = { + closeText: 'Zavřít', + prevText: '<Dříve', + nextText: 'Později>', + currentText: 'Nyní', + monthNames: ['leden','únor','březen','duben','květen','červen', + 'červenec','srpen','září','říjen','listopad','prosinec'], + monthNamesShort: ['led','úno','bře','dub','kvě','čer', + 'čvc','srp','zář','říj','lis','pro'], + dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'], + dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'], + dayNamesMin: ['ne','po','út','st','čt','pá','so'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['cs']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-da.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-da.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-da.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-da.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Danish initialisation for the jQuery UI date picker plugin. */ -/* Written by Jan Christensen ( deletestuff@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['da'] = { - clearText: 'Nulstil', clearStatus: 'Nulstil den aktuelle dato', - closeText: 'Luk', closeStatus: 'Luk uden ændringer', - prevText: '<Forrige', prevStatus: 'Vis forrige måned', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Næste>', nextStatus: 'Vis næste måned', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Idag', currentStatus: 'Vis aktuel måned', - monthNames: ['Januar','Februar','Marts','April','Maj','Juni', - 'Juli','August','September','Oktober','November','December'], - monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', - 'Jul','Aug','Sep','Okt','Nov','Dec'], - monthStatus: 'Vis en anden måned', yearStatus: 'Vis et andet år', - weekHeader: 'Uge', weekStatus: 'Årets uge', - dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], - dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], - dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], - dayStatus: 'Sæt DD som første ugedag', dateStatus: 'Vælg D, M d', - dateFormat: 'dd-mm-yy', firstDay: 0, - initStatus: 'Vælg en dato', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['da']); -}); +/* Danish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jan Christensen ( deletestuff@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['da'] = { + closeText: 'Luk', + prevText: '<Forrige', + nextText: 'Næste>', + currentText: 'Idag', + monthNames: ['Januar','Februar','Marts','April','Maj','Juni', + 'Juli','August','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], + dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], + dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], + dateFormat: 'dd-mm-yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['da']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-de.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-de.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-de.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-de.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* German initialisation for the jQuery UI date picker plugin. */ -/* Written by Milian Wolff (mail@milianw.de). */ -jQuery(function($){ - $.datepicker.regional['de'] = { - clearText: 'löschen', clearStatus: 'aktuelles Datum löschen', - closeText: 'schließen', closeStatus: 'ohne Änderungen schließen', - prevText: '<zurück', prevStatus: 'letzten Monat zeigen', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Vor>', nextStatus: 'nächsten Monat zeigen', - nextBigText: '>>', nextBigStatus: '', - currentText: 'heute', currentStatus: '', - monthNames: ['Januar','Februar','März','April','Mai','Juni', - 'Juli','August','September','Oktober','November','Dezember'], - monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun', - 'Jul','Aug','Sep','Okt','Nov','Dez'], - monthStatus: 'anderen Monat anzeigen', yearStatus: 'anderes Jahr anzeigen', - weekHeader: 'Wo', weekStatus: 'Woche des Monats', - dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'], - dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'], - dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'], - dayStatus: 'Setze DD als ersten Wochentag', dateStatus: 'Wähle D, M d', - dateFormat: 'dd.mm.yy', firstDay: 1, - initStatus: 'Wähle ein Datum', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['de']); -}); +/* German initialisation for the jQuery UI date picker plugin. */ +/* Written by Milian Wolff (mail@milianw.de). */ +jQuery(function($){ + $.datepicker.regional['de'] = { + closeText: 'schließen', + prevText: '<zurück', + nextText: 'Vor>', + currentText: 'heute', + monthNames: ['Januar','Februar','März','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Dezember'], + monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dez'], + dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'], + dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'], + dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['de']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-el.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-el.js,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-el.js 1 Apr 2009 00:45:11 -0000 1.1 @@ -0,0 +1,19 @@ +/* Greek (el) initialisation for the jQuery UI date picker plugin. */ +/* Written by Alex Cicovic (http://www.alexcicovic.com) */ +jQuery(function($){ + $.datepicker.regional['el'] = { + closeText: 'Κλείσιμο', + prevText: 'Προηγούμενος', + nextText: 'Επόμενος', + currentText: 'Τρέχων Μήνας', + monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος', + 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'], + monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν', + 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'], + dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'], + dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'], + dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['el']); +}); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-eo.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-eo.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-eo.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-eo.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Esperanto initialisation for the jQuery UI date picker plugin. */ -/* Written by Olivier M. (olivierweb@ifrance.com). */ -jQuery(function($){ - $.datepicker.regional['eo'] = { - clearText: 'Vakigi', clearStatus: '', - closeText: 'Fermi', closeStatus: 'Fermi sen modifi', - prevText: '<Anta', prevStatus: 'Vidi la antaŭan monaton', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Sekv>', nextStatus: 'Vidi la sekvan monaton', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Nuna', currentStatus: 'Vidi la nunan monaton', - monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio', - 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'], - monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', - 'Jul','Aŭg','Sep','Okt','Nov','Dec'], - monthStatus: 'Vidi alian monaton', yearStatus: 'Vidi alian jaron', - weekHeader: 'Sb', weekStatus: '', - dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'], - dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'], - dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'], - dayStatus: 'Uzi DD kiel unua tago de la semajno', dateStatus: 'Elekti DD, MM d', - dateFormat: 'dd/mm/yy', firstDay: 0, - initStatus: 'Elekti la daton', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['eo']); -}); +/* Esperanto initialisation for the jQuery UI date picker plugin. */ +/* Written by Olivier M. (olivierweb@ifrance.com). */ +jQuery(function($){ + $.datepicker.regional['eo'] = { + closeText: 'Fermi', + prevText: '<Anta', + nextText: 'Sekv>', + currentText: 'Nuna', + monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio', + 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aŭg','Sep','Okt','Nov','Dec'], + dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'], + dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['eo']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-es.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-es.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-es.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-es.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Inicializaci�n en espa�ol para la extensi�n 'UI date picker' para jQuery. */ -/* Traducido por Vester (xvester@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['es'] = { - clearText: 'Limpiar', clearStatus: '', - closeText: 'Cerrar', closeStatus: '', - prevText: '<Ant', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Sig>', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Hoy', currentStatus: '', - monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio', - 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'], - monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun', - 'Jul','Ago','Sep','Oct','Nov','Dic'], - monthStatus: '', yearStatus: '', - weekHeader: 'Sm', weekStatus: '', - dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sádabo'], - dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'], - dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'dd/mm/yy', firstDay: 0, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['es']); +/* Inicializaci�n en espa�ol para la extensi�n 'UI date picker' para jQuery. */ +/* Traducido por Vester (xvester@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['es'] = { + closeText: 'Cerrar', + prevText: '<Ant', + nextText: 'Sig>', + currentText: 'Hoy', + monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio', + 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'], + monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun', + 'Jul','Ago','Sep','Oct','Nov','Dic'], + dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'], + dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'], + dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['es']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-fa.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-fa.js,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-fa.js 1 Apr 2009 00:45:11 -0000 1.1 @@ -0,0 +1,19 @@ +/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */ +/* Javad Mowlanezhad -- jmowla@gmail.com */ +/* Jalali calendar should supported soon! (Its implemented but I have to test it) */ +jQuery(function($) { + $.datepicker.regional['fa'] = { + closeText: 'بستن', + prevText: '<قبلي', + nextText: 'بعدي>', + currentText: 'امروز', + monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور', + 'مهر','آبان','آذر','دي','بهمن','اسفند'], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: ['يکشنبه','دوشنبه','سه‌شنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'], + dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'], + dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'], + dateFormat: 'yy/mm/dd', firstDay: 6, + isRTL: true}; + $.datepicker.setDefaults($.datepicker.regional['fa']); +}); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-fi.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-fi.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-fi.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-fi.js 1 Apr 2009 00:45:12 -0000 1.2 @@ -1,25 +1,19 @@ -/* Finnish initialisation for the jQuery UI date picker plugin. */ -/* Written by Harri Kilpi� (harrikilpio@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['fi'] = { - clearText: 'Tyhjennä', clearStatus: '', - closeText: 'Sulje', closeStatus: '', - prevText: '«Edellinen', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Seuraava»', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Tänään', currentStatus: '', - monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu', - 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'], - monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä', - 'Heinä','Elo','Syys','Loka','Marras','Joulu'], - monthStatus: '', yearStatus: '', - weekHeader: 'Vk', weekStatus: '', - dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'], - dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'], - dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'dd.mm.yy', firstDay: 1, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['fi']); -}); +/* Finnish initialisation for the jQuery UI date picker plugin. */ +/* Written by Harri Kilpi� (harrikilpio@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['fi'] = { + closeText: 'Sulje', + prevText: '«Edellinen', + nextText: 'Seuraava»', + currentText: 'Tänään', + monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu', + 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'], + monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä', + 'Heinä','Elo','Syys','Loka','Marras','Joulu'], + dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'], + dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'], + dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['fi']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-fr.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-fr.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-fr.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-fr.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* French initialisation for the jQuery UI date picker plugin. */ -/* Written by Keith Wood (kbwood@virginbroadband.com.au) and Stéphane Nahmani (sholby@sholby.net). */ -jQuery(function($){ - $.datepicker.regional['fr'] = { - clearText: 'Effacer', clearStatus: '', - closeText: 'Fermer', closeStatus: 'Fermer sans modifier', - prevText: '<Préc', prevStatus: 'Voir le mois précédent', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Suiv>', nextStatus: 'Voir le mois suivant', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Courant', currentStatus: 'Voir le mois courant', - monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin', - 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'], - monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun', - 'Jul','Aoû','Sep','Oct','Nov','Déc'], - monthStatus: 'Voir un autre mois', yearStatus: 'Voir un autre année', - weekHeader: 'Sm', weekStatus: '', - dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'], - dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'], - dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'], - dayStatus: 'Utiliser DD comme premier jour de la semaine', dateStatus: 'Choisir le DD, MM d', - dateFormat: 'dd/mm/yy', firstDay: 0, - initStatus: 'Choisir la date', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['fr']); +/* French initialisation for the jQuery UI date picker plugin. */ +/* Written by Keith Wood (kbwood@virginbroadband.com.au) and Stéphane Nahmani (sholby@sholby.net). */ +jQuery(function($){ + $.datepicker.regional['fr'] = { + closeText: 'Fermer', + prevText: '<Préc', + nextText: 'Suiv>', + currentText: 'Courant', + monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin', + 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'], + monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun', + 'Jul','Aoû','Sep','Oct','Nov','Déc'], + dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'], + dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['fr']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-he.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-he.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-he.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-he.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Hebrew initialisation for the UI Datepicker extension. */ -/* Written by Amir Hardon (ahardon at gmail dot com). */ -jQuery(function($){ - $.datepicker.regional['he'] = { - clearText: 'נקה', clearStatus: '', - closeText: 'סגור', closeStatus: '', - prevText: '<הקודם', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'הבא>', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'היום', currentStatus: '', - monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני', - 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'], - monthNamesShort: ['1','2','3','4','5','6', - '7','8','9','10','11','12'], - monthStatus: '', yearStatus: '', - weekHeader: 'Sm', weekStatus: '', - dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'], - dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], - dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], - dayStatus: 'DD', dateStatus: 'DD, M d', - dateFormat: 'dd/mm/yy', firstDay: 0, - initStatus: '', isRTL: true}; - $.datepicker.setDefaults($.datepicker.regional['he']); -}); +/* Hebrew initialisation for the UI Datepicker extension. */ +/* Written by Amir Hardon (ahardon at gmail dot com). */ +jQuery(function($){ + $.datepicker.regional['he'] = { + closeText: 'סגור', + prevText: '<הקודם', + nextText: 'הבא>', + currentText: 'היום', + monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני', + 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'], + monthNamesShort: ['1','2','3','4','5','6', + '7','8','9','10','11','12'], + dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'], + dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: true}; + $.datepicker.setDefaults($.datepicker.regional['he']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-hr.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-hr.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-hr.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-hr.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Croatian i18n for the jQuery UI date picker plugin. */ -/* Written by Vjekoslav Nesek. */ -jQuery(function($){ - $.datepicker.regional['hr'] = { - clearText: 'izbriši', clearStatus: 'Izbriši trenutni datum', - closeText: 'Zatvori', closeStatus: 'Zatvori kalendar', - prevText: '<', prevStatus: 'Prikaži prethodni mjesec', - prevBigText: '<<', prevBigStatus: '', - nextText: '>', nextStatus: 'Prikaži slijedeći mjesec', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Danas', currentStatus: 'Današnji datum', - monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipani', - 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'], - monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip', - 'Srp','Kol','Ruj','Lis','Stu','Pro'], - monthStatus: 'Prikaži mjesece', yearStatus: 'Prikaži godine', - weekHeader: 'Tje', weekStatus: 'Tjedan', - dayNames: ['Nedjalja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'], - dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'], - dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], - dayStatus: 'Odaber DD za prvi dan tjedna', dateStatus: '\'Datum\' D, M d', - dateFormat: 'dd.mm.yy.', firstDay: 1, - initStatus: 'Odaberi datum', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['hr']); +/* Croatian i18n for the jQuery UI date picker plugin. */ +/* Written by Vjekoslav Nesek. */ +jQuery(function($){ + $.datepicker.regional['hr'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipani', + 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'], + monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip', + 'Srp','Kol','Ruj','Lis','Stu','Pro'], + dayNames: ['Nedjalja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + dateFormat: 'dd.mm.yy.', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['hr']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-hu.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-hu.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-hu.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-hu.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Hungarian initialisation for the jQuery UI date picker plugin. */ -/* Written by Istvan Karaszi (jquerycalendar@spam.raszi.hu). */ -jQuery(function($){ - $.datepicker.regional['hu'] = { - clearText: 'törlés', clearStatus: '', - closeText: 'bezárás', closeStatus: '', - prevText: '« vissza', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'előre »', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'ma', currentStatus: '', - monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június', - 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'], - monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún', - 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'], - monthStatus: '', yearStatus: '', - weekHeader: 'Hé', weekStatus: '', - dayNames: ['Vasámap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'], - dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'], - dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'yy-mm-dd', firstDay: 1, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['hu']); -}); +/* Hungarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Istvan Karaszi (jquerycalendar@spam.raszi.hu). */ +jQuery(function($){ + $.datepicker.regional['hu'] = { + closeText: 'bezárás', + prevText: '« vissza', + nextText: 'előre »', + currentText: 'ma', + monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június', + 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'], + monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún', + 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'], + dayNames: ['Vasámap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'], + dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'], + dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'], + dateFormat: 'yy-mm-dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['hu']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-hy.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-hy.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-hy.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-hy.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */ -/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/ -jQuery(function($){ - $.datepicker.regional['hy'] = { - clearText: 'Մաքրել', clearStatus: '', - closeText: 'Փակել', closeStatus: '', - prevText: '<Նախ.', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Հաջ.>', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Այսօր', currentStatus: '', - monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս', - 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'], - monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս', - 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'], - monthStatus: '', yearStatus: '', - weekHeader: 'ՇԲՏ', weekStatus: '', - dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'], - dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], - dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'dd.mm.yy', firstDay: 1, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['hy']); +/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/ +jQuery(function($){ + $.datepicker.regional['hy'] = { + closeText: 'Փակել', + prevText: '<Նախ.', + nextText: 'Հաջ.>', + currentText: 'Այսօր', + monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս', + 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'], + monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս', + 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'], + dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'], + dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['hy']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-id.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-id.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-id.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-id.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Indonesian initialisation for the jQuery UI date picker plugin. */ -/* Written by Deden Fathurahman (dedenf@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['id'] = { - clearText: 'kosongkan', clearStatus: 'bersihkan tanggal yang sekarang', - closeText: 'Tutup', closeStatus: 'Tutup tanpa mengubah', - prevText: '<mundur', prevStatus: 'Tampilkan bulan sebelumnya', - prevBigText: '<<', prevBigStatus: '', - nextText: 'maju>', nextStatus: 'Tampilkan bulan berikutnya', - nextBigText: '>>', nextBigStatus: '', - currentText: 'hari ini', currentStatus: 'Tampilkan bulan sekarang', - monthNames: ['Januari','Februari','Maret','April','Mei','Juni', - 'Juli','Agustus','September','Oktober','Nopember','Desember'], - monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun', - 'Jul','Agus','Sep','Okt','Nop','Des'], - monthStatus: 'Tampilkan bulan yang berbeda', yearStatus: 'Tampilkan tahun yang berbeda', - weekHeader: 'Mg', weekStatus: 'Minggu dalam tahun', - dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'], - dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'], - dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'], - dayStatus: 'gunakan DD sebagai awal hari dalam minggu', dateStatus: 'pilih le DD, MM d', - dateFormat: 'dd/mm/yy', firstDay: 0, - initStatus: 'Pilih Tanggal', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['id']); +/* Indonesian initialisation for the jQuery UI date picker plugin. */ +/* Written by Deden Fathurahman (dedenf@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['id'] = { + closeText: 'Tutup', + prevText: '<mundur', + nextText: 'maju>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Maret','April','Mei','Juni', + 'Juli','Agustus','September','Oktober','Nopember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun', + 'Jul','Agus','Sep','Okt','Nop','Des'], + dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'], + dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'], + dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['id']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-is.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-is.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-is.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-is.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Icelandic initialisation for the jQuery UI date picker plugin. */ -/* Written by Haukur H. Thorsson (haukur@eskill.is). */ -jQuery(function($){ - $.datepicker.regional['is'] = { - clearText: 'Hreinsa', clearStatus: '', - closeText: 'Loka', closeStatus: '', - prevText: '< Fyrri', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Næsti >', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Í dag', currentStatus: '', - monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní', - 'Júlí','Ágúst','September','Október','Nóvember','Desember'], - monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún', - 'Júl','Ágú','Sep','Okt','Nóv','Des'], - monthStatus: '', yearStatus: '', - weekHeader: 'Vika', weekStatus: '', - dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'], - dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'], - dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'dd/mm/yy', firstDay: 0, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['is']); +/* Icelandic initialisation for the jQuery UI date picker plugin. */ +/* Written by Haukur H. Thorsson (haukur@eskill.is). */ +jQuery(function($){ + $.datepicker.regional['is'] = { + closeText: 'Loka', + prevText: '< Fyrri', + nextText: 'Næsti >', + currentText: 'Í dag', + monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní', + 'Júlí','Ágúst','September','Október','Nóvember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún', + 'Júl','Ágú','Sep','Okt','Nóv','Des'], + dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'], + dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'], + dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['is']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-it.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-it.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-it.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-it.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Italian initialisation for the jQuery UI date picker plugin. */ -/* Written by Apaella (apaella@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['it'] = { - clearText: 'Svuota', clearStatus: 'Annulla', - closeText: 'Chiudi', closeStatus: 'Chiudere senza modificare', - prevText: '<Prec', prevStatus: 'Mese precedente', - prevBigText: '<<', prevBigStatus: 'Mostra l\'anno precedente', - nextText: 'Succ>', nextStatus: 'Mese successivo', - nextBigText: '>>', nextBigStatus: 'Mostra l\'anno successivo', - currentText: 'Oggi', currentStatus: 'Mese corrente', - monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno', - 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'], - monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu', - 'Lug','Ago','Set','Ott','Nov','Dic'], - monthStatus: 'Seleziona un altro mese', yearStatus: 'Seleziona un altro anno', - weekHeader: 'Sm', weekStatus: 'Settimana dell\'anno', - dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'], - dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'], - dayNamesMin: ['Do','Lu','Ma','Me','Gio','Ve','Sa'], - dayStatus: 'Usa DD come primo giorno della settimana', dateStatus: 'Seleziona D, M d', - dateFormat: 'dd/mm/yy', firstDay: 1, - initStatus: 'Scegliere una data', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['it']); -}); +/* Italian initialisation for the jQuery UI date picker plugin. */ +/* Written by Apaella (apaella@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['it'] = { + closeText: 'Chiudi', + prevText: '<Prec', + nextText: 'Succ>', + currentText: 'Oggi', + monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno', + 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'], + monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu', + 'Lug','Ago','Set','Ott','Nov','Dic'], + dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'], + dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'], + dayNamesMin: ['Do','Lu','Ma','Me','Gio','Ve','Sa'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['it']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ja.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-ja.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ja.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ja.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,20 @@ -/* Japanese (UTF-8) initialisation for the jQuery UI date picker plugin. */ -/* Written by Milly. */ -jQuery(function($){ - $.datepicker.regional['ja'] = { - clearText: '削除', clearStatus: '', - closeText: '閉じる', closeStatus: '', - prevText: '<前月', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: '次月>', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: '今日', currentStatus: '', - monthNames: ['1月','2月','3月','4月','5月','6月', - '7月','8月','9月','10月','11月','12月'], - monthNamesShort: ['1月','2月','3月','4月','5月','6月', - '7月','8月','9月','10月','11月','12月'], - monthStatus: '', yearStatus: '', - weekHeader: 'Wk', weekStatus: '', - dayNames: ['日','月','火','水','木','金','土'], - dayNamesShort: ['日','月','火','水','木','金','土'], - dayNamesMin: ['日','月','火','水','木','金','土'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'yy/mm/dd', firstDay: 0, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['ja']); +/* Japanese initialisation for the jQuery UI date picker plugin. */ +/* Written by Kentaro SATO (kentaro@ranvis.com). */ +jQuery(function($){ + $.datepicker.regional['ja'] = { + closeText: '閉じる', + prevText: '<前', + nextText: '次>', + currentText: '今日', + monthNames: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + monthNamesShort: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'], + dayNamesShort: ['日','月','火','水','木','金','土'], + dayNamesMin: ['日','月','火','水','木','金','土'], + dateFormat: 'yy/mm/dd', firstDay: 0, + isRTL: false, + showMonthAfterYear: true}; + $.datepicker.setDefaults($.datepicker.regional['ja']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ko.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-ko.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ko.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ko.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Korean initialisation for the jQuery calendar extension. */ -/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['ko'] = { - clearText: '지우기', clearStatus: '', - closeText: '닫기', closeStatus: '', - prevText: '이전달', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: '다음달', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: '오늘', currentStatus: '', - monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', - '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], - monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', - '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], - monthStatus: '', yearStatus: '', - weekHeader: 'Wk', weekStatus: '', - dayNames: ['일','월','화','수','목','금','토'], - dayNamesShort: ['일','월','화','수','목','금','토'], - dayNamesMin: ['일','월','화','수','목','금','토'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'yy-mm-dd', firstDay: 0, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['ko']); +/* Korean initialisation for the jQuery calendar extension. */ +/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ko'] = { + closeText: '닫기', + prevText: '이전달', + nextText: '다음달', + currentText: '오늘', + monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', + '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], + monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)', + '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'], + dayNames: ['일','월','화','수','목','금','토'], + dayNamesShort: ['일','월','화','수','목','금','토'], + dayNamesMin: ['일','월','화','수','목','금','토'], + dateFormat: 'yy-mm-dd', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['ko']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-lt.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-lt.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-lt.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-lt.js 1 Apr 2009 00:45:12 -0000 1.2 @@ -1,25 +1,19 @@ -/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */ -/* @author Arturas Paleicikas */ -jQuery(function($){ - $.datepicker.regional['lt'] = { - clearText: 'Išvalyti', clearStatus: '', - closeText: 'Uždaryti', closeStatus: '', - prevText: '<Atgal', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Pirmyn>', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Šiandien', currentStatus: '', - monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis', - 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'], - monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir', - 'Lie','Rugp','Rugs','Spa','Lap','Gru'], - monthStatus: '', yearStatus: '', - weekHeader: '', weekStatus: '', - dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'], - dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'], - dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'yy-mm-dd', firstDay: 1, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['lt']); +/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas */ +jQuery(function($){ + $.datepicker.regional['lt'] = { + closeText: 'Uždaryti', + prevText: '<Atgal', + nextText: 'Pirmyn>', + currentText: 'Šiandien', + monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis', + 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'], + monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir', + 'Lie','Rugp','Rugs','Spa','Lap','Gru'], + dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'], + dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'], + dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'], + dateFormat: 'yy-mm-dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['lt']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-lv.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-lv.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-lv.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-lv.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */ -/* @author Arturas Paleicikas */ -jQuery(function($){ - $.datepicker.regional['lv'] = { - clearText: 'Notīrīt', clearStatus: '', - closeText: 'Aizvērt', closeStatus: '', - prevText: 'Iepr', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Nāka', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Šodien', currentStatus: '', - monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs', - 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'], - monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn', - 'Jūl','Aug','Sep','Okt','Nov','Dec'], - monthStatus: '', yearStatus: '', - weekHeader: 'Nav', weekStatus: '', - dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'], - dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'], - dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'dd-mm-yy', firstDay: 1, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['lv']); +/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas */ +jQuery(function($){ + $.datepicker.regional['lv'] = { + closeText: 'Aizvērt', + prevText: 'Iepr', + nextText: 'Nāka', + currentText: 'Šodien', + monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs', + 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn', + 'Jūl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'], + dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'], + dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'], + dateFormat: 'dd-mm-yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['lv']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ms.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-ms.js,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ms.js 1 Apr 2009 00:45:11 -0000 1.1 @@ -0,0 +1,19 @@ +/* Malaysian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */ +jQuery(function($){ + $.datepicker.regional['ms'] = { + closeText: 'Tutup', + prevText: '<Sebelum', + nextText: 'Selepas>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Mac','April','Mei','Jun', + 'Julai','Ogos','September','Oktober','November','Disember'], + monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun', + 'Jul','Ogo','Sep','Okt','Nov','Dis'], + dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'], + dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'], + dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['ms']); +}); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-nl.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-nl.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-nl.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-nl.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */ -/* Written by ??? */ -jQuery(function($){ - $.datepicker.regional['nl'] = { - clearText: 'Wissen', clearStatus: 'Wis de huidige datum', - closeText: 'Sluiten', closeStatus: 'Sluit zonder verandering', - prevText: '<Terug', prevStatus: 'Laat de voorgaande maand zien', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Volgende>', nextStatus: 'Laat de volgende maand zien', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Vandaag', currentStatus: 'Laat de huidige maand zien', - monthNames: ['Januari','Februari','Maart','April','Mei','Juni', - 'Juli','Augustus','September','Oktober','November','December'], - monthNamesShort: ['Jan','Feb','Mrt','Apr','Mei','Jun', - 'Jul','Aug','Sep','Okt','Nov','Dec'], - monthStatus: 'Laat een andere maand zien', yearStatus: 'Laat een ander jaar zien', - weekHeader: 'Wk', weekStatus: 'Week van het jaar', - dayNames: ['Zondag','Maandag','Dinsdag','Woensdag','Donderdag','Vrijdag','Zaterdag'], - dayNamesShort: ['Zon','Maa','Din','Woe','Don','Vri','Zat'], - dayNamesMin: ['Zo','Ma','Di','Wo','Do','Vr','Za'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'dd.mm.yy', firstDay: 1, - initStatus: 'Kies een datum', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['nl']); +/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Mathias Bynens */ +jQuery(function($){ + $.datepicker.regional.nl = { + closeText: 'Sluiten', + prevText: '←', + nextText: '→', + currentText: 'Vandaag', + monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni', + 'juli', 'augustus', 'september', 'oktober', 'november', 'december'], + monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun', + 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'], + dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'], + dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'], + dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional.nl); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-no.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-no.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-no.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-no.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Norwegian initialisation for the jQuery UI date picker plugin. */ -/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['no'] = { - clearText: 'Tøm', clearStatus: '', - closeText: 'Lukk', closeStatus: '', - prevText: '«Forrige', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Neste»', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'I dag', currentStatus: '', - monthNames: ['Januar','Februar','Mars','April','Mai','Juni', - 'Juli','August','September','Oktober','November','Desember'], - monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun', - 'Jul','Aug','Sep','Okt','Nov','Des'], - monthStatus: '', yearStatus: '', - weekHeader: 'Uke', weekStatus: '', - dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], - dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], - dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'yy-mm-dd', firstDay: 0, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['no']); -}); +/* Norwegian initialisation for the jQuery UI date picker plugin. */ +/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['no'] = { + closeText: 'Lukk', + prevText: '«Forrige', + nextText: 'Neste»', + currentText: 'I dag', + monthNames: ['Januar','Februar','Mars','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Des'], + dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], + dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], + dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], + dateFormat: 'yy-mm-dd', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['no']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-pl.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-pl.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-pl.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-pl.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Polish initialisation for the jQuery UI date picker plugin. */ -/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['pl'] = { - clearText: 'Wyczyść', clearStatus: 'Wyczyść obecną datę', - closeText: 'Zamknij', closeStatus: 'Zamknij bez zapisywania', - prevText: '<Poprzedni', prevStatus: 'Pokaż poprzedni miesiąc', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Następny>', nextStatus: 'Pokaż następny miesiąc', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Dziś', currentStatus: 'Pokaż aktualny miesiąc', - monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec', - 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'], - monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze', - 'Lip','Sie','Wrz','Pa','Lis','Gru'], - monthStatus: 'Pokaż inny miesiąc', yearStatus: 'Pokaż inny rok', - weekHeader: 'Tydz', weekStatus: 'Tydzień roku', - dayNames: ['Niedziela','Poniedzialek','Wtorek','Środa','Czwartek','Piątek','Sobota'], - dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'], - dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'], - dayStatus: 'Ustaw DD jako pierwszy dzień tygodnia', dateStatus: 'Wybierz D, M d', - dateFormat: 'yy-mm-dd', firstDay: 1, - initStatus: 'Wybierz datę', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['pl']); -}); +/* Polish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pl'] = { + closeText: 'Zamknij', + prevText: '<Poprzedni', + nextText: 'Następny>', + currentText: 'Dziś', + monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec', + 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'], + monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze', + 'Lip','Sie','Wrz','Pa','Lis','Gru'], + dayNames: ['Niedziela','Poniedzialek','Wtorek','Środa','Czwartek','Piątek','Sobota'], + dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'], + dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'], + dateFormat: 'yy-mm-dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['pl']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-pt-BR.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-pt-BR.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-pt-BR.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-pt-BR.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Brazilian initialisation for the jQuery UI date picker plugin. */ -/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['pt-BR'] = { - clearText: 'Limpar', clearStatus: '', - closeText: 'Fechar', closeStatus: '', - prevText: '<Anterior', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Próximo>', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Hoje', currentStatus: '', - monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho', - 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], - monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun', - 'Jul','Ago','Set','Out','Nov','Dez'], - monthStatus: '', yearStatus: '', - weekHeader: 'Sm', weekStatus: '', - dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'], - dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'], - dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'dd/mm/yy', firstDay: 0, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['pt-BR']); +/* Brazilian initialisation for the jQuery UI date picker plugin. */ +/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pt-BR'] = { + closeText: 'Fechar', + prevText: '<Anterior', + nextText: 'Próximo>', + currentText: 'Hoje', + monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho', + 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], + monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Out','Nov','Dez'], + dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'], + dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'], + dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['pt-BR']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ro.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-ro.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ro.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ro.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,22 @@ -/* Romanian initialisation for the jQuery UI date picker plugin. */ -/* Written by Edmond L. (ll_edmond@walla.com). */ -jQuery(function($){ - $.datepicker.regional['ro'] = { - clearText: 'Curat', clearStatus: 'Sterge data curenta', - closeText: 'Inchide', closeStatus: 'Inchide fara schimbare', - prevText: '<Anterior', prevStatus: 'Arata luna trecuta', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Urmator>', nextStatus: 'Arata luna urmatoare', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Azi', currentStatus: 'Arata luna curenta', - monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Junie', - 'Julie','August','Septembrie','Octobrie','Noiembrie','Decembrie'], - monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Jun', - 'Jul', 'Aug', 'Sep', 'Oct', 'Noi', 'Dec'], - monthStatus: 'Arata o luna diferita', yearStatus: 'Arat un an diferit', - weekHeader: 'Sapt', weekStatus: 'Saptamana anului', - dayNames: ['Duminica', 'Luni', 'Marti', 'Miercuri', 'Joi', 'Vineri', 'Sambata'], - dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sam'], - dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sa'], - dayStatus: 'Seteaza DD ca prima saptamana zi', dateStatus: 'Selecteaza D, M d', - dateFormat: 'mm/dd/yy', firstDay: 0, - initStatus: 'Selecteaza o data', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['ro']); -}); +/* Romanian initialisation for the jQuery UI date picker plugin. + * + * Written by Edmond L. (ll_edmond@walla.com) + * and Ionut G. Stan (ionut.g.stan@gmail.com) + */ +jQuery(function($){ + $.datepicker.regional['ro'] = { + closeText: 'Închide', + prevText: '« Luna precedentă', + nextText: 'Luna următoare »', + currentText: 'Azi', + monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie', + 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'], + monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun', + 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'], + dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'], + dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'], + dateFormat: 'dd MM yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['ro']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ru.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-ru.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ru.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-ru.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */ -/* Written by Andrew Stromnov (stromnov@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['ru'] = { - clearText: 'Очистить', clearStatus: '', - closeText: 'Закрыть', closeStatus: '', - prevText: '<Пред', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'След>', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Сегодня', currentStatus: '', - monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь', - 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'], - monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн', - 'Июл','Авг','Сен','Окт','Ноя','Дек'], - monthStatus: '', yearStatus: '', - weekHeader: 'Не', weekStatus: '', - dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'], - dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'], - dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'dd.mm.yy', firstDay: 1, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['ru']); +/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Andrew Stromnov (stromnov@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ru'] = { + closeText: 'Закрыть', + prevText: '<Пред', + nextText: 'След>', + currentText: 'Сегодня', + monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь', + 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'], + monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн', + 'Июл','Авг','Сен','Окт','Ноя','Дек'], + dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'], + dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'], + dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['ru']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sk.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-sk.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sk.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sk.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Slovak initialisation for the jQuery UI date picker plugin. */ -/* Written by Vojtech Rinik (vojto@hmm.sk). */ -jQuery(function($){ - $.datepicker.regional['sk'] = { - clearText: 'Zmazať', clearStatus: '', - closeText: 'Zavrieť', closeStatus: '', - prevText: '<Predchádzajúci', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Nasledujúci>', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Dnes', currentStatus: '', - monthNames: ['Január','Február','Marec','Apríl','Máj','Jún', - 'Júl','August','September','Október','November','December'], - monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún', - 'Júl','Aug','Sep','Okt','Nov','Dec'], - monthStatus: '', yearStatus: '', - weekHeader: 'Ty', weekStatus: '', - dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'], - dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'], - dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'dd.mm.yy', firstDay: 0, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['sk']); -}); +/* Slovak initialisation for the jQuery UI date picker plugin. */ +/* Written by Vojtech Rinik (vojto@hmm.sk). */ +jQuery(function($){ + $.datepicker.regional['sk'] = { + closeText: 'Zavrieť', + prevText: '<Predchádzajúci', + nextText: 'Nasledujúci>', + currentText: 'Dnes', + monthNames: ['Január','Február','Marec','Apríl','Máj','Jún', + 'Júl','August','September','Október','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún', + 'Júl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'], + dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'], + dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'], + dateFormat: 'dd.mm.yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['sk']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sl.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-sl.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sl.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sl.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -2,22 +2,19 @@ /* Written by Jaka Jancar (jaka@kubje.org). */ /* c = č, s = š z = ž C = Č S = Š Z = Ž */ jQuery(function($){ - $.datepicker.regional['sl'] = {clearText: 'Izbriši', clearStatus: 'Izbriši trenutni datum', - closeText: 'Zapri', closeStatus: 'Zapri brez spreminjanja', - prevText: '<Prejšnji', prevStatus: 'Prikaži prejšnji mesec', - nextText: 'Naslednji>', nextStatus: 'Prikaži naslednji mesec', - currentText: 'Trenutni', currentStatus: 'Prikaži trenutni mesec', + $.datepicker.regional['sl'] = { + closeText: 'Zapri', + prevText: '<Prejšnji', + nextText: 'Naslednji>', + currentText: 'Trenutni', monthNames: ['Januar','Februar','Marec','April','Maj','Junij', 'Julij','Avgust','September','Oktober','November','December'], monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', 'Jul','Avg','Sep','Okt','Nov','Dec'], - monthStatus: 'Prikaži drug mesec', yearStatus: 'Prikaži drugo leto', - weekHeader: 'Teden', weekStatus: 'Teden v letu', dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'], dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'], dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'], - dayStatus: 'Nastavi DD za prvi dan v tednu', dateStatus: 'Izberi DD, d MM yy', - dateFormat: 'dd.mm.yy', firstDay: 1, - initStatus: 'Izbira datuma', isRTL: false}; + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; $.datepicker.setDefaults($.datepicker.regional['sl']); }); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sq.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-sq.js,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sq.js 1 Apr 2009 00:45:11 -0000 1.1 @@ -0,0 +1,19 @@ +/* Albanian initialisation for the jQuery UI date picker plugin. */ +/* Written by Flakron Bytyqi (flakron@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['sq'] = { + closeText: 'mbylle', + prevText: '<mbrapa', + nextText: 'Përpara>', + currentText: 'sot', + monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor', + 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'], + monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer', + 'Kor','Gus','Sht','Tet','Nën','Dhj'], + dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'], + dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'], + dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['sq']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sr-SR.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-sr-SR.js,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sr-SR.js 1 Apr 2009 00:45:12 -0000 1.1 @@ -0,0 +1,19 @@ +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr-SR'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Januar','Februar','Mart','April','Maj','Jun', + 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Avg','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['sr-SR']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sr.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-sr.js,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sr.js 1 Apr 2009 00:45:11 -0000 1.1 @@ -0,0 +1,19 @@ +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr'] = { + closeText: 'Затвори', + prevText: '<', + nextText: '>', + currentText: 'Данас', + monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун', + 'Јул','Август','Септембар','Октобар','Новембар','Децембар'], + monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун', + 'Јул','Авг','Сеп','Окт','Нов','Дец'], + dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'], + dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'], + dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'], + dateFormat: 'dd/mm/yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['sr']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sv.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-sv.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sv.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-sv.js 1 Apr 2009 00:45:12 -0000 1.2 @@ -1,25 +1,19 @@ -/* Swedish initialisation for the jQuery UI date picker plugin. */ -/* Written by Anders Ekdahl ( anders@nomadiz.se). */ -jQuery(function($){ - $.datepicker.regional['sv'] = { - clearText: 'Rensa', clearStatus: '', - closeText: 'Stäng', closeStatus: '', - prevText: '«Förra', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'Nästa»', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Idag', currentStatus: '', - monthNames: ['Januari','Februari','Mars','April','Maj','Juni', - 'Juli','Augusti','September','Oktober','November','December'], - monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', - 'Jul','Aug','Sep','Okt','Nov','Dec'], - monthStatus: '', yearStatus: '', - weekHeader: 'Ve', weekStatus: '', - dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'], - dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'], - dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'yy-mm-dd', firstDay: 1, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['sv']); -}); +/* Swedish initialisation for the jQuery UI date picker plugin. */ +/* Written by Anders Ekdahl ( anders@nomadiz.se). */ +jQuery(function($){ + $.datepicker.regional['sv'] = { + closeText: 'Stäng', + prevText: '«Förra', + nextText: 'Nästa»', + currentText: 'Idag', + monthNames: ['Januari','Februari','Mars','April','Maj','Juni', + 'Juli','Augusti','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'], + dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'], + dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'], + dateFormat: 'yy-mm-dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['sv']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-th.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-th.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-th.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-th.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Thai initialisation for the jQuery UI date picker plugin. */ -/* Written by pipo (pipo@sixhead.com). */ -jQuery(function($){ - $.datepicker.regional['th'] = { - clearText: 'ลบ', clearStatus: '', - closeText: 'ปิด', closeStatus: '', - prevText: '« ย้อน', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: 'ถัดไป »', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'วันนี้', currentStatus: '', - monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน', - 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'], - monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.', - 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'], - monthStatus: '', yearStatus: '', - weekHeader: 'Sm', weekStatus: '', - dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'], - dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], - dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'dd/mm/yy', firstDay: 0, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['th']); +/* Thai initialisation for the jQuery UI date picker plugin. */ +/* Written by pipo (pipo@sixhead.com). */ +jQuery(function($){ + $.datepicker.regional['th'] = { + closeText: 'ปิด', + prevText: '« ย้อน', + nextText: 'ถัดไป »', + currentText: 'วันนี้', + monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน', + 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'], + monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.', + 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'], + dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'], + dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + dateFormat: 'dd/mm/yy', firstDay: 0, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['th']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-tr.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-tr.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-tr.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-tr.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Turkish initialisation for the jQuery UI date picker plugin. */ -/* Written by Izzet Emre Erkan (kara@karalamalar.net). */ -jQuery(function($){ - $.datepicker.regional['tr'] = { - clearText: 'temizle', clearStatus: 'geçerli tarihi temizler', - closeText: 'kapat', closeStatus: 'sadece göstergeyi kapat', - prevText: '<geri', prevStatus: 'önceki ayı göster', - prevBigText: '<<', prevBigStatus: '', - nextText: 'ileri>', nextStatus: 'sonraki ayı göster', - nextBigText: '>>', nextBigStatus: '', - currentText: 'bugün', currentStatus: '', - monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran', - 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'], - monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz', - 'Tem','Ağu','Eyl','Eki','Kas','Ara'], - monthStatus: 'başka ay', yearStatus: 'başka yıl', - weekHeader: 'Hf', weekStatus: 'Ayın haftaları', - dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'], - dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], - dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], - dayStatus: 'Haftanın ilk gününü belirleyin', dateStatus: 'D, M d seçiniz', - dateFormat: 'dd.mm.yy', firstDay: 1, - initStatus: 'Bir tarih seçiniz', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['tr']); +/* Turkish initialisation for the jQuery UI date picker plugin. */ +/* Written by Izzet Emre Erkan (kara@karalamalar.net). */ +jQuery(function($){ + $.datepicker.regional['tr'] = { + closeText: 'kapat', + prevText: '<geri', + nextText: 'ileri>', + currentText: 'bugün', + monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran', + 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'], + monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz', + 'Tem','Ağu','Eyl','Eki','Kas','Ara'], + dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'], + dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + dateFormat: 'dd.mm.yy', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['tr']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-uk.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-uk.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-uk.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-uk.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,25 @@ -/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */ -/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['uk'] = { - clearText: 'Очистити', clearStatus: '', - closeText: 'Закрити', closeStatus: '', - prevText: '<', prevStatus: '', - prevBigText: '<<', prevBigStatus: '', - nextText: '>', nextStatus: '', - nextBigText: '>>', nextBigStatus: '', - currentText: 'Сьогодні', currentStatus: '', - monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень', - 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'], - monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер', - 'Лип','Сер','Вер','Жов','Лис','Гру'], - monthStatus: '', yearStatus: '', - weekHeader: 'Не', weekStatus: '', - dayNames: ['неділя','понеділок','вівторок','середа','четвер','пятниця','суббота'], - dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'], - dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'], - dayStatus: 'DD', dateStatus: 'D, M d', - dateFormat: 'dd.mm.yy', firstDay: 1, - initStatus: '', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['uk']); +/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['uk'] = { + clearText: 'Очистити', clearStatus: '', + closeText: 'Закрити', closeStatus: '', + prevText: '<', prevStatus: '', + prevBigText: '<<', prevBigStatus: '', + nextText: '>', nextStatus: '', + nextBigText: '>>', nextBigStatus: '', + currentText: 'Сьогодні', currentStatus: '', + monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень', + 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'], + monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер', + 'Лип','Сер','Вер','Жов','Лис','Гру'], + monthStatus: '', yearStatus: '', + weekHeader: 'Не', weekStatus: '', + dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'], + dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'], + dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'], + dayStatus: 'DD', dateStatus: 'D, M d', + dateFormat: 'dd/mm/yy', firstDay: 1, + initStatus: '', isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['uk']); }); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-zh-CN.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-zh-CN.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-zh-CN.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-zh-CN.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Chinese initialisation for the jQuery UI date picker plugin. */ -/* Written by Cloudream (cloudream@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['zh-CN'] = { - clearText: '清除', clearStatus: '清除已选日期', - closeText: '关闭', closeStatus: '不改变当前选择', - prevText: '<上月', prevStatus: '显示上月', - prevBigText: '<<', prevBigStatus: '显示上一年', - nextText: '下月>', nextStatus: '显示下月', - nextBigText: '>>', nextBigStatus: '显示下一年', - currentText: '今天', currentStatus: '显示本月', - monthNames: ['一月','二月','三月','四月','五月','六月', - '七月','八月','九月','十月','十一月','十二月'], - monthNamesShort: ['一','二','三','四','五','六', - '七','八','九','十','十一','十二'], - monthStatus: '选择月份', yearStatus: '选择年份', - weekHeader: '周', weekStatus: '年内周次', - dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], - dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], - dayNamesMin: ['日','一','二','三','四','五','六'], - dayStatus: '设置 DD 为一周起始', dateStatus: '选择 m月 d日, DD', - dateFormat: 'yy-mm-dd', firstDay: 1, - initStatus: '请选择日期', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['zh-CN']); -}); +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Cloudream (cloudream@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-CN'] = { + closeText: '关闭', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + dateFormat: 'yy-mm-dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['zh-CN']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-zh-TW.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/i18n/Attic/ui.datepicker-zh-TW.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-zh-TW.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/i18n/ui.datepicker-zh-TW.js 1 Apr 2009 00:45:11 -0000 1.2 @@ -1,25 +1,19 @@ -/* Chinese initialisation for the jQuery UI date picker plugin. */ -/* Written by Ressol (ressol@gmail.com). */ -jQuery(function($){ - $.datepicker.regional['zh-TW'] = { - clearText: '清除', clearStatus: '清除已選日期', - closeText: '關閉', closeStatus: '不改變目前的選擇', - prevText: '<上月', prevStatus: '顯示上月', - prevBigText: '<<', prevBigStatus: '顯示上一年', - nextText: '下月>', nextStatus: '顯示下月', - nextBigText: '>>', nextBigStatus: '顯示下一年', - currentText: '今天', currentStatus: '顯示本月', - monthNames: ['一月','二月','三月','四月','五月','六月', - '七月','八月','九月','十月','十一月','十二月'], - monthNamesShort: ['一','二','三','四','五','六', - '七','八','九','十','十一','十二'], - monthStatus: '選擇月份', yearStatus: '選擇年份', - weekHeader: '周', weekStatus: '年內周次', - dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], - dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], - dayNamesMin: ['日','一','二','三','四','五','六'], - dayStatus: '設定 DD 為一周起始', dateStatus: '選擇 m月 d日, DD', - dateFormat: 'yy/mm/dd', firstDay: 1, - initStatus: '請選擇日期', isRTL: false}; - $.datepicker.setDefaults($.datepicker.regional['zh-TW']); -}); +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Ressol (ressol@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-TW'] = { + closeText: '關閉', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一','二','三','四','五','六', + '七','八','九','十','十一','十二'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + dateFormat: 'yy/mm/dd', firstDay: 1, + isRTL: false}; + $.datepicker.setDefaults($.datepicker.regional['zh-TW']); +}); Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.blind.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/effects.blind.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.blind.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.blind.min.js 1 Apr 2009 00:45:13 -0000 1.2 @@ -1 +1,13 @@ -(function(A){A.effects.blind=function(B){return this.queue(function(){var D=A(this),C=["position","top","left"];var H=A.effects.setMode(D,B.options.mode||"hide");var G=B.options.direction||"vertical";A.effects.save(D,C);D.show();var J=A.effects.createWrapper(D).css({overflow:"hidden"});var E=(G=="vertical")?"height":"width";var I=(G=="vertical")?J.height():J.width();if(H=="show"){J.css(E,0)}var F={};F[E]=H=="show"?I:0;J.animate(F,B.duration,B.options.easing,function(){if(H=="hide"){D.hide()}A.effects.restore(D,C);A.effects.removeWrapper(D);if(B.callback){B.callback.apply(D[0],arguments)}D.dequeue()})})}})(jQuery) \ No newline at end of file +/* + * jQuery UI Effects Blind 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * effects.core.js + */ +(function(a){a.effects.blind=function(b){return this.queue(function(){var d=a(this),c=["position","top","left"];var h=a.effects.setMode(d,b.options.mode||"hide");var g=b.options.direction||"vertical";a.effects.save(d,c);d.show();var j=a.effects.createWrapper(d).css({overflow:"hidden"});var e=(g=="vertical")?"height":"width";var i=(g=="vertical")?j.height():j.width();if(h=="show"){j.css(e,0)}var f={};f[e]=h=="show"?i:0;j.animate(f,b.duration,b.options.easing,function(){if(h=="hide"){d.hide()}a.effects.restore(d,c);a.effects.removeWrapper(d);if(b.callback){b.callback.apply(d[0],arguments)}d.dequeue()})})}})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.bounce.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/effects.bounce.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.bounce.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.bounce.min.js 1 Apr 2009 00:45:13 -0000 1.2 @@ -1 +1,13 @@ -(function(A){A.effects.bounce=function(B){return this.queue(function(){var E=A(this),K=["position","top","left"];var J=A.effects.setMode(E,B.options.mode||"effect");var M=B.options.direction||"up";var C=B.options.distance||20;var D=B.options.times||5;var G=B.duration||250;if(/show|hide/.test(J)){K.push("opacity")}A.effects.save(E,K);E.show();A.effects.createWrapper(E);var F=(M=="up"||M=="down")?"top":"left";var O=(M=="up"||M=="left")?"pos":"neg";var C=B.options.distance||(F=="top"?E.outerHeight({margin:true})/3:E.outerWidth({margin:true})/3);if(J=="show"){E.css("opacity",0).css(F,O=="pos"?-C:C)}if(J=="hide"){C=C/(D*2)}if(J!="hide"){D--}if(J=="show"){var H={opacity:1};H[F]=(O=="pos"?"+=":"-=")+C;E.animate(H,G/2,B.options.easing);C=C/2;D--}for(var I=0;I
    ');var I=F.parent();if(F.css("position")=="static"){I.css({position:"relative"});F.css({position:"relative"})}else{var H=F.css("top");if(isNaN(parseInt(H))){H="auto"}var G=F.css("left");if(isNaN(parseInt(G))){G="auto"}I.css({position:F.css("position"),top:H,left:G,zIndex:F.css("z-index")}).show();F.css({position:"relative",top:0,left:0})}I.css(E);return I},removeWrapper:function(E){if(E.parent().attr("id")=="fxWrapper"){return E.parent().replaceWith(E)}return E},setTransition:function(F,G,E,H){H=H||{};C.each(G,function(J,I){unit=F.cssUnit(I);if(unit[0]>0){H[I]=unit[0]*E+unit[1]}});return H},animateClass:function(G,H,J,I){var E=(typeof J=="function"?J:(I?I:null));var F=(typeof J=="object"?J:null);return this.each(function(){var O={};var M=C(this);var N=M.attr("style")||"";if(typeof N=="object"){N=N["cssText"]}if(G.toggle){M.hasClass(G.toggle)?G.remove=G.toggle:G.add=G.toggle}var K=C.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(G.add){M.addClass(G.add)}if(G.remove){M.removeClass(G.remove)}var L=C.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(G.add){M.removeClass(G.add)}if(G.remove){M.addClass(G.remove)}for(var P in L){if(typeof L[P]!="function"&&L[P]&&P.indexOf("Moz")==-1&&P.indexOf("length")==-1&&L[P]!=K[P]&&(P.match(/color/i)||(!P.match(/color/i)&&!isNaN(parseInt(L[P],10))))&&(K.position!="static"||(K.position=="static"&&!P.match(/left|top|bottom|right/)))){O[P]=L[P]}}M.animate(O,H,F,function(){if(typeof C(this).attr("style")=="object"){C(this).attr("style")["cssText"]="";C(this).attr("style")["cssText"]=N}else{C(this).attr("style",N)}if(G.add){C(this).addClass(G.add)}if(G.remove){C(this).removeClass(G.remove)}if(E){E.apply(this,arguments)}})})}});C.fn.extend({_show:C.fn.show,_hide:C.fn.hide,__toggle:C.fn.toggle,_addClass:C.fn.addClass,_removeClass:C.fn.removeClass,_toggleClass:C.fn.toggleClass,effect:function(E,G,F,H){return C.effects[E]?C.effects[E].call(this,{method:E,options:G||{},duration:F,callback:H}):null},show:function(){if(!arguments[0]||(arguments[0].constructor==Number||/(slow|normal|fast)/.test(arguments[0]))){return this._show.apply(this,arguments)}else{var E=arguments[1]||{};E["mode"]="show";return this.effect.apply(this,[arguments[0],E,arguments[2]||E.duration,arguments[3]||E.callback])}},hide:function(){if(!arguments[0]||(arguments[0].constructor==Number||/(slow|normal|fast)/.test(arguments[0]))){return this._hide.apply(this,arguments)}else{var E=arguments[1]||{};E["mode"]="hide";return this.effect.apply(this,[arguments[0],E,arguments[2]||E.duration,arguments[3]||E.callback])}},toggle:function(){if(!arguments[0]||(arguments[0].constructor==Number||/(slow|normal|fast)/.test(arguments[0]))||(arguments[0].constructor==Function)){return this.__toggle.apply(this,arguments)}else{var E=arguments[1]||{};E["mode"]="toggle";return this.effect.apply(this,[arguments[0],E,arguments[2]||E.duration,arguments[3]||E.callback])}},addClass:function(F,E,H,G){return E?C.effects.animateClass.apply(this,[{add:F},E,H,G]):this._addClass(F)},removeClass:function(F,E,H,G){return E?C.effects.animateClass.apply(this,[{remove:F},E,H,G]):this._removeClass(F)},toggleClass:function(F,E,H,G){return E?C.effects.animateClass.apply(this,[{toggle:F},E,H,G]):this._toggleClass(F)},morph:function(E,G,F,I,H){return C.effects.animateClass.apply(this,[{add:G,remove:E},F,I,H])},switchClass:function(){return this.morph.apply(this,arguments)},cssUnit:function(E){var F=this.css(E),G=[];C.each(["em","px","%","pt"],function(H,I){if(F.indexOf(I)>0){G=[parseFloat(F),I]}});return G}});jQuery.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(F,E){jQuery.fx.step[E]=function(G){if(G.state==0){G.start=D(G.elem,E);G.end=B(G.end)}G.elem.style[E]="rgb("+[Math.max(Math.min(parseInt((G.pos*(G.end[0]-G.start[0]))+G.start[0]),255),0),Math.max(Math.min(parseInt((G.pos*(G.end[1]-G.start[1]))+G.start[1]),255),0),Math.max(Math.min(parseInt((G.pos*(G.end[2]-G.start[2]))+G.start[2]),255),0)].join(",")+")"}});function B(F){var E;if(F&&F.constructor==Array&&F.length==3){return F}if(E=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(F)){return[parseInt(E[1]),parseInt(E[2]),parseInt(E[3])]}if(E=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(F)){return[parseFloat(E[1])*2.55,parseFloat(E[2])*2.55,parseFloat(E[3])*2.55]}if(E=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(F)){return[parseInt(E[1],16),parseInt(E[2],16),parseInt(E[3],16)]}if(E=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(F)){return[parseInt(E[1]+E[1],16),parseInt(E[2]+E[2],16),parseInt(E[3]+E[3],16)]}if(E=/rgba\(0, 0, 0, 0\)/.exec(F)){return A["transparent"]}return A[jQuery.trim(F).toLowerCase()]}function D(G,E){var F;do{F=jQuery.curCSS(G,E);if(F!=""&&F!="transparent"||jQuery.nodeName(G,"body")){break}E="backgroundColor"}while(G=G.parentNode);return B(F)}var A={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};jQuery.easing["jswing"]=jQuery.easing["swing"];jQuery.extend(jQuery.easing,{def:"easeOutQuad",swing:function(F,G,E,I,H){return jQuery.easing[jQuery.easing.def](F,G,E,I,H)},easeInQuad:function(F,G,E,I,H){return I*(G/=H)*G+E},easeOutQuad:function(F,G,E,I,H){return -I*(G/=H)*(G-2)+E},easeInOutQuad:function(F,G,E,I,H){if((G/=H/2)<1){return I/2*G*G+E}return -I/2*((--G)*(G-2)-1)+E},easeInCubic:function(F,G,E,I,H){return I*(G/=H)*G*G+E},easeOutCubic:function(F,G,E,I,H){return I*((G=G/H-1)*G*G+1)+E},easeInOutCubic:function(F,G,E,I,H){if((G/=H/2)<1){return I/2*G*G*G+E}return I/2*((G-=2)*G*G+2)+E},easeInQuart:function(F,G,E,I,H){return I*(G/=H)*G*G*G+E},easeOutQuart:function(F,G,E,I,H){return -I*((G=G/H-1)*G*G*G-1)+E},easeInOutQuart:function(F,G,E,I,H){if((G/=H/2)<1){return I/2*G*G*G*G+E}return -I/2*((G-=2)*G*G*G-2)+E},easeInQuint:function(F,G,E,I,H){return I*(G/=H)*G*G*G*G+E},easeOutQuint:function(F,G,E,I,H){return I*((G=G/H-1)*G*G*G*G+1)+E},easeInOutQuint:function(F,G,E,I,H){if((G/=H/2)<1){return I/2*G*G*G*G*G+E}return I/2*((G-=2)*G*G*G*G+2)+E},easeInSine:function(F,G,E,I,H){return -I*Math.cos(G/H*(Math.PI/2))+I+E},easeOutSine:function(F,G,E,I,H){return I*Math.sin(G/H*(Math.PI/2))+E},easeInOutSine:function(F,G,E,I,H){return -I/2*(Math.cos(Math.PI*G/H)-1)+E},easeInExpo:function(F,G,E,I,H){return(G==0)?E:I*Math.pow(2,10*(G/H-1))+E},easeOutExpo:function(F,G,E,I,H){return(G==H)?E+I:I*(-Math.pow(2,-10*G/H)+1)+E},easeInOutExpo:function(F,G,E,I,H){if(G==0){return E}if(G==H){return E+I}if((G/=H/2)<1){return I/2*Math.pow(2,10*(G-1))+E}return I/2*(-Math.pow(2,-10*--G)+2)+E},easeInCirc:function(F,G,E,I,H){return -I*(Math.sqrt(1-(G/=H)*G)-1)+E},easeOutCirc:function(F,G,E,I,H){return I*Math.sqrt(1-(G=G/H-1)*G)+E},easeInOutCirc:function(F,G,E,I,H){if((G/=H/2)<1){return -I/2*(Math.sqrt(1-G*G)-1)+E}return I/2*(Math.sqrt(1-(G-=2)*G)+1)+E},easeInElastic:function(F,H,E,L,K){var I=1.70158;var J=0;var G=L;if(H==0){return E}if((H/=K)==1){return E+L}if(!J){J=K*0.3}if(G
    ');var j=f.parent();if(f.css("position")=="static"){j.css({position:"relative"});f.css({position:"relative"})}else{var i=f.css("top");if(isNaN(parseInt(i,10))){i="auto"}var h=f.css("left");if(isNaN(parseInt(h,10))){h="auto"}j.css({position:f.css("position"),top:i,left:h,zIndex:f.css("z-index")}).show();f.css({position:"relative",top:0,left:0})}j.css(g);return j},removeWrapper:function(f){if(f.parent().is(".ui-effects-wrapper")){return f.parent().replaceWith(f)}return f},setTransition:function(g,i,f,h){h=h||{};d.each(i,function(k,j){unit=g.cssUnit(j);if(unit[0]>0){h[j]=unit[0]*f+unit[1]}});return h},animateClass:function(h,i,k,j){var f=(typeof k=="function"?k:(j?j:null));var g=(typeof k=="string"?k:null);return this.each(function(){var q={};var o=d(this);var p=o.attr("style")||"";if(typeof p=="object"){p=p.cssText}if(h.toggle){o.hasClass(h.toggle)?h.remove=h.toggle:h.add=h.toggle}var l=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.addClass(h.add)}if(h.remove){o.removeClass(h.remove)}var m=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.removeClass(h.add)}if(h.remove){o.addClass(h.remove)}for(var r in m){if(typeof m[r]!="function"&&m[r]&&r.indexOf("Moz")==-1&&r.indexOf("length")==-1&&m[r]!=l[r]&&(r.match(/color/i)||(!r.match(/color/i)&&!isNaN(parseInt(m[r],10))))&&(l.position!="static"||(l.position=="static"&&!r.match(/left|top|bottom|right/)))){q[r]=m[r]}}o.animate(q,i,g,function(){if(typeof d(this).attr("style")=="object"){d(this).attr("style")["cssText"]="";d(this).attr("style")["cssText"]=p}else{d(this).attr("style",p)}if(h.add){d(this).addClass(h.add)}if(h.remove){d(this).removeClass(h.remove)}if(f){f.apply(this,arguments)}})})}};function c(g,f){var i=g[1]&&g[1].constructor==Object?g[1]:{};if(f){i.mode=f}var h=g[1]&&g[1].constructor!=Object?g[1]:(i.duration?i.duration:g[2]);h=d.fx.off?0:typeof h==="number"?h:d.fx.speeds[h]||d.fx.speeds._default;var j=i.callback||(d.isFunction(g[1])&&g[1])||(d.isFunction(g[2])&&g[2])||(d.isFunction(g[3])&&g[3]);return[g[0],i,h,j]}d.fn.extend({_show:d.fn.show,_hide:d.fn.hide,__toggle:d.fn.toggle,_addClass:d.fn.addClass,_removeClass:d.fn.removeClass,_toggleClass:d.fn.toggleClass,effect:function(g,f,h,i){return d.effects[g]?d.effects[g].call(this,{method:g,options:f||{},duration:h,callback:i}):null},show:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._show.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"show"))}},hide:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._hide.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"hide"))}},toggle:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))||(arguments[0].constructor==Function)){return this.__toggle.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"toggle"))}},addClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{add:g},f,i,h]):this._addClass(g)},removeClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{remove:g},f,i,h]):this._removeClass(g)},toggleClass:function(g,f,i,h){return((typeof f!=="boolean")&&f)?d.effects.animateClass.apply(this,[{toggle:g},f,i,h]):this._toggleClass(g,f)},morph:function(f,h,g,j,i){return d.effects.animateClass.apply(this,[{add:h,remove:f},g,j,i])},switchClass:function(){return this.morph.apply(this,arguments)},cssUnit:function(f){var g=this.css(f),h=[];d.each(["em","px","%","pt"],function(j,k){if(g.indexOf(k)>0){h=[parseFloat(g),k]}});return h}});d.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(g,f){d.fx.step[f]=function(h){if(h.state==0){h.start=e(h.elem,f);h.end=b(h.end)}h.elem.style[f]="rgb("+[Math.max(Math.min(parseInt((h.pos*(h.end[0]-h.start[0]))+h.start[0],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[1]-h.start[1]))+h.start[1],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[2]-h.start[2]))+h.start[2],10),255),0)].join(",")+")"}});function b(g){var f;if(g&&g.constructor==Array&&g.length==3){return g}if(f=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(g)){return[parseInt(f[1],10),parseInt(f[2],10),parseInt(f[3],10)]}if(f=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(g)){return[parseFloat(f[1])*2.55,parseFloat(f[2])*2.55,parseFloat(f[3])*2.55]}if(f=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(g)){return[parseInt(f[1],16),parseInt(f[2],16),parseInt(f[3],16)]}if(f=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(g)){return[parseInt(f[1]+f[1],16),parseInt(f[2]+f[2],16),parseInt(f[3]+f[3],16)]}if(f=/rgba\(0, 0, 0, 0\)/.exec(g)){return a.transparent}return a[d.trim(g).toLowerCase()]}function e(h,f){var g;do{g=d.curCSS(h,f);if(g!=""&&g!="transparent"||d.nodeName(h,"body")){break}f="backgroundColor"}while(h=h.parentNode);return b(g)}var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};d.easing.jswing=d.easing.swing;d.extend(d.easing,{def:"easeOutQuad",swing:function(g,h,f,j,i){return d.easing[d.easing.def](g,h,f,j,i)},easeInQuad:function(g,h,f,j,i){return j*(h/=i)*h+f},easeOutQuad:function(g,h,f,j,i){return -j*(h/=i)*(h-2)+f},easeInOutQuad:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h+f}return -j/2*((--h)*(h-2)-1)+f},easeInCubic:function(g,h,f,j,i){return j*(h/=i)*h*h+f},easeOutCubic:function(g,h,f,j,i){return j*((h=h/i-1)*h*h+1)+f},easeInOutCubic:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h+f}return j/2*((h-=2)*h*h+2)+f},easeInQuart:function(g,h,f,j,i){return j*(h/=i)*h*h*h+f},easeOutQuart:function(g,h,f,j,i){return -j*((h=h/i-1)*h*h*h-1)+f},easeInOutQuart:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h+f}return -j/2*((h-=2)*h*h*h-2)+f},easeInQuint:function(g,h,f,j,i){return j*(h/=i)*h*h*h*h+f},easeOutQuint:function(g,h,f,j,i){return j*((h=h/i-1)*h*h*h*h+1)+f},easeInOutQuint:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h*h+f}return j/2*((h-=2)*h*h*h*h+2)+f},easeInSine:function(g,h,f,j,i){return -j*Math.cos(h/i*(Math.PI/2))+j+f},easeOutSine:function(g,h,f,j,i){return j*Math.sin(h/i*(Math.PI/2))+f},easeInOutSine:function(g,h,f,j,i){return -j/2*(Math.cos(Math.PI*h/i)-1)+f},easeInExpo:function(g,h,f,j,i){return(h==0)?f:j*Math.pow(2,10*(h/i-1))+f},easeOutExpo:function(g,h,f,j,i){return(h==i)?f+j:j*(-Math.pow(2,-10*h/i)+1)+f},easeInOutExpo:function(g,h,f,j,i){if(h==0){return f}if(h==i){return f+j}if((h/=i/2)<1){return j/2*Math.pow(2,10*(h-1))+f}return j/2*(-Math.pow(2,-10*--h)+2)+f},easeInCirc:function(g,h,f,j,i){return -j*(Math.sqrt(1-(h/=i)*h)-1)+f},easeOutCirc:function(g,h,f,j,i){return j*Math.sqrt(1-(h=h/i-1)*h)+f},easeInOutCirc:function(g,h,f,j,i){if((h/=i/2)<1){return -j/2*(Math.sqrt(1-h*h)-1)+f}return j/2*(Math.sqrt(1-(h-=2)*h)+1)+f},easeInElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l)==1){return f+m}if(!k){k=l*0.3}if(h
    ").css({position:"absolute",visibility:"visible",left:-D*(G/E),top:-F*(C/I)}).parent().addClass("effects-explode").css({position:"absolute",overflow:"hidden",width:G/E,height:C/I,left:J.left+D*(G/E)+(B.options.mode=="show"?(D-Math.floor(E/2))*(G/E):0),top:J.top+F*(C/I)+(B.options.mode=="show"?(F-Math.floor(I/2))*(C/I):0),opacity:B.options.mode=="show"?0:1}).animate({left:J.left+D*(G/E)+(B.options.mode=="show"?0:(D-Math.floor(E/2))*(G/E)),top:J.top+F*(C/I)+(B.options.mode=="show"?0:(F-Math.floor(I/2))*(C/I)),opacity:B.options.mode=="show"?1:0},B.duration||500)}}setTimeout(function(){B.options.mode=="show"?H.css({visibility:"visible"}):H.css({visibility:"visible"}).hide();if(B.callback){B.callback.apply(H[0])}H.dequeue();A(".effects-explode").remove()},B.duration||500)})}})(jQuery) \ No newline at end of file +/* + * jQuery UI Effects Explode 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * effects.core.js + */ +(function(a){a.effects.explode=function(b){return this.queue(function(){var k=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;var e=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;b.options.mode=b.options.mode=="toggle"?(a(this).is(":visible")?"hide":"show"):b.options.mode;var h=a(this).show().css("visibility","hidden");var l=h.offset();l.top-=parseInt(h.css("marginTop"),10)||0;l.left-=parseInt(h.css("marginLeft"),10)||0;var g=h.outerWidth(true);var c=h.outerHeight(true);for(var f=0;f
    ").css({position:"absolute",visibility:"visible",left:-d*(g/e),top:-f*(c/k)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/e,height:c/k,left:l.left+d*(g/e)+(b.options.mode=="show"?(d-Math.floor(e/2))*(g/e):0),top:l.top+f*(c/k)+(b.options.mode=="show"?(f-Math.floor(k/2))*(c/k):0),opacity:b.options.mode=="show"?0:1}).animate({left:l.left+d*(g/e)+(b.options.mode=="show"?0:(d-Math.floor(e/2))*(g/e)),top:l.top+f*(c/k)+(b.options.mode=="show"?0:(f-Math.floor(k/2))*(c/k)),opacity:b.options.mode=="show"?1:0},b.duration||500)}}setTimeout(function(){b.options.mode=="show"?h.css({visibility:"visible"}):h.css({visibility:"visible"}).hide();if(b.callback){b.callback.apply(h[0])}h.dequeue();a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.fold.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/effects.fold.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.fold.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.fold.min.js 1 Apr 2009 00:45:13 -0000 1.2 @@ -1 +1,13 @@ -(function(A){A.effects.fold=function(B){return this.queue(function(){var E=A(this),J=["position","top","left"];var G=A.effects.setMode(E,B.options.mode||"hide");var N=B.options.size||15;var M=!(!B.options.horizFirst);A.effects.save(E,J);E.show();var D=A.effects.createWrapper(E).css({overflow:"hidden"});var H=((G=="show")!=M);var F=H?["width","height"]:["height","width"];var C=H?[D.width(),D.height()]:[D.height(),D.width()];var I=/([0-9]+)%/.exec(N);if(I){N=parseInt(I[1])/100*C[G=="hide"?0:1]}if(G=="show"){D.css(M?{height:0,width:N}:{height:N,width:0})}var L={},K={};L[F[0]]=G=="show"?C[0]:N;K[F[1]]=G=="show"?C[1]:0;D.animate(L,B.duration/2,B.options.easing).animate(K,B.duration/2,B.options.easing,function(){if(G=="hide"){E.hide()}A.effects.restore(E,J);A.effects.removeWrapper(E);if(B.callback){B.callback.apply(E[0],arguments)}E.dequeue()})})}})(jQuery) \ No newline at end of file +/* + * jQuery UI Effects Fold 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * effects.core.js + */ +(function(a){a.effects.fold=function(b){return this.queue(function(){var e=a(this),k=["position","top","left"];var h=a.effects.setMode(e,b.options.mode||"hide");var o=b.options.size||15;var n=!(!b.options.horizFirst);var g=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(e,k);e.show();var d=a.effects.createWrapper(e).css({overflow:"hidden"});var i=((h=="show")!=n);var f=i?["width","height"]:["height","width"];var c=i?[d.width(),d.height()]:[d.height(),d.width()];var j=/([0-9]+)%/.exec(o);if(j){o=parseInt(j[1],10)/100*c[h=="hide"?0:1]}if(h=="show"){d.css(n?{height:0,width:o}:{height:o,width:0})}var m={},l={};m[f[0]]=h=="show"?c[0]:o;l[f[1]]=h=="show"?c[1]:0;d.animate(m,g,b.options.easing).animate(l,g,b.options.easing,function(){if(h=="hide"){e.hide()}a.effects.restore(e,k);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.highlight.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/effects.highlight.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.highlight.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.highlight.min.js 1 Apr 2009 00:45:13 -0000 1.2 @@ -1 +1,13 @@ -(function(A){A.effects.highlight=function(B){return this.queue(function(){var E=A(this),D=["backgroundImage","backgroundColor","opacity"];var H=A.effects.setMode(E,B.options.mode||"show");var C=B.options.color||"#ffff99";var G=E.css("backgroundColor");A.effects.save(E,D);E.show();E.css({backgroundImage:"none",backgroundColor:C});var F={backgroundColor:G};if(H=="hide"){F["opacity"]=0}E.animate(F,{queue:false,duration:B.duration,easing:B.options.easing,complete:function(){if(H=="hide"){E.hide()}A.effects.restore(E,D);if(H=="show"&&jQuery.browser.msie){this.style.removeAttribute("filter")}if(B.callback){B.callback.apply(this,arguments)}E.dequeue()}})})}})(jQuery) \ No newline at end of file +/* + * jQuery UI Effects Highlight 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * effects.core.js + */ +(function(a){a.effects.highlight=function(b){return this.queue(function(){var e=a(this),d=["backgroundImage","backgroundColor","opacity"];var h=a.effects.setMode(e,b.options.mode||"show");var c=b.options.color||"#ffff99";var g=e.css("backgroundColor");a.effects.save(e,d);e.show();e.css({backgroundImage:"none",backgroundColor:c});var f={backgroundColor:g};if(h=="hide"){f.opacity=0}e.animate(f,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(h=="hide"){e.hide()}a.effects.restore(e,d);if(h=="show"&&a.browser.msie){this.style.removeAttribute("filter")}if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.pulsate.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/effects.pulsate.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.pulsate.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/effects.pulsate.min.js 1 Apr 2009 00:45:13 -0000 1.2 @@ -1 +1,13 @@ -(function(A){A.effects.pulsate=function(B){return this.queue(function(){var D=A(this);var F=A.effects.setMode(D,B.options.mode||"show");var E=B.options.times||5;if(F=="hide"){E--}if(D.is(":hidden")){D.css("opacity",0);D.show();D.animate({opacity:1},B.duration/2,B.options.easing);E=E-2}for(var C=0;C
    ').appendTo(document.body);if(B.options.className){D.addClass(B.options.className)}D.addClass(B.options.className);D.css({top:C.top,left:C.left,height:E.outerHeight()-parseInt(D.css("borderTopWidth"))-parseInt(D.css("borderBottomWidth")),width:E.outerWidth()-parseInt(D.css("borderLeftWidth"))-parseInt(D.css("borderRightWidth")),position:"absolute"});C=F.offset();animation={top:C.top,left:C.left,height:F.outerHeight()-parseInt(D.css("borderTopWidth"))-parseInt(D.css("borderBottomWidth")),width:F.outerWidth()-parseInt(D.css("borderLeftWidth"))-parseInt(D.css("borderRightWidth"))};D.animate(animation,B.duration,B.options.easing,function(){D.remove();if(B.callback){B.callback.apply(E[0],arguments)}E.dequeue()})})}})(jQuery) \ No newline at end of file +/* + * jQuery UI Effects Transfer 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * effects.core.js + */ +(function(a){a.effects.transfer=function(b){return this.queue(function(){var f=a(this),h=a(b.options.to),e=h.offset(),g={top:e.top,left:e.left,height:h.innerHeight(),width:h.innerWidth()},d=f.offset(),c=a('
    ').appendTo(document.body).addClass(b.options.className).css({top:d.top,left:d.left,height:f.innerHeight(),width:f.innerWidth(),position:"absolute"}).animate(g,b.duration,b.options.easing,function(){c.remove();(b.callback&&b.callback.apply(f[0],arguments));f.dequeue()})})}})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/jquery-ui.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/jquery-ui.min.js,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/jquery-ui.min.js 1 Apr 2009 00:45:13 -0000 1.1 @@ -0,0 +1,10 @@ +/* + * jQuery UI 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI + */ +jQuery.ui||(function(c){var i=c.fn.remove,d=c.browser.mozilla&&(parseFloat(c.browser.version)<1.9);c.ui={version:"1.7.1",plugin:{add:function(k,l,n){var m=c.ui[k].prototype;for(var j in n){m.plugins[j]=m.plugins[j]||[];m.plugins[j].push([l,n[j]])}},call:function(j,l,k){var n=j.plugins[l];if(!n||!j.element[0].parentNode){return}for(var m=0;m0){return true}m[j]=1;l=(m[j]>0);m[j]=0;return l},isOverAxis:function(k,j,l){return(k>j)&&(k<(j+l))},isOver:function(o,k,n,m,j,l){return c.ui.isOverAxis(o,n,j)&&c.ui.isOverAxis(k,m,l)},keyCode:{BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38}};if(d){var f=c.attr,e=c.fn.removeAttr,h="http://www.w3.org/2005/07/aaa",a=/^aria-/,b=/^wairole:/;c.attr=function(k,j,l){var m=l!==undefined;return(j=="role"?(m?f.call(this,k,j,"wairole:"+l):(f.apply(this,arguments)||"").replace(b,"")):(a.test(j)?(m?k.setAttributeNS(h,j.replace(a,"aaa:"),l):f.call(this,k,j.replace(a,"aaa:"))):f.apply(this,arguments)))};c.fn.removeAttr=function(j){return(a.test(j)?this.each(function(){this.removeAttributeNS(h,j.replace(a,""))}):e.call(this,j))}}c.fn.extend({remove:function(){c("*",this).add(this).each(function(){c(this).triggerHandler("remove")});return i.apply(this,arguments)},enableSelection:function(){return this.attr("unselectable","off").css("MozUserSelect","").unbind("selectstart.ui")},disableSelection:function(){return this.attr("unselectable","on").css("MozUserSelect","none").bind("selectstart.ui",function(){return false})},scrollParent:function(){var j;if((c.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){j=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(c.curCSS(this,"position",1))&&(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}else{j=this.parents().filter(function(){return(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!j.length?c(document):j}});c.extend(c.expr[":"],{data:function(l,k,j){return !!c.data(l,j[3])},focusable:function(k){var l=k.nodeName.toLowerCase(),j=c.attr(k,"tabindex");return(/input|select|textarea|button|object/.test(l)?!k.disabled:"a"==l||"area"==l?k.href||!isNaN(j):!isNaN(j))&&!c(k)["area"==l?"parents":"closest"](":hidden").length},tabbable:function(k){var j=c.attr(k,"tabindex");return(isNaN(j)||j>=0)&&c(k).is(":focusable")}});function g(m,n,o,l){function k(q){var p=c[m][n][q]||[];return(typeof p=="string"?p.split(/,?\s+/):p)}var j=k("getter");if(l.length==1&&typeof l[0]=="string"){j=j.concat(k("getterSetter"))}return(c.inArray(o,j)!=-1)}c.widget=function(k,j){var l=k.split(".")[0];k=k.split(".")[1];c.fn[k]=function(p){var n=(typeof p=="string"),o=Array.prototype.slice.call(arguments,1);if(n&&p.substring(0,1)=="_"){return this}if(n&&g(l,k,p,o)){var m=c.data(this[0],k);return(m?m[p].apply(m,o):undefined)}return this.each(function(){var q=c.data(this,k);(!q&&!n&&c.data(this,k,new c[l][k](this,p))._init());(q&&n&&c.isFunction(q[p])&&q[p].apply(q,o))})};c[l]=c[l]||{};c[l][k]=function(o,n){var m=this;this.namespace=l;this.widgetName=k;this.widgetEventPrefix=c[l][k].eventPrefix||k;this.widgetBaseClass=l+"-"+k;this.options=c.extend({},c.widget.defaults,c[l][k].defaults,c.metadata&&c.metadata.get(o)[k],n);this.element=c(o).bind("setData."+k,function(q,p,r){if(q.target==o){return m._setData(p,r)}}).bind("getData."+k,function(q,p){if(q.target==o){return m._getData(p)}}).bind("remove",function(){return m.destroy()})};c[l][k].prototype=c.extend({},c.widget.prototype,j);c[l][k].getterSetter="option"};c.widget.prototype={_init:function(){},destroy:function(){this.element.removeData(this.widgetName).removeClass(this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").removeAttr("aria-disabled")},option:function(l,m){var k=l,j=this;if(typeof l=="string"){if(m===undefined){return this._getData(l)}k={};k[l]=m}c.each(k,function(n,o){j._setData(n,o)})},_getData:function(j){return this.options[j]},_setData:function(j,k){this.options[j]=k;if(j=="disabled"){this.element[k?"addClass":"removeClass"](this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").attr("aria-disabled",k)}},enable:function(){this._setData("disabled",false)},disable:function(){this._setData("disabled",true)},_trigger:function(l,m,n){var p=this.options[l],j=(l==this.widgetEventPrefix?l:this.widgetEventPrefix+l);m=c.Event(m);m.type=j;if(m.originalEvent){for(var k=c.event.props.length,o;k;){o=c.event.props[--k];m[o]=m.originalEvent[o]}}this.element.trigger(m,n);return !(c.isFunction(p)&&p.call(this.element[0],m,n)===false||m.isDefaultPrevented())}};c.widget.defaults={disabled:false};c.ui.mouse={_mouseInit:function(){var j=this;this.element.bind("mousedown."+this.widgetName,function(k){return j._mouseDown(k)}).bind("click."+this.widgetName,function(k){if(j._preventClickEvent){j._preventClickEvent=false;k.stopImmediatePropagation();return false}});if(c.browser.msie){this._mouseUnselectable=this.element.attr("unselectable");this.element.attr("unselectable","on")}this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName);(c.browser.msie&&this.element.attr("unselectable",this._mouseUnselectable))},_mouseDown:function(l){l.originalEvent=l.originalEvent||{};if(l.originalEvent.mouseHandled){return}(this._mouseStarted&&this._mouseUp(l));this._mouseDownEvent=l;var k=this,m=(l.which==1),j=(typeof this.options.cancel=="string"?c(l.target).parents().add(l.target).filter(this.options.cancel).length:false);if(!m||j||!this._mouseCapture(l)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){k.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(l)&&this._mouseDelayMet(l)){this._mouseStarted=(this._mouseStart(l)!==false);if(!this._mouseStarted){l.preventDefault();return true}}this._mouseMoveDelegate=function(n){return k._mouseMove(n)};this._mouseUpDelegate=function(n){return k._mouseUp(n)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);(c.browser.safari||l.preventDefault());l.originalEvent.mouseHandled=true;return true},_mouseMove:function(j){if(c.browser.msie&&!j.button){return this._mouseUp(j)}if(this._mouseStarted){this._mouseDrag(j);return j.preventDefault()}if(this._mouseDistanceMet(j)&&this._mouseDelayMet(j)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,j)!==false);(this._mouseStarted?this._mouseDrag(j):this._mouseUp(j))}return !this._mouseStarted},_mouseUp:function(j){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=(j.target==this._mouseDownEvent.target);this._mouseStop(j)}return false},_mouseDistanceMet:function(j){return(Math.max(Math.abs(this._mouseDownEvent.pageX-j.pageX),Math.abs(this._mouseDownEvent.pageY-j.pageY))>=this.options.distance)},_mouseDelayMet:function(j){return this.mouseDelayMet},_mouseStart:function(j){},_mouseDrag:function(j){},_mouseStop:function(j){},_mouseCapture:function(j){return true}};c.ui.mouse.defaults={cancel:null,distance:1,delay:0}})(jQuery);(function(a){a.widget("ui.draggable",a.extend({},a.ui.mouse,{_init:function(){if(this.options.helper=="original"&&!(/^(?:r|a|f)/).test(this.element.css("position"))){this.element[0].style.position="relative"}(this.options.addClasses&&this.element.addClass("ui-draggable"));(this.options.disabled&&this.element.addClass("ui-draggable-disabled"));this._mouseInit()},destroy:function(){if(!this.element.data("draggable")){return}this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy()},_mouseCapture:function(b){var c=this.options;if(this.helper||c.disabled||a(b.target).is(".ui-resizable-handle")){return false}this.handle=this._getHandle(b);if(!this.handle){return false}return true},_mouseStart:function(b){var c=this.options;this.helper=this._createHelper(b);this._cacheHelperProportions();if(a.ui.ddmanager){a.ui.ddmanager.current=this}this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(b);this.originalPageX=b.pageX;this.originalPageY=b.pageY;if(c.cursorAt){this._adjustOffsetFromHelper(c.cursorAt)}if(c.containment){this._setContainment()}this._trigger("start",b);this._cacheHelperProportions();if(a.ui.ddmanager&&!c.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,b)}this.helper.addClass("ui-draggable-dragging");this._mouseDrag(b,true);return true},_mouseDrag:function(b,d){this.position=this._generatePosition(b);this.positionAbs=this._convertPositionTo("absolute");if(!d){var c=this._uiHash();this._trigger("drag",b,c);this.position=c.position}if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}if(a.ui.ddmanager){a.ui.ddmanager.drag(this,b)}return false},_mouseStop:function(c){var d=false;if(a.ui.ddmanager&&!this.options.dropBehaviour){d=a.ui.ddmanager.drop(this,c)}if(this.dropped){d=this.dropped;this.dropped=false}if((this.options.revert=="invalid"&&!d)||(this.options.revert=="valid"&&d)||this.options.revert===true||(a.isFunction(this.options.revert)&&this.options.revert.call(this.element,d))){var b=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){b._trigger("stop",c);b._clear()})}else{this._trigger("stop",c);this._clear()}return false},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==b.target){c=true}});return c},_createHelper:function(c){var d=this.options;var b=a.isFunction(d.helper)?a(d.helper.apply(this.element[0],[c])):(d.helper=="clone"?this.element.clone():this.element);if(!b.parents("body").length){b.appendTo((d.appendTo=="parent"?this.element[0].parentNode:d.appendTo))}if(b[0]!=this.element[0]&&!(/(fixed|absolute)/).test(b.css("position"))){b.css("position","absolute")}return b},_adjustOffsetFromHelper:function(b){if(b.left!=undefined){this.offset.click.left=b.left+this.margins.left}if(b.right!=undefined){this.offset.click.left=this.helperProportions.width-b.right+this.margins.left}if(b.top!=undefined){this.offset.click.top=b.top+this.margins.top}if(b.bottom!=undefined){this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){b.left+=this.scrollParent.scrollLeft();b.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){b={top:0,left:0}}return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var b=this.element.position();return{top:b.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:b.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.element.css("marginLeft"),10)||0),top:(parseInt(this.element.css("marginTop"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var e=this.options;if(e.containment=="parent"){e.containment=this.helper[0].parentNode}if(e.containment=="document"||e.containment=="window"){this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(e.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(e.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(e.containment)&&e.containment.constructor!=Array){var c=a(e.containment)[0];if(!c){return}var d=a(e.containment).offset();var b=(a(c).css("overflow")!="hidden");this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(b?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(b?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}else{if(e.containment.constructor==Array){this.containment=e.containment}}},_convertPositionTo:function(f,h){if(!h){h=this.position}var c=f=="absolute"?1:-1;var e=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=(/(html|body)/i).test(b[0].tagName);return{top:(h.top+this.offset.relative.top*c+this.offset.parent.top*c-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(g?0:b.scrollTop()))*c)),left:(h.left+this.offset.relative.left*c+this.offset.parent.left*c-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:b.scrollLeft())*c))}},_generatePosition:function(e){var h=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,i=(/(html|body)/i).test(b[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset()}var d=e.pageX;var c=e.pageY;if(this.originalPosition){if(this.containment){if(e.pageX-this.offset.click.leftthis.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.topthis.containment[3])?g:(!(g-this.offset.click.topthis.containment[2])?f:(!(f-this.offset.click.left
    ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css(a(this).offset()).appendTo("body")})},stop:function(b,c){a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});a.ui.plugin.add("draggable","opacity",{start:function(c,d){var b=a(d.helper),e=a(this).data("draggable").options;if(b.css("opacity")){e._opacity=b.css("opacity")}b.css("opacity",e.opacity)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._opacity){a(c.helper).css("opacity",d._opacity)}}});a.ui.plugin.add("draggable","scroll",{start:function(c,d){var b=a(this).data("draggable");if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){b.overflowOffset=b.scrollParent.offset()}},drag:function(d,e){var c=a(this).data("draggable"),f=c.options,b=false;if(c.scrollParent[0]!=document&&c.scrollParent[0].tagName!="HTML"){if(!f.axis||f.axis!="x"){if((c.overflowOffset.top+c.scrollParent[0].offsetHeight)-d.pageY=0;v--){var s=g.snapElements[v].left,n=s+g.snapElements[v].width,m=g.snapElements[v].top,A=m+g.snapElements[v].height;if(!((s-y=p&&n<=k)||(m>=p&&m<=k)||(nk))&&((e>=g&&e<=c)||(d>=g&&d<=c)||(ec));break;default:return false;break}};a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(e,g){var b=a.ui.ddmanager.droppables[e.options.scope];var f=g?g.type:null;var h=(e.currentItem||e.element).find(":data(droppable)").andSelf();droppablesLoop:for(var d=0;d
    ').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=j.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var k=this.handles.split(",");this.handles={};for(var f=0;f
    ');if(/sw|se|ne|nw/.test(h)){g.css({zIndex:++j.zIndex})}if("se"==h){g.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[h]=".ui-resizable-"+h;this.element.append(g)}}this._renderAxis=function(p){p=p||this.element;for(var m in this.handles){if(this.handles[m].constructor==String){this.handles[m]=c(this.handles[m],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var n=c(this.handles[m],this.element),o=0;o=/sw|ne|nw|se|n|s/.test(m)?n.outerHeight():n.outerWidth();var l=["padding",/ne|nw|n/.test(m)?"Top":/se|sw|s/.test(m)?"Bottom":/^e$/.test(m)?"Right":"Left"].join("");p.css(l,o);this._proportionallyResize()}if(!c(this.handles[m]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!e.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}e.axis=i&&i[1]?i[1]:"se"}});if(j.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){c(this).removeClass("ui-resizable-autohide");e._handles.show()},function(){if(!e.resizing){c(this).addClass("ui-resizable-autohide");e._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var d=function(f){c(f).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){d(this.element);var e=this.element;e.parent().append(this.originalElement.css({position:e.css("position"),width:e.outerWidth(),height:e.outerHeight(),top:e.css("top"),left:e.css("left")})).end().remove()}this.originalElement.css("resize",this.originalResizeStyle);d(this.originalElement)},_mouseCapture:function(e){var f=false;for(var d in this.handles){if(c(this.handles[d])[0]==e.target){f=true}}return this.options.disabled||!!f},_mouseStart:function(f){var i=this.options,e=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(d.is(".ui-draggable")||(/absolute/).test(d.css("position"))){d.css({position:"absolute",top:e.top,left:e.left})}if(c.browser.opera&&(/relative/).test(d.css("position"))){d.css({position:"relative",top:"auto",left:"auto"})}this._renderProxy();var j=b(this.helper.css("left")),g=b(this.helper.css("top"));if(i.containment){j+=c(i.containment).scrollLeft()||0;g+=c(i.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:j,top:g};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:j,top:g};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:f.pageX,top:f.pageY};this.aspectRatio=(typeof i.aspectRatio=="number")?i.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var h=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",h=="auto"?this.axis+"-resize":h);d.addClass("ui-resizable-resizing");this._propagate("start",f);return true},_mouseDrag:function(d){var g=this.helper,f=this.options,l={},p=this,i=this.originalMousePosition,m=this.axis;var q=(d.pageX-i.left)||0,n=(d.pageY-i.top)||0;var h=this._change[m];if(!h){return false}var k=h.apply(this,[d,q,n]),j=c.browser.msie&&c.browser.version<7,e=this.sizeDiff;if(this._aspectRatio||d.shiftKey){k=this._updateRatio(k,d)}k=this._respectSize(k,d);this._propagate("resize",d);g.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(k);this._trigger("resize",d,this.ui());return false},_mouseStop:function(g){this.resizing=false;var h=this.options,l=this;if(this._helper){var f=this._proportionallyResizeElements,d=f.length&&(/textarea/i).test(f[0].nodeName),e=d&&c.ui.hasScroll(f[0],"left")?0:l.sizeDiff.height,j=d?0:l.sizeDiff.width;var m={width:(l.size.width-j),height:(l.size.height-e)},i=(parseInt(l.element.css("left"),10)+(l.position.left-l.originalPosition.left))||null,k=(parseInt(l.element.css("top"),10)+(l.position.top-l.originalPosition.top))||null;if(!h.animate){this.element.css(c.extend(m,{top:k,left:i}))}l.helper.height(l.size.height);l.helper.width(l.size.width);if(this._helper&&!h.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",g);if(this._helper){this.helper.remove()}return false},_updateCache:function(d){var e=this.options;this.offset=this.helper.offset();if(a(d.left)){this.position.left=d.left}if(a(d.top)){this.position.top=d.top}if(a(d.height)){this.size.height=d.height}if(a(d.width)){this.size.width=d.width}},_updateRatio:function(g,f){var h=this.options,i=this.position,e=this.size,d=this.axis;if(g.height){g.width=(e.height*this.aspectRatio)}else{if(g.width){g.height=(e.width/this.aspectRatio)}}if(d=="sw"){g.left=i.left+(e.width-g.width);g.top=null}if(d=="nw"){g.top=i.top+(e.height-g.height);g.left=i.left+(e.width-g.width)}return g},_respectSize:function(k,f){var i=this.helper,h=this.options,q=this._aspectRatio||f.shiftKey,p=this.axis,s=a(k.width)&&h.maxWidth&&(h.maxWidthk.width),r=a(k.height)&&h.minHeight&&(h.minHeight>k.height);if(g){k.width=h.minWidth}if(r){k.height=h.minHeight}if(s){k.width=h.maxWidth}if(l){k.height=h.maxHeight}var e=this.originalPosition.left+this.originalSize.width,n=this.position.top+this.size.height;var j=/sw|nw|w/.test(p),d=/nw|ne|n/.test(p);if(g&&j){k.left=e-h.minWidth}if(s&&j){k.left=e-h.maxWidth}if(r&&d){k.top=n-h.minHeight}if(l&&d){k.top=n-h.maxHeight}var m=!k.width&&!k.height;if(m&&!k.left&&k.top){k.top=null}else{if(m&&!k.top&&k.left){k.left=null}}return k},_proportionallyResize:function(){var j=this.options;if(!this._proportionallyResizeElements.length){return}var f=this.helper||this.element;for(var e=0;e
    ');var d=c.browser.msie&&c.browser.version<7,f=(d?1:0),g=(d?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+g,height:this.element.outerHeight()+g,position:"absolute",left:this.elementOffset.left-f+"px",top:this.elementOffset.top-f+"px",zIndex:++h.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(f,e,d){return{width:this.originalSize.width+e}},w:function(g,e,d){var i=this.options,f=this.originalSize,h=this.originalPosition;return{left:h.left+e,width:f.width-e}},n:function(g,e,d){var i=this.options,f=this.originalSize,h=this.originalPosition;return{top:h.top+d,height:f.height-d}},s:function(f,e,d){return{height:this.originalSize.height+d}},se:function(f,e,d){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[f,e,d]))},sw:function(f,e,d){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[f,e,d]))},ne:function(f,e,d){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[f,e,d]))},nw:function(f,e,d){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[f,e,d]))}},_propagate:function(e,d){c.ui.plugin.call(this,e,[d,this.ui()]);(e!="resize"&&this._trigger(e,d,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}));c.extend(c.ui.resizable,{version:"1.7.1",eventPrefix:"resize",defaults:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,cancel:":input,option",containment:false,delay:0,distance:1,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000}});c.ui.plugin.add("resizable","alsoResize",{start:function(e,f){var d=c(this).data("resizable"),g=d.options;_store=function(h){c(h).each(function(){c(this).data("resizable-alsoresize",{width:parseInt(c(this).width(),10),height:parseInt(c(this).height(),10),left:parseInt(c(this).css("left"),10),top:parseInt(c(this).css("top"),10)})})};if(typeof(g.alsoResize)=="object"&&!g.alsoResize.parentNode){if(g.alsoResize.length){g.alsoResize=g.alsoResize[0];_store(g.alsoResize)}else{c.each(g.alsoResize,function(h,i){_store(h)})}}else{_store(g.alsoResize)}},resize:function(f,h){var e=c(this).data("resizable"),i=e.options,g=e.originalSize,k=e.originalPosition;var j={height:(e.size.height-g.height)||0,width:(e.size.width-g.width)||0,top:(e.position.top-k.top)||0,left:(e.position.left-k.left)||0},d=function(l,m){c(l).each(function(){var p=c(this),q=c(this).data("resizable-alsoresize"),o={},n=m&&m.length?m:["width","height","top","left"];c.each(n||["width","height","top","left"],function(r,u){var s=(q[u]||0)+(j[u]||0);if(s&&s>=0){o[u]=s||null}});if(/relative/.test(p.css("position"))&&c.browser.opera){e._revertToRelativePosition=true;p.css({position:"absolute",top:"auto",left:"auto"})}p.css(o)})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.nodeType){c.each(i.alsoResize,function(l,m){d(l,m)})}else{d(i.alsoResize)}},stop:function(e,f){var d=c(this).data("resizable");if(d._revertToRelativePosition&&c.browser.opera){d._revertToRelativePosition=false;el.css({position:"relative"})}c(this).removeData("resizable-alsoresize-start")}});c.ui.plugin.add("resizable","animate",{stop:function(h,m){var n=c(this).data("resizable"),i=n.options;var g=n._proportionallyResizeElements,d=g.length&&(/textarea/i).test(g[0].nodeName),e=d&&c.ui.hasScroll(g[0],"left")?0:n.sizeDiff.height,k=d?0:n.sizeDiff.width;var f={width:(n.size.width-k),height:(n.size.height-e)},j=(parseInt(n.element.css("left"),10)+(n.position.left-n.originalPosition.left))||null,l=(parseInt(n.element.css("top"),10)+(n.position.top-n.originalPosition.top))||null;n.element.animate(c.extend(f,l&&j?{top:l,left:j}:{}),{duration:i.animateDuration,easing:i.animateEasing,step:function(){var o={width:parseInt(n.element.css("width"),10),height:parseInt(n.element.css("height"),10),top:parseInt(n.element.css("top"),10),left:parseInt(n.element.css("left"),10)};if(g&&g.length){c(g[0]).css({width:o.width,height:o.height})}n._updateCache(o);n._propagate("resize",h)}})}});c.ui.plugin.add("resizable","containment",{start:function(e,q){var s=c(this).data("resizable"),i=s.options,k=s.element;var f=i.containment,j=(f instanceof c)?f.get(0):(/parent/.test(f))?k.parent().get(0):f;if(!j){return}s.containerElement=c(j);if(/document/.test(f)||f==document){s.containerOffset={left:0,top:0};s.containerPosition={left:0,top:0};s.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var m=c(j),h=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){h[p]=b(m.css("padding"+o))});s.containerOffset=m.offset();s.containerPosition=m.position();s.containerSize={height:(m.innerHeight()-h[3]),width:(m.innerWidth()-h[1])};var n=s.containerOffset,d=s.containerSize.height,l=s.containerSize.width,g=(c.ui.hasScroll(j,"left")?j.scrollWidth:l),r=(c.ui.hasScroll(j)?j.scrollHeight:d);s.parentData={element:j,left:n.left,top:n.top,width:g,height:r}}},resize:function(f,p){var s=c(this).data("resizable"),h=s.options,e=s.containerSize,n=s.containerOffset,l=s.size,m=s.position,q=s._aspectRatio||f.shiftKey,d={top:0,left:0},g=s.containerElement;if(g[0]!=document&&(/static/).test(g.css("position"))){d=n}if(m.left<(s._helper?n.left:0)){s.size.width=s.size.width+(s._helper?(s.position.left-n.left):(s.position.left-d.left));if(q){s.size.height=s.size.width/h.aspectRatio}s.position.left=h.helper?n.left:0}if(m.top<(s._helper?n.top:0)){s.size.height=s.size.height+(s._helper?(s.position.top-n.top):s.position.top);if(q){s.size.width=s.size.height*h.aspectRatio}s.position.top=s._helper?n.top:0}s.offset.left=s.parentData.left+s.position.left;s.offset.top=s.parentData.top+s.position.top;var k=Math.abs((s._helper?s.offset.left-d.left:(s.offset.left-d.left))+s.sizeDiff.width),r=Math.abs((s._helper?s.offset.top-d.top:(s.offset.top-n.top))+s.sizeDiff.height);var j=s.containerElement.get(0)==s.element.parent().get(0),i=/relative|absolute/.test(s.containerElement.css("position"));if(j&&i){k-=s.parentData.left}if(k+s.size.width>=s.parentData.width){s.size.width=s.parentData.width-k;if(q){s.size.height=s.size.width/s.aspectRatio}}if(r+s.size.height>=s.parentData.height){s.size.height=s.parentData.height-r;if(q){s.size.width=s.size.height*s.aspectRatio}}},stop:function(e,m){var p=c(this).data("resizable"),f=p.options,k=p.position,l=p.containerOffset,d=p.containerPosition,g=p.containerElement;var i=c(p.helper),q=i.offset(),n=i.outerWidth()-p.sizeDiff.width,j=i.outerHeight()-p.sizeDiff.height;if(p._helper&&!f.animate&&(/relative/).test(g.css("position"))){c(this).css({left:q.left-d.left-l.left,width:n,height:j})}if(p._helper&&!f.animate&&(/static/).test(g.css("position"))){c(this).css({left:q.left-d.left-l.left,width:n,height:j})}}});c.ui.plugin.add("resizable","ghost",{start:function(f,g){var d=c(this).data("resizable"),h=d.options,e=d.size;d.ghost=d.originalElement.clone();d.ghost.css({opacity:0.25,display:"block",position:"relative",height:e.height,width:e.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof h.ghost=="string"?h.ghost:"");d.ghost.appendTo(d.helper)},resize:function(e,f){var d=c(this).data("resizable"),g=d.options;if(d.ghost){d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})}},stop:function(e,f){var d=c(this).data("resizable"),g=d.options;if(d.ghost&&d.helper){d.helper.get(0).removeChild(d.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(d,l){var n=c(this).data("resizable"),g=n.options,j=n.size,h=n.originalSize,i=n.originalPosition,m=n.axis,k=g._aspectRatio||d.shiftKey;g.grid=typeof g.grid=="number"?[g.grid,g.grid]:g.grid;var f=Math.round((j.width-h.width)/(g.grid[0]||1))*(g.grid[0]||1),e=Math.round((j.height-h.height)/(g.grid[1]||1))*(g.grid[1]||1);if(/^(se|s|e)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e}else{if(/^(ne)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e;n.position.top=i.top-e}else{if(/^(sw)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e;n.position.left=i.left-f}else{n.size.width=h.width+f;n.size.height=h.height+e;n.position.top=i.top-e;n.position.left=i.left-f}}}}});var b=function(d){return parseInt(d,10)||0};var a=function(d){return !isNaN(parseInt(d,10))}})(jQuery);(function(a){a.widget("ui.selectable",a.extend({},a.ui.mouse,{_init:function(){var b=this;this.element.addClass("ui-selectable");this.dragged=false;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]);c.each(function(){var d=a(this);var e=d.offset();a.data(this,"selectable-item",{element:this,$element:d,left:e.left,top:e.top,right:e.left+d.outerWidth(),bottom:e.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=c.addClass("ui-selectee");this._mouseInit();this.helper=a(document.createElement("div")).css({border:"1px dotted black"}).addClass("ui-selectable-helper")},destroy:function(){this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy()},_mouseStart:function(d){var b=this;this.opos=[d.pageX,d.pageY];if(this.options.disabled){return}var c=this.options;this.selectees=a(c.filter,this.element[0]);this._trigger("start",d);a(c.appendTo).append(this.helper);this.helper.css({"z-index":100,position:"absolute",left:d.clientX,top:d.clientY,width:0,height:0});if(c.autoRefresh){this.refresh()}this.selectees.filter(".ui-selected").each(function(){var e=a.data(this,"selectable-item");e.startselected=true;if(!d.metaKey){e.$element.removeClass("ui-selected");e.selected=false;e.$element.addClass("ui-unselecting");e.unselecting=true;b._trigger("unselecting",d,{unselecting:e.element})}});a(d.target).parents().andSelf().each(function(){var e=a.data(this,"selectable-item");if(e){e.$element.removeClass("ui-unselecting").addClass("ui-selecting");e.unselecting=false;e.selecting=true;e.selected=true;b._trigger("selecting",d,{selecting:e.element});return false}})},_mouseDrag:function(i){var c=this;this.dragged=true;if(this.options.disabled){return}var e=this.options;var d=this.opos[0],h=this.opos[1],b=i.pageX,g=i.pageY;if(d>b){var f=b;b=d;d=f}if(h>g){var f=g;g=h;h=f}this.helper.css({left:d,top:h,width:b-d,height:g-h});this.selectees.each(function(){var j=a.data(this,"selectable-item");if(!j||j.element==c.element[0]){return}var k=false;if(e.tolerance=="touch"){k=(!(j.left>b||j.rightg||j.bottomd&&j.righth&&j.bottom=0;b--){this.items[b].item.removeData("sortable-item")}},_mouseCapture:function(e,f){if(this.reverting){return false}if(this.options.disabled||this.options.type=="static"){return false}this._refreshItems(e);var d=null,c=this,b=a(e.target).parents().each(function(){if(a.data(this,"sortable-item")==c){d=a(this);return false}});if(a.data(e.target,"sortable-item")==c){d=a(e.target)}if(!d){return false}if(this.options.handle&&!f){var g=false;a(this.options.handle,d).find("*").andSelf().each(function(){if(this==e.target){g=true}});if(!g){return false}}this.currentItem=d;this._removeCurrentsFromItems();return true},_mouseStart:function(e,f,b){var g=this.options,c=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(e);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");a.extend(this.offset,{click:{left:e.pageX-this.offset.left,top:e.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(e);this.originalPageX=e.pageX;this.originalPageY=e.pageY;if(g.cursorAt){this._adjustOffsetFromHelper(g.cursorAt)}this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};if(this.helper[0]!=this.currentItem[0]){this.currentItem.hide()}this._createPlaceholder();if(g.containment){this._setContainment()}if(g.cursor){if(a("body").css("cursor")){this._storedCursor=a("body").css("cursor")}a("body").css("cursor",g.cursor)}if(g.opacity){if(this.helper.css("opacity")){this._storedOpacity=this.helper.css("opacity")}this.helper.css("opacity",g.opacity)}if(g.zIndex){if(this.helper.css("zIndex")){this._storedZIndex=this.helper.css("zIndex")}this.helper.css("zIndex",g.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){this.overflowOffset=this.scrollParent.offset()}this._trigger("start",e,this._uiHash());if(!this._preserveHelperProportions){this._cacheHelperProportions()}if(!b){for(var d=this.containers.length-1;d>=0;d--){this.containers[d]._trigger("activate",e,c._uiHash(this))}}if(a.ui.ddmanager){a.ui.ddmanager.current=this}if(a.ui.ddmanager&&!g.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,e)}this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(e);return true},_mouseDrag:function(f){this.position=this._generatePosition(f);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs){this.lastPositionAbs=this.positionAbs}if(this.options.scroll){var g=this.options,b=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if((this.overflowOffset.top+this.scrollParent[0].offsetHeight)-f.pageY=0;d--){var e=this.items[d],c=e.item[0],h=this._intersectsWithPointer(e);if(!h){continue}if(c!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=c&&!a.ui.contains(this.placeholder[0],c)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],c):true)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(e)){this._rearrange(f,e)}else{break}this._trigger("change",f,this._uiHash());break}}this._contactContainers(f);if(a.ui.ddmanager){a.ui.ddmanager.drag(this,f)}this._trigger("sort",f,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(c,d){if(!c){return}if(a.ui.ddmanager&&!this.options.dropBehaviour){a.ui.ddmanager.drop(this,c)}if(this.options.revert){var b=this;var e=b.placeholder.offset();b.reverting=true;a(this.helper).animate({left:e.left-this.offset.parent.left-b.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-b.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){b._clear(c)})}else{this._clear(c,d)}return false},cancel:function(){var b=this;if(this.dragging){this._mouseUp();if(this.options.helper=="original"){this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else{this.currentItem.show()}for(var c=this.containers.length-1;c>=0;c--){this.containers[c]._trigger("deactivate",null,b._uiHash(this));if(this.containers[c].containerCache.over){this.containers[c]._trigger("out",null,b._uiHash(this));this.containers[c].containerCache.over=0}}}if(this.placeholder[0].parentNode){this.placeholder[0].parentNode.removeChild(this.placeholder[0])}if(this.options.helper!="original"&&this.helper&&this.helper[0].parentNode){this.helper.remove()}a.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});if(this.domPosition.prev){a(this.domPosition.prev).after(this.currentItem)}else{a(this.domPosition.parent).prepend(this.currentItem)}return true},serialize:function(d){var b=this._getItemsAsjQuery(d&&d.connected);var c=[];d=d||{};a(b).each(function(){var e=(a(d.item||this).attr(d.attribute||"id")||"").match(d.expression||(/(.+)[-=_](.+)/));if(e){c.push((d.key||e[1]+"[]")+"="+(d.key&&d.expression?e[1]:e[2]))}});return c.join("&")},toArray:function(d){var b=this._getItemsAsjQuery(d&&d.connected);var c=[];d=d||{};b.each(function(){c.push(a(d.item||this).attr(d.attribute||"id")||"")});return c},_intersectsWith:function(m){var e=this.positionAbs.left,d=e+this.helperProportions.width,k=this.positionAbs.top,j=k+this.helperProportions.height;var f=m.left,c=f+m.width,n=m.top,i=n+m.height;var o=this.offset.click.top,h=this.offset.click.left;var g=(k+o)>n&&(k+o)f&&(e+h)m[this.floating?"width":"height"])){return g}else{return(f0?"down":"up")},_getDragHorizontalDirection:function(){var b=this.positionAbs.left-this.lastPositionAbs.left;return b!=0&&(b>0?"right":"left")},refresh:function(b){this._refreshItems(b);this.refreshPositions()},_connectWith:function(){var b=this.options;return b.connectWith.constructor==String?[b.connectWith]:b.connectWith},_getItemsAsjQuery:function(b){var l=this;var g=[];var e=[];var h=this._connectWith();if(h&&b){for(var d=h.length-1;d>=0;d--){var k=a(h[d]);for(var c=k.length-1;c>=0;c--){var f=a.data(k[c],"sortable");if(f&&f!=this&&!f.options.disabled){e.push([a.isFunction(f.options.items)?f.options.items.call(f.element):a(f.options.items,f.element).not(".ui-sortable-helper"),f])}}}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper"),this]);for(var d=e.length-1;d>=0;d--){e[d][0].each(function(){g.push(this)})}return a(g)},_removeCurrentsFromItems:function(){var d=this.currentItem.find(":data(sortable-item)");for(var c=0;c=0;e--){var m=a(l[e]);for(var d=m.length-1;d>=0;d--){var g=a.data(m[d],"sortable");if(g&&g!=this&&!g.options.disabled){f.push([a.isFunction(g.options.items)?g.options.items.call(g.element[0],b,{item:this.currentItem}):a(g.options.items,g.element),g]);this.containers.push(g)}}}}for(var e=f.length-1;e>=0;e--){var k=f[e][1];var c=f[e][0];for(var d=0,n=c.length;d=0;d--){var e=this.items[d];if(e.instance!=this.currentContainer&&this.currentContainer&&e.item[0]!=this.currentItem[0]){continue}var c=this.options.toleranceElement?a(this.options.toleranceElement,e.item):e.item;if(!b){e.width=c.outerWidth();e.height=c.outerHeight()}var f=c.offset();e.left=f.left;e.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers){this.options.custom.refreshContainers.call(this)}else{for(var d=this.containers.length-1;d>=0;d--){var f=this.containers[d].element.offset();this.containers[d].containerCache.left=f.left;this.containers[d].containerCache.top=f.top;this.containers[d].containerCache.width=this.containers[d].element.outerWidth();this.containers[d].containerCache.height=this.containers[d].element.outerHeight()}}},_createPlaceholder:function(d){var b=d||this,e=b.options;if(!e.placeholder||e.placeholder.constructor==String){var c=e.placeholder;e.placeholder={element:function(){var f=a(document.createElement(b.currentItem[0].nodeName)).addClass(c||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!c){f.style.visibility="hidden"}return f},update:function(f,g){if(c&&!e.forcePlaceholderSize){return}if(!g.height()){g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10))}if(!g.width()){g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=a(e.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);e.placeholder.update(b,b.placeholder)},_contactContainers:function(d){for(var c=this.containers.length-1;c>=0;c--){if(this._intersectsWith(this.containers[c].containerCache)){if(!this.containers[c].containerCache.over){if(this.currentContainer!=this.containers[c]){var h=10000;var g=null;var e=this.positionAbs[this.containers[c].floating?"left":"top"];for(var b=this.items.length-1;b>=0;b--){if(!a.ui.contains(this.containers[c].element[0],this.items[b].item[0])){continue}var f=this.items[b][this.containers[c].floating?"left":"top"];if(Math.abs(f-e)this.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.topthis.containment[3])?g:(!(g-this.offset.click.topthis.containment[2])?f:(!(f-this.offset.click.left=0;c--){if(a.ui.contains(this.containers[c].element[0],this.currentItem[0])&&!e){f.push((function(g){return function(h){g._trigger("receive",h,this._uiHash(this))}}).call(this,this.containers[c]));f.push((function(g){return function(h){g._trigger("update",h,this._uiHash(this))}}).call(this,this.containers[c]))}}}for(var c=this.containers.length-1;c>=0;c--){if(!e){f.push((function(g){return function(h){g._trigger("deactivate",h,this._uiHash(this))}}).call(this,this.containers[c]))}if(this.containers[c].containerCache.over){f.push((function(g){return function(h){g._trigger("out",h,this._uiHash(this))}}).call(this,this.containers[c]));this.containers[c].containerCache.over=0}}if(this._storedCursor){a("body").css("cursor",this._storedCursor)}if(this._storedOpacity){this.helper.css("opacity",this._storedOpacity)}if(this._storedZIndex){this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex)}this.dragging=false;if(this.cancelHelperRemoval){if(!e){this._trigger("beforeStop",d,this._uiHash());for(var c=0;c *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1000}})})(jQuery);jQuery.effects||(function(d){d.effects={version:"1.7.1",save:function(g,h){for(var f=0;f');var j=f.parent();if(f.css("position")=="static"){j.css({position:"relative"});f.css({position:"relative"})}else{var i=f.css("top");if(isNaN(parseInt(i,10))){i="auto"}var h=f.css("left");if(isNaN(parseInt(h,10))){h="auto"}j.css({position:f.css("position"),top:i,left:h,zIndex:f.css("z-index")}).show();f.css({position:"relative",top:0,left:0})}j.css(g);return j},removeWrapper:function(f){if(f.parent().is(".ui-effects-wrapper")){return f.parent().replaceWith(f)}return f},setTransition:function(g,i,f,h){h=h||{};d.each(i,function(k,j){unit=g.cssUnit(j);if(unit[0]>0){h[j]=unit[0]*f+unit[1]}});return h},animateClass:function(h,i,k,j){var f=(typeof k=="function"?k:(j?j:null));var g=(typeof k=="string"?k:null);return this.each(function(){var q={};var o=d(this);var p=o.attr("style")||"";if(typeof p=="object"){p=p.cssText}if(h.toggle){o.hasClass(h.toggle)?h.remove=h.toggle:h.add=h.toggle}var l=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.addClass(h.add)}if(h.remove){o.removeClass(h.remove)}var m=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.removeClass(h.add)}if(h.remove){o.addClass(h.remove)}for(var r in m){if(typeof m[r]!="function"&&m[r]&&r.indexOf("Moz")==-1&&r.indexOf("length")==-1&&m[r]!=l[r]&&(r.match(/color/i)||(!r.match(/color/i)&&!isNaN(parseInt(m[r],10))))&&(l.position!="static"||(l.position=="static"&&!r.match(/left|top|bottom|right/)))){q[r]=m[r]}}o.animate(q,i,g,function(){if(typeof d(this).attr("style")=="object"){d(this).attr("style")["cssText"]="";d(this).attr("style")["cssText"]=p}else{d(this).attr("style",p)}if(h.add){d(this).addClass(h.add)}if(h.remove){d(this).removeClass(h.remove)}if(f){f.apply(this,arguments)}})})}};function c(g,f){var i=g[1]&&g[1].constructor==Object?g[1]:{};if(f){i.mode=f}var h=g[1]&&g[1].constructor!=Object?g[1]:(i.duration?i.duration:g[2]);h=d.fx.off?0:typeof h==="number"?h:d.fx.speeds[h]||d.fx.speeds._default;var j=i.callback||(d.isFunction(g[1])&&g[1])||(d.isFunction(g[2])&&g[2])||(d.isFunction(g[3])&&g[3]);return[g[0],i,h,j]}d.fn.extend({_show:d.fn.show,_hide:d.fn.hide,__toggle:d.fn.toggle,_addClass:d.fn.addClass,_removeClass:d.fn.removeClass,_toggleClass:d.fn.toggleClass,effect:function(g,f,h,i){return d.effects[g]?d.effects[g].call(this,{method:g,options:f||{},duration:h,callback:i}):null},show:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._show.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"show"))}},hide:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._hide.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"hide"))}},toggle:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))||(arguments[0].constructor==Function)){return this.__toggle.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"toggle"))}},addClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{add:g},f,i,h]):this._addClass(g)},removeClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{remove:g},f,i,h]):this._removeClass(g)},toggleClass:function(g,f,i,h){return((typeof f!=="boolean")&&f)?d.effects.animateClass.apply(this,[{toggle:g},f,i,h]):this._toggleClass(g,f)},morph:function(f,h,g,j,i){return d.effects.animateClass.apply(this,[{add:h,remove:f},g,j,i])},switchClass:function(){return this.morph.apply(this,arguments)},cssUnit:function(f){var g=this.css(f),h=[];d.each(["em","px","%","pt"],function(j,k){if(g.indexOf(k)>0){h=[parseFloat(g),k]}});return h}});d.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(g,f){d.fx.step[f]=function(h){if(h.state==0){h.start=e(h.elem,f);h.end=b(h.end)}h.elem.style[f]="rgb("+[Math.max(Math.min(parseInt((h.pos*(h.end[0]-h.start[0]))+h.start[0],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[1]-h.start[1]))+h.start[1],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[2]-h.start[2]))+h.start[2],10),255),0)].join(",")+")"}});function b(g){var f;if(g&&g.constructor==Array&&g.length==3){return g}if(f=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(g)){return[parseInt(f[1],10),parseInt(f[2],10),parseInt(f[3],10)]}if(f=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(g)){return[parseFloat(f[1])*2.55,parseFloat(f[2])*2.55,parseFloat(f[3])*2.55]}if(f=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(g)){return[parseInt(f[1],16),parseInt(f[2],16),parseInt(f[3],16)]}if(f=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(g)){return[parseInt(f[1]+f[1],16),parseInt(f[2]+f[2],16),parseInt(f[3]+f[3],16)]}if(f=/rgba\(0, 0, 0, 0\)/.exec(g)){return a.transparent}return a[d.trim(g).toLowerCase()]}function e(h,f){var g;do{g=d.curCSS(h,f);if(g!=""&&g!="transparent"||d.nodeName(h,"body")){break}f="backgroundColor"}while(h=h.parentNode);return b(g)}var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};d.easing.jswing=d.easing.swing;d.extend(d.easing,{def:"easeOutQuad",swing:function(g,h,f,j,i){return d.easing[d.easing.def](g,h,f,j,i)},easeInQuad:function(g,h,f,j,i){return j*(h/=i)*h+f},easeOutQuad:function(g,h,f,j,i){return -j*(h/=i)*(h-2)+f},easeInOutQuad:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h+f}return -j/2*((--h)*(h-2)-1)+f},easeInCubic:function(g,h,f,j,i){return j*(h/=i)*h*h+f},easeOutCubic:function(g,h,f,j,i){return j*((h=h/i-1)*h*h+1)+f},easeInOutCubic:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h+f}return j/2*((h-=2)*h*h+2)+f},easeInQuart:function(g,h,f,j,i){return j*(h/=i)*h*h*h+f},easeOutQuart:function(g,h,f,j,i){return -j*((h=h/i-1)*h*h*h-1)+f},easeInOutQuart:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h+f}return -j/2*((h-=2)*h*h*h-2)+f},easeInQuint:function(g,h,f,j,i){return j*(h/=i)*h*h*h*h+f},easeOutQuint:function(g,h,f,j,i){return j*((h=h/i-1)*h*h*h*h+1)+f},easeInOutQuint:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h*h+f}return j/2*((h-=2)*h*h*h*h+2)+f},easeInSine:function(g,h,f,j,i){return -j*Math.cos(h/i*(Math.PI/2))+j+f},easeOutSine:function(g,h,f,j,i){return j*Math.sin(h/i*(Math.PI/2))+f},easeInOutSine:function(g,h,f,j,i){return -j/2*(Math.cos(Math.PI*h/i)-1)+f},easeInExpo:function(g,h,f,j,i){return(h==0)?f:j*Math.pow(2,10*(h/i-1))+f},easeOutExpo:function(g,h,f,j,i){return(h==i)?f+j:j*(-Math.pow(2,-10*h/i)+1)+f},easeInOutExpo:function(g,h,f,j,i){if(h==0){return f}if(h==i){return f+j}if((h/=i/2)<1){return j/2*Math.pow(2,10*(h-1))+f}return j/2*(-Math.pow(2,-10*--h)+2)+f},easeInCirc:function(g,h,f,j,i){return -j*(Math.sqrt(1-(h/=i)*h)-1)+f},easeOutCirc:function(g,h,f,j,i){return j*Math.sqrt(1-(h=h/i-1)*h)+f},easeInOutCirc:function(g,h,f,j,i){if((h/=i/2)<1){return -j/2*(Math.sqrt(1-h*h)-1)+f}return j/2*(Math.sqrt(1-(h-=2)*h)+1)+f},easeInElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l)==1){return f+m}if(!k){k=l*0.3}if(h").css({position:"absolute",visibility:"visible",left:-d*(g/e),top:-f*(c/k)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/e,height:c/k,left:l.left+d*(g/e)+(b.options.mode=="show"?(d-Math.floor(e/2))*(g/e):0),top:l.top+f*(c/k)+(b.options.mode=="show"?(f-Math.floor(k/2))*(c/k):0),opacity:b.options.mode=="show"?0:1}).animate({left:l.left+d*(g/e)+(b.options.mode=="show"?0:(d-Math.floor(e/2))*(g/e)),top:l.top+f*(c/k)+(b.options.mode=="show"?0:(f-Math.floor(k/2))*(c/k)),opacity:b.options.mode=="show"?1:0},b.duration||500)}}setTimeout(function(){b.options.mode=="show"?h.css({visibility:"visible"}):h.css({visibility:"visible"}).hide();if(b.callback){b.callback.apply(h[0])}h.dequeue();a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);(function(a){a.effects.fold=function(b){return this.queue(function(){var e=a(this),k=["position","top","left"];var h=a.effects.setMode(e,b.options.mode||"hide");var o=b.options.size||15;var n=!(!b.options.horizFirst);var g=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(e,k);e.show();var d=a.effects.createWrapper(e).css({overflow:"hidden"});var i=((h=="show")!=n);var f=i?["width","height"]:["height","width"];var c=i?[d.width(),d.height()]:[d.height(),d.width()];var j=/([0-9]+)%/.exec(o);if(j){o=parseInt(j[1],10)/100*c[h=="hide"?0:1]}if(h=="show"){d.css(n?{height:0,width:o}:{height:o,width:0})}var m={},l={};m[f[0]]=h=="show"?c[0]:o;l[f[1]]=h=="show"?c[1]:0;d.animate(m,g,b.options.easing).animate(l,g,b.options.easing,function(){if(h=="hide"){e.hide()}a.effects.restore(e,k);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery);(function(a){a.effects.highlight=function(b){return this.queue(function(){var e=a(this),d=["backgroundImage","backgroundColor","opacity"];var h=a.effects.setMode(e,b.options.mode||"show");var c=b.options.color||"#ffff99";var g=e.css("backgroundColor");a.effects.save(e,d);e.show();e.css({backgroundImage:"none",backgroundColor:c});var f={backgroundColor:g};if(h=="hide"){f.opacity=0}e.animate(f,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(h=="hide"){e.hide()}a.effects.restore(e,d);if(h=="show"&&a.browser.msie){this.style.removeAttribute("filter")}if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);(function(a){a.effects.pulsate=function(b){return this.queue(function(){var d=a(this);var g=a.effects.setMode(d,b.options.mode||"show");var f=b.options.times||5;var e=b.duration?b.duration/2:a.fx.speeds._default/2;if(g=="hide"){f--}if(d.is(":hidden")){d.css("opacity",0);d.show();d.animate({opacity:1},e,b.options.easing);f=f-2}for(var c=0;c').appendTo(document.body).addClass(b.options.className).css({top:d.top,left:d.left,height:f.innerHeight(),width:f.innerWidth(),position:"absolute"}).animate(g,b.duration,b.options.easing,function(){c.remove();(b.callback&&b.callback.apply(f[0],arguments));f.dequeue()})})}})(jQuery);(function(a){a.widget("ui.accordion",{_init:function(){var d=this.options,b=this;this.running=0;if(d.collapsible==a.ui.accordion.defaults.collapsible&&d.alwaysOpen!=a.ui.accordion.defaults.alwaysOpen){d.collapsible=!d.alwaysOpen}if(d.navigation){var c=this.element.find("a").filter(d.navigationFilter);if(c.length){if(c.filter(d.header).length){this.active=c}else{this.active=c.parent().parent().prev();c.addClass("ui-accordion-content-active")}}}this.element.addClass("ui-accordion ui-widget ui-helper-reset");if(this.element[0].nodeName=="UL"){this.element.children("li").addClass("ui-accordion-li-fix")}this.headers=this.element.find(d.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){a(this).removeClass("ui-state-focus")});this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");this.active=this._findActive(this.active||d.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");this.active.next().addClass("ui-accordion-content-active");a("").addClass("ui-icon "+d.icons.header).prependTo(this.headers);this.active.find(".ui-icon").toggleClass(d.icons.header).toggleClass(d.icons.headerSelected);if(a.browser.msie){this.element.find("a").css("zoom","1")}this.resize();this.element.attr("role","tablist");this.headers.attr("role","tab").bind("keydown",function(e){return b._keydown(e)}).next().attr("role","tabpanel");this.headers.not(this.active||"").attr("aria-expanded","false").attr("tabIndex","-1").next().hide();if(!this.active.length){this.headers.eq(0).attr("tabIndex","0")}else{this.active.attr("aria-expanded","true").attr("tabIndex","0")}if(!a.browser.safari){this.headers.find("a").attr("tabIndex","-1")}if(d.event){this.headers.bind((d.event)+".accordion",function(e){return b._clickHandler.call(b,e,this)})}},destroy:function(){var c=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role").unbind(".accordion").removeData("accordion");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");this.headers.find("a").removeAttr("tabindex");this.headers.children(".ui-icon").remove();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");if(c.autoHeight||c.fillHeight){b.css("height","")}},_setData:function(b,c){if(b=="alwaysOpen"){b="collapsible";c=!c}a.widget.prototype._setData.apply(this,arguments)},_keydown:function(e){var g=this.options,f=a.ui.keyCode;if(g.disabled||e.altKey||e.ctrlKey){return}var d=this.headers.length;var b=this.headers.index(e.target);var c=false;switch(e.keyCode){case f.RIGHT:case f.DOWN:c=this.headers[(b+1)%d];break;case f.LEFT:case f.UP:c=this.headers[(b-1+d)%d];break;case f.SPACE:case f.ENTER:return this._clickHandler({target:e.target},e.target)}if(c){a(e.target).attr("tabIndex","-1");a(c).attr("tabIndex","0");c.focus();return false}return true},resize:function(){var e=this.options,d;if(e.fillSpace){if(a.browser.msie){var b=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}d=this.element.parent().height();if(a.browser.msie){this.element.parent().css("overflow",b)}this.headers.each(function(){d-=a(this).outerHeight()});var c=0;this.headers.next().each(function(){c=Math.max(c,a(this).innerHeight()-a(this).height())}).height(Math.max(0,d-c)).css("overflow","auto")}else{if(e.autoHeight){d=0;this.headers.next().each(function(){d=Math.max(d,a(this).outerHeight())}).height(d)}}},activate:function(b){var c=this._findActive(b)[0];this._clickHandler({target:c},c)},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===false?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(b,f){var d=this.options;if(d.disabled){return false}if(!b.target&&d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var h=this.active.next(),e={options:d,newHeader:a([]),oldHeader:d.active,newContent:a([]),oldContent:h},c=(this.active=a([]));this._toggle(c,h,e);return false}var g=a(b.currentTarget||f);var i=g[0]==this.active[0];if(this.running||(!d.collapsible&&i)){return false}this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");if(!i){g.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").find(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);g.next().addClass("ui-accordion-content-active")}var c=g.next(),h=this.active.next(),e={options:d,newHeader:i&&d.collapsible?a([]):g,oldHeader:this.active,newContent:i&&d.collapsible?a([]):c.find("> *"),oldContent:h.find("> *")},j=this.headers.index(this.active[0])>this.headers.index(g[0]);this.active=i?a([]):g;this._toggle(c,h,e,i,j);return false},_toggle:function(b,i,g,j,k){var d=this.options,m=this;this.toShow=b;this.toHide=i;this.data=g;var c=function(){if(!m){return}return m._completed.apply(m,arguments)};this._trigger("changestart",null,this.data);this.running=i.size()===0?b.size():i.size();if(d.animated){var f={};if(d.collapsible&&j){f={toShow:a([]),toHide:i,complete:c,down:k,autoHeight:d.autoHeight||d.fillSpace}}else{f={toShow:b,toHide:i,complete:c,down:k,autoHeight:d.autoHeight||d.fillSpace}}if(!d.proxied){d.proxied=d.animated}if(!d.proxiedDuration){d.proxiedDuration=d.duration}d.animated=a.isFunction(d.proxied)?d.proxied(f):d.proxied;d.duration=a.isFunction(d.proxiedDuration)?d.proxiedDuration(f):d.proxiedDuration;var l=a.ui.accordion.animations,e=d.duration,h=d.animated;if(!l[h]){l[h]=function(n){this.slide(n,{easing:h,duration:e||700})}}l[h](f)}else{if(d.collapsible&&j){b.toggle()}else{i.hide();b.show()}c(true)}i.prev().attr("aria-expanded","false").attr("tabIndex","-1").blur();b.prev().attr("aria-expanded","true").attr("tabIndex","0").focus()},_completed:function(b){var c=this.options;this.running=b?0:--this.running;if(this.running){return}if(c.clearStyle){this.toShow.add(this.toHide).css({height:"",overflow:""})}this._trigger("change",null,this.data)}});a.extend(a.ui.accordion,{version:"1.7.1",defaults:{active:null,alwaysOpen:true,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()==location.href.toLowerCase()}},animations:{slide:function(j,h){j=a.extend({easing:"swing",duration:300},j,h);if(!j.toHide.size()){j.toShow.animate({height:"show"},j);return}if(!j.toShow.size()){j.toHide.animate({height:"hide"},j);return}var c=j.toShow.css("overflow"),g,d={},f={},e=["height","paddingTop","paddingBottom"],b;var i=j.toShow;b=i[0].style.width;i.width(parseInt(i.parent().width(),10)-parseInt(i.css("paddingLeft"),10)-parseInt(i.css("paddingRight"),10)-(parseInt(i.css("borderLeftWidth"),10)||0)-(parseInt(i.css("borderRightWidth"),10)||0));a.each(e,function(k,m){f[m]="hide";var l=(""+a.css(j.toShow[0],m)).match(/^([\d+-.]+)(.*)$/);d[m]={value:l[1],unit:l[2]||"px"}});j.toShow.css({height:0,overflow:"hidden"}).show();j.toHide.filter(":hidden").each(j.complete).end().filter(":visible").animate(f,{step:function(k,l){if(l.prop=="height"){g=(l.now-l.start)/(l.end-l.start)}j.toShow[0].style[l.prop]=(g*d[l.prop].value)+d[l.prop].unit},duration:j.duration,easing:j.easing,complete:function(){if(!j.autoHeight){j.toShow.css("height","")}j.toShow.css("width",b);j.toShow.css({overflow:c});j.complete()}})},bounceslide:function(b){this.slide(b,{easing:b.down?"easeOutBounce":"swing",duration:b.down?1000:200})},easeslide:function(b){this.slide(b,{easing:"easeinout",duration:700})}}})})(jQuery);(function($){$.extend($.ui,{datepicker:{version:"1.7.1"}});var PROP_NAME="datepicker";function Datepicker(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._datepickerShowing=false;this._inDialog=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass="ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],dateFormat:"mm/dd/yy",firstDay:0,isRTL:false};this._defaults={showOn:"focus",showAnim:"show",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,showMonthAfterYear:false,yearRange:"-10:+10",showOtherMonths:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"normal",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false};$.extend(this._defaults,this.regional[""]);this.dpDiv=$('
    ')}$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",log:function(){if(this.debug){console.log.apply("",arguments)}},setDefaults:function(settings){extendRemove(this._defaults,settings||{});return this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase();var inline=(nodeName=="div"||nodeName=="span");if(!target.id){target.id="dp"+(++this.uuid)}var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{});if(nodeName=="input"){this._connectDatepicker(target,inst)}else{if(inline){this._inlineDatepicker(target,inst)}}},_newInst:function(target,inline){var id=target[0].id.replace(/([:\[\]\.])/g,"\\\\$1");return{id:id,input:target,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:inline,dpDiv:(!inline?this.dpDiv:$('
    '))}},_connectDatepicker:function(target,inst){var input=$(target);inst.trigger=$([]);if(input.hasClass(this.markerClassName)){return}var appendText=this._get(inst,"appendText");var isRTL=this._get(inst,"isRTL");if(appendText){input[isRTL?"before":"after"](''+appendText+"")}var showOn=this._get(inst,"showOn");if(showOn=="focus"||showOn=="both"){input.focus(this._showDatepicker)}if(showOn=="button"||showOn=="both"){var buttonText=this._get(inst,"buttonText");var buttonImage=this._get(inst,"buttonImage");inst.trigger=$(this._get(inst,"buttonImageOnly")?$("").addClass(this._triggerClass).attr({src:buttonImage,alt:buttonText,title:buttonText}):$('').addClass(this._triggerClass).html(buttonImage==""?buttonText:$("").attr({src:buttonImage,alt:buttonText,title:buttonText})));input[isRTL?"before":"after"](inst.trigger);inst.trigger.click(function(){if($.datepicker._datepickerShowing&&$.datepicker._lastInput==target){$.datepicker._hideDatepicker()}else{$.datepicker._showDatepicker(target)}return false})}input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst)},_inlineDatepicker:function(target,inst){var divSpan=$(target);if(divSpan.hasClass(this.markerClassName)){return}divSpan.addClass(this.markerClassName).append(inst.dpDiv).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst);this._setDate(inst,this._getDefaultDate(inst));this._updateDatepicker(inst);this._updateAlternate(inst)},_dialogDatepicker:function(input,dateText,onSelect,settings,pos){var inst=this._dialogInst;if(!inst){var id="dp"+(++this.uuid);this._dialogInput=$('');this._dialogInput.keydown(this._doKeyDown);$("body").append(this._dialogInput);inst=this._dialogInst=this._newInst(this._dialogInput,false);inst.settings={};$.data(this._dialogInput[0],PROP_NAME,inst)}extendRemove(inst.settings,settings||{});this._dialogInput.val(dateText);this._pos=(pos?(pos.length?pos:[pos.pageX,pos.pageY]):null);if(!this._pos){var browserWidth=window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth;var browserHeight=window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight;var scrollX=document.documentElement.scrollLeft||document.body.scrollLeft;var scrollY=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[(browserWidth/2)-100+scrollX,(browserHeight/2)-150+scrollY]}this._dialogInput.css("left",this._pos[0]+"px").css("top",this._pos[1]+"px");inst.settings.onSelect=onSelect;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);if($.blockUI){$.blockUI(this.dpDiv)}$.data(this._dialogInput[0],PROP_NAME,inst);return this},_destroyDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();$.removeData(target,PROP_NAME);if(nodeName=="input"){inst.trigger.remove();$target.siblings("."+this._appendClass).remove().end().removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress)}else{if(nodeName=="div"||nodeName=="span"){$target.removeClass(this.markerClassName).empty()}}},_enableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=false;inst.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().removeClass("ui-state-disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)})},_disableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=true;inst.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().addClass("ui-state-disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)});this._disabledInputs[this._disabledInputs.length]=target},_isDisabledDatepicker:function(target){if(!target){return false}for(var i=0;i-1)}},_showDatepicker:function(input){input=input.target||input;if(input.nodeName.toLowerCase()!="input"){input=$("input",input.parentNode)[0]}if($.datepicker._isDisabledDatepicker(input)||$.datepicker._lastInput==input){return}var inst=$.datepicker._getInst(input);var beforeShow=$.datepicker._get(inst,"beforeShow");extendRemove(inst.settings,(beforeShow?beforeShow.apply(input,[input,inst]):{}));$.datepicker._hideDatepicker(null,"");$.datepicker._lastInput=input;$.datepicker._setDateFromField(inst);if($.datepicker._inDialog){input.value=""}if(!$.datepicker._pos){$.datepicker._pos=$.datepicker._findPos(input);$.datepicker._pos[1]+=input.offsetHeight}var isFixed=false;$(input).parents().each(function(){isFixed|=$(this).css("position")=="fixed";return !isFixed});if(isFixed&&$.browser.opera){$.datepicker._pos[0]-=document.documentElement.scrollLeft;$.datepicker._pos[1]-=document.documentElement.scrollTop}var offset={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null;inst.rangeStart=null;inst.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});$.datepicker._updateDatepicker(inst);offset=$.datepicker._checkOffset(inst,offset,isFixed);inst.dpDiv.css({position:($.datepicker._inDialog&&$.blockUI?"static":(isFixed?"fixed":"absolute")),display:"none",left:offset.left+"px",top:offset.top+"px"});if(!inst.inline){var showAnim=$.datepicker._get(inst,"showAnim")||"show";var duration=$.datepicker._get(inst,"duration");var postProcess=function(){$.datepicker._datepickerShowing=true;if($.browser.msie&&parseInt($.browser.version,10)<7){$("iframe.ui-datepicker-cover").css({width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4})}};if($.effects&&$.effects[showAnim]){inst.dpDiv.show(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[showAnim](duration,postProcess)}if(duration==""){postProcess()}if(inst.input[0].type!="hidden"){inst.input[0].focus()}$.datepicker._curInst=inst}},_updateDatepicker:function(inst){var dims={width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4};var self=this;inst.dpDiv.empty().append(this._generateHTML(inst)).find("iframe.ui-datepicker-cover").css({width:dims.width,height:dims.height}).end().find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){$(this).removeClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).removeClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).removeClass("ui-datepicker-next-hover")}}).bind("mouseover",function(){if(!self._isDisabledDatepicker(inst.inline?inst.dpDiv.parent()[0]:inst.input[0])){$(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");$(this).addClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).addClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).addClass("ui-datepicker-next-hover")}}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();var numMonths=this._getNumberOfMonths(inst);var cols=numMonths[1];var width=17;if(cols>1){inst.dpDiv.addClass("ui-datepicker-multi-"+cols).css("width",(width*cols)+"em")}else{inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("")}inst.dpDiv[(numMonths[0]!=1||numMonths[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");inst.dpDiv[(this._get(inst,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");if(inst.input&&inst.input[0].type!="hidden"&&inst==$.datepicker._curInst){$(inst.input[0]).focus()}},_checkOffset:function(inst,offset,isFixed){var dpWidth=inst.dpDiv.outerWidth();var dpHeight=inst.dpDiv.outerHeight();var inputWidth=inst.input?inst.input.outerWidth():0;var inputHeight=inst.input?inst.input.outerHeight():0;var viewWidth=(window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth)+$(document).scrollLeft();var viewHeight=(window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight)+$(document).scrollTop();offset.left-=(this._get(inst,"isRTL")?(dpWidth-inputWidth):0);offset.left-=(isFixed&&offset.left==inst.input.offset().left)?$(document).scrollLeft():0;offset.top-=(isFixed&&offset.top==(inst.input.offset().top+inputHeight))?$(document).scrollTop():0;offset.left-=(offset.left+dpWidth>viewWidth&&viewWidth>dpWidth)?Math.abs(offset.left+dpWidth-viewWidth):0;offset.top-=(offset.top+dpHeight>viewHeight&&viewHeight>dpHeight)?Math.abs(offset.top+dpHeight+inputHeight*2-viewHeight):0;return offset},_findPos:function(obj){while(obj&&(obj.type=="hidden"||obj.nodeType!=1)){obj=obj.nextSibling}var position=$(obj).offset();return[position.left,position.top]},_hideDatepicker:function(input,duration){var inst=this._curInst;if(!inst||(input&&inst!=$.data(input,PROP_NAME))){return}if(inst.stayOpen){this._selectDate("#"+inst.id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear))}inst.stayOpen=false;if(this._datepickerShowing){duration=(duration!=null?duration:this._get(inst,"duration"));var showAnim=this._get(inst,"showAnim");var postProcess=function(){$.datepicker._tidyDialog(inst)};if(duration!=""&&$.effects&&$.effects[showAnim]){inst.dpDiv.hide(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[(duration==""?"hide":(showAnim=="slideDown"?"slideUp":(showAnim=="fadeIn"?"fadeOut":"hide")))](duration,postProcess)}if(duration==""){this._tidyDialog(inst)}var onClose=this._get(inst,"onClose");if(onClose){onClose.apply((inst.input?inst.input[0]:null),[(inst.input?inst.input.val():""),inst])}this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if($.blockUI){$.unblockUI();$("body").append(this.dpDiv)}}this._inDialog=false}this._curInst=null},_tidyDialog:function(inst){inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(event){if(!$.datepicker._curInst){return}var $target=$(event.target);if(($target.parents("#"+$.datepicker._mainDivId).length==0)&&!$target.hasClass($.datepicker.markerClassName)&&!$target.hasClass($.datepicker._triggerClass)&&$.datepicker._datepickerShowing&&!($.datepicker._inDialog&&$.blockUI)){$.datepicker._hideDatepicker(null,"")}},_adjustDate:function(id,offset,period){var target=$(id);var inst=this._getInst(target[0]);if(this._isDisabledDatepicker(target[0])){return}this._adjustInstDate(inst,offset+(period=="M"?this._get(inst,"showCurrentAtPos"):0),period);this._updateDatepicker(inst)},_gotoToday:function(id){var target=$(id);var inst=this._getInst(target[0]);if(this._get(inst,"gotoCurrent")&&inst.currentDay){inst.selectedDay=inst.currentDay;inst.drawMonth=inst.selectedMonth=inst.currentMonth;inst.drawYear=inst.selectedYear=inst.currentYear}else{var date=new Date();inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear()}this._notifyChange(inst);this._adjustDate(target)},_selectMonthYear:function(id,select,period){var target=$(id);var inst=this._getInst(target[0]);inst._selectingMonthYear=false;inst["selected"+(period=="M"?"Month":"Year")]=inst["draw"+(period=="M"?"Month":"Year")]=parseInt(select.options[select.selectedIndex].value,10);this._notifyChange(inst);this._adjustDate(target)},_clickMonthYear:function(id){var target=$(id);var inst=this._getInst(target[0]);if(inst.input&&inst._selectingMonthYear&&!$.browser.msie){inst.input[0].focus()}inst._selectingMonthYear=!inst._selectingMonthYear},_selectDay:function(id,month,year,td){var target=$(id);if($(td).hasClass(this._unselectableClass)||this._isDisabledDatepicker(target[0])){return}var inst=this._getInst(target[0]);inst.selectedDay=inst.currentDay=$("a",td).html();inst.selectedMonth=inst.currentMonth=month;inst.selectedYear=inst.currentYear=year;if(inst.stayOpen){inst.endDay=inst.endMonth=inst.endYear=null}this._selectDate(id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear));if(inst.stayOpen){inst.rangeStart=this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay));this._updateDatepicker(inst)}},_clearDate:function(id){var target=$(id);var inst=this._getInst(target[0]);inst.stayOpen=false;inst.endDay=inst.endMonth=inst.endYear=inst.rangeStart=null;this._selectDate(target,"")},_selectDate:function(id,dateStr){var target=$(id);var inst=this._getInst(target[0]);dateStr=(dateStr!=null?dateStr:this._formatDate(inst));if(inst.input){inst.input.val(dateStr)}this._updateAlternate(inst);var onSelect=this._get(inst,"onSelect");if(onSelect){onSelect.apply((inst.input?inst.input[0]:null),[dateStr,inst])}else{if(inst.input){inst.input.trigger("change")}}if(inst.inline){this._updateDatepicker(inst)}else{if(!inst.stayOpen){this._hideDatepicker(null,this._get(inst,"duration"));this._lastInput=inst.input[0];if(typeof(inst.input[0])!="object"){inst.input[0].focus()}this._lastInput=null}}},_updateAlternate:function(inst){var altField=this._get(inst,"altField");if(altField){var altFormat=this._get(inst,"altFormat")||this._get(inst,"dateFormat");var date=this._getDate(inst);dateStr=this.formatDate(altFormat,date,this._getFormatConfig(inst));$(altField).each(function(){$(this).val(dateStr)})}},noWeekends:function(date){var day=date.getDay();return[(day>0&&day<6),""]},iso8601Week:function(date){var checkDate=new Date(date.getFullYear(),date.getMonth(),date.getDate());var firstMon=new Date(checkDate.getFullYear(),1-1,4);var firstDay=firstMon.getDay()||7;firstMon.setDate(firstMon.getDate()+1-firstDay);if(firstDay<4&&checkDatenew Date(checkDate.getFullYear(),12-1,28)){firstDay=new Date(checkDate.getFullYear()+1,1-1,4).getDay()||7;if(firstDay>4&&(checkDate.getDay()||7)0&&iValue="0"&&value.charAt(iValue)<="9"){num=num*10+parseInt(value.charAt(iValue++),10);size--}if(size==origSize){throw"Missing number at position "+iValue}return num};var getName=function(match,shortNames,longNames){var names=(lookAhead(match)?longNames:shortNames);var size=0;for(var j=0;j0&&iValue-1){month=1;day=doy;do{var dim=this._getDaysInMonth(year,month-1);if(day<=dim){break}month++;day-=dim}while(true)}var date=this._daylightSavingAdjust(new Date(year,month-1,day));if(date.getFullYear()!=year||date.getMonth()+1!=month||date.getDate()!=day){throw"Invalid date"}return date},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TIMESTAMP:"@",W3C:"yy-mm-dd",formatDate:function(format,date,settings){if(!date){return""}var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var lookAhead=function(match){var matches=(iFormat+1=0;m--){doy+=this._getDaysInMonth(date.getFullYear(),m)}output+=formatNumber("o",doy,3);break;case"m":output+=formatNumber("m",date.getMonth()+1,2);break;case"M":output+=formatName("M",date.getMonth(),monthNamesShort,monthNames);break;case"y":output+=(lookAhead("y")?date.getFullYear():(date.getYear()%100<10?"0":"")+date.getYear()%100);break;case"@":output+=date.getTime();break;case"'":if(lookAhead("'")){output+="'"}else{literal=true}break;default:output+=format.charAt(iFormat)}}}}return output},_possibleChars:function(format){var chars="";var literal=false;for(var iFormat=0;iFormatmaxDate?maxDate:date);return date},_determineDate:function(date,defaultDate){var offsetNumeric=function(offset){var date=new Date();date.setDate(date.getDate()+offset);return date};var offsetString=function(offset,getDaysInMonth){var date=new Date();var year=date.getFullYear();var month=date.getMonth();var day=date.getDate();var pattern=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;var matches=pattern.exec(offset);while(matches){switch(matches[2]||"d"){case"d":case"D":day+=parseInt(matches[1],10);break;case"w":case"W":day+=parseInt(matches[1],10)*7;break;case"m":case"M":month+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break;case"y":case"Y":year+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break}matches=pattern.exec(offset)}return new Date(year,month,day)};date=(date==null?defaultDate:(typeof date=="string"?offsetString(date,this._getDaysInMonth):(typeof date=="number"?(isNaN(date)?defaultDate:offsetNumeric(date)):date)));date=(date&&date.toString()=="Invalid Date"?defaultDate:date);if(date){date.setHours(0);date.setMinutes(0);date.setSeconds(0);date.setMilliseconds(0)}return this._daylightSavingAdjust(date)},_daylightSavingAdjust:function(date){if(!date){return null}date.setHours(date.getHours()>12?date.getHours()+2:0);return date},_setDate:function(inst,date,endDate){var clear=!(date);var origMonth=inst.selectedMonth;var origYear=inst.selectedYear;date=this._determineDate(date,new Date());inst.selectedDay=inst.currentDay=date.getDate();inst.drawMonth=inst.selectedMonth=inst.currentMonth=date.getMonth();inst.drawYear=inst.selectedYear=inst.currentYear=date.getFullYear();if(origMonth!=inst.selectedMonth||origYear!=inst.selectedYear){this._notifyChange(inst)}this._adjustInstDate(inst);if(inst.input){inst.input.val(clear?"":this._formatDate(inst))}},_getDate:function(inst){var startDate=(!inst.currentYear||(inst.input&&inst.input.val()=="")?null:this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return startDate},_generateHTML:function(inst){var today=new Date();today=this._daylightSavingAdjust(new Date(today.getFullYear(),today.getMonth(),today.getDate()));var isRTL=this._get(inst,"isRTL");var showButtonPanel=this._get(inst,"showButtonPanel");var hideIfNoPrevNext=this._get(inst,"hideIfNoPrevNext");var navigationAsDateFormat=this._get(inst,"navigationAsDateFormat");var numMonths=this._getNumberOfMonths(inst);var showCurrentAtPos=this._get(inst,"showCurrentAtPos");var stepMonths=this._get(inst,"stepMonths");var stepBigMonths=this._get(inst,"stepBigMonths");var isMultiMonth=(numMonths[0]!=1||numMonths[1]!=1);var currentDate=this._daylightSavingAdjust((!inst.currentDay?new Date(9999,9,9):new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");var drawMonth=inst.drawMonth-showCurrentAtPos;var drawYear=inst.drawYear;if(drawMonth<0){drawMonth+=12;drawYear--}if(maxDate){var maxDraw=this._daylightSavingAdjust(new Date(maxDate.getFullYear(),maxDate.getMonth()-numMonths[1]+1,maxDate.getDate()));maxDraw=(minDate&&maxDrawmaxDraw){drawMonth--;if(drawMonth<0){drawMonth=11;drawYear--}}}inst.drawMonth=drawMonth;inst.drawYear=drawYear;var prevText=this._get(inst,"prevText");prevText=(!navigationAsDateFormat?prevText:this.formatDate(prevText,this._daylightSavingAdjust(new Date(drawYear,drawMonth-stepMonths,1)),this._getFormatConfig(inst)));var prev=(this._canAdjustMonth(inst,-1,drawYear,drawMonth)?''+prevText+"":(hideIfNoPrevNext?"":''+prevText+""));var nextText=this._get(inst,"nextText");nextText=(!navigationAsDateFormat?nextText:this.formatDate(nextText,this._daylightSavingAdjust(new Date(drawYear,drawMonth+stepMonths,1)),this._getFormatConfig(inst)));var next=(this._canAdjustMonth(inst,+1,drawYear,drawMonth)?''+nextText+"":(hideIfNoPrevNext?"":''+nextText+""));var currentText=this._get(inst,"currentText");var gotoDate=(this._get(inst,"gotoCurrent")&&inst.currentDay?currentDate:today);currentText=(!navigationAsDateFormat?currentText:this.formatDate(currentText,gotoDate,this._getFormatConfig(inst)));var controls=(!inst.inline?'":"");var buttonPanel=(showButtonPanel)?'
    '+(isRTL?controls:"")+(this._isInRange(inst,gotoDate)?'":"")+(isRTL?"":controls)+"
    ":"";var firstDay=parseInt(this._get(inst,"firstDay"),10);firstDay=(isNaN(firstDay)?0:firstDay);var dayNames=this._get(inst,"dayNames");var dayNamesShort=this._get(inst,"dayNamesShort");var dayNamesMin=this._get(inst,"dayNamesMin");var monthNames=this._get(inst,"monthNames");var monthNamesShort=this._get(inst,"monthNamesShort");var beforeShowDay=this._get(inst,"beforeShowDay");var showOtherMonths=this._get(inst,"showOtherMonths");var calculateWeek=this._get(inst,"calculateWeek")||this.iso8601Week;var endDate=inst.endDay?this._daylightSavingAdjust(new Date(inst.endYear,inst.endMonth,inst.endDay)):currentDate;var defaultDate=this._getDefaultDate(inst);var html="";for(var row=0;row'+(/all|left/.test(cornerClass)&&row==0?(isRTL?next:prev):"")+(/all|right/.test(cornerClass)&&row==0?(isRTL?prev:next):"")+this._generateMonthYearHeader(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,row>0||col>0,monthNames,monthNamesShort)+'';var thead="";for(var dow=0;dow<7;dow++){var day=(dow+firstDay)%7;thead+="=5?' class="ui-datepicker-week-end"':"")+'>'+dayNamesMin[day]+""}calender+=thead+"";var daysInMonth=this._getDaysInMonth(drawYear,drawMonth);if(drawYear==inst.selectedYear&&drawMonth==inst.selectedMonth){inst.selectedDay=Math.min(inst.selectedDay,daysInMonth)}var leadDays=(this._getFirstDayOfMonth(drawYear,drawMonth)-firstDay+7)%7;var numRows=(isMultiMonth?6:Math.ceil((leadDays+daysInMonth)/7));var printDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,1-leadDays));for(var dRow=0;dRow";var tbody="";for(var dow=0;dow<7;dow++){var daySettings=(beforeShowDay?beforeShowDay.apply((inst.input?inst.input[0]:null),[printDate]):[true,""]);var otherMonth=(printDate.getMonth()!=drawMonth);var unselectable=otherMonth||!daySettings[0]||(minDate&&printDatemaxDate);tbody+='";printDate.setDate(printDate.getDate()+1);printDate=this._daylightSavingAdjust(printDate)}calender+=tbody+""}drawMonth++;if(drawMonth>11){drawMonth=0;drawYear++}calender+="
    =currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?" "+this._currentClass:"")+(printDate.getTime()==today.getTime()?" ui-datepicker-today":""))+'"'+((!otherMonth||showOtherMonths)&&daySettings[2]?' title="'+daySettings[2]+'"':"")+(unselectable?"":" onclick=\"DP_jQuery.datepicker._selectDay('#"+inst.id+"',"+drawMonth+","+drawYear+', this);return false;"')+">"+(otherMonth?(showOtherMonths?printDate.getDate():" "):(unselectable?''+printDate.getDate()+"":'=currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?" ui-state-active":"")+'" href="#">'+printDate.getDate()+""))+"
    "+(isMultiMonth?""+((numMonths[0]>0&&col==numMonths[1]-1)?'
    ':""):"");group+=calender}html+=group}html+=buttonPanel+($.browser.msie&&parseInt($.browser.version,10)<7&&!inst.inline?'':"");inst._keyEvent=false;return html},_generateMonthYearHeader:function(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,secondary,monthNames,monthNamesShort){minDate=(inst.rangeStart&&minDate&&selectedDate "}else{var inMinYear=(minDate&&minDate.getFullYear()==drawYear);var inMaxYear=(maxDate&&maxDate.getFullYear()==drawYear);monthHtml+='"}if(!showMonthAfterYear){html+=monthHtml+((secondary||changeMonth||changeYear)&&(!(changeMonth&&changeYear))?" ":"")}if(secondary||!changeYear){html+=''+drawYear+""}else{var years=this._get(inst,"yearRange").split(":");var year=0;var endYear=0;if(years.length!=2){year=drawYear-10;endYear=drawYear+10}else{if(years[0].charAt(0)=="+"||years[0].charAt(0)=="-"){year=drawYear+parseInt(years[0],10);endYear=drawYear+parseInt(years[1],10)}else{year=parseInt(years[0],10);endYear=parseInt(years[1],10)}}year=(minDate?Math.max(year,minDate.getFullYear()):year);endYear=(maxDate?Math.min(endYear,maxDate.getFullYear()):endYear);html+='"}if(showMonthAfterYear){html+=(secondary||changeMonth||changeYear?" ":"")+monthHtml}html+="";return html},_adjustInstDate:function(inst,offset,period){var year=inst.drawYear+(period=="Y"?offset:0);var month=inst.drawMonth+(period=="M"?offset:0);var day=Math.min(inst.selectedDay,this._getDaysInMonth(year,month))+(period=="D"?offset:0);var date=this._daylightSavingAdjust(new Date(year,month,day));var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");date=(minDate&&datemaxDate?maxDate:date);inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();if(period=="M"||period=="Y"){this._notifyChange(inst)}},_notifyChange:function(inst){var onChange=this._get(inst,"onChangeMonthYear");if(onChange){onChange.apply((inst.input?inst.input[0]:null),[inst.selectedYear,inst.selectedMonth+1,inst])}},_getNumberOfMonths:function(inst){var numMonths=this._get(inst,"numberOfMonths");return(numMonths==null?[1,1]:(typeof numMonths=="number"?[1,numMonths]:numMonths))},_getMinMaxDate:function(inst,minMax,checkRange){var date=this._determineDate(this._get(inst,minMax+"Date"),null);return(!checkRange||!inst.rangeStart?date:(!date||inst.rangeStart>date?inst.rangeStart:date))},_getDaysInMonth:function(year,month){return 32-new Date(year,month,32).getDate()},_getFirstDayOfMonth:function(year,month){return new Date(year,month,1).getDay()},_canAdjustMonth:function(inst,offset,curYear,curMonth){var numMonths=this._getNumberOfMonths(inst);var date=this._daylightSavingAdjust(new Date(curYear,curMonth+(offset<0?offset:numMonths[1]),1));if(offset<0){date.setDate(this._getDaysInMonth(date.getFullYear(),date.getMonth()))}return this._isInRange(inst,date)},_isInRange:function(inst,date){var newMinDate=(!inst.rangeStart?null:this._daylightSavingAdjust(new Date(inst.selectedYear,inst.selectedMonth,inst.selectedDay)));newMinDate=(newMinDate&&inst.rangeStart=minDate)&&(!maxDate||date<=maxDate))},_getFormatConfig:function(inst){var shortYearCutoff=this._get(inst,"shortYearCutoff");shortYearCutoff=(typeof shortYearCutoff!="string"?shortYearCutoff:new Date().getFullYear()%100+parseInt(shortYearCutoff,10));return{shortYearCutoff:shortYearCutoff,dayNamesShort:this._get(inst,"dayNamesShort"),dayNames:this._get(inst,"dayNames"),monthNamesShort:this._get(inst,"monthNamesShort"),monthNames:this._get(inst,"monthNames")}},_formatDate:function(inst,day,month,year){if(!day){inst.currentDay=inst.selectedDay;inst.currentMonth=inst.selectedMonth;inst.currentYear=inst.selectedYear}var date=(day?(typeof day=="object"?day:this._daylightSavingAdjust(new Date(year,month,day))):this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return this.formatDate(this._get(inst,"dateFormat"),date,this._getFormatConfig(inst))}});function extendRemove(target,props){$.extend(target,props);for(var name in props){if(props[name]==null||props[name]==undefined){target[name]=props[name]}}return target}function isArray(a){return(a&&(($.browser.safari&&typeof a=="object"&&a.length)||(a.constructor&&a.constructor.toString().match(/\Array\(\)/))))}$.fn.datepicker=function(options){if(!$.datepicker.initialized){$(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv);$.datepicker.initialized=true}var otherArgs=Array.prototype.slice.call(arguments,1);if(typeof options=="string"&&(options=="isDisabled"||options=="getDate")){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}return this.each(function(){typeof options=="string"?$.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this].concat(otherArgs)):$.datepicker._attachDatepicker(this,options)})};$.datepicker=new Datepicker();$.datepicker.initialized=false;$.datepicker.uuid=new Date().getTime();$.datepicker.version="1.7.1";window.DP_jQuery=$})(jQuery);(function(c){var b={dragStart:"start.draggable",drag:"drag.draggable",dragStop:"stop.draggable",maxHeight:"maxHeight.resizable",minHeight:"minHeight.resizable",maxWidth:"maxWidth.resizable",minWidth:"minWidth.resizable",resizeStart:"start.resizable",resize:"drag.resizable",resizeStop:"stop.resizable"},a="ui-dialog ui-widget ui-widget-content ui-corner-all ";c.widget("ui.dialog",{_init:function(){this.originalTitle=this.element.attr("title");var l=this,m=this.options,j=m.title||this.originalTitle||" ",e=c.ui.dialog.getTitleId(this.element),k=(this.uiDialog=c("
    ")).appendTo(document.body).hide().addClass(a+m.dialogClass).css({position:"absolute",overflow:"hidden",zIndex:m.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(n){(m.closeOnEscape&&n.keyCode&&n.keyCode==c.ui.keyCode.ESCAPE&&l.close(n))}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(n){l.moveToTop(false,n)}),g=this.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(k),f=(this.uiDialogTitlebar=c("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(k),i=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){i.addClass("ui-state-hover")},function(){i.removeClass("ui-state-hover")}).focus(function(){i.addClass("ui-state-focus")}).blur(function(){i.removeClass("ui-state-focus")}).mousedown(function(n){n.stopPropagation()}).click(function(n){l.close(n);return false}).appendTo(f),h=(this.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(m.closeText).appendTo(i),d=c("").addClass("ui-dialog-title").attr("id",e).html(j).prependTo(f);f.find("*").add(f).disableSelection();(m.draggable&&c.fn.draggable&&this._makeDraggable());(m.resizable&&c.fn.resizable&&this._makeResizable());this._createButtons(m.buttons);this._isOpen=false;(m.bgiframe&&c.fn.bgiframe&&k.bgiframe());(m.autoOpen&&this.open())},destroy:function(){(this.overlay&&this.overlay.destroy());this.uiDialog.hide();this.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");this.uiDialog.remove();(this.originalTitle&&this.element.attr("title",this.originalTitle))},close:function(e){var d=this;if(false===d._trigger("beforeclose",e)){return}(d.overlay&&d.overlay.destroy());d.uiDialog.unbind("keypress.ui-dialog");(d.options.hide?d.uiDialog.hide(d.options.hide,function(){d._trigger("close",e)}):d.uiDialog.hide()&&d._trigger("close",e));c.ui.dialog.overlay.resize();d._isOpen=false},isOpen:function(){return this._isOpen},moveToTop:function(f,e){if((this.options.modal&&!f)||(!this.options.stack&&!this.options.modal)){return this._trigger("focus",e)}if(this.options.zIndex>c.ui.dialog.maxZ){c.ui.dialog.maxZ=this.options.zIndex}(this.overlay&&this.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=++c.ui.dialog.maxZ));var d={scrollTop:this.element.attr("scrollTop"),scrollLeft:this.element.attr("scrollLeft")};this.uiDialog.css("z-index",++c.ui.dialog.maxZ);this.element.attr(d);this._trigger("focus",e)},open:function(){if(this._isOpen){return}var e=this.options,d=this.uiDialog;this.overlay=e.modal?new c.ui.dialog.overlay(this):null;(d.next().length&&d.appendTo("body"));this._size();this._position(e.position);d.show(e.show);this.moveToTop(true);(e.modal&&d.bind("keypress.ui-dialog",function(h){if(h.keyCode!=c.ui.keyCode.TAB){return}var g=c(":tabbable",this),i=g.filter(":first")[0],f=g.filter(":last")[0];if(h.target==f&&!h.shiftKey){setTimeout(function(){i.focus()},1)}else{if(h.target==i&&h.shiftKey){setTimeout(function(){f.focus()},1)}}}));c([]).add(d.find(".ui-dialog-content :tabbable:first")).add(d.find(".ui-dialog-buttonpane :tabbable:first")).add(d).filter(":first").focus();this._trigger("open");this._isOpen=true},_createButtons:function(g){var f=this,d=false,e=c("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");this.uiDialog.find(".ui-dialog-buttonpane").remove();(typeof g=="object"&&g!==null&&c.each(g,function(){return !(d=true)}));if(d){c.each(g,function(h,i){c('').addClass("ui-state-default ui-corner-all").text(h).click(function(){i.apply(f.element[0],arguments)}).hover(function(){c(this).addClass("ui-state-hover")},function(){c(this).removeClass("ui-state-hover")}).focus(function(){c(this).addClass("ui-state-focus")}).blur(function(){c(this).removeClass("ui-state-focus")}).appendTo(e)});e.appendTo(this.uiDialog)}},_makeDraggable:function(){var d=this,f=this.options,e;this.uiDialog.draggable({cancel:".ui-dialog-content",handle:".ui-dialog-titlebar",containment:"document",start:function(){e=f.height;c(this).height(c(this).height()).addClass("ui-dialog-dragging");(f.dragStart&&f.dragStart.apply(d.element[0],arguments))},drag:function(){(f.drag&&f.drag.apply(d.element[0],arguments))},stop:function(){c(this).removeClass("ui-dialog-dragging").height(e);(f.dragStop&&f.dragStop.apply(d.element[0],arguments));c.ui.dialog.overlay.resize()}})},_makeResizable:function(g){g=(g===undefined?this.options.resizable:g);var d=this,f=this.options,e=typeof g=="string"?g:"n,e,s,w,se,sw,ne,nw";this.uiDialog.resizable({cancel:".ui-dialog-content",alsoResize:this.element,maxWidth:f.maxWidth,maxHeight:f.maxHeight,minWidth:f.minWidth,minHeight:f.minHeight,start:function(){c(this).addClass("ui-dialog-resizing");(f.resizeStart&&f.resizeStart.apply(d.element[0],arguments))},resize:function(){(f.resize&&f.resize.apply(d.element[0],arguments))},handles:e,stop:function(){c(this).removeClass("ui-dialog-resizing");f.height=c(this).height();f.width=c(this).width();(f.resizeStop&&f.resizeStop.apply(d.element[0],arguments));c.ui.dialog.overlay.resize()}}).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_position:function(i){var e=c(window),f=c(document),g=f.scrollTop(),d=f.scrollLeft(),h=g;if(c.inArray(i,["center","top","right","bottom","left"])>=0){i=[i=="right"||i=="left"?i:"center",i=="top"||i=="bottom"?i:"middle"]}if(i.constructor!=Array){i=["center","middle"]}if(i[0].constructor==Number){d+=i[0]}else{switch(i[0]){case"left":d+=0;break;case"right":d+=e.width()-this.uiDialog.outerWidth();break;default:case"center":d+=(e.width()-this.uiDialog.outerWidth())/2}}if(i[1].constructor==Number){g+=i[1]}else{switch(i[1]){case"top":g+=0;break;case"bottom":g+=e.height()-this.uiDialog.outerHeight();break;default:case"middle":g+=(e.height()-this.uiDialog.outerHeight())/2}}g=Math.max(g,h);this.uiDialog.css({top:g,left:d})},_setData:function(e,f){(b[e]&&this.uiDialog.data(b[e],f));switch(e){case"buttons":this._createButtons(f);break;case"closeText":this.uiDialogTitlebarCloseText.text(f);break;case"dialogClass":this.uiDialog.removeClass(this.options.dialogClass).addClass(a+f);break;case"draggable":(f?this._makeDraggable():this.uiDialog.draggable("destroy"));break;case"height":this.uiDialog.height(f);break;case"position":this._position(f);break;case"resizable":var d=this.uiDialog,g=this.uiDialog.is(":data(resizable)");(g&&!f&&d.resizable("destroy"));(g&&typeof f=="string"&&d.resizable("option","handles",f));(g||this._makeResizable(f));break;case"title":c(".ui-dialog-title",this.uiDialogTitlebar).html(f||" ");break;case"width":this.uiDialog.width(f);break}c.widget.prototype._setData.apply(this,arguments)},_size:function(){var e=this.options;this.element.css({height:0,minHeight:0,width:"auto"});var d=this.uiDialog.css({height:"auto",width:e.width}).height();this.element.css({minHeight:Math.max(e.minHeight-d,0),height:e.height=="auto"?"auto":Math.max(e.height-d,0)})}});c.extend(c.ui.dialog,{version:"1.7.1",defaults:{autoOpen:true,bgiframe:false,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:"center",resizable:true,show:null,stack:true,title:"",width:300,zIndex:1000},getter:"isOpen",uuid:0,maxZ:0,getTitleId:function(d){return"ui-dialog-title-"+(d.attr("id")||++this.uuid)},overlay:function(d){this.$el=c.ui.dialog.overlay.create(d)}});c.extend(c.ui.dialog.overlay,{instances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(d){return d+".dialog-overlay"}).join(" "),create:function(e){if(this.instances.length===0){setTimeout(function(){c(document).bind(c.ui.dialog.overlay.events,function(f){var g=c(f.target).parents(".ui-dialog").css("zIndex")||0;return(g>c.ui.dialog.overlay.maxZ)})},1);c(document).bind("keydown.dialog-overlay",function(f){(e.options.closeOnEscape&&f.keyCode&&f.keyCode==c.ui.keyCode.ESCAPE&&e.close(f))});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var d=c("
    ").appendTo(document.body).addClass("ui-widget-overlay").css({width:this.width(),height:this.height()});(e.options.bgiframe&&c.fn.bgiframe&&d.bgiframe());this.instances.push(d);return d},destroy:function(d){this.instances.splice(c.inArray(this.instances,d),1);if(this.instances.length===0){c([document,window]).unbind(".dialog-overlay")}d.remove()},height:function(){if(c.browser.msie&&c.browser.version<7){var e=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);var d=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(e
    ').appendTo(this.element);this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow").removeData("progressbar").unbind(".progressbar");this.valueDiv.remove();a.widget.prototype.destroy.apply(this,arguments)},value:function(b){arguments.length&&this._setData("value",b);return this._value()},_setData:function(b,c){switch(b){case"value":this.options.value=c;this._refreshValue();this._trigger("change",null,{});break}a.widget.prototype._setData.apply(this,arguments)},_value:function(){var b=this.options.value;if(bthis._valueMax()){b=this._valueMax()}return b},_valueMin:function(){var b=0;return b},_valueMax:function(){var b=100;return b},_refreshValue:function(){var b=this.value();this.valueDiv[b==this._valueMax()?"addClass":"removeClass"]("ui-corner-right");this.valueDiv.width(b+"%");this.element.attr("aria-valuenow",b)}});a.extend(a.ui.progressbar,{version:"1.7.1",defaults:{value:0}})})(jQuery);(function(a){a.widget("ui.slider",a.extend({},a.ui.mouse,{_init:function(){var b=this,c=this.options;this._keySliding=false;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");this.range=a([]);if(c.range){if(c.range===true){this.range=a("
    ");if(!c.values){c.values=[this._valueMin(),this._valueMin()]}if(c.values.length&&c.values.length!=2){c.values=[c.values[0],c.values[0]]}}else{this.range=a("
    ")}this.range.appendTo(this.element).addClass("ui-slider-range");if(c.range=="min"||c.range=="max"){this.range.addClass("ui-slider-range-"+c.range)}this.range.addClass("ui-widget-header")}if(a(".ui-slider-handle",this.element).length==0){a('
    ').appendTo(this.element).addClass("ui-slider-handle")}if(c.values&&c.values.length){while(a(".ui-slider-handle",this.element).length').appendTo(this.element).addClass("ui-slider-handle")}}this.handles=a(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(d){d.preventDefault()}).hover(function(){a(this).addClass("ui-state-hover")},function(){a(this).removeClass("ui-state-hover")}).focus(function(){a(".ui-slider .ui-state-focus").removeClass("ui-state-focus");a(this).addClass("ui-state-focus")}).blur(function(){a(this).removeClass("ui-state-focus")});this.handles.each(function(d){a(this).data("index.ui-slider-handle",d)});this.handles.keydown(function(i){var f=true;var e=a(this).data("index.ui-slider-handle");if(b.options.disabled){return}switch(i.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:f=false;if(!b._keySliding){b._keySliding=true;a(this).addClass("ui-state-active");b._start(i,e)}break}var g,d,h=b._step();if(b.options.values&&b.options.values.length){g=d=b.values(e)}else{g=d=b.value()}switch(i.keyCode){case a.ui.keyCode.HOME:d=b._valueMin();break;case a.ui.keyCode.END:d=b._valueMax();break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(g==b._valueMax()){return}d=g+h;break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(g==b._valueMin()){return}d=g-h;break}b._slide(i,e,d);return f}).keyup(function(e){var d=a(this).data("index.ui-slider-handle");if(b._keySliding){b._stop(e,d);b._change(e,d);b._keySliding=false;a(this).removeClass("ui-state-active")}});this._refreshValue()},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy()},_mouseCapture:function(d){var e=this.options;if(e.disabled){return false}this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();var h={x:d.pageX,y:d.pageY};var j=this._normValueFromMouse(h);var c=this._valueMax()-this._valueMin()+1,f;var k=this,i;this.handles.each(function(l){var m=Math.abs(j-k.values(l));if(c>m){c=m;f=a(this);i=l}});if(e.range==true&&this.values(1)==e.min){f=a(this.handles[++i])}this._start(d,i);k._handleIndex=i;f.addClass("ui-state-active").focus();var g=f.offset();var b=!a(d.target).parents().andSelf().is(".ui-slider-handle");this._clickOffset=b?{left:0,top:0}:{left:d.pageX-g.left-(f.width()/2),top:d.pageY-g.top-(f.height()/2)-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};j=this._normValueFromMouse(h);this._slide(d,i,j);return true},_mouseStart:function(b){return true},_mouseDrag:function(d){var b={x:d.pageX,y:d.pageY};var c=this._normValueFromMouse(b);this._slide(d,this._handleIndex,c);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._handleIndex=null;this._clickOffset=null;return false},_detectOrientation:function(){this.orientation=this.options.orientation=="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(d){var c,h;if("horizontal"==this.orientation){c=this.elementSize.width;h=d.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{c=this.elementSize.height;h=d.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}var f=(h/c);if(f>1){f=1}if(f<0){f=0}if("vertical"==this.orientation){f=1-f}var e=this._valueMax()-this._valueMin(),i=f*e,b=i%this.options.step,g=this._valueMin()+i-b;if(b>(this.options.step/2)){g+=this.options.step}return parseFloat(g.toFixed(5))},_start:function(d,c){var b={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){b.value=this.values(c);b.values=this.values()}this._trigger("start",d,b)},_slide:function(f,e,d){var g=this.handles[e];if(this.options.values&&this.options.values.length){var b=this.values(e?0:1);if((e==0&&d>=b)||(e==1&&d<=b)){d=b}if(d!=this.values(e)){var c=this.values();c[e]=d;var h=this._trigger("slide",f,{handle:this.handles[e],value:d,values:c});var b=this.values(e?0:1);if(h!==false){this.values(e,d,(f.type=="mousedown"&&this.options.animate),true)}}}else{if(d!=this.value()){var h=this._trigger("slide",f,{handle:this.handles[e],value:d});if(h!==false){this._setData("value",d,(f.type=="mousedown"&&this.options.animate))}}}},_stop:function(d,c){var b={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){b.value=this.values(c);b.values=this.values()}this._trigger("stop",d,b)},_change:function(d,c){var b={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){b.value=this.values(c);b.values=this.values()}this._trigger("change",d,b)},value:function(b){if(arguments.length){this._setData("value",b);this._change(null,0)}return this._value()},values:function(b,e,c,d){if(arguments.length>1){this.options.values[b]=e;this._refreshValue(c);if(!d){this._change(null,b)}}if(arguments.length){if(this.options.values&&this.options.values.length){return this._values(b)}else{return this.value()}}else{return this._values()}},_setData:function(b,d,c){a.widget.prototype._setData.apply(this,arguments);switch(b){case"orientation":this._detectOrientation();this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue(c);break;case"value":this._refreshValue(c);break}},_step:function(){var b=this.options.step;return b},_value:function(){var b=this.options.value;if(bthis._valueMax()){b=this._valueMax()}return b},_values:function(b){if(arguments.length){var c=this.options.values[b];if(cthis._valueMax()){c=this._valueMax()}return c}else{return this.options.values}},_valueMin:function(){var b=this.options.min;return b},_valueMax:function(){var b=this.options.max;return b},_refreshValue:function(c){var f=this.options.range,d=this.options,l=this;if(this.options.values&&this.options.values.length){var i,h;this.handles.each(function(p,n){var o=(l.values(p)-l._valueMin())/(l._valueMax()-l._valueMin())*100;var m={};m[l.orientation=="horizontal"?"left":"bottom"]=o+"%";a(this).stop(1,1)[c?"animate":"css"](m,d.animate);if(l.options.range===true){if(l.orientation=="horizontal"){(p==0)&&l.range.stop(1,1)[c?"animate":"css"]({left:o+"%"},d.animate);(p==1)&&l.range[c?"animate":"css"]({width:(o-lastValPercent)+"%"},{queue:false,duration:d.animate})}else{(p==0)&&l.range.stop(1,1)[c?"animate":"css"]({bottom:(o)+"%"},d.animate);(p==1)&&l.range[c?"animate":"css"]({height:(o-lastValPercent)+"%"},{queue:false,duration:d.animate})}}lastValPercent=o})}else{var j=this.value(),g=this._valueMin(),k=this._valueMax(),e=k!=g?(j-g)/(k-g)*100:0;var b={};b[l.orientation=="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[c?"animate":"css"](b,d.animate);(f=="min")&&(this.orientation=="horizontal")&&this.range.stop(1,1)[c?"animate":"css"]({width:e+"%"},d.animate);(f=="max")&&(this.orientation=="horizontal")&&this.range[c?"animate":"css"]({width:(100-e)+"%"},{queue:false,duration:d.animate});(f=="min")&&(this.orientation=="vertical")&&this.range.stop(1,1)[c?"animate":"css"]({height:e+"%"},d.animate);(f=="max")&&(this.orientation=="vertical")&&this.range[c?"animate":"css"]({height:(100-e)+"%"},{queue:false,duration:d.animate})}}}));a.extend(a.ui.slider,{getter:"value values",version:"1.7.1",eventPrefix:"slide",defaults:{animate:false,delay:0,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null}})})(jQuery);(function(a){a.widget("ui.tabs",{_init:function(){if(this.options.deselectable!==undefined){this.options.collapsible=this.options.deselectable}this._tabify(true)},_setData:function(b,c){if(b=="selected"){if(this.options.collapsible&&c==this.options.selected){return}this.select(c)}else{this.options[b]=c;if(b=="deselectable"){this.options.collapsible=c}this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^A-Za-z0-9\-_:\.]/g,"")||this.options.idPrefix+a.data(b)},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+a.data(this.list[0]));return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(c,b){return{tab:c,panel:b,index:this.anchors.index(c)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=a(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(n){this.list=this.element.children("ul:first");this.lis=a("li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return a("a",this)[0]});this.panels=a([]);var p=this,d=this.options;var c=/^#.+/;this.anchors.each(function(r,o){var q=a(o).attr("href");var s=q.split("#")[0],u;if(s&&(s===location.toString().split("#")[0]||(u=a("base")[0])&&s===u.href)){q=o.hash;o.href=q}if(c.test(q)){p.panels=p.panels.add(p._sanitizeSelector(q))}else{if(q!="#"){a.data(o,"href.tabs",q);a.data(o,"load.tabs",q.replace(/#.*$/,""));var w=p._tabId(o);o.href="#"+w;var v=a("#"+w);if(!v.length){v=a(d.panelTemplate).attr("id",w).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(p.panels[r-1]||p.list);v.data("destroy.tabs",true)}p.panels=p.panels.add(v)}else{d.disabled.push(r)}}});if(n){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(d.selected===undefined){if(location.hash){this.anchors.each(function(q,o){if(o.hash==location.hash){d.selected=q;return false}})}if(typeof d.selected!="number"&&d.cookie){d.selected=parseInt(p._cookie(),10)}if(typeof d.selected!="number"&&this.lis.filter(".ui-tabs-selected").length){d.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))}d.selected=d.selected||0}else{if(d.selected===null){d.selected=-1}}d.selected=((d.selected>=0&&this.anchors[d.selected])||d.selected<0)?d.selected:0;d.disabled=a.unique(d.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(q,o){return p.lis.index(q)}))).sort();if(a.inArray(d.selected,d.disabled)!=-1){d.disabled.splice(a.inArray(d.selected,d.disabled),1)}this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");if(d.selected>=0&&this.anchors.length){this.panels.eq(d.selected).removeClass("ui-tabs-hide");this.lis.eq(d.selected).addClass("ui-tabs-selected ui-state-active");p.element.queue("tabs",function(){p._trigger("show",null,p._ui(p.anchors[d.selected],p.panels[d.selected]))});this.load(d.selected)}a(window).bind("unload",function(){p.lis.add(p.anchors).unbind(".tabs");p.lis=p.anchors=p.panels=null})}else{d.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))}this.element[d.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");if(d.cookie){this._cookie(d.selected,d.cookie)}for(var g=0,m;(m=this.lis[g]);g++){a(m)[a.inArray(g,d.disabled)!=-1&&!a(m).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled")}if(d.cache===false){this.anchors.removeData("cache.tabs")}this.lis.add(this.anchors).unbind(".tabs");if(d.event!="mouseover"){var f=function(o,i){if(i.is(":not(.ui-state-disabled)")){i.addClass("ui-state-"+o)}};var j=function(o,i){i.removeClass("ui-state-"+o)};this.lis.bind("mouseover.tabs",function(){f("hover",a(this))});this.lis.bind("mouseout.tabs",function(){j("hover",a(this))});this.anchors.bind("focus.tabs",function(){f("focus",a(this).closest("li"))});this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var b,h;if(d.fx){if(a.isArray(d.fx)){b=d.fx[0];h=d.fx[1]}else{b=h=d.fx}}function e(i,o){i.css({display:""});if(a.browser.msie&&o.opacity){i[0].style.removeAttribute("filter")}}var k=h?function(i,o){a(i).closest("li").removeClass("ui-state-default").addClass("ui-tabs-selected ui-state-active");o.hide().removeClass("ui-tabs-hide").animate(h,h.duration||"normal",function(){e(o,h);p._trigger("show",null,p._ui(i,o[0]))})}:function(i,o){a(i).closest("li").removeClass("ui-state-default").addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");p._trigger("show",null,p._ui(i,o[0]))};var l=b?function(o,i){i.animate(b,b.duration||"normal",function(){p.lis.removeClass("ui-tabs-selected ui-state-active").addClass("ui-state-default");i.addClass("ui-tabs-hide");e(i,b);p.element.dequeue("tabs")})}:function(o,i,q){p.lis.removeClass("ui-tabs-selected ui-state-active").addClass("ui-state-default");i.addClass("ui-tabs-hide");p.element.dequeue("tabs")};this.anchors.bind(d.event+".tabs",function(){var o=this,r=a(this).closest("li"),i=p.panels.filter(":not(.ui-tabs-hide)"),q=a(p._sanitizeSelector(this.hash));if((r.hasClass("ui-tabs-selected")&&!d.collapsible)||r.hasClass("ui-state-disabled")||r.hasClass("ui-state-processing")||p._trigger("select",null,p._ui(this,q[0]))===false){this.blur();return false}d.selected=p.anchors.index(this);p.abort();if(d.collapsible){if(r.hasClass("ui-tabs-selected")){d.selected=-1;if(d.cookie){p._cookie(d.selected,d.cookie)}p.element.queue("tabs",function(){l(o,i)}).dequeue("tabs");this.blur();return false}else{if(!i.length){if(d.cookie){p._cookie(d.selected,d.cookie)}p.element.queue("tabs",function(){k(o,q)});p.load(p.anchors.index(this));this.blur();return false}}}if(d.cookie){p._cookie(d.selected,d.cookie)}if(q.length){if(i.length){p.element.queue("tabs",function(){l(o,i)})}p.element.queue("tabs",function(){k(o,q)});p.load(p.anchors.index(this))}else{throw"jQuery UI Tabs: Mismatching fragment identifier."}if(a.browser.msie){this.blur()}});this.anchors.bind("click.tabs",function(){return false})},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var c=a.data(this,"href.tabs");if(c){this.href=c}var d=a(this).unbind(".tabs");a.each(["href","load","cache"],function(e,f){d.removeData(f+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){if(a.data(this,"destroy.tabs")){a(this).remove()}else{a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}});if(b.cookie){this._cookie(null,b.cookie)}},add:function(e,d,c){if(c===undefined){c=this.anchors.length}var b=this,g=this.options,i=a(g.tabTemplate.replace(/#\{href\}/g,e).replace(/#\{label\}/g,d)),h=!e.indexOf("#")?e.replace("#",""):this._tabId(a("a",i)[0]);i.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var f=a("#"+h);if(!f.length){f=a(g.panelTemplate).attr("id",h).data("destroy.tabs",true)}f.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(c>=this.lis.length){i.appendTo(this.list);f.appendTo(this.list[0].parentNode)}else{i.insertBefore(this.lis[c]);f.insertBefore(this.panels[c])}g.disabled=a.map(g.disabled,function(k,j){return k>=c?++k:k});this._tabify();if(this.anchors.length==1){i.addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){b._trigger("show",null,b._ui(b.anchors[0],b.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[c],this.panels[c]))},remove:function(b){var d=this.options,e=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();if(e.hasClass("ui-tabs-selected")&&this.anchors.length>1){this.select(b+(b+1=b?--g:g});this._tabify();this._trigger("remove",null,this._ui(e.find("a")[0],c[0]))},enable:function(b){var c=this.options;if(a.inArray(b,c.disabled)==-1){return}this.lis.eq(b).removeClass("ui-state-disabled");c.disabled=a.grep(c.disabled,function(e,d){return e!=b});this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b]))},disable:function(c){var b=this,d=this.options;if(c!=d.selected){this.lis.eq(c).addClass("ui-state-disabled");d.disabled.push(c);d.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[c],this.panels[c]))}},select:function(b){if(typeof b=="string"){b=this.anchors.index(this.anchors.filter("[href$="+b+"]"))}else{if(b===null){b=-1}}if(b==-1&&this.options.collapsible){b=this.options.selected}this.anchors.eq(b).trigger(this.options.event+".tabs")},load:function(e){var c=this,g=this.options,b=this.anchors.eq(e)[0],d=a.data(b,"load.tabs");this.abort();if(!d||this.element.queue("tabs").length!==0&&a.data(b,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(e).addClass("ui-state-processing");if(g.spinner){var f=a("span",b);f.data("label.tabs",f.html()).html(g.spinner)}this.xhr=a.ajax(a.extend({},g.ajaxOptions,{url:d,success:function(i,h){a(c._sanitizeSelector(b.hash)).html(i);c._cleanup();if(g.cache){a.data(b,"cache.tabs",true)}c._trigger("load",null,c._ui(c.anchors[e],c.panels[e]));try{g.ajaxOptions.success(i,h)}catch(j){}c.element.dequeue("tabs")}}))},abort:function(){this.element.queue([]);this.panels.stop(false,true);if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup()},url:function(c,b){this.anchors.eq(c).removeData("cache.tabs").data("load.tabs",b)},length:function(){return this.anchors.length}});a.extend(a.ui.tabs,{version:"1.7.1",getter:"length",defaults:{ajaxOptions:null,cache:false,cookie:null,collapsible:false,disabled:[],event:"click",fx:null,idPrefix:"ui-tabs-",panelTemplate:"
    ",spinner:"Loading…",tabTemplate:'
  • #{label}
  • '}});a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(d,f){var b=this,g=this.options;var c=b._rotate||(b._rotate=function(h){clearTimeout(b.rotation);b.rotation=setTimeout(function(){var i=g.selected;b.select(++i').insertBefore(G.headers);E('').appendTo(G.headers);G.headers.addClass("ui-accordion-header").attr("tabindex","0")}var I;if(G.fillSpace){I=this.element.parent().height();G.headers.each(function(){I-=E(this).outerHeight()});var H=0;G.headers.next().each(function(){H=Math.max(H,E(this).innerHeight()-E(this).height())}).height(I-H)}else{if(G.autoHeight){I=0;G.headers.next().each(function(){I=Math.max(I,E(this).outerHeight())}).height(I)}}G.headers.not(G.active||"").next().hide();G.active.parent().andSelf().addClass(G.selectedClass);if(G.event){this.element.bind((G.event)+".accordion",F)}},activate:function(G){F.call(this.element[0],{target:C(this.options.headers,G)[0]})},destroy:function(){this.options.headers.next().css("display","");if(this.options.fillSpace||this.options.autoHeight){this.options.headers.next().css("height","")}E.removeData(this.element[0],"accordion");this.element.removeClass("ui-accordion").unbind(".accordion")}});function B(H,G){return function(){return H.apply(G,arguments)}}function D(I){if(!E.data(this,"accordion")){return }var G=E.data(this,"accordion");var H=G.options;H.running=I?0:--H.running;if(H.running){return }if(H.clearStyle){H.toShow.add(H.toHide).css({height:"",overflow:""})}G._trigger("change",null,H.data)}function A(G,K,L,J,M){var I=E.data(this,"accordion").options;I.toShow=G;I.toHide=K;I.data=L;var H=B(D,this);E.data(this,"accordion")._trigger("changestart",null,I.data);I.running=K.size()===0?G.size():K.size();if(I.animated){if(!I.alwaysOpen&&J){E.ui.accordion.animations[I.animated]({toShow:jQuery([]),toHide:K,complete:H,down:M,autoHeight:I.autoHeight})}else{E.ui.accordion.animations[I.animated]({toShow:G,toHide:K,complete:H,down:M,autoHeight:I.autoHeight})}}else{if(!I.alwaysOpen&&J){G.toggle()}else{K.hide();G.show()}H(true)}}function F(L){var J=E.data(this,"accordion").options;if(J.disabled){return false}if(!L.target&&!J.alwaysOpen){J.active.parent().andSelf().toggleClass(J.selectedClass);var I=J.active.next(),M={options:J,newHeader:jQuery([]),oldHeader:J.active,newContent:jQuery([]),oldContent:I},G=(J.active=E([]));A.call(this,G,I,M);return false}var K=E(L.target);K=E(K.parents(J.header)[0]||K);var H=K[0]==J.active[0];if(J.running||(J.alwaysOpen&&H)){return false}if(!K.is(J.header)){return }J.active.parent().andSelf().toggleClass(J.selectedClass);if(!H){K.parent().andSelf().addClass(J.selectedClass)}var G=K.next(),I=J.active.next(),M={options:J,newHeader:H&&!J.alwaysOpen?E([]):K,oldHeader:J.active,newContent:H&&!J.alwaysOpen?E([]):G,oldContent:I},N=J.headers.index(J.active[0])>J.headers.index(K[0]);J.active=H?E([]):K;A.call(this,G,I,M,H,N);return false}function C(H,G){return G?typeof G=="number"?H.filter(":eq("+G+")"):H.not(H.not(G)):G===false?E([]):H.filter(":eq(0)")}E.extend(E.ui.accordion,{defaults:{selectedClass:"selected",alwaysOpen:true,animated:"slide",event:"click",header:"a",autoHeight:true,running:0,navigationFilter:function(){return this.href.toLowerCase()==location.href.toLowerCase()}},animations:{slide:function(G,I){G=E.extend({easing:"swing",duration:300},G,I);if(!G.toHide.size()){G.toShow.animate({height:"show"},G);return }var H=G.toHide.height(),J=G.toShow.height(),K=J/H;G.toShow.css({height:0,overflow:"hidden"}).show();G.toHide.filter(":hidden").each(G.complete).end().filter(":visible").animate({height:"hide"},{step:function(L){var M=(H-L)*K;if(E.browser.msie||E.browser.opera){M=Math.ceil(M)}G.toShow.height(M)},duration:G.duration,easing:G.easing,complete:function(){if(!G.autoHeight){G.toShow.css("height","auto")}G.complete()}})},bounceslide:function(G){this.slide(G,{easing:G.down?"bounceout":"swing",duration:G.down?1000:200})},easeslide:function(G){this.slide(G,{easing:"easeinout",duration:700})}}})})(jQuery) \ No newline at end of file +/* + * jQuery UI Accordion 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * ui.core.js + */ +(function(a){a.widget("ui.accordion",{_init:function(){var d=this.options,b=this;this.running=0;if(d.collapsible==a.ui.accordion.defaults.collapsible&&d.alwaysOpen!=a.ui.accordion.defaults.alwaysOpen){d.collapsible=!d.alwaysOpen}if(d.navigation){var c=this.element.find("a").filter(d.navigationFilter);if(c.length){if(c.filter(d.header).length){this.active=c}else{this.active=c.parent().parent().prev();c.addClass("ui-accordion-content-active")}}}this.element.addClass("ui-accordion ui-widget ui-helper-reset");if(this.element[0].nodeName=="UL"){this.element.children("li").addClass("ui-accordion-li-fix")}this.headers=this.element.find(d.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){a(this).removeClass("ui-state-focus")});this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");this.active=this._findActive(this.active||d.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");this.active.next().addClass("ui-accordion-content-active");a("").addClass("ui-icon "+d.icons.header).prependTo(this.headers);this.active.find(".ui-icon").toggleClass(d.icons.header).toggleClass(d.icons.headerSelected);if(a.browser.msie){this.element.find("a").css("zoom","1")}this.resize();this.element.attr("role","tablist");this.headers.attr("role","tab").bind("keydown",function(e){return b._keydown(e)}).next().attr("role","tabpanel");this.headers.not(this.active||"").attr("aria-expanded","false").attr("tabIndex","-1").next().hide();if(!this.active.length){this.headers.eq(0).attr("tabIndex","0")}else{this.active.attr("aria-expanded","true").attr("tabIndex","0")}if(!a.browser.safari){this.headers.find("a").attr("tabIndex","-1")}if(d.event){this.headers.bind((d.event)+".accordion",function(e){return b._clickHandler.call(b,e,this)})}},destroy:function(){var c=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role").unbind(".accordion").removeData("accordion");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");this.headers.find("a").removeAttr("tabindex");this.headers.children(".ui-icon").remove();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");if(c.autoHeight||c.fillHeight){b.css("height","")}},_setData:function(b,c){if(b=="alwaysOpen"){b="collapsible";c=!c}a.widget.prototype._setData.apply(this,arguments)},_keydown:function(e){var g=this.options,f=a.ui.keyCode;if(g.disabled||e.altKey||e.ctrlKey){return}var d=this.headers.length;var b=this.headers.index(e.target);var c=false;switch(e.keyCode){case f.RIGHT:case f.DOWN:c=this.headers[(b+1)%d];break;case f.LEFT:case f.UP:c=this.headers[(b-1+d)%d];break;case f.SPACE:case f.ENTER:return this._clickHandler({target:e.target},e.target)}if(c){a(e.target).attr("tabIndex","-1");a(c).attr("tabIndex","0");c.focus();return false}return true},resize:function(){var e=this.options,d;if(e.fillSpace){if(a.browser.msie){var b=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}d=this.element.parent().height();if(a.browser.msie){this.element.parent().css("overflow",b)}this.headers.each(function(){d-=a(this).outerHeight()});var c=0;this.headers.next().each(function(){c=Math.max(c,a(this).innerHeight()-a(this).height())}).height(Math.max(0,d-c)).css("overflow","auto")}else{if(e.autoHeight){d=0;this.headers.next().each(function(){d=Math.max(d,a(this).outerHeight())}).height(d)}}},activate:function(b){var c=this._findActive(b)[0];this._clickHandler({target:c},c)},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===false?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(b,f){var d=this.options;if(d.disabled){return false}if(!b.target&&d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var h=this.active.next(),e={options:d,newHeader:a([]),oldHeader:d.active,newContent:a([]),oldContent:h},c=(this.active=a([]));this._toggle(c,h,e);return false}var g=a(b.currentTarget||f);var i=g[0]==this.active[0];if(this.running||(!d.collapsible&&i)){return false}this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");if(!i){g.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").find(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);g.next().addClass("ui-accordion-content-active")}var c=g.next(),h=this.active.next(),e={options:d,newHeader:i&&d.collapsible?a([]):g,oldHeader:this.active,newContent:i&&d.collapsible?a([]):c.find("> *"),oldContent:h.find("> *")},j=this.headers.index(this.active[0])>this.headers.index(g[0]);this.active=i?a([]):g;this._toggle(c,h,e,i,j);return false},_toggle:function(b,i,g,j,k){var d=this.options,m=this;this.toShow=b;this.toHide=i;this.data=g;var c=function(){if(!m){return}return m._completed.apply(m,arguments)};this._trigger("changestart",null,this.data);this.running=i.size()===0?b.size():i.size();if(d.animated){var f={};if(d.collapsible&&j){f={toShow:a([]),toHide:i,complete:c,down:k,autoHeight:d.autoHeight||d.fillSpace}}else{f={toShow:b,toHide:i,complete:c,down:k,autoHeight:d.autoHeight||d.fillSpace}}if(!d.proxied){d.proxied=d.animated}if(!d.proxiedDuration){d.proxiedDuration=d.duration}d.animated=a.isFunction(d.proxied)?d.proxied(f):d.proxied;d.duration=a.isFunction(d.proxiedDuration)?d.proxiedDuration(f):d.proxiedDuration;var l=a.ui.accordion.animations,e=d.duration,h=d.animated;if(!l[h]){l[h]=function(n){this.slide(n,{easing:h,duration:e||700})}}l[h](f)}else{if(d.collapsible&&j){b.toggle()}else{i.hide();b.show()}c(true)}i.prev().attr("aria-expanded","false").attr("tabIndex","-1").blur();b.prev().attr("aria-expanded","true").attr("tabIndex","0").focus()},_completed:function(b){var c=this.options;this.running=b?0:--this.running;if(this.running){return}if(c.clearStyle){this.toShow.add(this.toHide).css({height:"",overflow:""})}this._trigger("change",null,this.data)}});a.extend(a.ui.accordion,{version:"1.7.1",defaults:{active:null,alwaysOpen:true,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()==location.href.toLowerCase()}},animations:{slide:function(j,h){j=a.extend({easing:"swing",duration:300},j,h);if(!j.toHide.size()){j.toShow.animate({height:"show"},j);return}if(!j.toShow.size()){j.toHide.animate({height:"hide"},j);return}var c=j.toShow.css("overflow"),g,d={},f={},e=["height","paddingTop","paddingBottom"],b;var i=j.toShow;b=i[0].style.width;i.width(parseInt(i.parent().width(),10)-parseInt(i.css("paddingLeft"),10)-parseInt(i.css("paddingRight"),10)-(parseInt(i.css("borderLeftWidth"),10)||0)-(parseInt(i.css("borderRightWidth"),10)||0));a.each(e,function(k,m){f[m]="hide";var l=(""+a.css(j.toShow[0],m)).match(/^([\d+-.]+)(.*)$/);d[m]={value:l[1],unit:l[2]||"px"}});j.toShow.css({height:0,overflow:"hidden"}).show();j.toHide.filter(":hidden").each(j.complete).end().filter(":visible").animate(f,{step:function(k,l){if(l.prop=="height"){g=(l.now-l.start)/(l.end-l.start)}j.toShow[0].style[l.prop]=(g*d[l.prop].value)+d[l.prop].unit},duration:j.duration,easing:j.easing,complete:function(){if(!j.autoHeight){j.toShow.css("height","")}j.toShow.css("width",b);j.toShow.css({overflow:c});j.complete()}})},bounceslide:function(b){this.slide(b,{easing:b.down?"easeOutBounce":"swing",duration:b.down?1000:200})},easeslide:function(b){this.slide(b,{easing:"easeinout",duration:700})}}})})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.core.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/ui.core.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.core.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.core.min.js 1 Apr 2009 00:45:13 -0000 1.2 @@ -1 +1,10 @@ -(function(D){var C=D.fn.remove;D.fn.remove=function(){D("*",this).add(this).triggerHandler("remove");return C.apply(this,arguments)};function B(E){function G(H){var I=H.style;return(I.display!="none"&&I.visibility!="hidden")}var F=G(E);(F&&D.each(D.dir(E,"parentNode"),function(){return(F=G(this))}));return F}D.extend(D.expr[":"],{data:function(F,G,E){return D.data(F,E[3])},tabbable:function(F,G,E){var H=F.nodeName.toLowerCase();return(F.tabIndex>=0&&(("a"==H&&F.href)||(/input|select|textarea|button/.test(H)&&"hidden"!=F.type&&!F.disabled))&&B(F))}});D.keyCode={BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38};function A(H,I,J,G){function F(L){var K=D[H][I][L]||[];return(typeof K=="string"?K.split(/,?\s+/):K)}var E=F("getter");if(G.length==1&&typeof G[0]=="string"){E=E.concat(F("getterSetter"))}return(D.inArray(J,E)!=-1)}D.widget=function(F,E){var G=F.split(".")[0];F=F.split(".")[1];D.fn[F]=function(K){var I=(typeof K=="string"),J=Array.prototype.slice.call(arguments,1);if(I&&K.substring(0,1)=="_"){return this}if(I&&A(G,F,K,J)){var H=D.data(this[0],F);return(H?H[K].apply(H,J):undefined)}return this.each(function(){var L=D.data(this,F);(!L&&!I&&D.data(this,F,new D[G][F](this,K)));(L&&I&&D.isFunction(L[K])&&L[K].apply(L,J))})};D[G][F]=function(J,I){var H=this;this.widgetName=F;this.widgetEventPrefix=D[G][F].eventPrefix||F;this.widgetBaseClass=G+"-"+F;this.options=D.extend({},D.widget.defaults,D[G][F].defaults,D.metadata&&D.metadata.get(J)[F],I);this.element=D(J).bind("setData."+F,function(M,K,L){return H._setData(K,L)}).bind("getData."+F,function(L,K){return H._getData(K)}).bind("remove",function(){return H.destroy()});this._init()};D[G][F].prototype=D.extend({},D.widget.prototype,E);D[G][F].getterSetter="option"};D.widget.prototype={_init:function(){},destroy:function(){this.element.removeData(this.widgetName)},option:function(G,H){var F=G,E=this;if(typeof G=="string"){if(H===undefined){return this._getData(G)}F={};F[G]=H}D.each(F,function(I,J){E._setData(I,J)})},_getData:function(E){return this.options[E]},_setData:function(E,F){this.options[E]=F;if(E=="disabled"){this.element[F?"addClass":"removeClass"](this.widgetBaseClass+"-disabled")}},enable:function(){this._setData("disabled",false)},disable:function(){this._setData("disabled",true)},_trigger:function(F,H,G){var E=(F==this.widgetEventPrefix?F:this.widgetEventPrefix+F);H=H||D.event.fix({type:E,target:this.element[0]});return this.element.triggerHandler(E,[H,G],this.options[F])}};D.widget.defaults={disabled:false};D.ui={plugin:{add:function(F,G,I){var H=D.ui[F].prototype;for(var E in I){H.plugins[E]=H.plugins[E]||[];H.plugins[E].push([G,I[E]])}},call:function(E,G,F){var I=E.plugins[G];if(!I){return }for(var H=0;H').addClass(E).css({position:"absolute",top:"-5000px",left:"-5000px",display:"block"}).appendTo("body");D.ui.cssCache[E]=!!((!(/auto|default/).test(F.css("cursor"))||(/^[1-9]/).test(F.css("height"))||(/^[1-9]/).test(F.css("width"))||!(/none/).test(F.css("backgroundImage"))||!(/transparent|rgba\(0, 0, 0, 0\)/).test(F.css("backgroundColor"))));try{D("body").get(0).removeChild(F.get(0))}catch(G){}return D.ui.cssCache[E]},disableSelection:function(E){return D(E).attr("unselectable","on").css("MozUserSelect","none").bind("selectstart.ui",function(){return false})},enableSelection:function(E){return D(E).attr("unselectable","off").css("MozUserSelect","").unbind("selectstart.ui")},hasScroll:function(H,F){if(D(H).css("overflow")=="hidden"){return false}var E=(F&&F=="left")?"scrollLeft":"scrollTop",G=false;if(H[E]>0){return true}H[E]=1;G=(H[E]>0);H[E]=0;return G}};D.ui.mouse={_mouseInit:function(){var E=this;this.element.bind("mousedown."+this.widgetName,function(F){return E._mouseDown(F)});if(D.browser.msie){this._mouseUnselectable=this.element.attr("unselectable");this.element.attr("unselectable","on")}this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName);(D.browser.msie&&this.element.attr("unselectable",this._mouseUnselectable))},_mouseDown:function(G){(this._mouseStarted&&this._mouseUp(G));this._mouseDownEvent=G;var F=this,H=(G.which==1),E=(typeof this.options.cancel=="string"?D(G.target).parents().add(G.target).filter(this.options.cancel).length:false);if(!H||E||!this._mouseCapture(G)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){F.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(G)&&this._mouseDelayMet(G)){this._mouseStarted=(this._mouseStart(G)!==false);if(!this._mouseStarted){G.preventDefault();return true}}this._mouseMoveDelegate=function(I){return F._mouseMove(I)};this._mouseUpDelegate=function(I){return F._mouseUp(I)};D(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);return false},_mouseMove:function(E){if(D.browser.msie&&!E.button){return this._mouseUp(E)}if(this._mouseStarted){this._mouseDrag(E);return false}if(this._mouseDistanceMet(E)&&this._mouseDelayMet(E)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,E)!==false);(this._mouseStarted?this._mouseDrag(E):this._mouseUp(E))}return !this._mouseStarted},_mouseUp:function(E){D(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._mouseStop(E)}return false},_mouseDistanceMet:function(E){return(Math.max(Math.abs(this._mouseDownEvent.pageX-E.pageX),Math.abs(this._mouseDownEvent.pageY-E.pageY))>=this.options.distance)},_mouseDelayMet:function(E){return this.mouseDelayMet},_mouseStart:function(E){},_mouseDrag:function(E){},_mouseStop:function(E){},_mouseCapture:function(E){return true}};D.ui.mouse.defaults={cancel:null,distance:1,delay:0}})(jQuery) \ No newline at end of file +/* + * jQuery UI 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI + */ +jQuery.ui||(function(c){var i=c.fn.remove,d=c.browser.mozilla&&(parseFloat(c.browser.version)<1.9);c.ui={version:"1.7.1",plugin:{add:function(k,l,n){var m=c.ui[k].prototype;for(var j in n){m.plugins[j]=m.plugins[j]||[];m.plugins[j].push([l,n[j]])}},call:function(j,l,k){var n=j.plugins[l];if(!n||!j.element[0].parentNode){return}for(var m=0;m0){return true}m[j]=1;l=(m[j]>0);m[j]=0;return l},isOverAxis:function(k,j,l){return(k>j)&&(k<(j+l))},isOver:function(o,k,n,m,j,l){return c.ui.isOverAxis(o,n,j)&&c.ui.isOverAxis(k,m,l)},keyCode:{BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38}};if(d){var f=c.attr,e=c.fn.removeAttr,h="http://www.w3.org/2005/07/aaa",a=/^aria-/,b=/^wairole:/;c.attr=function(k,j,l){var m=l!==undefined;return(j=="role"?(m?f.call(this,k,j,"wairole:"+l):(f.apply(this,arguments)||"").replace(b,"")):(a.test(j)?(m?k.setAttributeNS(h,j.replace(a,"aaa:"),l):f.call(this,k,j.replace(a,"aaa:"))):f.apply(this,arguments)))};c.fn.removeAttr=function(j){return(a.test(j)?this.each(function(){this.removeAttributeNS(h,j.replace(a,""))}):e.call(this,j))}}c.fn.extend({remove:function(){c("*",this).add(this).each(function(){c(this).triggerHandler("remove")});return i.apply(this,arguments)},enableSelection:function(){return this.attr("unselectable","off").css("MozUserSelect","").unbind("selectstart.ui")},disableSelection:function(){return this.attr("unselectable","on").css("MozUserSelect","none").bind("selectstart.ui",function(){return false})},scrollParent:function(){var j;if((c.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){j=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(c.curCSS(this,"position",1))&&(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}else{j=this.parents().filter(function(){return(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!j.length?c(document):j}});c.extend(c.expr[":"],{data:function(l,k,j){return !!c.data(l,j[3])},focusable:function(k){var l=k.nodeName.toLowerCase(),j=c.attr(k,"tabindex");return(/input|select|textarea|button|object/.test(l)?!k.disabled:"a"==l||"area"==l?k.href||!isNaN(j):!isNaN(j))&&!c(k)["area"==l?"parents":"closest"](":hidden").length},tabbable:function(k){var j=c.attr(k,"tabindex");return(isNaN(j)||j>=0)&&c(k).is(":focusable")}});function g(m,n,o,l){function k(q){var p=c[m][n][q]||[];return(typeof p=="string"?p.split(/,?\s+/):p)}var j=k("getter");if(l.length==1&&typeof l[0]=="string"){j=j.concat(k("getterSetter"))}return(c.inArray(o,j)!=-1)}c.widget=function(k,j){var l=k.split(".")[0];k=k.split(".")[1];c.fn[k]=function(p){var n=(typeof p=="string"),o=Array.prototype.slice.call(arguments,1);if(n&&p.substring(0,1)=="_"){return this}if(n&&g(l,k,p,o)){var m=c.data(this[0],k);return(m?m[p].apply(m,o):undefined)}return this.each(function(){var q=c.data(this,k);(!q&&!n&&c.data(this,k,new c[l][k](this,p))._init());(q&&n&&c.isFunction(q[p])&&q[p].apply(q,o))})};c[l]=c[l]||{};c[l][k]=function(o,n){var m=this;this.namespace=l;this.widgetName=k;this.widgetEventPrefix=c[l][k].eventPrefix||k;this.widgetBaseClass=l+"-"+k;this.options=c.extend({},c.widget.defaults,c[l][k].defaults,c.metadata&&c.metadata.get(o)[k],n);this.element=c(o).bind("setData."+k,function(q,p,r){if(q.target==o){return m._setData(p,r)}}).bind("getData."+k,function(q,p){if(q.target==o){return m._getData(p)}}).bind("remove",function(){return m.destroy()})};c[l][k].prototype=c.extend({},c.widget.prototype,j);c[l][k].getterSetter="option"};c.widget.prototype={_init:function(){},destroy:function(){this.element.removeData(this.widgetName).removeClass(this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").removeAttr("aria-disabled")},option:function(l,m){var k=l,j=this;if(typeof l=="string"){if(m===undefined){return this._getData(l)}k={};k[l]=m}c.each(k,function(n,o){j._setData(n,o)})},_getData:function(j){return this.options[j]},_setData:function(j,k){this.options[j]=k;if(j=="disabled"){this.element[k?"addClass":"removeClass"](this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").attr("aria-disabled",k)}},enable:function(){this._setData("disabled",false)},disable:function(){this._setData("disabled",true)},_trigger:function(l,m,n){var p=this.options[l],j=(l==this.widgetEventPrefix?l:this.widgetEventPrefix+l);m=c.Event(m);m.type=j;if(m.originalEvent){for(var k=c.event.props.length,o;k;){o=c.event.props[--k];m[o]=m.originalEvent[o]}}this.element.trigger(m,n);return !(c.isFunction(p)&&p.call(this.element[0],m,n)===false||m.isDefaultPrevented())}};c.widget.defaults={disabled:false};c.ui.mouse={_mouseInit:function(){var j=this;this.element.bind("mousedown."+this.widgetName,function(k){return j._mouseDown(k)}).bind("click."+this.widgetName,function(k){if(j._preventClickEvent){j._preventClickEvent=false;k.stopImmediatePropagation();return false}});if(c.browser.msie){this._mouseUnselectable=this.element.attr("unselectable");this.element.attr("unselectable","on")}this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName);(c.browser.msie&&this.element.attr("unselectable",this._mouseUnselectable))},_mouseDown:function(l){l.originalEvent=l.originalEvent||{};if(l.originalEvent.mouseHandled){return}(this._mouseStarted&&this._mouseUp(l));this._mouseDownEvent=l;var k=this,m=(l.which==1),j=(typeof this.options.cancel=="string"?c(l.target).parents().add(l.target).filter(this.options.cancel).length:false);if(!m||j||!this._mouseCapture(l)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){k.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(l)&&this._mouseDelayMet(l)){this._mouseStarted=(this._mouseStart(l)!==false);if(!this._mouseStarted){l.preventDefault();return true}}this._mouseMoveDelegate=function(n){return k._mouseMove(n)};this._mouseUpDelegate=function(n){return k._mouseUp(n)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);(c.browser.safari||l.preventDefault());l.originalEvent.mouseHandled=true;return true},_mouseMove:function(j){if(c.browser.msie&&!j.button){return this._mouseUp(j)}if(this._mouseStarted){this._mouseDrag(j);return j.preventDefault()}if(this._mouseDistanceMet(j)&&this._mouseDelayMet(j)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,j)!==false);(this._mouseStarted?this._mouseDrag(j):this._mouseUp(j))}return !this._mouseStarted},_mouseUp:function(j){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=(j.target==this._mouseDownEvent.target);this._mouseStop(j)}return false},_mouseDistanceMet:function(j){return(Math.max(Math.abs(this._mouseDownEvent.pageX-j.pageX),Math.abs(this._mouseDownEvent.pageY-j.pageY))>=this.options.distance)},_mouseDelayMet:function(j){return this.mouseDelayMet},_mouseStart:function(j){},_mouseDrag:function(j){},_mouseStop:function(j){},_mouseCapture:function(j){return true}};c.ui.mouse.defaults={cancel:null,distance:1,delay:0}})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.datepicker.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/ui.datepicker.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.datepicker.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.datepicker.min.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1 +1,13 @@ -(function($){var PROP_NAME="datepicker";function Datepicker(){this.debug=false;this._curInst=null;this._disabledInputs=[];this._datepickerShowing=false;this._inDialog=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._promptClass="ui-datepicker-prompt";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this.regional=[];this.regional[""]={clearText:"Clear",clearStatus:"Erase the current date",closeText:"Close",closeStatus:"Close without change",prevText:"<Prev",prevStatus:"Show the previous month",prevBigText:"<<",prevBigStatus:"Show the previous year",nextText:"Next>",nextStatus:"Show the next month",nextBigText:">>",nextBigStatus:"Show the next year",currentText:"Today",currentStatus:"Show the current month",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],monthStatus:"Show a different month",yearStatus:"Show a different year",weekHeader:"Wk",weekStatus:"Week of the year",dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],dayStatus:"Set DD as first week day",dateStatus:"Select DD, M d",dateFormat:"mm/dd/yy",firstDay:0,initStatus:"Select a date",isRTL:false};this._defaults={showOn:"focus",showAnim:"show",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,closeAtTop:true,mandatory:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,showBigPrevNext:false,gotoCurrent:false,changeMonth:true,changeYear:true,showMonthAfterYear:false,yearRange:"-10:+10",changeFirstDay:true,highlightWeek:false,showOtherMonths:false,showWeeks:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",showStatus:false,statusForDate:this.dateStatus,minDate:null,maxDate:null,duration:"normal",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,rangeSelect:false,rangeSeparator:" - ",altField:"",altFormat:""};$.extend(this._defaults,this.regional[""]);this.dpDiv=$('')}$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",log:function(){if(this.debug){console.log.apply("",arguments)}},setDefaults:function(settings){extendRemove(this._defaults,settings||{});return this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase();var inline=(nodeName=="div"||nodeName=="span");if(!target.id){target.id="dp"+(++this.uuid)}var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{});if(nodeName=="input"){this._connectDatepicker(target,inst)}else{if(inline){this._inlineDatepicker(target,inst)}}},_newInst:function(target,inline){var id=target[0].id.replace(/([:\[\]\.])/g,"\\\\$1");return{id:id,input:target,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:inline,dpDiv:(!inline?this.dpDiv:$('
    '))}},_connectDatepicker:function(target,inst){var input=$(target);if(input.hasClass(this.markerClassName)){return }var appendText=this._get(inst,"appendText");var isRTL=this._get(inst,"isRTL");if(appendText){input[isRTL?"before":"after"](''+appendText+"")}var showOn=this._get(inst,"showOn");if(showOn=="focus"||showOn=="both"){input.focus(this._showDatepicker)}if(showOn=="button"||showOn=="both"){var buttonText=this._get(inst,"buttonText");var buttonImage=this._get(inst,"buttonImage");var trigger=$(this._get(inst,"buttonImageOnly")?$("").addClass(this._triggerClass).attr({src:buttonImage,alt:buttonText,title:buttonText}):$('').addClass(this._triggerClass).html(buttonImage==""?buttonText:$("").attr({src:buttonImage,alt:buttonText,title:buttonText})));input[isRTL?"before":"after"](trigger);trigger.click(function(){if($.datepicker._datepickerShowing&&$.datepicker._lastInput==target){$.datepicker._hideDatepicker()}else{$.datepicker._showDatepicker(target)}return false})}input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst)},_inlineDatepicker:function(target,inst){var divSpan=$(target);if(divSpan.hasClass(this.markerClassName)){return }divSpan.addClass(this.markerClassName).append(inst.dpDiv).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst);this._setDate(inst,this._getDefaultDate(inst));this._updateDatepicker(inst)},_inlineShow:function(inst){var numMonths=this._getNumberOfMonths(inst);inst.dpDiv.width(numMonths[1]*$(".ui-datepicker",inst.dpDiv[0]).width())},_dialogDatepicker:function(input,dateText,onSelect,settings,pos){var inst=this._dialogInst;if(!inst){var id="dp"+(++this.uuid);this._dialogInput=$('');this._dialogInput.keydown(this._doKeyDown);$("body").append(this._dialogInput);inst=this._dialogInst=this._newInst(this._dialogInput,false);inst.settings={};$.data(this._dialogInput[0],PROP_NAME,inst)}extendRemove(inst.settings,settings||{});this._dialogInput.val(dateText);this._pos=(pos?(pos.length?pos:[pos.pageX,pos.pageY]):null);if(!this._pos){var browserWidth=window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth;var browserHeight=window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight;var scrollX=document.documentElement.scrollLeft||document.body.scrollLeft;var scrollY=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[(browserWidth/2)-100+scrollX,(browserHeight/2)-150+scrollY]}this._dialogInput.css("left",this._pos[0]+"px").css("top",this._pos[1]+"px");inst.settings.onSelect=onSelect;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);if($.blockUI){$.blockUI(this.dpDiv)}$.data(this._dialogInput[0],PROP_NAME,inst);return this},_destroyDatepicker:function(target){var $target=$(target);if(!$target.hasClass(this.markerClassName)){return }var nodeName=target.nodeName.toLowerCase();$.removeData(target,PROP_NAME);if(nodeName=="input"){$target.siblings("."+this._appendClass).remove().end().siblings("."+this._triggerClass).remove().end().removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress)}else{if(nodeName=="div"||nodeName=="span"){$target.removeClass(this.markerClassName).empty()}}},_enableDatepicker:function(target){var $target=$(target);if(!$target.hasClass(this.markerClassName)){return }var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=false;$target.siblings("button."+this._triggerClass).each(function(){this.disabled=false}).end().siblings("img."+this._triggerClass).css({opacity:"1.0",cursor:""})}else{if(nodeName=="div"||nodeName=="span"){$target.children("."+this._disableClass).remove()}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)})},_disableDatepicker:function(target){var $target=$(target);if(!$target.hasClass(this.markerClassName)){return }var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=true;$target.siblings("button."+this._triggerClass).each(function(){this.disabled=true}).end().siblings("img."+this._triggerClass).css({opacity:"0.5",cursor:"default"})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);var offset=inline.offset();var relOffset={left:0,top:0};inline.parents().each(function(){if($(this).css("position")=="relative"){relOffset=$(this).offset();return false}});$target.prepend('
    ')}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)});this._disabledInputs[this._disabledInputs.length]=target},_isDisabledDatepicker:function(target){if(!target){return false}for(var i=0;i-1)},_showDatepicker:function(input){input=input.target||input;if(input.nodeName.toLowerCase()!="input"){input=$("input",input.parentNode)[0]}if($.datepicker._isDisabledDatepicker(input)||$.datepicker._lastInput==input){return }var inst=$.datepicker._getInst(input);var beforeShow=$.datepicker._get(inst,"beforeShow");extendRemove(inst.settings,(beforeShow?beforeShow.apply(input,[input,inst]):{}));$.datepicker._hideDatepicker(null,"");$.datepicker._lastInput=input;$.datepicker._setDateFromField(inst);if($.datepicker._inDialog){input.value=""}if(!$.datepicker._pos){$.datepicker._pos=$.datepicker._findPos(input);$.datepicker._pos[1]+=input.offsetHeight}var isFixed=false;$(input).parents().each(function(){isFixed|=$(this).css("position")=="fixed";return !isFixed});if(isFixed&&$.browser.opera){$.datepicker._pos[0]-=document.documentElement.scrollLeft;$.datepicker._pos[1]-=document.documentElement.scrollTop}var offset={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null;inst.rangeStart=null;inst.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});$.datepicker._updateDatepicker(inst);inst.dpDiv.width($.datepicker._getNumberOfMonths(inst)[1]*$(".ui-datepicker",inst.dpDiv[0])[0].offsetWidth);offset=$.datepicker._checkOffset(inst,offset,isFixed);inst.dpDiv.css({position:($.datepicker._inDialog&&$.blockUI?"static":(isFixed?"fixed":"absolute")),display:"none",left:offset.left+"px",top:offset.top+"px"});if(!inst.inline){var showAnim=$.datepicker._get(inst,"showAnim")||"show";var duration=$.datepicker._get(inst,"duration");var postProcess=function(){$.datepicker._datepickerShowing=true;if($.browser.msie&&parseInt($.browser.version,10)<7){$("iframe.ui-datepicker-cover").css({width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4})}};if($.effects&&$.effects[showAnim]){inst.dpDiv.show(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[showAnim](duration,postProcess)}if(duration==""){postProcess()}if(inst.input[0].type!="hidden"){inst.input[0].focus()}$.datepicker._curInst=inst}},_updateDatepicker:function(inst){var dims={width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4};inst.dpDiv.empty().append(this._generateHTML(inst)).find("iframe.ui-datepicker-cover").css({width:dims.width,height:dims.height});var numMonths=this._getNumberOfMonths(inst);inst.dpDiv[(numMonths[0]!=1||numMonths[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");inst.dpDiv[(this._get(inst,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");if(inst.input&&inst.input[0].type!="hidden"){$(inst.input[0]).focus()}},_checkOffset:function(inst,offset,isFixed){var pos=inst.input?this._findPos(inst.input[0]):null;var browserWidth=window.innerWidth||document.documentElement.clientWidth;var browserHeight=window.innerHeight||document.documentElement.clientHeight;var scrollX=document.documentElement.scrollLeft||document.body.scrollLeft;var scrollY=document.documentElement.scrollTop||document.body.scrollTop;if(this._get(inst,"isRTL")||(offset.left+inst.dpDiv.width()-scrollX)>browserWidth){offset.left=Math.max((isFixed?0:scrollX),pos[0]+(inst.input?inst.input.width():0)-(isFixed?scrollX:0)-inst.dpDiv.width()-(isFixed&&$.browser.opera?document.documentElement.scrollLeft:0))}else{offset.left-=(isFixed?scrollX:0)}if((offset.top+inst.dpDiv.height()-scrollY)>browserHeight){offset.top=Math.max((isFixed?0:scrollY),pos[1]-(isFixed?scrollY:0)-(this._inDialog?0:inst.dpDiv.height())-(isFixed&&$.browser.opera?document.documentElement.scrollTop:0))}else{offset.top-=(isFixed?scrollY:0)}return offset},_findPos:function(obj){while(obj&&(obj.type=="hidden"||obj.nodeType!=1)){obj=obj.nextSibling}var position=$(obj).offset();return[position.left,position.top]},_hideDatepicker:function(input,duration){var inst=this._curInst;if(!inst||(input&&inst!=$.data(input,PROP_NAME))){return }var rangeSelect=this._get(inst,"rangeSelect");if(rangeSelect&&inst.stayOpen){this._selectDate("#"+inst.id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear))}inst.stayOpen=false;if(this._datepickerShowing){duration=(duration!=null?duration:this._get(inst,"duration"));var showAnim=this._get(inst,"showAnim");var postProcess=function(){$.datepicker._tidyDialog(inst)};if(duration!=""&&$.effects&&$.effects[showAnim]){inst.dpDiv.hide(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[(duration==""?"hide":(showAnim=="slideDown"?"slideUp":(showAnim=="fadeIn"?"fadeOut":"hide")))](duration,postProcess)}if(duration==""){this._tidyDialog(inst)}var onClose=this._get(inst,"onClose");if(onClose){onClose.apply((inst.input?inst.input[0]:null),[(inst.input?inst.input.val():""),inst])}this._datepickerShowing=false;this._lastInput=null;inst.settings.prompt=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if($.blockUI){$.unblockUI();$("body").append(this.dpDiv)}}this._inDialog=false}this._curInst=null},_tidyDialog:function(inst){inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker");$("."+this._promptClass,inst.dpDiv).remove()},_checkExternalClick:function(event){if(!$.datepicker._curInst){return }var $target=$(event.target);if(($target.parents("#"+$.datepicker._mainDivId).length==0)&&!$target.hasClass($.datepicker.markerClassName)&&!$target.hasClass($.datepicker._triggerClass)&&$.datepicker._datepickerShowing&&!($.datepicker._inDialog&&$.blockUI)){$.datepicker._hideDatepicker(null,"")}},_adjustDate:function(id,offset,period){var target=$(id);var inst=this._getInst(target[0]);this._adjustInstDate(inst,offset,period);this._updateDatepicker(inst)},_gotoToday:function(id){var target=$(id);var inst=this._getInst(target[0]);if(this._get(inst,"gotoCurrent")&&inst.currentDay){inst.selectedDay=inst.currentDay;inst.drawMonth=inst.selectedMonth=inst.currentMonth;inst.drawYear=inst.selectedYear=inst.currentYear}else{var date=new Date();inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear()}this._notifyChange(inst);this._adjustDate(target)},_selectMonthYear:function(id,select,period){var target=$(id);var inst=this._getInst(target[0]);inst._selectingMonthYear=false;inst["selected"+(period=="M"?"Month":"Year")]=inst["draw"+(period=="M"?"Month":"Year")]=parseInt(select.options[select.selectedIndex].value,10);this._notifyChange(inst);this._adjustDate(target)},_clickMonthYear:function(id){var target=$(id);var inst=this._getInst(target[0]);if(inst.input&&inst._selectingMonthYear&&!$.browser.msie){inst.input[0].focus()}inst._selectingMonthYear=!inst._selectingMonthYear},_changeFirstDay:function(id,day){var target=$(id);var inst=this._getInst(target[0]);inst.settings.firstDay=day;this._updateDatepicker(inst)},_selectDay:function(id,month,year,td){if($(td).hasClass(this._unselectableClass)){return }var target=$(id);var inst=this._getInst(target[0]);var rangeSelect=this._get(inst,"rangeSelect");if(rangeSelect){inst.stayOpen=!inst.stayOpen;if(inst.stayOpen){$(".ui-datepicker td",inst.dpDiv).removeClass(this._currentClass);$(td).addClass(this._currentClass)}}inst.selectedDay=inst.currentDay=$("a",td).html();inst.selectedMonth=inst.currentMonth=month;inst.selectedYear=inst.currentYear=year;if(inst.stayOpen){inst.endDay=inst.endMonth=inst.endYear=null}else{if(rangeSelect){inst.endDay=inst.currentDay;inst.endMonth=inst.currentMonth;inst.endYear=inst.currentYear}}this._selectDate(id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear));if(inst.stayOpen){inst.rangeStart=new Date(inst.currentYear,inst.currentMonth,inst.currentDay);this._updateDatepicker(inst)}else{if(rangeSelect){inst.selectedDay=inst.currentDay=inst.rangeStart.getDate();inst.selectedMonth=inst.currentMonth=inst.rangeStart.getMonth();inst.selectedYear=inst.currentYear=inst.rangeStart.getFullYear();inst.rangeStart=null;if(inst.inline){this._updateDatepicker(inst)}}}},_clearDate:function(id){var target=$(id);var inst=this._getInst(target[0]);if(this._get(inst,"mandatory")){return }inst.stayOpen=false;inst.endDay=inst.endMonth=inst.endYear=inst.rangeStart=null;this._selectDate(target,"")},_selectDate:function(id,dateStr){var target=$(id);var inst=this._getInst(target[0]);dateStr=(dateStr!=null?dateStr:this._formatDate(inst));if(this._get(inst,"rangeSelect")&&dateStr){dateStr=(inst.rangeStart?this._formatDate(inst,inst.rangeStart):dateStr)+this._get(inst,"rangeSeparator")+dateStr}if(inst.input){inst.input.val(dateStr)}this._updateAlternate(inst);var onSelect=this._get(inst,"onSelect");if(onSelect){onSelect.apply((inst.input?inst.input[0]:null),[dateStr,inst])}else{if(inst.input){inst.input.trigger("change")}}if(inst.inline){this._updateDatepicker(inst)}else{if(!inst.stayOpen){this._hideDatepicker(null,this._get(inst,"duration"));this._lastInput=inst.input[0];if(typeof (inst.input[0])!="object"){inst.input[0].focus()}this._lastInput=null}}},_updateAlternate:function(inst){var altField=this._get(inst,"altField");if(altField){var altFormat=this._get(inst,"altFormat");var date=this._getDate(inst);dateStr=(isArray(date)?(!date[0]&&!date[1]?"":this.formatDate(altFormat,date[0],this._getFormatConfig(inst))+this._get(inst,"rangeSeparator")+this.formatDate(altFormat,date[1]||date[0],this._getFormatConfig(inst))):this.formatDate(altFormat,date,this._getFormatConfig(inst)));$(altField).each(function(){$(this).val(dateStr)})}},noWeekends:function(date){var day=date.getDay();return[(day>0&&day<6),""]},iso8601Week:function(date){var checkDate=new Date(date.getFullYear(),date.getMonth(),date.getDate(),(date.getTimezoneOffset()/-60));var firstMon=new Date(checkDate.getFullYear(),1-1,4);var firstDay=firstMon.getDay()||7;firstMon.setDate(firstMon.getDate()+1-firstDay);if(firstDay<4&&checkDatenew Date(checkDate.getFullYear(),12-1,28)){firstDay=new Date(checkDate.getFullYear()+1,1-1,4).getDay()||7;if(firstDay>4&&(checkDate.getDay()||7)0&&iValue="0"&&value.charAt(iValue)<="9"){num=num*10+parseInt(value.charAt(iValue++),10);size--}if(size==origSize){throw"Missing number at position "+iValue}return num};var getName=function(match,shortNames,longNames){var names=(lookAhead(match)?longNames:shortNames);var size=0;for(var j=0;j0&&iValue-1){month=1;day=doy;do{var dim=this._getDaysInMonth(year,month-1);if(day<=dim){break}month++;day-=dim}while(true)}var date=new Date(year,month-1,day);if(date.getFullYear()!=year||date.getMonth()+1!=month||date.getDate()!=day){throw"Invalid date"}return date},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TIMESTAMP:"@",W3C:"yy-mm-dd",formatDate:function(format,date,settings){if(!date){return""}var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var lookAhead=function(match){var matches=(iFormat+1=0;m--){doy+=this._getDaysInMonth(date.getFullYear(),m)}output+=formatNumber("o",doy,3);break;case"m":output+=formatNumber("m",date.getMonth()+1,2);break;case"M":output+=formatName("M",date.getMonth(),monthNamesShort,monthNames);break;case"y":output+=(lookAhead("y")?date.getFullYear():(date.getYear()%100<10?"0":"")+date.getYear()%100);break;case"@":output+=date.getTime();break;case"'":if(lookAhead("'")){output+="'"}else{literal=true}break;default:output+=format.charAt(iFormat)}}}}return output},_possibleChars:function(format){var chars="";var literal=false;for(var iFormat=0;iFormat0){var settings=this._getFormatConfig(inst);if(dates.length>1){date=this.parseDate(dateFormat,dates[1],settings)||defaultDate;inst.endDay=date.getDate();inst.endMonth=date.getMonth();inst.endYear=date.getFullYear()}try{date=this.parseDate(dateFormat,dates[0],settings)||defaultDate}catch(e){this.log(e);date=defaultDate}}inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();inst.currentDay=(dates[0]?date.getDate():0);inst.currentMonth=(dates[0]?date.getMonth():0);inst.currentYear=(dates[0]?date.getFullYear():0);this._adjustInstDate(inst)},_getDefaultDate:function(inst){var date=this._determineDate(this._get(inst,"defaultDate"),new Date());var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");date=(minDate&&datemaxDate?maxDate:date);return date},_determineDate:function(date,defaultDate){var offsetNumeric=function(offset){var date=new Date();date.setUTCDate(date.getUTCDate()+offset);return date};var offsetString=function(offset,getDaysInMonth){var date=new Date();var year=date.getFullYear();var month=date.getMonth();var day=date.getDate();var pattern=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;var matches=pattern.exec(offset);while(matches){switch(matches[2]||"d"){case"d":case"D":day+=parseInt(matches[1],10);break;case"w":case"W":day+=parseInt(matches[1],10)*7;break;case"m":case"M":month+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break;case"y":case"Y":year+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break}matches=pattern.exec(offset)}return new Date(year,month,day)};date=(date==null?defaultDate:(typeof date=="string"?offsetString(date,this._getDaysInMonth):(typeof date=="number"?(isNaN(date)?defaultDate:offsetNumeric(date)):date)));return(date&&date.toString()=="Invalid Date"?defaultDate:date)},_setDate:function(inst,date,endDate){var clear=!(date);var origMonth=inst.selectedMonth;var origYear=inst.selectedYear;date=this._determineDate(date,new Date());inst.selectedDay=inst.currentDay=date.getDate();inst.drawMonth=inst.selectedMonth=inst.currentMonth=date.getMonth();inst.drawYear=inst.selectedYear=inst.currentYear=date.getFullYear();if(this._get(inst,"rangeSelect")){if(endDate){endDate=this._determineDate(endDate,null);inst.endDay=endDate.getDate();inst.endMonth=endDate.getMonth();inst.endYear=endDate.getFullYear()}else{inst.endDay=inst.currentDay;inst.endMonth=inst.currentMonth;inst.endYear=inst.currentYear}}if(origMonth!=inst.selectedMonth||origYear!=inst.selectedYear){this._notifyChange(inst)}this._adjustInstDate(inst);if(inst.input){inst.input.val(clear?"":this._formatDate(inst)+(!this._get(inst,"rangeSelect")?"":this._get(inst,"rangeSeparator")+this._formatDate(inst,inst.endDay,inst.endMonth,inst.endYear)))}},_getDate:function(inst){var startDate=(!inst.currentYear||(inst.input&&inst.input.val()=="")?null:new Date(inst.currentYear,inst.currentMonth,inst.currentDay));if(this._get(inst,"rangeSelect")){return[inst.rangeStart||startDate,(!inst.endYear?inst.rangeStart||startDate:new Date(inst.endYear,inst.endMonth,inst.endDay))]}else{return startDate}},_generateHTML:function(inst){var today=new Date();today=new Date(today.getFullYear(),today.getMonth(),today.getDate());var showStatus=this._get(inst,"showStatus");var initStatus=this._get(inst,"initStatus")||" ";var isRTL=this._get(inst,"isRTL");var clear=(this._get(inst,"mandatory")?"":'");var controls='
    '+(isRTL?"":clear)+'"+(isRTL?clear:"")+"
    ";var prompt=this._get(inst,"prompt");var closeAtTop=this._get(inst,"closeAtTop");var hideIfNoPrevNext=this._get(inst,"hideIfNoPrevNext");var navigationAsDateFormat=this._get(inst,"navigationAsDateFormat");var showBigPrevNext=this._get(inst,"showBigPrevNext");var numMonths=this._getNumberOfMonths(inst);var showCurrentAtPos=this._get(inst,"showCurrentAtPos");var stepMonths=this._get(inst,"stepMonths");var stepBigMonths=this._get(inst,"stepBigMonths");var isMultiMonth=(numMonths[0]!=1||numMonths[1]!=1);var currentDate=(!inst.currentDay?new Date(9999,9,9):new Date(inst.currentYear,inst.currentMonth,inst.currentDay));var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");var drawMonth=inst.drawMonth-showCurrentAtPos;var drawYear=inst.drawYear;if(drawMonth<0){drawMonth+=12;drawYear--}if(maxDate){var maxDraw=new Date(maxDate.getFullYear(),maxDate.getMonth()-numMonths[1]+1,maxDate.getDate());maxDraw=(minDate&&maxDrawmaxDraw){drawMonth--;if(drawMonth<0){drawMonth=11;drawYear--}}}var prevText=this._get(inst,"prevText");prevText=(!navigationAsDateFormat?prevText:this.formatDate(prevText,new Date(drawYear,drawMonth-stepMonths,1),this._getFormatConfig(inst)));var prevBigText=(showBigPrevNext?this._get(inst,"prevBigText"):"");prevBigText=(!navigationAsDateFormat?prevBigText:this.formatDate(prevBigText,new Date(drawYear,drawMonth-stepBigMonths,1),this._getFormatConfig(inst)));var prev='
    '+(this._canAdjustMonth(inst,-1,drawYear,drawMonth)?(showBigPrevNext?""+prevBigText+"":"")+""+prevText+"":(hideIfNoPrevNext?"":""))+"
    ";var nextText=this._get(inst,"nextText");nextText=(!navigationAsDateFormat?nextText:this.formatDate(nextText,new Date(drawYear,drawMonth+stepMonths,1),this._getFormatConfig(inst)));var nextBigText=(showBigPrevNext?this._get(inst,"nextBigText"):"");nextBigText=(!navigationAsDateFormat?nextBigText:this.formatDate(nextBigText,new Date(drawYear,drawMonth+stepBigMonths,1),this._getFormatConfig(inst)));var next='
    '+(this._canAdjustMonth(inst,+1,drawYear,drawMonth)?""+nextText+""+(showBigPrevNext?""+nextBigText+"":""):(hideIfNoPrevNext?"":""))+"
    ";var currentText=this._get(inst,"currentText");var gotoDate=(this._get(inst,"gotoCurrent")&&inst.currentDay?currentDate:today);currentText=(!navigationAsDateFormat?currentText:this.formatDate(currentText,gotoDate,this._getFormatConfig(inst)));var html=(prompt?'
    '+prompt+"
    ":"")+(closeAtTop&&!inst.inline?controls:"")+'";var firstDay=this._get(inst,"firstDay");var changeFirstDay=this._get(inst,"changeFirstDay");var dayNames=this._get(inst,"dayNames");var dayNamesShort=this._get(inst,"dayNamesShort");var dayNamesMin=this._get(inst,"dayNamesMin");var monthNames=this._get(inst,"monthNames");var beforeShowDay=this._get(inst,"beforeShowDay");var highlightWeek=this._get(inst,"highlightWeek");var showOtherMonths=this._get(inst,"showOtherMonths");var showWeeks=this._get(inst,"showWeeks");var calculateWeek=this._get(inst,"calculateWeek")||this.iso8601Week;var weekStatus=this._get(inst,"weekStatus");var status=(showStatus?this._get(inst,"dayStatus")||initStatus:"");var dateStatus=this._get(inst,"statusForDate")||this.dateStatus;var endDate=inst.endDay?new Date(inst.endYear,inst.endMonth,inst.endDay):currentDate;for(var row=0;row'+this._generateMonthYearHeader(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,row>0||col>0,showStatus,initStatus,monthNames)+''+(showWeeks?""+this._get(inst,"weekHeader")+"":"");for(var dow=0;dow<7;dow++){var day=(dow+firstDay)%7;var dayStatus=(status.indexOf("DD")>-1?status.replace(/DD/,dayNames[day]):status.replace(/D/,dayNamesShort[day]));html+="=5?' class="ui-datepicker-week-end-cell"':"")+">"+(!changeFirstDay?"'+dayNamesMin[day]+(changeFirstDay?"":"")+""}html+="";var daysInMonth=this._getDaysInMonth(drawYear,drawMonth);if(drawYear==inst.selectedYear&&drawMonth==inst.selectedMonth){inst.selectedDay=Math.min(inst.selectedDay,daysInMonth)}var leadDays=(this._getFirstDayOfMonth(drawYear,drawMonth)-firstDay+7)%7;var tzDate=new Date(drawYear,drawMonth,1-leadDays);var utcDate=new Date(drawYear,drawMonth,1-leadDays);var printDate=utcDate;var numRows=(isMultiMonth?6:Math.ceil((leadDays+daysInMonth)/7));for(var dRow=0;dRow'+(showWeeks?'":"");for(var dow=0;dow<7;dow++){var daySettings=(beforeShowDay?beforeShowDay.apply((inst.input?inst.input[0]:null),[printDate]):[true,""]);var otherMonth=(printDate.getMonth()!=drawMonth);var unselectable=otherMonth||!daySettings[0]||(minDate&&printDatemaxDate);html+='";tzDate.setDate(tzDate.getDate()+1);utcDate.setUTCDate(utcDate.getUTCDate()+1);printDate=(tzDate>utcDate?tzDate:utcDate)}html+=""}drawMonth++;if(drawMonth>11){drawMonth=0;drawYear++}html+="
    "+calculateWeek(printDate)+"=currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?" "+this._currentClass:"")+(printDate.getTime()==today.getTime()?" ui-datepicker-today":""))+'"'+((!otherMonth||showOtherMonths)&&daySettings[2]?' title="'+daySettings[2]+'"':"")+(unselectable?(highlightWeek?" onmouseover=\"jQuery(this).parent().addClass('ui-datepicker-week-over');\" onmouseout=\"jQuery(this).parent().removeClass('ui-datepicker-week-over');\"":""):" onmouseover=\"jQuery(this).addClass('ui-datepicker-days-cell-over')"+(highlightWeek?".parent().addClass('ui-datepicker-week-over')":"")+";"+(!showStatus||(otherMonth&&!showOtherMonths)?"":"jQuery('#ui-datepicker-status-"+inst.id+"').html('"+(dateStatus.apply((inst.input?inst.input[0]:null),[printDate,inst])||initStatus)+"');")+"\" onmouseout=\"jQuery(this).removeClass('ui-datepicker-days-cell-over')"+(highlightWeek?".parent().removeClass('ui-datepicker-week-over')":"")+";"+(!showStatus||(otherMonth&&!showOtherMonths)?"":"jQuery('#ui-datepicker-status-"+inst.id+"').html('"+initStatus+"');")+'" onclick="jQuery.datepicker._selectDay(\'#'+inst.id+"',"+drawMonth+","+drawYear+', this);"')+">"+(otherMonth?(showOtherMonths?printDate.getDate():" "):(unselectable?printDate.getDate():""+printDate.getDate()+""))+"
    "}}html+=(showStatus?'
    '+initStatus+"
    ":"")+(!closeAtTop&&!inst.inline?controls:"")+'
    '+($.browser.msie&&parseInt($.browser.version,10)<7&&!inst.inline?'':"");return html},_generateMonthYearHeader:function(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,secondary,showStatus,initStatus,monthNames){minDate=(inst.rangeStart&&minDate&&selectedDate";for(var month=0;month<12;month++){if((!inMinYear||month>=minDate.getMonth())&&(!inMaxYear||month<=maxDate.getMonth())){monthHtml+='"}}monthHtml+=""}if(!showMonthAfterYear){html+=monthHtml}if(secondary||!this._get(inst,"changeYear")){html+=drawYear}else{var years=this._get(inst,"yearRange").split(":");var year=0;var endYear=0;if(years.length!=2){year=drawYear-10;endYear=drawYear+10}else{if(years[0].charAt(0)=="+"||years[0].charAt(0)=="-"){year=endYear=new Date().getFullYear();year+=parseInt(years[0],10);endYear+=parseInt(years[1],10)}else{year=parseInt(years[0],10);endYear=parseInt(years[1],10)}}year=(minDate?Math.max(year,minDate.getFullYear()):year);endYear=(maxDate?Math.min(endYear,maxDate.getFullYear()):endYear);html+='"}if(showMonthAfterYear){html+=monthHtml}html+="";return html},_addStatus:function(showStatus,id,text,initStatus){return(showStatus?" onmouseover=\"jQuery('#ui-datepicker-status-"+id+"').html('"+(text||initStatus)+"');\" onmouseout=\"jQuery('#ui-datepicker-status-"+id+"').html('"+initStatus+"');\"":"")},_adjustInstDate:function(inst,offset,period){var year=inst.drawYear+(period=="Y"?offset:0);var month=inst.drawMonth+(period=="M"?offset:0);var day=Math.min(inst.selectedDay,this._getDaysInMonth(year,month))+(period=="D"?offset:0);var date=new Date(year,month,day);var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");date=(minDate&&datemaxDate?maxDate:date);inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();if(period=="M"||period=="Y"){this._notifyChange(inst)}},_notifyChange:function(inst){var onChange=this._get(inst,"onChangeMonthYear");if(onChange){onChange.apply((inst.input?inst.input[0]:null),[inst.selectedYear,inst.selectedMonth+1,inst])}},_getNumberOfMonths:function(inst){var numMonths=this._get(inst,"numberOfMonths");return(numMonths==null?[1,1]:(typeof numMonths=="number"?[1,numMonths]:numMonths))},_getMinMaxDate:function(inst,minMax,checkRange){var date=this._determineDate(this._get(inst,minMax+"Date"),null);if(date){date.setHours(0);date.setMinutes(0);date.setSeconds(0);date.setMilliseconds(0)}return(!checkRange||!inst.rangeStart?date:(!date||inst.rangeStart>date?inst.rangeStart:date))},_getDaysInMonth:function(year,month){return 32-new Date(year,month,32).getDate()},_getFirstDayOfMonth:function(year,month){return new Date(year,month,1).getDay()},_canAdjustMonth:function(inst,offset,curYear,curMonth){var numMonths=this._getNumberOfMonths(inst);var date=new Date(curYear,curMonth+(offset<0?offset:numMonths[1]),1);if(offset<0){date.setDate(this._getDaysInMonth(date.getFullYear(),date.getMonth()))}return this._isInRange(inst,date)},_isInRange:function(inst,date){var newMinDate=(!inst.rangeStart?null:new Date(inst.selectedYear,inst.selectedMonth,inst.selectedDay));newMinDate=(newMinDate&&inst.rangeStart=minDate)&&(!maxDate||date<=maxDate))},_getFormatConfig:function(inst){var shortYearCutoff=this._get(inst,"shortYearCutoff");shortYearCutoff=(typeof shortYearCutoff!="string"?shortYearCutoff:new Date().getFullYear()%100+parseInt(shortYearCutoff,10));return{shortYearCutoff:shortYearCutoff,dayNamesShort:this._get(inst,"dayNamesShort"),dayNames:this._get(inst,"dayNames"),monthNamesShort:this._get(inst,"monthNamesShort"),monthNames:this._get(inst,"monthNames")}},_formatDate:function(inst,day,month,year){if(!day){inst.currentDay=inst.selectedDay;inst.currentMonth=inst.selectedMonth;inst.currentYear=inst.selectedYear}var date=(day?(typeof day=="object"?day:new Date(year,month,day)):new Date(inst.currentYear,inst.currentMonth,inst.currentDay));return this.formatDate(this._get(inst,"dateFormat"),date,this._getFormatConfig(inst))}});function extendRemove(target,props){$.extend(target,props);for(var name in props){if(props[name]==null||props[name]==undefined){target[name]=props[name]}}return target}function isArray(a){return(a&&(($.browser.safari&&typeof a=="object"&&a.length)||(a.constructor&&a.constructor.toString().match(/\Array\(\)/))))}$.fn.datepicker=function(options){if(!$.datepicker.initialized){$(document.body).append($.datepicker.dpDiv).mousedown($.datepicker._checkExternalClick);$.datepicker.initialized=true}var otherArgs=Array.prototype.slice.call(arguments,1);if(typeof options=="string"&&(options=="isDisabled"||options=="getDate")){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}return this.each(function(){typeof options=="string"?$.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this].concat(otherArgs)):$.datepicker._attachDatepicker(this,options)})};$.datepicker=new Datepicker();$.datepicker.initialized=false;$.datepicker.uuid=new Date().getTime()})(jQuery) \ No newline at end of file +/* + * jQuery UI Datepicker 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * ui.core.js + */ +(function($){$.extend($.ui,{datepicker:{version:"1.7.1"}});var PROP_NAME="datepicker";function Datepicker(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._datepickerShowing=false;this._inDialog=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass="ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],dateFormat:"mm/dd/yy",firstDay:0,isRTL:false};this._defaults={showOn:"focus",showAnim:"show",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,showMonthAfterYear:false,yearRange:"-10:+10",showOtherMonths:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"normal",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false};$.extend(this._defaults,this.regional[""]);this.dpDiv=$('
    ')}$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",log:function(){if(this.debug){console.log.apply("",arguments)}},setDefaults:function(settings){extendRemove(this._defaults,settings||{});return this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase();var inline=(nodeName=="div"||nodeName=="span");if(!target.id){target.id="dp"+(++this.uuid)}var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{});if(nodeName=="input"){this._connectDatepicker(target,inst)}else{if(inline){this._inlineDatepicker(target,inst)}}},_newInst:function(target,inline){var id=target[0].id.replace(/([:\[\]\.])/g,"\\\\$1");return{id:id,input:target,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:inline,dpDiv:(!inline?this.dpDiv:$('
    '))}},_connectDatepicker:function(target,inst){var input=$(target);inst.trigger=$([]);if(input.hasClass(this.markerClassName)){return}var appendText=this._get(inst,"appendText");var isRTL=this._get(inst,"isRTL");if(appendText){input[isRTL?"before":"after"](''+appendText+"")}var showOn=this._get(inst,"showOn");if(showOn=="focus"||showOn=="both"){input.focus(this._showDatepicker)}if(showOn=="button"||showOn=="both"){var buttonText=this._get(inst,"buttonText");var buttonImage=this._get(inst,"buttonImage");inst.trigger=$(this._get(inst,"buttonImageOnly")?$("").addClass(this._triggerClass).attr({src:buttonImage,alt:buttonText,title:buttonText}):$('').addClass(this._triggerClass).html(buttonImage==""?buttonText:$("").attr({src:buttonImage,alt:buttonText,title:buttonText})));input[isRTL?"before":"after"](inst.trigger);inst.trigger.click(function(){if($.datepicker._datepickerShowing&&$.datepicker._lastInput==target){$.datepicker._hideDatepicker()}else{$.datepicker._showDatepicker(target)}return false})}input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst)},_inlineDatepicker:function(target,inst){var divSpan=$(target);if(divSpan.hasClass(this.markerClassName)){return}divSpan.addClass(this.markerClassName).append(inst.dpDiv).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst);this._setDate(inst,this._getDefaultDate(inst));this._updateDatepicker(inst);this._updateAlternate(inst)},_dialogDatepicker:function(input,dateText,onSelect,settings,pos){var inst=this._dialogInst;if(!inst){var id="dp"+(++this.uuid);this._dialogInput=$('');this._dialogInput.keydown(this._doKeyDown);$("body").append(this._dialogInput);inst=this._dialogInst=this._newInst(this._dialogInput,false);inst.settings={};$.data(this._dialogInput[0],PROP_NAME,inst)}extendRemove(inst.settings,settings||{});this._dialogInput.val(dateText);this._pos=(pos?(pos.length?pos:[pos.pageX,pos.pageY]):null);if(!this._pos){var browserWidth=window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth;var browserHeight=window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight;var scrollX=document.documentElement.scrollLeft||document.body.scrollLeft;var scrollY=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[(browserWidth/2)-100+scrollX,(browserHeight/2)-150+scrollY]}this._dialogInput.css("left",this._pos[0]+"px").css("top",this._pos[1]+"px");inst.settings.onSelect=onSelect;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);if($.blockUI){$.blockUI(this.dpDiv)}$.data(this._dialogInput[0],PROP_NAME,inst);return this},_destroyDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();$.removeData(target,PROP_NAME);if(nodeName=="input"){inst.trigger.remove();$target.siblings("."+this._appendClass).remove().end().removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress)}else{if(nodeName=="div"||nodeName=="span"){$target.removeClass(this.markerClassName).empty()}}},_enableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=false;inst.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().removeClass("ui-state-disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)})},_disableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=true;inst.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().addClass("ui-state-disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)});this._disabledInputs[this._disabledInputs.length]=target},_isDisabledDatepicker:function(target){if(!target){return false}for(var i=0;i-1)}},_showDatepicker:function(input){input=input.target||input;if(input.nodeName.toLowerCase()!="input"){input=$("input",input.parentNode)[0]}if($.datepicker._isDisabledDatepicker(input)||$.datepicker._lastInput==input){return}var inst=$.datepicker._getInst(input);var beforeShow=$.datepicker._get(inst,"beforeShow");extendRemove(inst.settings,(beforeShow?beforeShow.apply(input,[input,inst]):{}));$.datepicker._hideDatepicker(null,"");$.datepicker._lastInput=input;$.datepicker._setDateFromField(inst);if($.datepicker._inDialog){input.value=""}if(!$.datepicker._pos){$.datepicker._pos=$.datepicker._findPos(input);$.datepicker._pos[1]+=input.offsetHeight}var isFixed=false;$(input).parents().each(function(){isFixed|=$(this).css("position")=="fixed";return !isFixed});if(isFixed&&$.browser.opera){$.datepicker._pos[0]-=document.documentElement.scrollLeft;$.datepicker._pos[1]-=document.documentElement.scrollTop}var offset={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null;inst.rangeStart=null;inst.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});$.datepicker._updateDatepicker(inst);offset=$.datepicker._checkOffset(inst,offset,isFixed);inst.dpDiv.css({position:($.datepicker._inDialog&&$.blockUI?"static":(isFixed?"fixed":"absolute")),display:"none",left:offset.left+"px",top:offset.top+"px"});if(!inst.inline){var showAnim=$.datepicker._get(inst,"showAnim")||"show";var duration=$.datepicker._get(inst,"duration");var postProcess=function(){$.datepicker._datepickerShowing=true;if($.browser.msie&&parseInt($.browser.version,10)<7){$("iframe.ui-datepicker-cover").css({width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4})}};if($.effects&&$.effects[showAnim]){inst.dpDiv.show(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[showAnim](duration,postProcess)}if(duration==""){postProcess()}if(inst.input[0].type!="hidden"){inst.input[0].focus()}$.datepicker._curInst=inst}},_updateDatepicker:function(inst){var dims={width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4};var self=this;inst.dpDiv.empty().append(this._generateHTML(inst)).find("iframe.ui-datepicker-cover").css({width:dims.width,height:dims.height}).end().find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){$(this).removeClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).removeClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).removeClass("ui-datepicker-next-hover")}}).bind("mouseover",function(){if(!self._isDisabledDatepicker(inst.inline?inst.dpDiv.parent()[0]:inst.input[0])){$(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");$(this).addClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).addClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).addClass("ui-datepicker-next-hover")}}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();var numMonths=this._getNumberOfMonths(inst);var cols=numMonths[1];var width=17;if(cols>1){inst.dpDiv.addClass("ui-datepicker-multi-"+cols).css("width",(width*cols)+"em")}else{inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("")}inst.dpDiv[(numMonths[0]!=1||numMonths[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");inst.dpDiv[(this._get(inst,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");if(inst.input&&inst.input[0].type!="hidden"&&inst==$.datepicker._curInst){$(inst.input[0]).focus()}},_checkOffset:function(inst,offset,isFixed){var dpWidth=inst.dpDiv.outerWidth();var dpHeight=inst.dpDiv.outerHeight();var inputWidth=inst.input?inst.input.outerWidth():0;var inputHeight=inst.input?inst.input.outerHeight():0;var viewWidth=(window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth)+$(document).scrollLeft();var viewHeight=(window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight)+$(document).scrollTop();offset.left-=(this._get(inst,"isRTL")?(dpWidth-inputWidth):0);offset.left-=(isFixed&&offset.left==inst.input.offset().left)?$(document).scrollLeft():0;offset.top-=(isFixed&&offset.top==(inst.input.offset().top+inputHeight))?$(document).scrollTop():0;offset.left-=(offset.left+dpWidth>viewWidth&&viewWidth>dpWidth)?Math.abs(offset.left+dpWidth-viewWidth):0;offset.top-=(offset.top+dpHeight>viewHeight&&viewHeight>dpHeight)?Math.abs(offset.top+dpHeight+inputHeight*2-viewHeight):0;return offset},_findPos:function(obj){while(obj&&(obj.type=="hidden"||obj.nodeType!=1)){obj=obj.nextSibling}var position=$(obj).offset();return[position.left,position.top]},_hideDatepicker:function(input,duration){var inst=this._curInst;if(!inst||(input&&inst!=$.data(input,PROP_NAME))){return}if(inst.stayOpen){this._selectDate("#"+inst.id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear))}inst.stayOpen=false;if(this._datepickerShowing){duration=(duration!=null?duration:this._get(inst,"duration"));var showAnim=this._get(inst,"showAnim");var postProcess=function(){$.datepicker._tidyDialog(inst)};if(duration!=""&&$.effects&&$.effects[showAnim]){inst.dpDiv.hide(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[(duration==""?"hide":(showAnim=="slideDown"?"slideUp":(showAnim=="fadeIn"?"fadeOut":"hide")))](duration,postProcess)}if(duration==""){this._tidyDialog(inst)}var onClose=this._get(inst,"onClose");if(onClose){onClose.apply((inst.input?inst.input[0]:null),[(inst.input?inst.input.val():""),inst])}this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if($.blockUI){$.unblockUI();$("body").append(this.dpDiv)}}this._inDialog=false}this._curInst=null},_tidyDialog:function(inst){inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(event){if(!$.datepicker._curInst){return}var $target=$(event.target);if(($target.parents("#"+$.datepicker._mainDivId).length==0)&&!$target.hasClass($.datepicker.markerClassName)&&!$target.hasClass($.datepicker._triggerClass)&&$.datepicker._datepickerShowing&&!($.datepicker._inDialog&&$.blockUI)){$.datepicker._hideDatepicker(null,"")}},_adjustDate:function(id,offset,period){var target=$(id);var inst=this._getInst(target[0]);if(this._isDisabledDatepicker(target[0])){return}this._adjustInstDate(inst,offset+(period=="M"?this._get(inst,"showCurrentAtPos"):0),period);this._updateDatepicker(inst)},_gotoToday:function(id){var target=$(id);var inst=this._getInst(target[0]);if(this._get(inst,"gotoCurrent")&&inst.currentDay){inst.selectedDay=inst.currentDay;inst.drawMonth=inst.selectedMonth=inst.currentMonth;inst.drawYear=inst.selectedYear=inst.currentYear}else{var date=new Date();inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear()}this._notifyChange(inst);this._adjustDate(target)},_selectMonthYear:function(id,select,period){var target=$(id);var inst=this._getInst(target[0]);inst._selectingMonthYear=false;inst["selected"+(period=="M"?"Month":"Year")]=inst["draw"+(period=="M"?"Month":"Year")]=parseInt(select.options[select.selectedIndex].value,10);this._notifyChange(inst);this._adjustDate(target)},_clickMonthYear:function(id){var target=$(id);var inst=this._getInst(target[0]);if(inst.input&&inst._selectingMonthYear&&!$.browser.msie){inst.input[0].focus()}inst._selectingMonthYear=!inst._selectingMonthYear},_selectDay:function(id,month,year,td){var target=$(id);if($(td).hasClass(this._unselectableClass)||this._isDisabledDatepicker(target[0])){return}var inst=this._getInst(target[0]);inst.selectedDay=inst.currentDay=$("a",td).html();inst.selectedMonth=inst.currentMonth=month;inst.selectedYear=inst.currentYear=year;if(inst.stayOpen){inst.endDay=inst.endMonth=inst.endYear=null}this._selectDate(id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear));if(inst.stayOpen){inst.rangeStart=this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay));this._updateDatepicker(inst)}},_clearDate:function(id){var target=$(id);var inst=this._getInst(target[0]);inst.stayOpen=false;inst.endDay=inst.endMonth=inst.endYear=inst.rangeStart=null;this._selectDate(target,"")},_selectDate:function(id,dateStr){var target=$(id);var inst=this._getInst(target[0]);dateStr=(dateStr!=null?dateStr:this._formatDate(inst));if(inst.input){inst.input.val(dateStr)}this._updateAlternate(inst);var onSelect=this._get(inst,"onSelect");if(onSelect){onSelect.apply((inst.input?inst.input[0]:null),[dateStr,inst])}else{if(inst.input){inst.input.trigger("change")}}if(inst.inline){this._updateDatepicker(inst)}else{if(!inst.stayOpen){this._hideDatepicker(null,this._get(inst,"duration"));this._lastInput=inst.input[0];if(typeof(inst.input[0])!="object"){inst.input[0].focus()}this._lastInput=null}}},_updateAlternate:function(inst){var altField=this._get(inst,"altField");if(altField){var altFormat=this._get(inst,"altFormat")||this._get(inst,"dateFormat");var date=this._getDate(inst);dateStr=this.formatDate(altFormat,date,this._getFormatConfig(inst));$(altField).each(function(){$(this).val(dateStr)})}},noWeekends:function(date){var day=date.getDay();return[(day>0&&day<6),""]},iso8601Week:function(date){var checkDate=new Date(date.getFullYear(),date.getMonth(),date.getDate());var firstMon=new Date(checkDate.getFullYear(),1-1,4);var firstDay=firstMon.getDay()||7;firstMon.setDate(firstMon.getDate()+1-firstDay);if(firstDay<4&&checkDatenew Date(checkDate.getFullYear(),12-1,28)){firstDay=new Date(checkDate.getFullYear()+1,1-1,4).getDay()||7;if(firstDay>4&&(checkDate.getDay()||7)0&&iValue="0"&&value.charAt(iValue)<="9"){num=num*10+parseInt(value.charAt(iValue++),10);size--}if(size==origSize){throw"Missing number at position "+iValue}return num};var getName=function(match,shortNames,longNames){var names=(lookAhead(match)?longNames:shortNames);var size=0;for(var j=0;j0&&iValue-1){month=1;day=doy;do{var dim=this._getDaysInMonth(year,month-1);if(day<=dim){break}month++;day-=dim}while(true)}var date=this._daylightSavingAdjust(new Date(year,month-1,day));if(date.getFullYear()!=year||date.getMonth()+1!=month||date.getDate()!=day){throw"Invalid date"}return date},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TIMESTAMP:"@",W3C:"yy-mm-dd",formatDate:function(format,date,settings){if(!date){return""}var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var lookAhead=function(match){var matches=(iFormat+1=0;m--){doy+=this._getDaysInMonth(date.getFullYear(),m)}output+=formatNumber("o",doy,3);break;case"m":output+=formatNumber("m",date.getMonth()+1,2);break;case"M":output+=formatName("M",date.getMonth(),monthNamesShort,monthNames);break;case"y":output+=(lookAhead("y")?date.getFullYear():(date.getYear()%100<10?"0":"")+date.getYear()%100);break;case"@":output+=date.getTime();break;case"'":if(lookAhead("'")){output+="'"}else{literal=true}break;default:output+=format.charAt(iFormat)}}}}return output},_possibleChars:function(format){var chars="";var literal=false;for(var iFormat=0;iFormatmaxDate?maxDate:date);return date},_determineDate:function(date,defaultDate){var offsetNumeric=function(offset){var date=new Date();date.setDate(date.getDate()+offset);return date};var offsetString=function(offset,getDaysInMonth){var date=new Date();var year=date.getFullYear();var month=date.getMonth();var day=date.getDate();var pattern=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;var matches=pattern.exec(offset);while(matches){switch(matches[2]||"d"){case"d":case"D":day+=parseInt(matches[1],10);break;case"w":case"W":day+=parseInt(matches[1],10)*7;break;case"m":case"M":month+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break;case"y":case"Y":year+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break}matches=pattern.exec(offset)}return new Date(year,month,day)};date=(date==null?defaultDate:(typeof date=="string"?offsetString(date,this._getDaysInMonth):(typeof date=="number"?(isNaN(date)?defaultDate:offsetNumeric(date)):date)));date=(date&&date.toString()=="Invalid Date"?defaultDate:date);if(date){date.setHours(0);date.setMinutes(0);date.setSeconds(0);date.setMilliseconds(0)}return this._daylightSavingAdjust(date)},_daylightSavingAdjust:function(date){if(!date){return null}date.setHours(date.getHours()>12?date.getHours()+2:0);return date},_setDate:function(inst,date,endDate){var clear=!(date);var origMonth=inst.selectedMonth;var origYear=inst.selectedYear;date=this._determineDate(date,new Date());inst.selectedDay=inst.currentDay=date.getDate();inst.drawMonth=inst.selectedMonth=inst.currentMonth=date.getMonth();inst.drawYear=inst.selectedYear=inst.currentYear=date.getFullYear();if(origMonth!=inst.selectedMonth||origYear!=inst.selectedYear){this._notifyChange(inst)}this._adjustInstDate(inst);if(inst.input){inst.input.val(clear?"":this._formatDate(inst))}},_getDate:function(inst){var startDate=(!inst.currentYear||(inst.input&&inst.input.val()=="")?null:this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return startDate},_generateHTML:function(inst){var today=new Date();today=this._daylightSavingAdjust(new Date(today.getFullYear(),today.getMonth(),today.getDate()));var isRTL=this._get(inst,"isRTL");var showButtonPanel=this._get(inst,"showButtonPanel");var hideIfNoPrevNext=this._get(inst,"hideIfNoPrevNext");var navigationAsDateFormat=this._get(inst,"navigationAsDateFormat");var numMonths=this._getNumberOfMonths(inst);var showCurrentAtPos=this._get(inst,"showCurrentAtPos");var stepMonths=this._get(inst,"stepMonths");var stepBigMonths=this._get(inst,"stepBigMonths");var isMultiMonth=(numMonths[0]!=1||numMonths[1]!=1);var currentDate=this._daylightSavingAdjust((!inst.currentDay?new Date(9999,9,9):new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");var drawMonth=inst.drawMonth-showCurrentAtPos;var drawYear=inst.drawYear;if(drawMonth<0){drawMonth+=12;drawYear--}if(maxDate){var maxDraw=this._daylightSavingAdjust(new Date(maxDate.getFullYear(),maxDate.getMonth()-numMonths[1]+1,maxDate.getDate()));maxDraw=(minDate&&maxDrawmaxDraw){drawMonth--;if(drawMonth<0){drawMonth=11;drawYear--}}}inst.drawMonth=drawMonth;inst.drawYear=drawYear;var prevText=this._get(inst,"prevText");prevText=(!navigationAsDateFormat?prevText:this.formatDate(prevText,this._daylightSavingAdjust(new Date(drawYear,drawMonth-stepMonths,1)),this._getFormatConfig(inst)));var prev=(this._canAdjustMonth(inst,-1,drawYear,drawMonth)?''+prevText+"":(hideIfNoPrevNext?"":''+prevText+""));var nextText=this._get(inst,"nextText");nextText=(!navigationAsDateFormat?nextText:this.formatDate(nextText,this._daylightSavingAdjust(new Date(drawYear,drawMonth+stepMonths,1)),this._getFormatConfig(inst)));var next=(this._canAdjustMonth(inst,+1,drawYear,drawMonth)?''+nextText+"":(hideIfNoPrevNext?"":''+nextText+""));var currentText=this._get(inst,"currentText");var gotoDate=(this._get(inst,"gotoCurrent")&&inst.currentDay?currentDate:today);currentText=(!navigationAsDateFormat?currentText:this.formatDate(currentText,gotoDate,this._getFormatConfig(inst)));var controls=(!inst.inline?'":"");var buttonPanel=(showButtonPanel)?'
    '+(isRTL?controls:"")+(this._isInRange(inst,gotoDate)?'":"")+(isRTL?"":controls)+"
    ":"";var firstDay=parseInt(this._get(inst,"firstDay"),10);firstDay=(isNaN(firstDay)?0:firstDay);var dayNames=this._get(inst,"dayNames");var dayNamesShort=this._get(inst,"dayNamesShort");var dayNamesMin=this._get(inst,"dayNamesMin");var monthNames=this._get(inst,"monthNames");var monthNamesShort=this._get(inst,"monthNamesShort");var beforeShowDay=this._get(inst,"beforeShowDay");var showOtherMonths=this._get(inst,"showOtherMonths");var calculateWeek=this._get(inst,"calculateWeek")||this.iso8601Week;var endDate=inst.endDay?this._daylightSavingAdjust(new Date(inst.endYear,inst.endMonth,inst.endDay)):currentDate;var defaultDate=this._getDefaultDate(inst);var html="";for(var row=0;row'+(/all|left/.test(cornerClass)&&row==0?(isRTL?next:prev):"")+(/all|right/.test(cornerClass)&&row==0?(isRTL?prev:next):"")+this._generateMonthYearHeader(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,row>0||col>0,monthNames,monthNamesShort)+'';var thead="";for(var dow=0;dow<7;dow++){var day=(dow+firstDay)%7;thead+="=5?' class="ui-datepicker-week-end"':"")+'>'+dayNamesMin[day]+""}calender+=thead+"";var daysInMonth=this._getDaysInMonth(drawYear,drawMonth);if(drawYear==inst.selectedYear&&drawMonth==inst.selectedMonth){inst.selectedDay=Math.min(inst.selectedDay,daysInMonth)}var leadDays=(this._getFirstDayOfMonth(drawYear,drawMonth)-firstDay+7)%7;var numRows=(isMultiMonth?6:Math.ceil((leadDays+daysInMonth)/7));var printDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,1-leadDays));for(var dRow=0;dRow";var tbody="";for(var dow=0;dow<7;dow++){var daySettings=(beforeShowDay?beforeShowDay.apply((inst.input?inst.input[0]:null),[printDate]):[true,""]);var otherMonth=(printDate.getMonth()!=drawMonth);var unselectable=otherMonth||!daySettings[0]||(minDate&&printDatemaxDate);tbody+='";printDate.setDate(printDate.getDate()+1);printDate=this._daylightSavingAdjust(printDate)}calender+=tbody+""}drawMonth++;if(drawMonth>11){drawMonth=0;drawYear++}calender+="
    =currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?" "+this._currentClass:"")+(printDate.getTime()==today.getTime()?" ui-datepicker-today":""))+'"'+((!otherMonth||showOtherMonths)&&daySettings[2]?' title="'+daySettings[2]+'"':"")+(unselectable?"":" onclick=\"DP_jQuery.datepicker._selectDay('#"+inst.id+"',"+drawMonth+","+drawYear+', this);return false;"')+">"+(otherMonth?(showOtherMonths?printDate.getDate():" "):(unselectable?''+printDate.getDate()+"":'=currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?" ui-state-active":"")+'" href="#">'+printDate.getDate()+""))+"
    "+(isMultiMonth?""+((numMonths[0]>0&&col==numMonths[1]-1)?'
    ':""):"");group+=calender}html+=group}html+=buttonPanel+($.browser.msie&&parseInt($.browser.version,10)<7&&!inst.inline?'':"");inst._keyEvent=false;return html},_generateMonthYearHeader:function(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,secondary,monthNames,monthNamesShort){minDate=(inst.rangeStart&&minDate&&selectedDate "}else{var inMinYear=(minDate&&minDate.getFullYear()==drawYear);var inMaxYear=(maxDate&&maxDate.getFullYear()==drawYear);monthHtml+='"}if(!showMonthAfterYear){html+=monthHtml+((secondary||changeMonth||changeYear)&&(!(changeMonth&&changeYear))?" ":"")}if(secondary||!changeYear){html+=''+drawYear+""}else{var years=this._get(inst,"yearRange").split(":");var year=0;var endYear=0;if(years.length!=2){year=drawYear-10;endYear=drawYear+10}else{if(years[0].charAt(0)=="+"||years[0].charAt(0)=="-"){year=drawYear+parseInt(years[0],10);endYear=drawYear+parseInt(years[1],10)}else{year=parseInt(years[0],10);endYear=parseInt(years[1],10)}}year=(minDate?Math.max(year,minDate.getFullYear()):year);endYear=(maxDate?Math.min(endYear,maxDate.getFullYear()):endYear);html+='"}if(showMonthAfterYear){html+=(secondary||changeMonth||changeYear?" ":"")+monthHtml}html+="";return html},_adjustInstDate:function(inst,offset,period){var year=inst.drawYear+(period=="Y"?offset:0);var month=inst.drawMonth+(period=="M"?offset:0);var day=Math.min(inst.selectedDay,this._getDaysInMonth(year,month))+(period=="D"?offset:0);var date=this._daylightSavingAdjust(new Date(year,month,day));var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");date=(minDate&&datemaxDate?maxDate:date);inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();if(period=="M"||period=="Y"){this._notifyChange(inst)}},_notifyChange:function(inst){var onChange=this._get(inst,"onChangeMonthYear");if(onChange){onChange.apply((inst.input?inst.input[0]:null),[inst.selectedYear,inst.selectedMonth+1,inst])}},_getNumberOfMonths:function(inst){var numMonths=this._get(inst,"numberOfMonths");return(numMonths==null?[1,1]:(typeof numMonths=="number"?[1,numMonths]:numMonths))},_getMinMaxDate:function(inst,minMax,checkRange){var date=this._determineDate(this._get(inst,minMax+"Date"),null);return(!checkRange||!inst.rangeStart?date:(!date||inst.rangeStart>date?inst.rangeStart:date))},_getDaysInMonth:function(year,month){return 32-new Date(year,month,32).getDate()},_getFirstDayOfMonth:function(year,month){return new Date(year,month,1).getDay()},_canAdjustMonth:function(inst,offset,curYear,curMonth){var numMonths=this._getNumberOfMonths(inst);var date=this._daylightSavingAdjust(new Date(curYear,curMonth+(offset<0?offset:numMonths[1]),1));if(offset<0){date.setDate(this._getDaysInMonth(date.getFullYear(),date.getMonth()))}return this._isInRange(inst,date)},_isInRange:function(inst,date){var newMinDate=(!inst.rangeStart?null:this._daylightSavingAdjust(new Date(inst.selectedYear,inst.selectedMonth,inst.selectedDay)));newMinDate=(newMinDate&&inst.rangeStart=minDate)&&(!maxDate||date<=maxDate))},_getFormatConfig:function(inst){var shortYearCutoff=this._get(inst,"shortYearCutoff");shortYearCutoff=(typeof shortYearCutoff!="string"?shortYearCutoff:new Date().getFullYear()%100+parseInt(shortYearCutoff,10));return{shortYearCutoff:shortYearCutoff,dayNamesShort:this._get(inst,"dayNamesShort"),dayNames:this._get(inst,"dayNames"),monthNamesShort:this._get(inst,"monthNamesShort"),monthNames:this._get(inst,"monthNames")}},_formatDate:function(inst,day,month,year){if(!day){inst.currentDay=inst.selectedDay;inst.currentMonth=inst.selectedMonth;inst.currentYear=inst.selectedYear}var date=(day?(typeof day=="object"?day:this._daylightSavingAdjust(new Date(year,month,day))):this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return this.formatDate(this._get(inst,"dateFormat"),date,this._getFormatConfig(inst))}});function extendRemove(target,props){$.extend(target,props);for(var name in props){if(props[name]==null||props[name]==undefined){target[name]=props[name]}}return target}function isArray(a){return(a&&(($.browser.safari&&typeof a=="object"&&a.length)||(a.constructor&&a.constructor.toString().match(/\Array\(\)/))))}$.fn.datepicker=function(options){if(!$.datepicker.initialized){$(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv);$.datepicker.initialized=true}var otherArgs=Array.prototype.slice.call(arguments,1);if(typeof options=="string"&&(options=="isDisabled"||options=="getDate")){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}return this.each(function(){typeof options=="string"?$.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this].concat(otherArgs)):$.datepicker._attachDatepicker(this,options)})};$.datepicker=new Datepicker();$.datepicker.initialized=false;$.datepicker.uuid=new Date().getTime();$.datepicker.version="1.7.1";window.DP_jQuery=$})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.dialog.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/ui.dialog.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.dialog.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.dialog.min.js 1 Apr 2009 00:45:14 -0000 1.2 @@ -1 +1,15 @@ -(function(B){var A={dragStart:"start.draggable",drag:"drag.draggable",dragStop:"stop.draggable",maxHeight:"maxHeight.resizable",minHeight:"minHeight.resizable",maxWidth:"maxWidth.resizable",minWidth:"minWidth.resizable",resizeStart:"start.resizable",resize:"drag.resizable",resizeStop:"stop.resizable"};B.widget("ui.dialog",{_init:function(){this.originalTitle=this.element.attr("title");this.options.title=this.options.title||this.originalTitle;var K=this,L=this.options,F=this.element.removeAttr("title").addClass("ui-dialog-content").wrap("
    ").wrap("
    "),H=(this.uiDialogContainer=F.parent()).addClass("ui-dialog-container").css({position:"relative",width:"100%",height:"100%"}),E=(this.uiDialogTitlebar=B("
    ")).addClass("ui-dialog-titlebar").append('X').prependTo(H),J=L.title||" ",C=B.ui.dialog.getTitleId(this.element),D=B("").addClass("ui-dialog-title").attr("id",C).html(J).prependTo(E),I=(this.uiDialog=H.parent()).appendTo(document.body).hide().addClass("ui-dialog").addClass(L.dialogClass).addClass(F.attr("className")).removeClass("ui-dialog-content").css({position:"absolute",width:L.width,height:L.height,overflow:"hidden",zIndex:L.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(M){(L.closeOnEscape&&M.keyCode&&M.keyCode==B.keyCode.ESCAPE&&K.close())}).mousedown(function(){K._moveToTop()}),G=(this.uiDialogButtonPane=B("
    ")).addClass("ui-dialog-buttonpane").css({position:"absolute",bottom:0}).appendTo(I);this.uiDialogTitlebarClose=B(".ui-dialog-titlebar-close",E).hover(function(){B(this).addClass("ui-dialog-titlebar-close-hover")},function(){B(this).removeClass("ui-dialog-titlebar-close-hover")}).mousedown(function(M){M.stopPropagation()}).click(function(){K.close();return false});E.find("*").add(E).each(function(){B.ui.disableSelection(this)});(L.draggable&&B.fn.draggable&&this._makeDraggable());(L.resizable&&B.fn.resizable&&this._makeResizable());this._createButtons(L.buttons);this._isOpen=false;(L.bgiframe&&B.fn.bgiframe&&I.bgiframe());(L.autoOpen&&this.open())},destroy:function(){(this.overlay&&this.overlay.destroy());this.uiDialog.hide();this.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content").hide().appendTo("body");this.uiDialog.remove();(this.originalTitle&&this.element.attr("title",this.originalTitle))},close:function(){if(false===this._trigger("beforeclose",null,{options:this.options})){return }(this.overlay&&this.overlay.destroy());this.uiDialog.hide(this.options.hide).unbind("keypress.ui-dialog");this._trigger("close",null,{options:this.options});B.ui.dialog.overlay.resize();this._isOpen=false},isOpen:function(){return this._isOpen},open:function(){if(this._isOpen){return }this.overlay=this.options.modal?new B.ui.dialog.overlay(this):null;(this.uiDialog.next().length&&this.uiDialog.appendTo("body"));this._position(this.options.position);this.uiDialog.show(this.options.show);(this.options.autoResize&&this._size());this._moveToTop(true);(this.options.modal&&this.uiDialog.bind("keypress.ui-dialog",function(E){if(E.keyCode!=B.keyCode.TAB){return }var D=B(":tabbable",this),F=D.filter(":first")[0],C=D.filter(":last")[0];if(E.target==C&&!E.shiftKey){setTimeout(function(){F.focus()},1)}else{if(E.target==F&&E.shiftKey){setTimeout(function(){C.focus()},1)}}}));this.uiDialog.find(":tabbable:first").focus();this._trigger("open",null,{options:this.options});this._isOpen=true},_createButtons:function(F){var E=this,C=false,D=this.uiDialogButtonPane;D.empty().hide();B.each(F,function(){return !(C=true)});if(C){D.show();B.each(F,function(G,H){B('').text(G).click(function(){H.apply(E.element[0],arguments)}).appendTo(D)})}},_makeDraggable:function(){var C=this,D=this.options;this.uiDialog.draggable({cancel:".ui-dialog-content",helper:D.dragHelper,handle:".ui-dialog-titlebar",start:function(){C._moveToTop();(D.dragStart&&D.dragStart.apply(C.element[0],arguments))},drag:function(){(D.drag&&D.drag.apply(C.element[0],arguments))},stop:function(){(D.dragStop&&D.dragStop.apply(C.element[0],arguments));B.ui.dialog.overlay.resize()}})},_makeResizable:function(F){F=(F===undefined?this.options.resizable:F);var C=this,E=this.options,D=typeof F=="string"?F:"n,e,s,w,se,sw,ne,nw";this.uiDialog.resizable({cancel:".ui-dialog-content",helper:E.resizeHelper,maxWidth:E.maxWidth,maxHeight:E.maxHeight,minWidth:E.minWidth,minHeight:E.minHeight,start:function(){(E.resizeStart&&E.resizeStart.apply(C.element[0],arguments))},resize:function(){(E.autoResize&&C._size.apply(C));(E.resize&&E.resize.apply(C.element[0],arguments))},handles:D,stop:function(){(E.autoResize&&C._size.apply(C));(E.resizeStop&&E.resizeStop.apply(C.element[0],arguments));B.ui.dialog.overlay.resize()}})},_moveToTop:function(E){if((this.options.modal&&!E)||(!this.options.stack&&!this.options.modal)){return this._trigger("focus",null,{options:this.options})}var D=this.options.zIndex,C=this.options;B(".ui-dialog:visible").each(function(){D=Math.max(D,parseInt(B(this).css("z-index"),10)||C.zIndex)});(this.overlay&&this.overlay.$el.css("z-index",++D));this.uiDialog.css("z-index",++D);this._trigger("focus",null,{options:this.options})},_position:function(H){var D=B(window),E=B(document),F=E.scrollTop(),C=E.scrollLeft(),G=F;if(B.inArray(H,["center","top","right","bottom","left"])>=0){H=[H=="right"||H=="left"?H:"center",H=="top"||H=="bottom"?H:"middle"]}if(H.constructor!=Array){H=["center","middle"]}if(H[0].constructor==Number){C+=H[0]}else{switch(H[0]){case"left":C+=0;break;case"right":C+=D.width()-this.uiDialog.width();break;default:case"center":C+=(D.width()-this.uiDialog.width())/2}}if(H[1].constructor==Number){F+=H[1]}else{switch(H[1]){case"top":F+=0;break;case"bottom":F+=D.height()-this.uiDialog.height();break;default:case"middle":F+=(D.height()-this.uiDialog.height())/2}}F=Math.max(F,G);this.uiDialog.css({top:F,left:C})},_setData:function(D,E){(A[D]&&this.uiDialog.data(A[D],E));switch(D){case"buttons":this._createButtons(E);break;case"draggable":(E?this._makeDraggable():this.uiDialog.draggable("destroy"));break;case"height":this.uiDialog.height(E);break;case"position":this._position(E);break;case"resizable":var C=this.uiDialog,F=this.uiDialog.is(":data(resizable)");(F&&!E&&C.resizable("destroy"));(F&&typeof E=="string"&&C.resizable("option","handles",E));(F||this._makeResizable(E));break;case"title":B(".ui-dialog-title",this.uiDialogTitlebar).html(E||" ");break;case"width":this.uiDialog.width(E);break}B.widget.prototype._setData.apply(this,arguments)},_size:function(){var D=this.uiDialogContainer,G=this.uiDialogTitlebar,E=this.element,F=(parseInt(E.css("margin-top"),10)||0)+(parseInt(E.css("margin-bottom"),10)||0),C=(parseInt(E.css("margin-left"),10)||0)+(parseInt(E.css("margin-right"),10)||0);E.height(D.height()-G.outerHeight()-F);E.width(D.width()-C)}});B.extend(B.ui.dialog,{defaults:{autoOpen:true,autoResize:true,bgiframe:false,buttons:{},closeOnEscape:true,draggable:true,height:200,minHeight:100,minWidth:150,modal:false,overlay:{},position:"center",resizable:true,stack:true,width:300,zIndex:1000},getter:"isOpen",uuid:0,getTitleId:function(C){return"ui-dialog-title-"+(C.attr("id")||++this.uuid)},overlay:function(C){this.$el=B.ui.dialog.overlay.create(C)}});B.extend(B.ui.dialog.overlay,{instances:[],events:B.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(C){return C+".dialog-overlay"}).join(" "),create:function(D){if(this.instances.length===0){setTimeout(function(){B("a, :input").bind(B.ui.dialog.overlay.events,function(){var F=false;var H=B(this).parents(".ui-dialog");if(H.length){var E=B(".ui-dialog-overlay");if(E.length){var G=parseInt(E.css("z-index"),10);E.each(function(){G=Math.max(G,parseInt(B(this).css("z-index"),10))});F=parseInt(H.css("z-index"),10)>G}else{F=true}}return F})},1);B(document).bind("keydown.dialog-overlay",function(E){(D.options.closeOnEscape&&E.keyCode&&E.keyCode==B.keyCode.ESCAPE&&D.close())});B(window).bind("resize.dialog-overlay",B.ui.dialog.overlay.resize)}var C=B("
    ").appendTo(document.body).addClass("ui-dialog-overlay").css(B.extend({borderWidth:0,margin:0,padding:0,position:"absolute",top:0,left:0,width:this.width(),height:this.height()},D.options.overlay));(D.options.bgiframe&&B.fn.bgiframe&&C.bgiframe());this.instances.push(C);return C},destroy:function(C){this.instances.splice(B.inArray(this.instances,C),1);if(this.instances.length===0){B("a, :input").add([document,window]).unbind(".dialog-overlay")}C.remove()},height:function(){if(B.browser.msie&&B.browser.version<7){var D=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);var C=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(D")).appendTo(document.body).hide().addClass(a+m.dialogClass).css({position:"absolute",overflow:"hidden",zIndex:m.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(n){(m.closeOnEscape&&n.keyCode&&n.keyCode==c.ui.keyCode.ESCAPE&&l.close(n))}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(n){l.moveToTop(false,n)}),g=this.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(k),f=(this.uiDialogTitlebar=c("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(k),i=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){i.addClass("ui-state-hover")},function(){i.removeClass("ui-state-hover")}).focus(function(){i.addClass("ui-state-focus")}).blur(function(){i.removeClass("ui-state-focus")}).mousedown(function(n){n.stopPropagation()}).click(function(n){l.close(n);return false}).appendTo(f),h=(this.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(m.closeText).appendTo(i),d=c("").addClass("ui-dialog-title").attr("id",e).html(j).prependTo(f);f.find("*").add(f).disableSelection();(m.draggable&&c.fn.draggable&&this._makeDraggable());(m.resizable&&c.fn.resizable&&this._makeResizable());this._createButtons(m.buttons);this._isOpen=false;(m.bgiframe&&c.fn.bgiframe&&k.bgiframe());(m.autoOpen&&this.open())},destroy:function(){(this.overlay&&this.overlay.destroy());this.uiDialog.hide();this.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");this.uiDialog.remove();(this.originalTitle&&this.element.attr("title",this.originalTitle))},close:function(e){var d=this;if(false===d._trigger("beforeclose",e)){return}(d.overlay&&d.overlay.destroy());d.uiDialog.unbind("keypress.ui-dialog");(d.options.hide?d.uiDialog.hide(d.options.hide,function(){d._trigger("close",e)}):d.uiDialog.hide()&&d._trigger("close",e));c.ui.dialog.overlay.resize();d._isOpen=false},isOpen:function(){return this._isOpen},moveToTop:function(f,e){if((this.options.modal&&!f)||(!this.options.stack&&!this.options.modal)){return this._trigger("focus",e)}if(this.options.zIndex>c.ui.dialog.maxZ){c.ui.dialog.maxZ=this.options.zIndex}(this.overlay&&this.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=++c.ui.dialog.maxZ));var d={scrollTop:this.element.attr("scrollTop"),scrollLeft:this.element.attr("scrollLeft")};this.uiDialog.css("z-index",++c.ui.dialog.maxZ);this.element.attr(d);this._trigger("focus",e)},open:function(){if(this._isOpen){return}var e=this.options,d=this.uiDialog;this.overlay=e.modal?new c.ui.dialog.overlay(this):null;(d.next().length&&d.appendTo("body"));this._size();this._position(e.position);d.show(e.show);this.moveToTop(true);(e.modal&&d.bind("keypress.ui-dialog",function(h){if(h.keyCode!=c.ui.keyCode.TAB){return}var g=c(":tabbable",this),i=g.filter(":first")[0],f=g.filter(":last")[0];if(h.target==f&&!h.shiftKey){setTimeout(function(){i.focus()},1)}else{if(h.target==i&&h.shiftKey){setTimeout(function(){f.focus()},1)}}}));c([]).add(d.find(".ui-dialog-content :tabbable:first")).add(d.find(".ui-dialog-buttonpane :tabbable:first")).add(d).filter(":first").focus();this._trigger("open");this._isOpen=true},_createButtons:function(g){var f=this,d=false,e=c("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");this.uiDialog.find(".ui-dialog-buttonpane").remove();(typeof g=="object"&&g!==null&&c.each(g,function(){return !(d=true)}));if(d){c.each(g,function(h,i){c('').addClass("ui-state-default ui-corner-all").text(h).click(function(){i.apply(f.element[0],arguments)}).hover(function(){c(this).addClass("ui-state-hover")},function(){c(this).removeClass("ui-state-hover")}).focus(function(){c(this).addClass("ui-state-focus")}).blur(function(){c(this).removeClass("ui-state-focus")}).appendTo(e)});e.appendTo(this.uiDialog)}},_makeDraggable:function(){var d=this,f=this.options,e;this.uiDialog.draggable({cancel:".ui-dialog-content",handle:".ui-dialog-titlebar",containment:"document",start:function(){e=f.height;c(this).height(c(this).height()).addClass("ui-dialog-dragging");(f.dragStart&&f.dragStart.apply(d.element[0],arguments))},drag:function(){(f.drag&&f.drag.apply(d.element[0],arguments))},stop:function(){c(this).removeClass("ui-dialog-dragging").height(e);(f.dragStop&&f.dragStop.apply(d.element[0],arguments));c.ui.dialog.overlay.resize()}})},_makeResizable:function(g){g=(g===undefined?this.options.resizable:g);var d=this,f=this.options,e=typeof g=="string"?g:"n,e,s,w,se,sw,ne,nw";this.uiDialog.resizable({cancel:".ui-dialog-content",alsoResize:this.element,maxWidth:f.maxWidth,maxHeight:f.maxHeight,minWidth:f.minWidth,minHeight:f.minHeight,start:function(){c(this).addClass("ui-dialog-resizing");(f.resizeStart&&f.resizeStart.apply(d.element[0],arguments))},resize:function(){(f.resize&&f.resize.apply(d.element[0],arguments))},handles:e,stop:function(){c(this).removeClass("ui-dialog-resizing");f.height=c(this).height();f.width=c(this).width();(f.resizeStop&&f.resizeStop.apply(d.element[0],arguments));c.ui.dialog.overlay.resize()}}).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_position:function(i){var e=c(window),f=c(document),g=f.scrollTop(),d=f.scrollLeft(),h=g;if(c.inArray(i,["center","top","right","bottom","left"])>=0){i=[i=="right"||i=="left"?i:"center",i=="top"||i=="bottom"?i:"middle"]}if(i.constructor!=Array){i=["center","middle"]}if(i[0].constructor==Number){d+=i[0]}else{switch(i[0]){case"left":d+=0;break;case"right":d+=e.width()-this.uiDialog.outerWidth();break;default:case"center":d+=(e.width()-this.uiDialog.outerWidth())/2}}if(i[1].constructor==Number){g+=i[1]}else{switch(i[1]){case"top":g+=0;break;case"bottom":g+=e.height()-this.uiDialog.outerHeight();break;default:case"middle":g+=(e.height()-this.uiDialog.outerHeight())/2}}g=Math.max(g,h);this.uiDialog.css({top:g,left:d})},_setData:function(e,f){(b[e]&&this.uiDialog.data(b[e],f));switch(e){case"buttons":this._createButtons(f);break;case"closeText":this.uiDialogTitlebarCloseText.text(f);break;case"dialogClass":this.uiDialog.removeClass(this.options.dialogClass).addClass(a+f);break;case"draggable":(f?this._makeDraggable():this.uiDialog.draggable("destroy"));break;case"height":this.uiDialog.height(f);break;case"position":this._position(f);break;case"resizable":var d=this.uiDialog,g=this.uiDialog.is(":data(resizable)");(g&&!f&&d.resizable("destroy"));(g&&typeof f=="string"&&d.resizable("option","handles",f));(g||this._makeResizable(f));break;case"title":c(".ui-dialog-title",this.uiDialogTitlebar).html(f||" ");break;case"width":this.uiDialog.width(f);break}c.widget.prototype._setData.apply(this,arguments)},_size:function(){var e=this.options;this.element.css({height:0,minHeight:0,width:"auto"});var d=this.uiDialog.css({height:"auto",width:e.width}).height();this.element.css({minHeight:Math.max(e.minHeight-d,0),height:e.height=="auto"?"auto":Math.max(e.height-d,0)})}});c.extend(c.ui.dialog,{version:"1.7.1",defaults:{autoOpen:true,bgiframe:false,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:"center",resizable:true,show:null,stack:true,title:"",width:300,zIndex:1000},getter:"isOpen",uuid:0,maxZ:0,getTitleId:function(d){return"ui-dialog-title-"+(d.attr("id")||++this.uuid)},overlay:function(d){this.$el=c.ui.dialog.overlay.create(d)}});c.extend(c.ui.dialog.overlay,{instances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(d){return d+".dialog-overlay"}).join(" "),create:function(e){if(this.instances.length===0){setTimeout(function(){c(document).bind(c.ui.dialog.overlay.events,function(f){var g=c(f.target).parents(".ui-dialog").css("zIndex")||0;return(g>c.ui.dialog.overlay.maxZ)})},1);c(document).bind("keydown.dialog-overlay",function(f){(e.options.closeOnEscape&&f.keyCode&&f.keyCode==c.ui.keyCode.ESCAPE&&e.close(f))});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var d=c("
    ").appendTo(document.body).addClass("ui-widget-overlay").css({width:this.width(),height:this.height()});(e.options.bgiframe&&c.fn.bgiframe&&d.bgiframe());this.instances.push(d);return d},destroy:function(d){this.instances.splice(c.inArray(this.instances,d),1);if(this.instances.length===0){c([document,window]).unbind(".dialog-overlay")}d.remove()},height:function(){if(c.browser.msie&&c.browser.version<7){var e=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);var d=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(ethis.containment[2]){B.left=this.containment[2]}if(B.top>this.containment[3]){B.top=this.containment[3]}}if(F.grid){var D=this.originalPosition.top+Math.round((B.top-this.originalPosition.top)/F.grid[1])*F.grid[1];B.top=this.containment?(!(Dthis.containment[3])?D:(!(Dthis.containment[2])?C:(!(C
    ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css(A(this).offset()).appendTo("body")})},stop:function(C,B){A("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});A.ui.plugin.add("draggable","scroll",{start:function(D,C){var E=C.options;var B=A(this).data("draggable");E.scrollSensitivity=E.scrollSensitivity||20;E.scrollSpeed=E.scrollSpeed||20;B.overflowY=function(F){do{if(/auto|scroll/.test(F.css("overflow"))||(/auto|scroll/).test(F.css("overflow-y"))){return F}F=F.parent()}while(F[0].parentNode);return A(document)}(this);B.overflowX=function(F){do{if(/auto|scroll/.test(F.css("overflow"))||(/auto|scroll/).test(F.css("overflow-x"))){return F}F=F.parent()}while(F[0].parentNode);return A(document)}(this);if(B.overflowY[0]!=document&&B.overflowY[0].tagName!="HTML"){B.overflowYOffset=B.overflowY.offset()}if(B.overflowX[0]!=document&&B.overflowX[0].tagName!="HTML"){B.overflowXOffset=B.overflowX.offset()}},drag:function(E,D){var F=D.options,B=false;var C=A(this).data("draggable");if(C.overflowY[0]!=document&&C.overflowY[0].tagName!="HTML"){if((C.overflowYOffset.top+C.overflowY[0].offsetHeight)-E.pageY=0;M--){var L=E.snapElements[M].left,J=L+E.snapElements[M].width,I=E.snapElements[M].top,S=I+E.snapElements[M].height;if(!((L-Qthis.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.topthis.containment[3])?g:(!(g-this.offset.click.topthis.containment[2])?f:(!(f-this.offset.click.left
    ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css(a(this).offset()).appendTo("body")})},stop:function(b,c){a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});a.ui.plugin.add("draggable","opacity",{start:function(c,d){var b=a(d.helper),e=a(this).data("draggable").options;if(b.css("opacity")){e._opacity=b.css("opacity")}b.css("opacity",e.opacity)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._opacity){a(c.helper).css("opacity",d._opacity)}}});a.ui.plugin.add("draggable","scroll",{start:function(c,d){var b=a(this).data("draggable");if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){b.overflowOffset=b.scrollParent.offset()}},drag:function(d,e){var c=a(this).data("draggable"),f=c.options,b=false;if(c.scrollParent[0]!=document&&c.scrollParent[0].tagName!="HTML"){if(!f.axis||f.axis!="x"){if((c.overflowOffset.top+c.scrollParent[0].offsetHeight)-d.pageY=0;v--){var s=g.snapElements[v].left,n=s+g.snapElements[v].width,m=g.snapElements[v].top,A=m+g.snapElements[v].height;if(!((s-y=K&&I<=G)||(H>=K&&H<=G)||(IG))&&((D>=E&&D<=B)||(C>=E&&C<=B)||(DB));break;default:return false;break}};A.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(E,H){var B=A.ui.ddmanager.droppables[E.options.scope];var F=H?H.type:null;var G=(E.currentItem||E.element).find(":data(droppable)").andSelf();droppablesLoop:for(var D=0;D=p&&n<=k)||(m>=p&&m<=k)||(nk))&&((e>=g&&e<=c)||(d>=g&&d<=c)||(ec));break;default:return false;break}};a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(e,g){var b=a.ui.ddmanager.droppables[e.options.scope];var f=g?g.type:null;var h=(e.currentItem||e.element).find(":data(droppable)").andSelf();droppablesLoop:for(var d=0;d
    ').css({width:"0px",overflow:"hidden",zIndex:100}),textElement:A('
    ').html(D).css({width:"0px",overflow:"hidden"}),textBg:A('
    ').html(D).css({width:this.element.width()}),wrapper:A('
    ')});this.wrapper.append(this.bar.append(this.textElement.addClass(C.textClass)),this.textBg).appendTo(this.element)},plugins:{},ui:function(B){return{instance:this,identifier:this.identifier,options:this.options,element:this.bar,textElement:this.textElement,pixelState:this.pixelState,percentState:this.percentState}},_propagate:function(C,B){A.ui.plugin.call(this,C,[B,this.ui()]);this.element.triggerHandler(C=="progressbar"?C:["progressbar",C].join(""),[B,this.ui()],this.options[C])},destroy:function(){this.stop();this.element.removeClass("ui-progressbar ui-progressbar-disabled").removeData("progressbar").unbind(".progressbar").find(".ui-progressbar-wrap").remove();delete jQuery.easing[this.identifier]},enable:function(){this.element.removeClass("ui-progressbar-disabled");this.disabled=false},disable:function(){this.element.addClass("ui-progressbar-disabled");this.disabled=true},start:function(){var B=this,C=this.options;if(this.disabled){return }jQuery.easing[this.identifier]=function(K,L,J,I,H){var G=C.increment,E=C.width,F=((G>E?E:G)/E),D=Math.round(K/F)*F;return D>1?1:D};B.active=true;setTimeout(function(){B.active=false},C.duration);this._animate();this._propagate("start",this.ui());return false},_animate:function(){var C=this,D=this.options,B=D.interval;this.bar.animate({width:D.width},{duration:B,easing:this.identifier,step:function(G,E){C.progress((G/D.width)*100);var H=new Date().getTime(),F=(H-E.startTime);D.interval=B-F},complete:function(){delete jQuery.easing[C.identifier];C.pause();if(C.active){}}})},pause:function(){if(this.disabled){return }this.bar.stop();this._propagate("pause",this.ui())},stop:function(){this.bar.stop();this.bar.width(0);this.textElement.width(0);this.bar.addClass("ui-hidden");this.options.interval=this._interval;this._propagate("stop",this.ui())},text:function(B){this.textElement.html(B);this.textBg.html(B)},progress:function(B){if(this.bar.is(".ui-hidden")){this.bar.removeClass("ui-hidden")}this.percentState=B>100?100:B;this.pixelState=(this.percentState/100)*this.options.width;this.bar.width(this.pixelState);this.textElement.width(this.pixelState);if(this.options.range&&!this.options.text){this.textElement.html(Math.round(this.percentState)+"%")}this._propagate("progress",this.ui())}});A.ui.progressbar.defaults={width:300,duration:3000,interval:200,increment:1,range:true,text:"",addClass:"",textClass:""}})(jQuery) \ No newline at end of file +/* + * jQuery UI Progressbar 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * ui.core.js + */ +(function(a){a.widget("ui.progressbar",{_init:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this._valueMin(),"aria-valuemax":this._valueMax(),"aria-valuenow":this._value()});this.valueDiv=a('
    ').appendTo(this.element);this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow").removeData("progressbar").unbind(".progressbar");this.valueDiv.remove();a.widget.prototype.destroy.apply(this,arguments)},value:function(b){arguments.length&&this._setData("value",b);return this._value()},_setData:function(b,c){switch(b){case"value":this.options.value=c;this._refreshValue();this._trigger("change",null,{});break}a.widget.prototype._setData.apply(this,arguments)},_value:function(){var b=this.options.value;if(bthis._valueMax()){b=this._valueMax()}return b},_valueMin:function(){var b=0;return b},_valueMax:function(){var b=100;return b},_refreshValue:function(){var b=this.value();this.valueDiv[b==this._valueMax()?"addClass":"removeClass"]("ui-corner-right");this.valueDiv.width(b+"%");this.element.attr("aria-valuenow",b)}});a.extend(a.ui.progressbar,{version:"1.7.1",defaults:{value:0}})})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.resizable.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/ui.resizable.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.resizable.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.resizable.min.js 1 Apr 2009 00:45:13 -0000 1.2 @@ -1 +1,13 @@ -(function(A){A.widget("ui.resizable",A.extend({},A.ui.mouse,{_init:function(){var M=this,N=this.options;var Q=this.element.css("position");this.originalElement=this.element;this.element.addClass("ui-resizable").css({position:/static/.test(Q)?"relative":Q});A.extend(N,{_aspectRatio:!!(N.aspectRatio),helper:N.helper||N.ghost||N.animate?N.helper||"proxy":null,knobHandles:N.knobHandles===true?"ui-resizable-knob-handle":N.knobHandles});var H="1px solid #DEDEDE";N.defaultTheme={"ui-resizable":{display:"block"},"ui-resizable-handle":{position:"absolute",background:"#F2F2F2",fontSize:"0.1px"},"ui-resizable-n":{cursor:"n-resize",height:"4px",left:"0px",right:"0px",borderTop:H},"ui-resizable-s":{cursor:"s-resize",height:"4px",left:"0px",right:"0px",borderBottom:H},"ui-resizable-e":{cursor:"e-resize",width:"4px",top:"0px",bottom:"0px",borderRight:H},"ui-resizable-w":{cursor:"w-resize",width:"4px",top:"0px",bottom:"0px",borderLeft:H},"ui-resizable-se":{cursor:"se-resize",width:"4px",height:"4px",borderRight:H,borderBottom:H},"ui-resizable-sw":{cursor:"sw-resize",width:"4px",height:"4px",borderBottom:H,borderLeft:H},"ui-resizable-ne":{cursor:"ne-resize",width:"4px",height:"4px",borderRight:H,borderTop:H},"ui-resizable-nw":{cursor:"nw-resize",width:"4px",height:"4px",borderLeft:H,borderTop:H}};N.knobTheme={"ui-resizable-handle":{background:"#F2F2F2",border:"1px solid #808080",height:"8px",width:"8px"},"ui-resizable-n":{cursor:"n-resize",top:"0px",left:"45%"},"ui-resizable-s":{cursor:"s-resize",bottom:"0px",left:"45%"},"ui-resizable-e":{cursor:"e-resize",right:"0px",top:"45%"},"ui-resizable-w":{cursor:"w-resize",left:"0px",top:"45%"},"ui-resizable-se":{cursor:"se-resize",right:"0px",bottom:"0px"},"ui-resizable-sw":{cursor:"sw-resize",left:"0px",bottom:"0px"},"ui-resizable-nw":{cursor:"nw-resize",left:"0px",top:"0px"},"ui-resizable-ne":{cursor:"ne-resize",right:"0px",top:"0px"}};N._nodeName=this.element[0].nodeName;if(N._nodeName.match(/canvas|textarea|input|select|button|img/i)){var B=this.element;if(/relative/.test(B.css("position"))&&A.browser.opera){B.css({position:"relative",top:"auto",left:"auto"})}B.wrap(A('
    ').css({position:B.css("position"),width:B.outerWidth(),height:B.outerHeight(),top:B.css("top"),left:B.css("left")}));var J=this.element;this.element=this.element.parent();this.element.data("resizable",this);this.element.css({marginLeft:J.css("marginLeft"),marginTop:J.css("marginTop"),marginRight:J.css("marginRight"),marginBottom:J.css("marginBottom")});J.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});if(A.browser.safari&&N.preventDefault){J.css("resize","none")}N.proportionallyResize=J.css({position:"static",zoom:1,display:"block"});this.element.css({margin:J.css("margin")});this._proportionallyResize()}if(!N.handles){N.handles=!A(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}}if(N.handles.constructor==String){N.zIndex=N.zIndex||1000;if(N.handles=="all"){N.handles="n,e,s,w,se,sw,ne,nw"}var O=N.handles.split(",");N.handles={};var G={handle:"position: absolute; display: none; overflow:hidden;",n:"top: 0pt; width:100%;",e:"right: 0pt; height:100%;",s:"bottom: 0pt; width:100%;",w:"left: 0pt; height:100%;",se:"bottom: 0pt; right: 0px;",sw:"bottom: 0pt; left: 0px;",ne:"top: 0pt; right: 0px;",nw:"top: 0pt; left: 0px;"};for(var R=0;R
    '].join("")).css(K);N.handles[S]=".ui-resizable-"+S;this.element.append(E.css(C?T:{}).css(N.knobHandles?D:{}).addClass(N.knobHandles?"ui-resizable-knob-handle":"").addClass(N.knobHandles))}if(N.knobHandles){this.element.addClass("ui-resizable-knob").css(!A.ui.css("ui-resizable-knob")?{}:{})}}this._renderAxis=function(Y){Y=Y||this.element;for(var V in N.handles){if(N.handles[V].constructor==String){N.handles[V]=A(N.handles[V],this.element).show()}if(N.transparent){N.handles[V].css({opacity:0})}if(this.element.is(".ui-wrapper")&&N._nodeName.match(/textarea|input|select|button/i)){var W=A(N.handles[V],this.element),X=0;X=/sw|ne|nw|se|n|s/.test(V)?W.outerHeight():W.outerWidth();var U=["padding",/ne|nw|n/.test(V)?"Top":/se|sw|s/.test(V)?"Bottom":/^e$/.test(V)?"Right":"Left"].join("");if(!N.transparent){Y.css(U,X)}this._proportionallyResize()}if(!A(N.handles[V]).length){continue}}};this._renderAxis(this.element);N._handles=A(".ui-resizable-handle",M.element);if(N.disableSelection){N._handles.each(function(U,V){A.ui.disableSelection(V)})}N._handles.mouseover(function(){if(!N.resizing){if(this.className){var U=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}M.axis=N.axis=U&&U[1]?U[1]:"se"}});if(N.autoHide){N._handles.hide();A(M.element).addClass("ui-resizable-autohide").hover(function(){A(this).removeClass("ui-resizable-autohide");N._handles.show()},function(){if(!N.resizing){A(this).addClass("ui-resizable-autohide");N._handles.hide()}})}this._mouseInit()},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,options:this.options,originalSize:this.originalSize,originalPosition:this.originalPosition}},_propagate:function(C,B){A.ui.plugin.call(this,C,[B,this.ui()]);if(C!="resize"){this.element.triggerHandler(["resize",C].join(""),[B,this.ui()],this.options[C])}},destroy:function(){var D=this.element,C=D.children(".ui-resizable").get(0);this._mouseDestroy();var B=function(E){A(E).removeClass("ui-resizable ui-resizable-disabled").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};B(D);if(D.is(".ui-wrapper")&&C){D.parent().append(A(C).css({position:D.css("position"),width:D.outerWidth(),height:D.outerHeight(),top:D.css("top"),left:D.css("left")})).end().remove();B(C)}},_mouseCapture:function(D){if(this.options.disabled){return false}var C=false;for(var B in this.options.handles){if(A(this.options.handles[B])[0]==D.target){C=true}}if(!C){return false}return true},_mouseStart:function(I){var C=this.options,B=this.element.position(),D=this.element,H=function(M){return parseInt(M,10)||0},G=A.browser.msie&&A.browser.version<7;C.resizing=true;C.documentScroll={top:A(document).scrollTop(),left:A(document).scrollLeft()};if(D.is(".ui-draggable")||(/absolute/).test(D.css("position"))){var J=A.browser.msie&&!C.containment&&(/absolute/).test(D.css("position"))&&!(/relative/).test(D.parent().css("position"));var K=J?C.documentScroll.top:0,F=J?C.documentScroll.left:0;D.css({position:"absolute",top:(B.top+K),left:(B.left+F)})}if(A.browser.opera&&/relative/.test(D.css("position"))){D.css({position:"relative",top:"auto",left:"auto"})}this._renderProxy();var L=H(this.helper.css("left")),E=H(this.helper.css("top"));if(C.containment){L+=A(C.containment).scrollLeft()||0;E+=A(C.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:L,top:E};this.size=C.helper||G?{width:D.outerWidth(),height:D.outerHeight()}:{width:D.width(),height:D.height()};this.originalSize=C.helper||G?{width:D.outerWidth(),height:D.outerHeight()}:{width:D.width(),height:D.height()};this.originalPosition={left:L,top:E};this.sizeDiff={width:D.outerWidth()-D.width(),height:D.outerHeight()-D.height()};this.originalMousePosition={left:I.pageX,top:I.pageY};C.aspectRatio=(typeof C.aspectRatio=="number")?C.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);if(C.preserveCursor){A("body").css("cursor",this.axis+"-resize")}this._propagate("start",I);return true},_mouseDrag:function(I){var D=this.helper,C=this.options,J={},M=this,F=this.originalMousePosition,K=this.axis;var N=(I.pageX-F.left)||0,L=(I.pageY-F.top)||0;var E=this._change[K];if(!E){return false}var H=E.apply(this,[I,N,L]),G=A.browser.msie&&A.browser.version<7,B=this.sizeDiff;if(C._aspectRatio||I.shiftKey){H=this._updateRatio(H,I)}H=this._respectSize(H,I);this._propagate("resize",I);D.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!C.helper&&C.proportionallyResize){this._proportionallyResize()}this._updateCache(H);this.element.triggerHandler("resize",[I,this.ui()],this.options["resize"]);return false},_mouseStop:function(I){this.options.resizing=false;var E=this.options,H=function(M){return parseInt(M,10)||0},K=this;if(E.helper){var D=E.proportionallyResize,B=D&&(/textarea/i).test(D.get(0).nodeName),C=B&&A.ui.hasScroll(D.get(0),"left")?0:K.sizeDiff.height,G=B?0:K.sizeDiff.width;var L={width:(K.size.width-G),height:(K.size.height-C)},F=(parseInt(K.element.css("left"),10)+(K.position.left-K.originalPosition.left))||null,J=(parseInt(K.element.css("top"),10)+(K.position.top-K.originalPosition.top))||null;if(!E.animate){this.element.css(A.extend(L,{top:J,left:F}))}if(E.helper&&!E.animate){this._proportionallyResize()}}if(E.preserveCursor){A("body").css("cursor","auto")}this._propagate("stop",I);if(E.helper){this.helper.remove()}return false},_updateCache:function(B){var C=this.options;this.offset=this.helper.offset();if(B.left){this.position.left=B.left}if(B.top){this.position.top=B.top}if(B.height){this.size.height=B.height}if(B.width){this.size.width=B.width}},_updateRatio:function(D,E){var F=this.options,G=this.position,C=this.size,B=this.axis;if(D.height){D.width=(C.height*F.aspectRatio)}else{if(D.width){D.height=(C.width/F.aspectRatio)}}if(B=="sw"){D.left=G.left+(C.width-D.width);D.top=null}if(B=="nw"){D.top=G.top+(C.height-D.height);D.left=G.left+(C.width-D.width)}return D},_respectSize:function(H,I){var F=this.helper,E=this.options,N=E._aspectRatio||I.shiftKey,M=this.axis,P=H.width&&E.maxWidth&&E.maxWidthH.width,O=H.height&&E.minHeight&&E.minHeight>H.height;if(D){H.width=E.minWidth}if(O){H.height=E.minHeight}if(P){H.width=E.maxWidth}if(J){H.height=E.maxHeight}var C=this.originalPosition.left+this.originalSize.width,L=this.position.top+this.size.height;var G=/sw|nw|w/.test(M),B=/nw|ne|n/.test(M);if(D&&G){H.left=C-E.minWidth}if(P&&G){H.left=C-E.maxWidth}if(O&&B){H.top=L-E.minHeight}if(J&&B){H.top=L-E.maxHeight}var K=!H.width&&!H.height;if(K&&!H.left&&H.top){H.top=null}else{if(K&&!H.top&&H.left){H.left=null}}return H},_proportionallyResize:function(){var F=this.options;if(!F.proportionallyResize){return }var D=F.proportionallyResize,C=this.helper||this.element;if(!F.borderDif){var B=[D.css("borderTopWidth"),D.css("borderRightWidth"),D.css("borderBottomWidth"),D.css("borderLeftWidth")],E=[D.css("paddingTop"),D.css("paddingRight"),D.css("paddingBottom"),D.css("paddingLeft")];F.borderDif=A.map(B,function(G,I){var H=parseInt(G,10)||0,J=parseInt(E[I],10)||0;return H+J})}D.css({height:(C.height()-F.borderDif[0]-F.borderDif[2])+"px",width:(C.width()-F.borderDif[1]-F.borderDif[3])+"px"})},_renderProxy:function(){var C=this.element,F=this.options;this.elementOffset=C.offset();if(F.helper){this.helper=this.helper||A('
    ');var B=A.browser.msie&&A.browser.version<7,D=(B?1:0),E=(B?2:-1);this.helper.addClass(F.helper).css({width:C.outerWidth()+E,height:C.outerHeight()+E,position:"absolute",left:this.elementOffset.left-D+"px",top:this.elementOffset.top-D+"px",zIndex:++F.zIndex});this.helper.appendTo("body");if(F.disableSelection){A.ui.disableSelection(this.helper.get(0))}}else{this.helper=C}},_change:{e:function(D,C,B){return{width:this.originalSize.width+C}},w:function(F,C,B){var G=this.options,D=this.originalSize,E=this.originalPosition;return{left:E.left+C,width:D.width-C}},n:function(F,C,B){var G=this.options,D=this.originalSize,E=this.originalPosition;return{top:E.top+B,height:D.height-B}},s:function(D,C,B){return{height:this.originalSize.height+B}},se:function(D,C,B){return A.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[D,C,B]))},sw:function(D,C,B){return A.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[D,C,B]))},ne:function(D,C,B){return A.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[D,C,B]))},nw:function(D,C,B){return A.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[D,C,B]))}}}));A.extend(A.ui.resizable,{defaults:{cancel:":input",distance:1,delay:0,preventDefault:true,transparent:false,minWidth:10,minHeight:10,aspectRatio:false,disableSelection:true,preserveCursor:true,autoHide:false,knobHandles:false}});A.ui.plugin.add("resizable","containment",{start:function(I,K){var E=K.options,M=A(this).data("resizable"),G=M.element;var C=E.containment,F=(C instanceof A)?C.get(0):(/parent/.test(C))?G.parent().get(0):C;if(!F){return }M.containerElement=A(F);if(/document/.test(C)||C==document){M.containerOffset={left:0,top:0};M.containerPosition={left:0,top:0};M.parentData={element:A(document),left:0,top:0,width:A(document).width(),height:A(document).height()||document.body.parentNode.scrollHeight}}else{M.containerOffset=A(F).offset();M.containerPosition=A(F).position();M.containerSize={height:A(F).innerHeight(),width:A(F).innerWidth()};var J=M.containerOffset,B=M.containerSize.height,H=M.containerSize.width,D=(A.ui.hasScroll(F,"left")?F.scrollWidth:H),L=(A.ui.hasScroll(F)?F.scrollHeight:B);M.parentData={element:F,left:J.left,top:J.top,width:D,height:L}}},resize:function(H,K){var E=K.options,N=A(this).data("resizable"),C=N.containerSize,J=N.containerOffset,G=N.size,I=N.position,L=E._aspectRatio||H.shiftKey,B={top:0,left:0},D=N.containerElement;if(D[0]!=document&&/static/.test(D.css("position"))){B=N.containerPosition}if(I.left<(E.helper?J.left:B.left)){N.size.width=N.size.width+(E.helper?(N.position.left-J.left):(N.position.left-B.left));if(L){N.size.height=N.size.width/E.aspectRatio}N.position.left=E.helper?J.left:B.left}if(I.top<(E.helper?J.top:0)){N.size.height=N.size.height+(E.helper?(N.position.top-J.top):N.position.top);if(L){N.size.width=N.size.height*E.aspectRatio}N.position.top=E.helper?J.top:0}var F=(E.helper?N.offset.left-J.left:(N.position.left-B.left))+N.sizeDiff.width,M=(E.helper?N.offset.top-J.top:N.position.top)+N.sizeDiff.height;if(F+N.size.width>=N.parentData.width){N.size.width=N.parentData.width-F;if(L){N.size.height=N.size.width/E.aspectRatio}}if(M+N.size.height>=N.parentData.height){N.size.height=N.parentData.height-M;if(L){N.size.width=N.size.height*E.aspectRatio}}},stop:function(G,J){var C=J.options,L=A(this).data("resizable"),H=L.position,I=L.containerOffset,B=L.containerPosition,D=L.containerElement;var E=A(L.helper),M=E.offset(),K=E.innerWidth(),F=E.innerHeight();if(C.helper&&!C.animate&&/relative/.test(D.css("position"))){A(this).css({left:(M.left-I.left),top:(M.top-I.top),width:K,height:F})}if(C.helper&&!C.animate&&/static/.test(D.css("position"))){A(this).css({left:B.left+(M.left-I.left),top:B.top+(M.top-I.top),width:K,height:F})}}});A.ui.plugin.add("resizable","grid",{resize:function(H,J){var D=J.options,L=A(this).data("resizable"),G=L.size,E=L.originalSize,F=L.originalPosition,K=L.axis,I=D._aspectRatio||H.shiftKey;D.grid=typeof D.grid=="number"?[D.grid,D.grid]:D.grid;var C=Math.round((G.width-E.width)/(D.grid[0]||1))*(D.grid[0]||1),B=Math.round((G.height-E.height)/(D.grid[1]||1))*(D.grid[1]||1);if(/^(se|s|e)$/.test(K)){L.size.width=E.width+C;L.size.height=E.height+B}else{if(/^(ne)$/.test(K)){L.size.width=E.width+C;L.size.height=E.height+B;L.position.top=F.top-B}else{if(/^(sw)$/.test(K)){L.size.width=E.width+C;L.size.height=E.height+B;L.position.left=F.left-C}else{L.size.width=E.width+C;L.size.height=E.height+B;L.position.top=F.top-B;L.position.left=F.left-C}}}}});A.ui.plugin.add("resizable","animate",{stop:function(I,K){var F=K.options,L=A(this).data("resizable");var E=F.proportionallyResize,B=E&&(/textarea/i).test(E.get(0).nodeName),C=B&&A.ui.hasScroll(E.get(0),"left")?0:L.sizeDiff.height,H=B?0:L.sizeDiff.width;var D={width:(L.size.width-H),height:(L.size.height-C)},G=(parseInt(L.element.css("left"),10)+(L.position.left-L.originalPosition.left))||null,J=(parseInt(L.element.css("top"),10)+(L.position.top-L.originalPosition.top))||null;L.element.animate(A.extend(D,J&&G?{top:J,left:G}:{}),{duration:F.animateDuration||"slow",easing:F.animateEasing||"swing",step:function(){var M={width:parseInt(L.element.css("width"),10),height:parseInt(L.element.css("height"),10),top:parseInt(L.element.css("top"),10),left:parseInt(L.element.css("left"),10)};if(E){E.css({width:M.width,height:M.height})}L._updateCache(M);L._propagate("animate",I)}})}});A.ui.plugin.add("resizable","ghost",{start:function(E,D){var F=D.options,B=A(this).data("resizable"),G=F.proportionallyResize,C=B.size;if(!G){B.ghost=B.element.clone()}else{B.ghost=G.clone()}B.ghost.css({opacity:0.25,display:"block",position:"relative",height:C.height,width:C.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof F.ghost=="string"?F.ghost:"");B.ghost.appendTo(B.helper)},resize:function(D,C){var E=C.options,B=A(this).data("resizable"),F=E.proportionallyResize;if(B.ghost){B.ghost.css({position:"relative",height:B.size.height,width:B.size.width})}},stop:function(D,C){var E=C.options,B=A(this).data("resizable"),F=E.proportionallyResize;if(B.ghost&&B.helper){B.helper.get(0).removeChild(B.ghost.get(0))}}});A.ui.plugin.add("resizable","alsoResize",{start:function(E,C){var F=C.options,B=A(this).data("resizable"),D=function(G){A(G).each(function(){A(this).data("resizable-alsoresize",{width:parseInt(A(this).width(),10),height:parseInt(A(this).height(),10),left:parseInt(A(this).css("left"),10),top:parseInt(A(this).css("top"),10)})})};if(typeof (F.alsoResize)=="object"){if(F.alsoResize.length){F.alsoResize=F.alsoResize[0];D(F.alsoResize)}else{A.each(F.alsoResize,function(G,H){D(G)})}}else{D(F.alsoResize)}},resize:function(F,E){var G=E.options,C=A(this).data("resizable"),D=C.originalSize,I=C.originalPosition;var H={height:(C.size.height-D.height)||0,width:(C.size.width-D.width)||0,top:(C.position.top-I.top)||0,left:(C.position.left-I.left)||0},B=function(J,K){A(J).each(function(){var N=A(this).data("resizable-alsoresize"),M={},L=K&&K.length?K:["width","height","top","left"];A.each(L||["width","height","top","left"],function(O,Q){var P=(N[Q]||0)+(H[Q]||0);if(P&&P>=0){M[Q]=P||null}});A(this).css(M)})};if(typeof (G.alsoResize)=="object"){A.each(G.alsoResize,function(J,K){B(J,K)})}else{B(G.alsoResize)}},stop:function(C,B){A(this).removeData("resizable-alsoresize-start")}})})(jQuery) \ No newline at end of file +/* + * jQuery UI Resizable 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * ui.core.js + */ +(function(c){c.widget("ui.resizable",c.extend({},c.ui.mouse,{_init:function(){var e=this,j=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(j.aspectRatio),aspectRatio:j.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:j.helper||j.ghost||j.animate?j.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){if(/relative/.test(this.element.css("position"))&&c.browser.opera){this.element.css({position:"relative",top:"auto",left:"auto"})}this.element.wrap(c('
    ').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=j.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var k=this.handles.split(",");this.handles={};for(var f=0;f
    ');if(/sw|se|ne|nw/.test(h)){g.css({zIndex:++j.zIndex})}if("se"==h){g.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[h]=".ui-resizable-"+h;this.element.append(g)}}this._renderAxis=function(p){p=p||this.element;for(var m in this.handles){if(this.handles[m].constructor==String){this.handles[m]=c(this.handles[m],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var n=c(this.handles[m],this.element),o=0;o=/sw|ne|nw|se|n|s/.test(m)?n.outerHeight():n.outerWidth();var l=["padding",/ne|nw|n/.test(m)?"Top":/se|sw|s/.test(m)?"Bottom":/^e$/.test(m)?"Right":"Left"].join("");p.css(l,o);this._proportionallyResize()}if(!c(this.handles[m]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!e.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}e.axis=i&&i[1]?i[1]:"se"}});if(j.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){c(this).removeClass("ui-resizable-autohide");e._handles.show()},function(){if(!e.resizing){c(this).addClass("ui-resizable-autohide");e._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var d=function(f){c(f).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){d(this.element);var e=this.element;e.parent().append(this.originalElement.css({position:e.css("position"),width:e.outerWidth(),height:e.outerHeight(),top:e.css("top"),left:e.css("left")})).end().remove()}this.originalElement.css("resize",this.originalResizeStyle);d(this.originalElement)},_mouseCapture:function(e){var f=false;for(var d in this.handles){if(c(this.handles[d])[0]==e.target){f=true}}return this.options.disabled||!!f},_mouseStart:function(f){var i=this.options,e=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(d.is(".ui-draggable")||(/absolute/).test(d.css("position"))){d.css({position:"absolute",top:e.top,left:e.left})}if(c.browser.opera&&(/relative/).test(d.css("position"))){d.css({position:"relative",top:"auto",left:"auto"})}this._renderProxy();var j=b(this.helper.css("left")),g=b(this.helper.css("top"));if(i.containment){j+=c(i.containment).scrollLeft()||0;g+=c(i.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:j,top:g};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:j,top:g};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:f.pageX,top:f.pageY};this.aspectRatio=(typeof i.aspectRatio=="number")?i.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var h=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",h=="auto"?this.axis+"-resize":h);d.addClass("ui-resizable-resizing");this._propagate("start",f);return true},_mouseDrag:function(d){var g=this.helper,f=this.options,l={},p=this,i=this.originalMousePosition,m=this.axis;var q=(d.pageX-i.left)||0,n=(d.pageY-i.top)||0;var h=this._change[m];if(!h){return false}var k=h.apply(this,[d,q,n]),j=c.browser.msie&&c.browser.version<7,e=this.sizeDiff;if(this._aspectRatio||d.shiftKey){k=this._updateRatio(k,d)}k=this._respectSize(k,d);this._propagate("resize",d);g.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(k);this._trigger("resize",d,this.ui());return false},_mouseStop:function(g){this.resizing=false;var h=this.options,l=this;if(this._helper){var f=this._proportionallyResizeElements,d=f.length&&(/textarea/i).test(f[0].nodeName),e=d&&c.ui.hasScroll(f[0],"left")?0:l.sizeDiff.height,j=d?0:l.sizeDiff.width;var m={width:(l.size.width-j),height:(l.size.height-e)},i=(parseInt(l.element.css("left"),10)+(l.position.left-l.originalPosition.left))||null,k=(parseInt(l.element.css("top"),10)+(l.position.top-l.originalPosition.top))||null;if(!h.animate){this.element.css(c.extend(m,{top:k,left:i}))}l.helper.height(l.size.height);l.helper.width(l.size.width);if(this._helper&&!h.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",g);if(this._helper){this.helper.remove()}return false},_updateCache:function(d){var e=this.options;this.offset=this.helper.offset();if(a(d.left)){this.position.left=d.left}if(a(d.top)){this.position.top=d.top}if(a(d.height)){this.size.height=d.height}if(a(d.width)){this.size.width=d.width}},_updateRatio:function(g,f){var h=this.options,i=this.position,e=this.size,d=this.axis;if(g.height){g.width=(e.height*this.aspectRatio)}else{if(g.width){g.height=(e.width/this.aspectRatio)}}if(d=="sw"){g.left=i.left+(e.width-g.width);g.top=null}if(d=="nw"){g.top=i.top+(e.height-g.height);g.left=i.left+(e.width-g.width)}return g},_respectSize:function(k,f){var i=this.helper,h=this.options,q=this._aspectRatio||f.shiftKey,p=this.axis,s=a(k.width)&&h.maxWidth&&(h.maxWidthk.width),r=a(k.height)&&h.minHeight&&(h.minHeight>k.height);if(g){k.width=h.minWidth}if(r){k.height=h.minHeight}if(s){k.width=h.maxWidth}if(l){k.height=h.maxHeight}var e=this.originalPosition.left+this.originalSize.width,n=this.position.top+this.size.height;var j=/sw|nw|w/.test(p),d=/nw|ne|n/.test(p);if(g&&j){k.left=e-h.minWidth}if(s&&j){k.left=e-h.maxWidth}if(r&&d){k.top=n-h.minHeight}if(l&&d){k.top=n-h.maxHeight}var m=!k.width&&!k.height;if(m&&!k.left&&k.top){k.top=null}else{if(m&&!k.top&&k.left){k.left=null}}return k},_proportionallyResize:function(){var j=this.options;if(!this._proportionallyResizeElements.length){return}var f=this.helper||this.element;for(var e=0;e');var d=c.browser.msie&&c.browser.version<7,f=(d?1:0),g=(d?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+g,height:this.element.outerHeight()+g,position:"absolute",left:this.elementOffset.left-f+"px",top:this.elementOffset.top-f+"px",zIndex:++h.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(f,e,d){return{width:this.originalSize.width+e}},w:function(g,e,d){var i=this.options,f=this.originalSize,h=this.originalPosition;return{left:h.left+e,width:f.width-e}},n:function(g,e,d){var i=this.options,f=this.originalSize,h=this.originalPosition;return{top:h.top+d,height:f.height-d}},s:function(f,e,d){return{height:this.originalSize.height+d}},se:function(f,e,d){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[f,e,d]))},sw:function(f,e,d){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[f,e,d]))},ne:function(f,e,d){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[f,e,d]))},nw:function(f,e,d){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[f,e,d]))}},_propagate:function(e,d){c.ui.plugin.call(this,e,[d,this.ui()]);(e!="resize"&&this._trigger(e,d,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}));c.extend(c.ui.resizable,{version:"1.7.1",eventPrefix:"resize",defaults:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,cancel:":input,option",containment:false,delay:0,distance:1,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000}});c.ui.plugin.add("resizable","alsoResize",{start:function(e,f){var d=c(this).data("resizable"),g=d.options;_store=function(h){c(h).each(function(){c(this).data("resizable-alsoresize",{width:parseInt(c(this).width(),10),height:parseInt(c(this).height(),10),left:parseInt(c(this).css("left"),10),top:parseInt(c(this).css("top"),10)})})};if(typeof(g.alsoResize)=="object"&&!g.alsoResize.parentNode){if(g.alsoResize.length){g.alsoResize=g.alsoResize[0];_store(g.alsoResize)}else{c.each(g.alsoResize,function(h,i){_store(h)})}}else{_store(g.alsoResize)}},resize:function(f,h){var e=c(this).data("resizable"),i=e.options,g=e.originalSize,k=e.originalPosition;var j={height:(e.size.height-g.height)||0,width:(e.size.width-g.width)||0,top:(e.position.top-k.top)||0,left:(e.position.left-k.left)||0},d=function(l,m){c(l).each(function(){var p=c(this),q=c(this).data("resizable-alsoresize"),o={},n=m&&m.length?m:["width","height","top","left"];c.each(n||["width","height","top","left"],function(r,t){var s=(q[t]||0)+(j[t]||0);if(s&&s>=0){o[t]=s||null}});if(/relative/.test(p.css("position"))&&c.browser.opera){e._revertToRelativePosition=true;p.css({position:"absolute",top:"auto",left:"auto"})}p.css(o)})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.nodeType){c.each(i.alsoResize,function(l,m){d(l,m)})}else{d(i.alsoResize)}},stop:function(e,f){var d=c(this).data("resizable");if(d._revertToRelativePosition&&c.browser.opera){d._revertToRelativePosition=false;el.css({position:"relative"})}c(this).removeData("resizable-alsoresize-start")}});c.ui.plugin.add("resizable","animate",{stop:function(h,m){var n=c(this).data("resizable"),i=n.options;var g=n._proportionallyResizeElements,d=g.length&&(/textarea/i).test(g[0].nodeName),e=d&&c.ui.hasScroll(g[0],"left")?0:n.sizeDiff.height,k=d?0:n.sizeDiff.width;var f={width:(n.size.width-k),height:(n.size.height-e)},j=(parseInt(n.element.css("left"),10)+(n.position.left-n.originalPosition.left))||null,l=(parseInt(n.element.css("top"),10)+(n.position.top-n.originalPosition.top))||null;n.element.animate(c.extend(f,l&&j?{top:l,left:j}:{}),{duration:i.animateDuration,easing:i.animateEasing,step:function(){var o={width:parseInt(n.element.css("width"),10),height:parseInt(n.element.css("height"),10),top:parseInt(n.element.css("top"),10),left:parseInt(n.element.css("left"),10)};if(g&&g.length){c(g[0]).css({width:o.width,height:o.height})}n._updateCache(o);n._propagate("resize",h)}})}});c.ui.plugin.add("resizable","containment",{start:function(e,q){var s=c(this).data("resizable"),i=s.options,k=s.element;var f=i.containment,j=(f instanceof c)?f.get(0):(/parent/.test(f))?k.parent().get(0):f;if(!j){return}s.containerElement=c(j);if(/document/.test(f)||f==document){s.containerOffset={left:0,top:0};s.containerPosition={left:0,top:0};s.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var m=c(j),h=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){h[p]=b(m.css("padding"+o))});s.containerOffset=m.offset();s.containerPosition=m.position();s.containerSize={height:(m.innerHeight()-h[3]),width:(m.innerWidth()-h[1])};var n=s.containerOffset,d=s.containerSize.height,l=s.containerSize.width,g=(c.ui.hasScroll(j,"left")?j.scrollWidth:l),r=(c.ui.hasScroll(j)?j.scrollHeight:d);s.parentData={element:j,left:n.left,top:n.top,width:g,height:r}}},resize:function(f,p){var s=c(this).data("resizable"),h=s.options,e=s.containerSize,n=s.containerOffset,l=s.size,m=s.position,q=s._aspectRatio||f.shiftKey,d={top:0,left:0},g=s.containerElement;if(g[0]!=document&&(/static/).test(g.css("position"))){d=n}if(m.left<(s._helper?n.left:0)){s.size.width=s.size.width+(s._helper?(s.position.left-n.left):(s.position.left-d.left));if(q){s.size.height=s.size.width/h.aspectRatio}s.position.left=h.helper?n.left:0}if(m.top<(s._helper?n.top:0)){s.size.height=s.size.height+(s._helper?(s.position.top-n.top):s.position.top);if(q){s.size.width=s.size.height*h.aspectRatio}s.position.top=s._helper?n.top:0}s.offset.left=s.parentData.left+s.position.left;s.offset.top=s.parentData.top+s.position.top;var k=Math.abs((s._helper?s.offset.left-d.left:(s.offset.left-d.left))+s.sizeDiff.width),r=Math.abs((s._helper?s.offset.top-d.top:(s.offset.top-n.top))+s.sizeDiff.height);var j=s.containerElement.get(0)==s.element.parent().get(0),i=/relative|absolute/.test(s.containerElement.css("position"));if(j&&i){k-=s.parentData.left}if(k+s.size.width>=s.parentData.width){s.size.width=s.parentData.width-k;if(q){s.size.height=s.size.width/s.aspectRatio}}if(r+s.size.height>=s.parentData.height){s.size.height=s.parentData.height-r;if(q){s.size.width=s.size.height*s.aspectRatio}}},stop:function(e,m){var p=c(this).data("resizable"),f=p.options,k=p.position,l=p.containerOffset,d=p.containerPosition,g=p.containerElement;var i=c(p.helper),q=i.offset(),n=i.outerWidth()-p.sizeDiff.width,j=i.outerHeight()-p.sizeDiff.height;if(p._helper&&!f.animate&&(/relative/).test(g.css("position"))){c(this).css({left:q.left-d.left-l.left,width:n,height:j})}if(p._helper&&!f.animate&&(/static/).test(g.css("position"))){c(this).css({left:q.left-d.left-l.left,width:n,height:j})}}});c.ui.plugin.add("resizable","ghost",{start:function(f,g){var d=c(this).data("resizable"),h=d.options,e=d.size;d.ghost=d.originalElement.clone();d.ghost.css({opacity:0.25,display:"block",position:"relative",height:e.height,width:e.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof h.ghost=="string"?h.ghost:"");d.ghost.appendTo(d.helper)},resize:function(e,f){var d=c(this).data("resizable"),g=d.options;if(d.ghost){d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})}},stop:function(e,f){var d=c(this).data("resizable"),g=d.options;if(d.ghost&&d.helper){d.helper.get(0).removeChild(d.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(d,l){var n=c(this).data("resizable"),g=n.options,j=n.size,h=n.originalSize,i=n.originalPosition,m=n.axis,k=g._aspectRatio||d.shiftKey;g.grid=typeof g.grid=="number"?[g.grid,g.grid]:g.grid;var f=Math.round((j.width-h.width)/(g.grid[0]||1))*(g.grid[0]||1),e=Math.round((j.height-h.height)/(g.grid[1]||1))*(g.grid[1]||1);if(/^(se|s|e)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e}else{if(/^(ne)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e;n.position.top=i.top-e}else{if(/^(sw)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e;n.position.left=i.left-f}else{n.size.width=h.width+f;n.size.height=h.height+e;n.position.top=i.top-e;n.position.left=i.left-f}}}}});var b=function(d){return parseInt(d,10)||0};var a=function(d){return !isNaN(parseInt(d,10))}})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.selectable.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/ui.selectable.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.selectable.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.selectable.min.js 1 Apr 2009 00:45:13 -0000 1.2 @@ -1 +1,13 @@ -(function(A){A.widget("ui.selectable",A.extend({},A.ui.mouse,{_init:function(){var B=this;this.element.addClass("ui-selectable");this.dragged=false;var C;this.refresh=function(){C=A(B.options.filter,B.element[0]);C.each(function(){var D=A(this);var E=D.offset();A.data(this,"selectable-item",{element:this,$element:D,left:E.left,top:E.top,right:E.left+D.width(),bottom:E.top+D.height(),startselected:false,selected:D.hasClass("ui-selected"),selecting:D.hasClass("ui-selecting"),unselecting:D.hasClass("ui-unselecting")})})};this.refresh();this.selectees=C.addClass("ui-selectee");this._mouseInit();this.helper=A(document.createElement("div")).css({border:"1px dotted black"}).addClass("ui-selectable-helper")},toggle:function(){if(this.options.disabled){this.enable()}else{this.disable()}},destroy:function(){this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy()},_mouseStart:function(E){var C=this;this.opos=[E.pageX,E.pageY];if(this.options.disabled){return }var D=this.options;this.selectees=A(D.filter,this.element[0]);this.element.triggerHandler("selectablestart",[E,{"selectable":this.element[0],"options":D}],D.start);A("body").append(this.helper);this.helper.css({"z-index":100,"position":"absolute","left":E.clientX,"top":E.clientY,"width":0,"height":0});if(D.autoRefresh){this.refresh()}this.selectees.filter(".ui-selected").each(function(){var F=A.data(this,"selectable-item");F.startselected=true;if(!E.metaKey){F.$element.removeClass("ui-selected");F.selected=false;F.$element.addClass("ui-unselecting");F.unselecting=true;C.element.triggerHandler("selectableunselecting",[E,{selectable:C.element[0],unselecting:F.element,options:D}],D.unselecting)}});var B=false;A(E.target).parents().andSelf().each(function(){if(A.data(this,"selectable-item")){B=true}});return this.options.keyboard?!B:true},_mouseDrag:function(I){var C=this;this.dragged=true;if(this.options.disabled){return }var E=this.options;var D=this.opos[0],H=this.opos[1],B=I.pageX,G=I.pageY;if(D>B){var F=B;B=D;D=F}if(H>G){var F=G;G=H;H=F}this.helper.css({left:D,top:H,width:B-D,height:G-H});this.selectees.each(function(){var J=A.data(this,"selectable-item");if(!J||J.element==C.element[0]){return }var K=false;if(E.tolerance=="touch"){K=(!(J.left>B||J.rightG||J.bottomD&&J.rightH&&J.bottomb){var f=b;b=d;d=f}if(h>g){var f=g;g=h;h=f}this.helper.css({left:d,top:h,width:b-d,height:g-h});this.selectees.each(function(){var j=a.data(this,"selectable-item");if(!j||j.element==c.element[0]){return}var k=false;if(e.tolerance=="touch"){k=(!(j.left>b||j.rightg||j.bottomd&&j.righth&&j.bottom").addClass("ui-slider-handle").appendTo(B.element);if(this.id){D.attr("id",this.id)}return D[0]})}var C=function(D){this.element=A(D);this.element.data("mouse",this);this.options=B.options;this.element.bind("mousedown",function(){if(B.currentHandle){this.blur(B.currentHandle)}B._focus(this,true)});this._mouseInit()};A.extend(C.prototype,A.ui.mouse,{_mouseStart:function(D){return B._start.call(B,D,this.element[0])},_mouseStop:function(D){return B._stop.call(B,D,this.element[0])},_mouseDrag:function(D){return B._drag.call(B,D,this.element[0])},_mouseCapture:function(){return true},trigger:function(D){this._mouseDown(D)}});A(this.handle).each(function(){new C(this)}).wrap('').parent().bind("click",function(){return false}).bind("focus",function(D){B._focus(this.firstChild)}).bind("blur",function(D){B._blur(this.firstChild)}).bind("keydown",function(D){if(!B.options.noKeyboard){return B._keydown(D.keyCode,this.firstChild)}});this.element.bind("mousedown.slider",function(D){B._click.apply(B,[D]);B.currentHandle.data("mouse").trigger(D);B.firstValue=B.firstValue+1});A.each(this.options.handles||[],function(D,E){B.moveTo(E.start,D,true)});if(!isNaN(this.options.startValue)){this.moveTo(this.options.startValue,0,true)}this.previousHandle=A(this.handle[0]);if(this.handle.length==2&&this.options.range){this._createRange()}},_initBoundaries:function(){var B=this.element[0],C=this.options;this.actualSize={width:this.element.outerWidth(),height:this.element.outerHeight()};A.extend(C,{axis:C.axis||(B.offsetWidth").addClass("ui-slider-range").css({position:"absolute"}).appendTo(this.element);this._updateRange()},_removeRange:function(){this.rangeElement.remove();this.rangeElement=null},_updateRange:function(){var C=this.options.axis=="vertical"?"top":"left";var B=this.options.axis=="vertical"?"height":"width";this.rangeElement.css(C,(parseInt(A(this.handle[0]).css(C),10)||0)+this._handleSize(0,this.options.axis=="vertical"?"y":"x")/2);this.rangeElement.css(B,(parseInt(A(this.handle[1]).css(C),10)||0)-(parseInt(A(this.handle[0]).css(C),10)||0))},_getRange:function(){return this.rangeElement?this._convertValue(parseInt(this.rangeElement.css(this.options.axis=="vertical"?"height":"width"),10),this.options.axis=="vertical"?"y":"x"):null},_handleIndex:function(){return this.handle.index(this.currentHandle[0])},value:function(D,B){if(this.handle.length==1){this.currentHandle=this.handle}if(!B){B=this.options.axis=="vertical"?"y":"x"}var C=A(D!=undefined&&D!==null?this.handle[D]||D:this.currentHandle);if(C.data("mouse").sliderValue){return parseInt(C.data("mouse").sliderValue[B],10)}else{return parseInt(((parseInt(C.css(B=="x"?"left":"top"),10)/(this.actualSize[B=="x"?"width":"height"]-this._handleSize(D,B)))*this.options.realMax[B])+this.options.min[B],10)}},_convertValue:function(C,B){return this.options.min[B]+(C/(this.actualSize[B=="x"?"width":"height"]-this._handleSize(null,B)))*this.options.realMax[B]},_translateValue:function(C,B){return((C-this.options.min[B])/this.options.realMax[B])*(this.actualSize[B=="x"?"width":"height"]-this._handleSize(null,B))},_translateRange:function(D,B){if(this.rangeElement){if(this.currentHandle[0]==this.handle[0]&&D>=this._translateValue(this.value(1),B)){D=this._translateValue(this.value(1,B)-this._oneStep(B),B)}if(this.currentHandle[0]==this.handle[1]&&D<=this._translateValue(this.value(0),B)){D=this._translateValue(this.value(0,B)+this._oneStep(B),B)}}if(this.options.handles){var C=this.options.handles[this._handleIndex()];if(Dthis._translateValue(C.max,B)){D=this._translateValue(C.max,B)}}}return D},_translateLimits:function(C,B){if(C>=this.actualSize[B=="x"?"width":"height"]-this._handleSize(null,B)){C=this.actualSize[B=="x"?"width":"height"]-this._handleSize(null,B)}if(C<=0){C=0}return C},_handleSize:function(C,B){return A(C!=undefined&&C!==null?this.handle[C]:this.currentHandle)[0]["offset"+(B=="x"?"Width":"Height")]},_oneStep:function(B){return this.options.stepping[B]||1},_pageStep:function(B){return 10},_start:function(C,B){var D=this.options;if(D.disabled){return false}this.actualSize={width:this.element.outerWidth(),height:this.element.outerHeight()};if(!this.currentHandle){this._focus(this.previousHandle,true)}this.offset=this.element.offset();this.handleOffset=this.currentHandle.offset();this.clickOffset={top:C.pageY-this.handleOffset.top,left:C.pageX-this.handleOffset.left};this.firstValue=this.value();this._propagate("start",C);this._drag(C,B);return true},_stop:function(B){this._propagate("stop",B);if(this.firstValue!=this.value()){this._propagate("change",B)}this._focus(this.currentHandle,true);return false},_drag:function(E,D){var F=this.options;var B={top:E.pageY-this.offset.top-this.clickOffset.top,left:E.pageX-this.offset.left-this.clickOffset.left};if(!this.currentHandle){this._focus(this.previousHandle,true)}B.left=this._translateLimits(B.left,"x");B.top=this._translateLimits(B.top,"y");if(F.stepping.x){var C=this._convertValue(B.left,"x");C=Math.round(C/F.stepping.x)*F.stepping.x;B.left=this._translateValue(C,"x")}if(F.stepping.y){var C=this._convertValue(B.top,"y");C=Math.round(C/F.stepping.y)*F.stepping.y;B.top=this._translateValue(C,"y")}B.left=this._translateRange(B.left,"x");B.top=this._translateRange(B.top,"y");if(F.axis!="vertical"){this.currentHandle.css({left:B.left})}if(F.axis!="horizontal"){this.currentHandle.css({top:B.top})}this.currentHandle.data("mouse").sliderValue={x:Math.round(this._convertValue(B.left,"x"))||0,y:Math.round(this._convertValue(B.top,"y"))||0};if(this.rangeElement){this._updateRange()}this._propagate("slide",E);return false},moveTo:function(F,E,G){var H=this.options;this.actualSize={width:this.element.outerWidth(),height:this.element.outerHeight()};if(E==undefined&&!this.currentHandle&&this.handle.length!=1){return false}if(E==undefined&&!this.currentHandle){E=0}if(E!=undefined){this.currentHandle=this.previousHandle=A(this.handle[E]||E)}if(F.x!==undefined&&F.y!==undefined){var B=F.x,I=F.y}else{var B=F,I=F}if(B!==undefined&&B.constructor!=Number){var D=/^\-\=/.test(B),C=/^\+\=/.test(B);if(D||C){B=this.value(null,"x")+parseInt(B.replace(D?"=":"+=",""),10)}else{B=isNaN(parseInt(B,10))?undefined:parseInt(B,10)}}if(I!==undefined&&I.constructor!=Number){var D=/^\-\=/.test(I),C=/^\+\=/.test(I);if(D||C){I=this.value(null,"y")+parseInt(I.replace(D?"=":"+=",""),10)}else{I=isNaN(parseInt(I,10))?undefined:parseInt(I,10)}}if(H.axis!="vertical"&&B!==undefined){if(H.stepping.x){B=Math.round(B/H.stepping.x)*H.stepping.x}B=this._translateValue(B,"x");B=this._translateLimits(B,"x");B=this._translateRange(B,"x");H.animate?this.currentHandle.stop().animate({left:B},(Math.abs(parseInt(this.currentHandle.css("left"))-B))*(!isNaN(parseInt(H.animate))?H.animate:5)):this.currentHandle.css({left:B})}if(H.axis!="horizontal"&&I!==undefined){if(H.stepping.y){I=Math.round(I/H.stepping.y)*H.stepping.y}I=this._translateValue(I,"y");I=this._translateLimits(I,"y");I=this._translateRange(I,"y");H.animate?this.currentHandle.stop().animate({top:I},(Math.abs(parseInt(this.currentHandle.css("top"))-I))*(!isNaN(parseInt(H.animate))?H.animate:5)):this.currentHandle.css({top:I})}if(this.rangeElement){this._updateRange()}this.currentHandle.data("mouse").sliderValue={x:Math.round(this._convertValue(B,"x"))||0,y:Math.round(this._convertValue(I,"y"))||0};if(!G){this._propagate("start",null);this._propagate("stop",null);this._propagate("change",null);this._propagate("slide",null)}}});A.ui.slider.getter="value";A.ui.slider.defaults={handle:".ui-slider-handle",distance:1,animate:false}})(jQuery) \ No newline at end of file +/* + * jQuery UI Slider 1.7.1 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * ui.core.js + */ +(function(a){a.widget("ui.slider",a.extend({},a.ui.mouse,{_init:function(){var b=this,c=this.options;this._keySliding=false;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");this.range=a([]);if(c.range){if(c.range===true){this.range=a("
    ");if(!c.values){c.values=[this._valueMin(),this._valueMin()]}if(c.values.length&&c.values.length!=2){c.values=[c.values[0],c.values[0]]}}else{this.range=a("
    ")}this.range.appendTo(this.element).addClass("ui-slider-range");if(c.range=="min"||c.range=="max"){this.range.addClass("ui-slider-range-"+c.range)}this.range.addClass("ui-widget-header")}if(a(".ui-slider-handle",this.element).length==0){a('').appendTo(this.element).addClass("ui-slider-handle")}if(c.values&&c.values.length){while(a(".ui-slider-handle",this.element).length').appendTo(this.element).addClass("ui-slider-handle")}}this.handles=a(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(d){d.preventDefault()}).hover(function(){a(this).addClass("ui-state-hover")},function(){a(this).removeClass("ui-state-hover")}).focus(function(){a(".ui-slider .ui-state-focus").removeClass("ui-state-focus");a(this).addClass("ui-state-focus")}).blur(function(){a(this).removeClass("ui-state-focus")});this.handles.each(function(d){a(this).data("index.ui-slider-handle",d)});this.handles.keydown(function(i){var f=true;var e=a(this).data("index.ui-slider-handle");if(b.options.disabled){return}switch(i.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:f=false;if(!b._keySliding){b._keySliding=true;a(this).addClass("ui-state-active");b._start(i,e)}break}var g,d,h=b._step();if(b.options.values&&b.options.values.length){g=d=b.values(e)}else{g=d=b.value()}switch(i.keyCode){case a.ui.keyCode.HOME:d=b._valueMin();break;case a.ui.keyCode.END:d=b._valueMax();break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(g==b._valueMax()){return}d=g+h;break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(g==b._valueMin()){return}d=g-h;break}b._slide(i,e,d);return f}).keyup(function(e){var d=a(this).data("index.ui-slider-handle");if(b._keySliding){b._stop(e,d);b._change(e,d);b._keySliding=false;a(this).removeClass("ui-state-active")}});this._refreshValue()},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy()},_mouseCapture:function(d){var e=this.options;if(e.disabled){return false}this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();var h={x:d.pageX,y:d.pageY};var j=this._normValueFromMouse(h);var c=this._valueMax()-this._valueMin()+1,f;var k=this,i;this.handles.each(function(l){var m=Math.abs(j-k.values(l));if(c>m){c=m;f=a(this);i=l}});if(e.range==true&&this.values(1)==e.min){f=a(this.handles[++i])}this._start(d,i);k._handleIndex=i;f.addClass("ui-state-active").focus();var g=f.offset();var b=!a(d.target).parents().andSelf().is(".ui-slider-handle");this._clickOffset=b?{left:0,top:0}:{left:d.pageX-g.left-(f.width()/2),top:d.pageY-g.top-(f.height()/2)-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};j=this._normValueFromMouse(h);this._slide(d,i,j);return true},_mouseStart:function(b){return true},_mouseDrag:function(d){var b={x:d.pageX,y:d.pageY};var c=this._normValueFromMouse(b);this._slide(d,this._handleIndex,c);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._handleIndex=null;this._clickOffset=null;return false},_detectOrientation:function(){this.orientation=this.options.orientation=="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(d){var c,h;if("horizontal"==this.orientation){c=this.elementSize.width;h=d.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{c=this.elementSize.height;h=d.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}var f=(h/c);if(f>1){f=1}if(f<0){f=0}if("vertical"==this.orientation){f=1-f}var e=this._valueMax()-this._valueMin(),i=f*e,b=i%this.options.step,g=this._valueMin()+i-b;if(b>(this.options.step/2)){g+=this.options.step}return parseFloat(g.toFixed(5))},_start:function(d,c){var b={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){b.value=this.values(c);b.values=this.values()}this._trigger("start",d,b)},_slide:function(f,e,d){var g=this.handles[e];if(this.options.values&&this.options.values.length){var b=this.values(e?0:1);if((e==0&&d>=b)||(e==1&&d<=b)){d=b}if(d!=this.values(e)){var c=this.values();c[e]=d;var h=this._trigger("slide",f,{handle:this.handles[e],value:d,values:c});var b=this.values(e?0:1);if(h!==false){this.values(e,d,(f.type=="mousedown"&&this.options.animate),true)}}}else{if(d!=this.value()){var h=this._trigger("slide",f,{handle:this.handles[e],value:d});if(h!==false){this._setData("value",d,(f.type=="mousedown"&&this.options.animate))}}}},_stop:function(d,c){var b={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){b.value=this.values(c);b.values=this.values()}this._trigger("stop",d,b)},_change:function(d,c){var b={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){b.value=this.values(c);b.values=this.values()}this._trigger("change",d,b)},value:function(b){if(arguments.length){this._setData("value",b);this._change(null,0)}return this._value()},values:function(b,e,c,d){if(arguments.length>1){this.options.values[b]=e;this._refreshValue(c);if(!d){this._change(null,b)}}if(arguments.length){if(this.options.values&&this.options.values.length){return this._values(b)}else{return this.value()}}else{return this._values()}},_setData:function(b,d,c){a.widget.prototype._setData.apply(this,arguments);switch(b){case"orientation":this._detectOrientation();this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue(c);break;case"value":this._refreshValue(c);break}},_step:function(){var b=this.options.step;return b},_value:function(){var b=this.options.value;if(bthis._valueMax()){b=this._valueMax()}return b},_values:function(b){if(arguments.length){var c=this.options.values[b];if(cthis._valueMax()){c=this._valueMax()}return c}else{return this.options.values}},_valueMin:function(){var b=this.options.min;return b},_valueMax:function(){var b=this.options.max;return b},_refreshValue:function(c){var f=this.options.range,d=this.options,l=this;if(this.options.values&&this.options.values.length){var i,h;this.handles.each(function(p,n){var o=(l.values(p)-l._valueMin())/(l._valueMax()-l._valueMin())*100;var m={};m[l.orientation=="horizontal"?"left":"bottom"]=o+"%";a(this).stop(1,1)[c?"animate":"css"](m,d.animate);if(l.options.range===true){if(l.orientation=="horizontal"){(p==0)&&l.range.stop(1,1)[c?"animate":"css"]({left:o+"%"},d.animate);(p==1)&&l.range[c?"animate":"css"]({width:(o-lastValPercent)+"%"},{queue:false,duration:d.animate})}else{(p==0)&&l.range.stop(1,1)[c?"animate":"css"]({bottom:(o)+"%"},d.animate);(p==1)&&l.range[c?"animate":"css"]({height:(o-lastValPercent)+"%"},{queue:false,duration:d.animate})}}lastValPercent=o})}else{var j=this.value(),g=this._valueMin(),k=this._valueMax(),e=k!=g?(j-g)/(k-g)*100:0;var b={};b[l.orientation=="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[c?"animate":"css"](b,d.animate);(f=="min")&&(this.orientation=="horizontal")&&this.range.stop(1,1)[c?"animate":"css"]({width:e+"%"},d.animate);(f=="max")&&(this.orientation=="horizontal")&&this.range[c?"animate":"css"]({width:(100-e)+"%"},{queue:false,duration:d.animate});(f=="min")&&(this.orientation=="vertical")&&this.range.stop(1,1)[c?"animate":"css"]({height:e+"%"},d.animate);(f=="max")&&(this.orientation=="vertical")&&this.range[c?"animate":"css"]({height:(100-e)+"%"},{queue:false,duration:d.animate})}}}));a.extend(a.ui.slider,{getter:"value values",version:"1.7.1",eventPrefix:"slide",defaults:{animate:false,delay:0,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null}})})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.sortable.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/ui.sortable.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.sortable.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.sortable.min.js 1 Apr 2009 00:45:13 -0000 1.2 @@ -1 +1,13 @@ -(function(B){function A(E,D){var C=B.browser.safari&&B.browser.version<522;if(E.contains&&!C){return E.contains(D)}if(E.compareDocumentPosition){return !!(E.compareDocumentPosition(D)&16)}while(D=D.parentNode){if(D==E){return true}}return false}B.widget("ui.sortable",B.extend({},B.ui.mouse,{_init:function(){var C=this.options;this.containerCache={};this.element.addClass("ui-sortable");this.refresh();this.floating=this.items.length?(/left|right/).test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},plugins:{},ui:function(C){return{helper:(C||this)["helper"],placeholder:(C||this)["placeholder"]||B([]),position:(C||this)["position"],absolutePosition:(C||this)["positionAbs"],options:this.options,element:this.element,item:(C||this)["currentItem"],sender:C?C.element:null}},_propagate:function(F,E,C,D){B.ui.plugin.call(this,F,[E,this.ui(C)]);if(!D){this.element.triggerHandler(F=="sort"?F:"sort"+F,[E,this.ui(C)],this.options[F])}},serialize:function(E){var C=this._getItemsAsjQuery(E&&E.connected);var D=[];E=E||{};B(C).each(function(){var F=(B(this.item||this).attr(E.attribute||"id")||"").match(E.expression||(/(.+)[-=_](.+)/));if(F){D.push((E.key||F[1]+"[]")+"="+(E.key&&E.expression?F[1]:F[2]))}});return D.join("&")},toArray:function(E){var C=this._getItemsAsjQuery(E&&E.connected);var D=[];C.each(function(){D.push(B(this).attr(E.attr||"id"))});return D},_intersectsWith:function(L){var E=this.positionAbs.left,D=E+this.helperProportions.width,K=this.positionAbs.top,J=K+this.helperProportions.height;var F=L.left,C=F+L.width,M=L.top,I=M+L.height;var N=this.offset.click.top,H=this.offset.click.left;var G=(K+N)>M&&(K+N)F&&(E+H)L[this.floating?"width":"height"])){return G}else{return(FO&&(L+P)F&&(E+H)N[this.floating?"width":"height"])){if(!G){return false}if(this.floating){if((E+H)>F&&(E+H)F+N.width/2&&(E+H)O+M/2){return 1}}}}else{if(!(FF&&EC){return 1}}else{if(J>O&&LI){return 2}}}return false},refresh:function(){this._refreshItems();this.refreshPositions()},_getItemsAsjQuery:function(H){var D=this;var C=[];var F=[];if(this.options.connectWith&&H){for(var G=this.options.connectWith.length-1;G>=0;G--){var J=B(this.options.connectWith[G]);for(var E=J.length-1;E>=0;E--){var I=B.data(J[E],"sortable");if(I&&I!=this&&!I.options.disabled){F.push([B.isFunction(I.options.items)?I.options.items.call(I.element):B(I.options.items,I.element).not(".ui-sortable-helper"),I])}}}}F.push([B.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):B(this.options.items,this.element).not(".ui-sortable-helper"),this]);for(var G=F.length-1;G>=0;G--){F[G][0].each(function(){C.push(this)})}return B(C)},_removeCurrentsFromItems:function(){var E=this.currentItem.find(":data(sortable-item)");for(var D=0;D=0;G--){var I=B(this.options.connectWith[G]);for(var E=I.length-1;E>=0;E--){var H=B.data(I[E],"sortable");if(H&&H!=this&&!H.options.disabled){F.push([B.isFunction(H.options.items)?H.options.items.call(H.element):B(H.options.items,H.element),H]);this.containers.push(H)}}}}for(var G=F.length-1;G>=0;G--){F[G][0].each(function(){B.data(this,"sortable-item",F[G][1]);D.push({item:B(this),instance:F[G][1],width:0,height:0,left:0,top:0})})}},refreshPositions:function(D){if(this.offsetParent){var C=this.offsetParent.offset();this.offset.parent={top:C.top+this.offsetParentBorders.top,left:C.left+this.offsetParentBorders.left}}for(var F=this.items.length-1;F>=0;F--){if(this.items[F].instance!=this.currentContainer&&this.currentContainer&&this.items[F].item[0]!=this.currentItem[0]){continue}var E=this.options.toleranceElement?B(this.options.toleranceElement,this.items[F].item):this.items[F].item;if(!D){this.items[F].width=E[0].offsetWidth;this.items[F].height=E[0].offsetHeight}var G=E.offset();this.items[F].left=G.left;this.items[F].top=G.top}if(this.options.custom&&this.options.custom.refreshContainers){this.options.custom.refreshContainers.call(this)}else{for(var F=this.containers.length-1;F>=0;F--){var G=this.containers[F].element.offset();this.containers[F].containerCache.left=G.left;this.containers[F].containerCache.top=G.top;this.containers[F].containerCache.width=this.containers[F].element.outerWidth();this.containers[F].containerCache.height=this.containers[F].element.outerHeight()}}},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var C=this.items.length-1;C>=0;C--){this.items[C].item.removeData("sortable-item")}},_createPlaceholder:function(E){var C=E||this,F=C.options;if(!F.placeholder||F.placeholder.constructor==String){var D=F.placeholder;F.placeholder={element:function(){var G=B(document.createElement(C.currentItem[0].nodeName)).addClass(D||"ui-sortable-placeholder")[0];if(!D){G.style.visibility="hidden";document.body.appendChild(G);G.innerHTML=C.currentItem[0].innerHTML;document.body.removeChild(G)}return G},update:function(G,H){if(D&&!F.forcePlaceholderSize){return }if(!H.height()){H.height(C.currentItem.innerHeight()-parseInt(C.currentItem.css("paddingTop")||0,10)-parseInt(C.currentItem.css("paddingBottom")||0,10))}if(!H.width()){H.width(C.currentItem.innerWidth()-parseInt(C.currentItem.css("paddingLeft")||0,10)-parseInt(C.currentItem.css("paddingRight")||0,10))}}}}C.placeholder=B(F.placeholder.element.call(C.element,C.currentItem));C.currentItem.parent()[0].appendChild(C.placeholder[0]);C.placeholder[0].parentNode.insertBefore(C.placeholder[0],C.currentItem[0]);F.placeholder.update(C,C.placeholder)},_contactContainers:function(F){for(var D=this.containers.length-1;D>=0;D--){if(this._intersectsWith(this.containers[D].containerCache)){if(!this.containers[D].containerCache.over){if(this.currentContainer!=this.containers[D]){var I=10000;var H=null;var E=this.positionAbs[this.containers[D].floating?"left":"top"];for(var C=this.items.length-1;C>=0;C--){if(!A(this.containers[D].element[0],this.items[C].item[0])){continue}var G=this.items[C][this.containers[D].floating?"left":"top"];if(Math.abs(G-E)=0;F--){this.containers[F]._propagate("activate",G,this)}}if(B.ui.ddmanager){B.ui.ddmanager.current=this}if(B.ui.ddmanager&&!C.dropBehaviour){B.ui.ddmanager.prepareOffsets(this,G)}this.dragging=true;this._mouseDrag(G);return true},_convertPositionTo:function(D,E){if(!E){E=this.position}var C=D=="absolute"?1:-1;return{top:(E.top+this.offset.parent.top*C-(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)*C+this.margins.top*C),left:(E.left+this.offset.parent.left*C-(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft)*C+this.margins.left*C)}},_generatePosition:function(F){var G=this.options;var C={top:(F.pageY-this.offset.click.top-this.offset.parent.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)),left:(F.pageX-this.offset.click.left-this.offset.parent.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft))};if(!this.originalPosition){return C}if(this.containment){if(C.leftthis.containment[2]){C.left=this.containment[2]}if(C.top>this.containment[3]){C.top=this.containment[3]}}if(G.grid){var E=this.originalPosition.top+Math.round((C.top-this.originalPosition.top)/G.grid[1])*G.grid[1];C.top=this.containment?(!(Ethis.containment[3])?E:(!(Ethis.containment[2])?D:(!(D=0;C--){var E=this._intersectsWithEdge(this.items[C]);if(!E){continue}if(this.items[C].item[0]!=this.currentItem[0]&&this.placeholder[E==1?"next":"prev"]()[0]!=this.items[C].item[0]&&!A(this.placeholder[0],this.items[C].item[0])&&(this.options.type=="semi-dynamic"?!A(this.element[0],this.items[C].item[0]):true)){this.updateOriginalPosition=this._generatePosition(D);this.direction=E==1?"down":"up";this.options.sortIndicator.call(this,D,this.items[C]);this._propagate("change",D);break}}this._contactContainers(D);if(B.ui.ddmanager){B.ui.ddmanager.drag(this,D)}this.element.triggerHandler("sort",[D,this.ui()],this.options["sort"]);return false},_rearrange:function(H,G,D,F){D?D[0].appendChild(this.placeholder[0]):G.item[0].parentNode.insertBefore(this.placeholder[0],(this.direction=="down"?G.item[0]:G.item[0].nextSibling));this.counter=this.counter?++this.counter:1;var E=this,C=this.counter;window.setTimeout(function(){if(C==E.counter){E.refreshPositions(!F)}},0)},_mouseStop:function(E,D){if(B.ui.ddmanager&&!this.options.dropBehaviour){B.ui.ddmanager.drop(this,E)}if(this.options.revert){var C=this;var F=C.placeholder.offset();B(this.helper).animate({left:F.left-this.offset.parent.left-C.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:F.top-this.offset.parent.top-C.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){C._clear(E)})}else{this._clear(E,D)}return false},_clear:function(E,D){if(!this._noFinalSort){this.placeholder.before(this.currentItem)}this._noFinalSort=null;if(this.options.helper=="original"){this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else{this.currentItem.show()}if(this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0]){this._propagate("update",E,null,D)}if(!A(this.element[0],this.currentItem[0])){this._propagate("remove",E,null,D);for(var C=this.containers.length-1;C>=0;C--){if(A(this.containers[C].element[0],this.currentItem[0])){this.containers[C]._propagate("update",E,this,D);this.containers[C]._propagate("receive",E,this,D)}}}for(var C=this.containers.length-1;C>=0;C--){this.containers[C]._propagate("deactivate",E,this,D);if(this.containers[C].containerCache.over){this.containers[C]._propagate("out",E,this);this.containers[C].containerCache.over=0}}this.dragging=false;if(this.cancelHelperRemoval){this._propagate("beforeStop",E,null,D);this._propagate("stop",E,null,D);return false}this._propagate("beforeStop",E,null,D);this.placeholder.remove();if(this.options.helper!="original"){this.helper.remove()}this.helper=null;this._propagate("stop",E,null,D);return true}}));B.extend(B.ui.sortable,{getter:"serialize toArray",defaults:{helper:"original",tolerance:"guess",distance:1,delay:0,scroll:true,scrollSensitivity:20,scrollSpeed:20,cancel:":input",items:"> *",zIndex:1000,dropOnEmpty:true,appendTo:"parent",sortIndicator:B.ui.sortable.prototype._rearrange,scope:"default",forcePlaceholderSize:false}});B.ui.plugin.add("sortable","cursor",{start:function(E,D){var C=B("body");if(C.css("cursor")){D.options._cursor=C.css("cursor")}C.css("cursor",D.options.cursor)},beforeStop:function(D,C){if(C.options._cursor){B("body").css("cursor",C.options._cursor)}}});B.ui.plugin.add("sortable","zIndex",{start:function(E,D){var C=D.helper;if(C.css("zIndex")){D.options._zIndex=C.css("zIndex")}C.css("zIndex",D.options.zIndex)},beforeStop:function(D,C){if(C.options._zIndex){B(C.helper).css("zIndex",C.options._zIndex)}}});B.ui.plugin.add("sortable","opacity",{start:function(E,D){var C=D.helper;if(C.css("opacity")){D.options._opacity=C.css("opacity")}C.css("opacity",D.options.opacity)},beforeStop:function(D,C){if(C.options._opacity){B(C.helper).css("opacity",C.options._opacity)}}});B.ui.plugin.add("sortable","scroll",{start:function(E,D){var F=D.options;var C=B(this).data("sortable");C.overflowY=function(G){do{if(/auto|scroll/.test(G.css("overflow"))||(/auto|scroll/).test(G.css("overflow-y"))){return G}G=G.parent()}while(G[0].parentNode);return B(document)}(C.currentItem);C.overflowX=function(G){do{if(/auto|scroll/.test(G.css("overflow"))||(/auto|scroll/).test(G.css("overflow-x"))){return G}G=G.parent()}while(G[0].parentNode);return B(document)}(C.currentItem);if(C.overflowY[0]!=document&&C.overflowY[0].tagName!="HTML"){C.overflowYOffset=C.overflowY.offset()}if(C.overflowX[0]!=document&&C.overflowX[0].tagName!="HTML"){C.overflowXOffset=C.overflowX.offset()}},sort:function(E,D){var F=D.options;var C=B(this).data("sortable");if(C.overflowY[0]!=document&&C.overflowY[0].tagName!="HTML"){if((C.overflowYOffset.top+C.overflowY[0].offsetHeight)-E.pageY=0;b--){this.items[b].item.removeData("sortable-item")}},_mouseCapture:function(e,f){if(this.reverting){return false}if(this.options.disabled||this.options.type=="static"){return false}this._refreshItems(e);var d=null,c=this,b=a(e.target).parents().each(function(){if(a.data(this,"sortable-item")==c){d=a(this);return false}});if(a.data(e.target,"sortable-item")==c){d=a(e.target)}if(!d){return false}if(this.options.handle&&!f){var g=false;a(this.options.handle,d).find("*").andSelf().each(function(){if(this==e.target){g=true}});if(!g){return false}}this.currentItem=d;this._removeCurrentsFromItems();return true},_mouseStart:function(e,f,b){var g=this.options,c=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(e);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");a.extend(this.offset,{click:{left:e.pageX-this.offset.left,top:e.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(e);this.originalPageX=e.pageX;this.originalPageY=e.pageY;if(g.cursorAt){this._adjustOffsetFromHelper(g.cursorAt)}this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};if(this.helper[0]!=this.currentItem[0]){this.currentItem.hide()}this._createPlaceholder();if(g.containment){this._setContainment()}if(g.cursor){if(a("body").css("cursor")){this._storedCursor=a("body").css("cursor")}a("body").css("cursor",g.cursor)}if(g.opacity){if(this.helper.css("opacity")){this._storedOpacity=this.helper.css("opacity")}this.helper.css("opacity",g.opacity)}if(g.zIndex){if(this.helper.css("zIndex")){this._storedZIndex=this.helper.css("zIndex")}this.helper.css("zIndex",g.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){this.overflowOffset=this.scrollParent.offset()}this._trigger("start",e,this._uiHash());if(!this._preserveHelperProportions){this._cacheHelperProportions()}if(!b){for(var d=this.containers.length-1;d>=0;d--){this.containers[d]._trigger("activate",e,c._uiHash(this))}}if(a.ui.ddmanager){a.ui.ddmanager.current=this}if(a.ui.ddmanager&&!g.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,e)}this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(e);return true},_mouseDrag:function(f){this.position=this._generatePosition(f);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs){this.lastPositionAbs=this.positionAbs}if(this.options.scroll){var g=this.options,b=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if((this.overflowOffset.top+this.scrollParent[0].offsetHeight)-f.pageY=0;d--){var e=this.items[d],c=e.item[0],h=this._intersectsWithPointer(e);if(!h){continue}if(c!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=c&&!a.ui.contains(this.placeholder[0],c)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],c):true)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(e)){this._rearrange(f,e)}else{break}this._trigger("change",f,this._uiHash());break}}this._contactContainers(f);if(a.ui.ddmanager){a.ui.ddmanager.drag(this,f)}this._trigger("sort",f,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(c,d){if(!c){return}if(a.ui.ddmanager&&!this.options.dropBehaviour){a.ui.ddmanager.drop(this,c)}if(this.options.revert){var b=this;var e=b.placeholder.offset();b.reverting=true;a(this.helper).animate({left:e.left-this.offset.parent.left-b.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-b.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){b._clear(c)})}else{this._clear(c,d)}return false},cancel:function(){var b=this;if(this.dragging){this._mouseUp();if(this.options.helper=="original"){this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else{this.currentItem.show()}for(var c=this.containers.length-1;c>=0;c--){this.containers[c]._trigger("deactivate",null,b._uiHash(this));if(this.containers[c].containerCache.over){this.containers[c]._trigger("out",null,b._uiHash(this));this.containers[c].containerCache.over=0}}}if(this.placeholder[0].parentNode){this.placeholder[0].parentNode.removeChild(this.placeholder[0])}if(this.options.helper!="original"&&this.helper&&this.helper[0].parentNode){this.helper.remove()}a.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});if(this.domPosition.prev){a(this.domPosition.prev).after(this.currentItem)}else{a(this.domPosition.parent).prepend(this.currentItem)}return true},serialize:function(d){var b=this._getItemsAsjQuery(d&&d.connected);var c=[];d=d||{};a(b).each(function(){var e=(a(d.item||this).attr(d.attribute||"id")||"").match(d.expression||(/(.+)[-=_](.+)/));if(e){c.push((d.key||e[1]+"[]")+"="+(d.key&&d.expression?e[1]:e[2]))}});return c.join("&")},toArray:function(d){var b=this._getItemsAsjQuery(d&&d.connected);var c=[];d=d||{};b.each(function(){c.push(a(d.item||this).attr(d.attribute||"id")||"")});return c},_intersectsWith:function(m){var e=this.positionAbs.left,d=e+this.helperProportions.width,k=this.positionAbs.top,j=k+this.helperProportions.height;var f=m.left,c=f+m.width,n=m.top,i=n+m.height;var o=this.offset.click.top,h=this.offset.click.left;var g=(k+o)>n&&(k+o)f&&(e+h)m[this.floating?"width":"height"])){return g}else{return(f0?"down":"up")},_getDragHorizontalDirection:function(){var b=this.positionAbs.left-this.lastPositionAbs.left;return b!=0&&(b>0?"right":"left")},refresh:function(b){this._refreshItems(b);this.refreshPositions()},_connectWith:function(){var b=this.options;return b.connectWith.constructor==String?[b.connectWith]:b.connectWith},_getItemsAsjQuery:function(b){var l=this;var g=[];var e=[];var h=this._connectWith();if(h&&b){for(var d=h.length-1;d>=0;d--){var k=a(h[d]);for(var c=k.length-1;c>=0;c--){var f=a.data(k[c],"sortable");if(f&&f!=this&&!f.options.disabled){e.push([a.isFunction(f.options.items)?f.options.items.call(f.element):a(f.options.items,f.element).not(".ui-sortable-helper"),f])}}}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper"),this]);for(var d=e.length-1;d>=0;d--){e[d][0].each(function(){g.push(this)})}return a(g)},_removeCurrentsFromItems:function(){var d=this.currentItem.find(":data(sortable-item)");for(var c=0;c=0;e--){var m=a(l[e]);for(var d=m.length-1;d>=0;d--){var g=a.data(m[d],"sortable");if(g&&g!=this&&!g.options.disabled){f.push([a.isFunction(g.options.items)?g.options.items.call(g.element[0],b,{item:this.currentItem}):a(g.options.items,g.element),g]);this.containers.push(g)}}}}for(var e=f.length-1;e>=0;e--){var k=f[e][1];var c=f[e][0];for(var d=0,n=c.length;d=0;d--){var e=this.items[d];if(e.instance!=this.currentContainer&&this.currentContainer&&e.item[0]!=this.currentItem[0]){continue}var c=this.options.toleranceElement?a(this.options.toleranceElement,e.item):e.item;if(!b){e.width=c.outerWidth();e.height=c.outerHeight()}var f=c.offset();e.left=f.left;e.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers){this.options.custom.refreshContainers.call(this)}else{for(var d=this.containers.length-1;d>=0;d--){var f=this.containers[d].element.offset();this.containers[d].containerCache.left=f.left;this.containers[d].containerCache.top=f.top;this.containers[d].containerCache.width=this.containers[d].element.outerWidth();this.containers[d].containerCache.height=this.containers[d].element.outerHeight()}}},_createPlaceholder:function(d){var b=d||this,e=b.options;if(!e.placeholder||e.placeholder.constructor==String){var c=e.placeholder;e.placeholder={element:function(){var f=a(document.createElement(b.currentItem[0].nodeName)).addClass(c||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!c){f.style.visibility="hidden"}return f},update:function(f,g){if(c&&!e.forcePlaceholderSize){return}if(!g.height()){g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10))}if(!g.width()){g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=a(e.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);e.placeholder.update(b,b.placeholder)},_contactContainers:function(d){for(var c=this.containers.length-1;c>=0;c--){if(this._intersectsWith(this.containers[c].containerCache)){if(!this.containers[c].containerCache.over){if(this.currentContainer!=this.containers[c]){var h=10000;var g=null;var e=this.positionAbs[this.containers[c].floating?"left":"top"];for(var b=this.items.length-1;b>=0;b--){if(!a.ui.contains(this.containers[c].element[0],this.items[b].item[0])){continue}var f=this.items[b][this.containers[c].floating?"left":"top"];if(Math.abs(f-e)this.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.topthis.containment[3])?g:(!(g-this.offset.click.topthis.containment[2])?f:(!(f-this.offset.click.left=0;c--){if(a.ui.contains(this.containers[c].element[0],this.currentItem[0])&&!e){f.push((function(g){return function(h){g._trigger("receive",h,this._uiHash(this))}}).call(this,this.containers[c]));f.push((function(g){return function(h){g._trigger("update",h,this._uiHash(this))}}).call(this,this.containers[c]))}}}for(var c=this.containers.length-1;c>=0;c--){if(!e){f.push((function(g){return function(h){g._trigger("deactivate",h,this._uiHash(this))}}).call(this,this.containers[c]))}if(this.containers[c].containerCache.over){f.push((function(g){return function(h){g._trigger("out",h,this._uiHash(this))}}).call(this,this.containers[c]));this.containers[c].containerCache.over=0}}if(this._storedCursor){a("body").css("cursor",this._storedCursor)}if(this._storedOpacity){this.helper.css("opacity",this._storedOpacity)}if(this._storedZIndex){this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex)}this.dragging=false;if(this.cancelHelperRemoval){if(!e){this._trigger("beforeStop",d,this._uiHash());for(var c=0;c *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1000}})})(jQuery); \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.tabs.min.js =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/minified/Attic/ui.tabs.min.js,v diff -u -r1.1 -r1.2 --- lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.tabs.min.js 3 Nov 2008 03:59:26 -0000 1.1 +++ lams_central/web/includes/javascript/jquery-ui/ui/minified/ui.tabs.min.js 1 Apr 2009 00:45:13 -0000 1.2 @@ -1 +1,13 @@ -(function(A){A.widget("ui.tabs",{_init:function(){this.options.event+=".tabs";this._tabify(true)},_setData:function(B,C){if((/^selected/).test(B)){this.select(C)}else{this.options[B]=C;this._tabify()}},length:function(){return this.$tabs.length},_tabId:function(B){return B.title&&B.title.replace(/\s/g,"_").replace(/[^A-Za-z0-9\-_:\.]/g,"")||this.options.idPrefix+A.data(B)},ui:function(C,B){return{options:this.options,tab:C,panel:B,index:this.$tabs.index(C)}},_tabify:function(O){this.$lis=A("li:has(a[href])",this.element);this.$tabs=this.$lis.map(function(){return A("a",this)[0]});this.$panels=A([]);var P=this,D=this.options;this.$tabs.each(function(R,Q){if(Q.hash&&Q.hash.replace("#","")){P.$panels=P.$panels.add(Q.hash)}else{if(A(Q).attr("href")!="#"){A.data(Q,"href.tabs",Q.href);A.data(Q,"load.tabs",Q.href);var T=P._tabId(Q);Q.href="#"+T;var S=A("#"+T);if(!S.length){S=A(D.panelTemplate).attr("id",T).addClass(D.panelClass).insertAfter(P.$panels[R-1]||P.element);S.data("destroy.tabs",true)}P.$panels=P.$panels.add(S)}else{D.disabled.push(R+1)}}});if(O){this.element.addClass(D.navClass);this.$panels.each(function(){var Q=A(this);Q.addClass(D.panelClass)});if(D.selected===undefined){if(location.hash){this.$tabs.each(function(S,Q){if(Q.hash==location.hash){D.selected=S;if(A.browser.msie||A.browser.opera){var R=A(location.hash),T=R.attr("id");R.attr("id","");setTimeout(function(){R.attr("id",T)},500)}scrollTo(0,0);return false}})}else{if(D.cookie){var J=parseInt(A.cookie("ui-tabs-"+A.data(P.element[0])),10);if(J&&P.$tabs[J]){D.selected=J}}else{if(P.$lis.filter("."+D.selectedClass).length){D.selected=P.$lis.index(P.$lis.filter("."+D.selectedClass)[0])}}}}D.selected=D.selected===null||D.selected!==undefined?D.selected:0;D.disabled=A.unique(D.disabled.concat(A.map(this.$lis.filter("."+D.disabledClass),function(R,Q){return P.$lis.index(R)}))).sort();if(A.inArray(D.selected,D.disabled)!=-1){D.disabled.splice(A.inArray(D.selected,D.disabled),1)}this.$panels.addClass(D.hideClass);this.$lis.removeClass(D.selectedClass);if(D.selected!==null){this.$panels.eq(D.selected).show().removeClass(D.hideClass);this.$lis.eq(D.selected).addClass(D.selectedClass);var K=function(){P._trigger("show",null,P.ui(P.$tabs[D.selected],P.$panels[D.selected]))};if(A.data(this.$tabs[D.selected],"load.tabs")){this.load(D.selected,K)}else{K()}}A(window).bind("unload",function(){P.$tabs.unbind(".tabs");P.$lis=P.$tabs=P.$panels=null})}else{D.selected=this.$lis.index(this.$lis.filter("."+D.selectedClass)[0])}if(D.cookie){A.cookie("ui-tabs-"+A.data(P.element[0]),D.selected,D.cookie)}for(var G=0,N;N=this.$lis[G];G++){A(N)[A.inArray(G,D.disabled)!=-1&&!A(N).hasClass(D.selectedClass)?"addClass":"removeClass"](D.disabledClass)}if(D.cache===false){this.$tabs.removeData("cache.tabs")}var C,I,B={"min-width":0,duration:1},E="normal";if(D.fx&&D.fx.constructor==Array){C=D.fx[0]||B,I=D.fx[1]||B}else{C=I=D.fx||B}var H={display:"",overflow:"",height:""};if(!A.browser.msie){H.opacity=""}function M(R,Q,S){Q.animate(C,C.duration||E,function(){Q.addClass(D.hideClass).css(H);if(A.browser.msie&&C.opacity){Q[0].style.filter=""}if(S){L(R,S,Q)}})}function L(R,S,Q){if(I===B){S.css("display","block")}S.animate(I,I.duration||E,function(){S.removeClass(D.hideClass).css(H);if(A.browser.msie&&I.opacity){S[0].style.filter=""}P._trigger("show",null,P.ui(R,S[0]))})}function F(R,T,Q,S){T.addClass(D.selectedClass).siblings().removeClass(D.selectedClass);M(R,Q,S)}this.$tabs.unbind(".tabs").bind(D.event,function(){var T=A(this).parents("li:eq(0)"),Q=P.$panels.filter(":visible"),S=A(this.hash);if((T.hasClass(D.selectedClass)&&!D.unselect)||T.hasClass(D.disabledClass)||A(this).hasClass(D.loadingClass)||P._trigger("select",null,P.ui(this,S[0]))===false){this.blur();return false}P.options.selected=P.$tabs.index(this);if(D.unselect){if(T.hasClass(D.selectedClass)){P.options.selected=null;T.removeClass(D.selectedClass);P.$panels.stop();M(this,Q);this.blur();return false}else{if(!Q.length){P.$panels.stop();var R=this;P.load(P.$tabs.index(this),function(){T.addClass(D.selectedClass).addClass(D.unselectClass);L(R,S)});this.blur();return false}}}if(D.cookie){A.cookie("ui-tabs-"+A.data(P.element[0]),P.options.selected,D.cookie)}P.$panels.stop();if(S.length){var R=this;P.load(P.$tabs.index(this),Q.length?function(){F(R,T,Q,S)}:function(){T.addClass(D.selectedClass);L(R,S)})}else{throw"jQuery UI Tabs: Mismatching fragment identifier."}if(A.browser.msie){this.blur()}return false});if(!(/^click/).test(D.event)){this.$tabs.bind("click.tabs",function(){return false})}},add:function(E,D,C){if(C==undefined){C=this.$tabs.length}var G=this.options;var I=A(G.tabTemplate.replace(/#\{href\}/g,E).replace(/#\{label\}/g,D));I.data("destroy.tabs",true);var H=E.indexOf("#")==0?E.replace("#",""):this._tabId(A("a:first-child",I)[0]);var F=A("#"+H);if(!F.length){F=A(G.panelTemplate).attr("id",H).addClass(G.hideClass).data("destroy.tabs",true)}F.addClass(G.panelClass);if(C>=this.$lis.length){I.appendTo(this.element);F.appendTo(this.element[0].parentNode)}else{I.insertBefore(this.$lis[C]);F.insertBefore(this.$panels[C])}G.disabled=A.map(G.disabled,function(K,J){return K>=C?++K:K});this._tabify();if(this.$tabs.length==1){I.addClass(G.selectedClass);F.removeClass(G.hideClass);var B=A.data(this.$tabs[0],"load.tabs");if(B){this.load(C,B)}}this._trigger("add",null,this.ui(this.$tabs[C],this.$panels[C]))},remove:function(B){var D=this.options,E=this.$lis.eq(B).remove(),C=this.$panels.eq(B).remove();if(E.hasClass(D.selectedClass)&&this.$tabs.length>1){this.select(B+(B+1=B?--G:G});this._tabify();this._trigger("remove",null,this.ui(E.find("a")[0],C[0]))},enable:function(B){var C=this.options;if(A.inArray(B,C.disabled)==-1){return }var D=this.$lis.eq(B).removeClass(C.disabledClass);if(A.browser.safari){D.css("display","inline-block");setTimeout(function(){D.css("display","block")},0)}C.disabled=A.grep(C.disabled,function(F,E){return F!=B});this._trigger("enable",null,this.ui(this.$tabs[B],this.$panels[B]))},disable:function(C){var B=this,D=this.options;if(C!=D.selected){this.$lis.eq(C).addClass(D.disabledClass);D.disabled.push(C);D.disabled.sort();this._trigger("disable",null,this.ui(this.$tabs[C],this.$panels[C]))}},select:function(B){if(typeof B=="string"){B=this.$tabs.index(this.$tabs.filter("[href$="+B+"]")[0])}this.$tabs.eq(B).trigger(this.options.event)},load:function(G,K){var L=this,D=this.options,E=this.$tabs.eq(G),J=E[0],H=K==undefined||K===false,B=E.data("load.tabs");K=K||function(){};if(!B||!H&&A.data(J,"cache.tabs")){K();return }var M=function(N){var O=A(N),P=O.find("*:last");return P.length&&P.is(":not(img)")&&P||O};var C=function(){L.$tabs.filter("."+D.loadingClass).removeClass(D.loadingClass).each(function(){if(D.spinner){M(this).parent().html(M(this).data("label.tabs"))}});L.xhr=null};if(D.spinner){var I=M(J).html();M(J).wrapInner("").find("em").data("label.tabs",I).html(D.spinner)}var F=A.extend({},D.ajaxOptions,{url:B,success:function(O,N){A(J.hash).html(O);C();if(D.cache){A.data(J,"cache.tabs",true)}L._trigger("load",null,L.ui(L.$tabs[G],L.$panels[G]));D.ajaxOptions.success&&D.ajaxOptions.success(O,N);K()}});if(this.xhr){this.xhr.abort();C()}E.addClass(D.loadingClass);setTimeout(function(){L.xhr=A.ajax(F)},0)},url:function(C,B){this.$tabs.eq(C).removeData("cache.tabs").data("load.tabs",B)},destroy:function(){var B=this.options;this.element.unbind(".tabs").removeClass(B.navClass).removeData("tabs");this.$tabs.each(function(){var C=A.data(this,"href.tabs");if(C){this.href=C}var D=A(this).unbind(".tabs");A.each(["href","load","cache"],function(E,F){D.removeData(F+".tabs")})});this.$lis.add(this.$panels).each(function(){if(A.data(this,"destroy.tabs")){A(this).remove()}else{A(this).removeClass([B.selectedClass,B.unselectClass,B.disabledClass,B.panelClass,B.hideClass].join(" "))}})}});A.ui.tabs.defaults={unselect:false,event:"click",disabled:[],cookie:null,spinner:"Loading…",cache:false,idPrefix:"ui-tabs-",ajaxOptions:{},fx:null,tabTemplate:'
  • #{label}
  • ',panelTemplate:"
    ",navClass:"ui-tabs-nav",selectedClass:"ui-tabs-selected",unselectClass:"ui-tabs-unselect",disabledClass:"ui-tabs-disabled",panelClass:"ui-tabs-panel",hideClass:"ui-tabs-hide",loadingClass:"ui-tabs-loading"};A.ui.tabs.getter="length";A.extend(A.ui.tabs.prototype,{rotation:null,rotate:function(C,F){F=F||false;var B=this,E=this.options.selected;function G(){B.rotation=setInterval(function(){E=++E=0&&this.anchors[d.selected])||d.selected<0)?d.selected:0;d.disabled=a.unique(d.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(q,o){return p.lis.index(q)}))).sort();if(a.inArray(d.selected,d.disabled)!=-1){d.disabled.splice(a.inArray(d.selected,d.disabled),1)}this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");if(d.selected>=0&&this.anchors.length){this.panels.eq(d.selected).removeClass("ui-tabs-hide");this.lis.eq(d.selected).addClass("ui-tabs-selected ui-state-active");p.element.queue("tabs",function(){p._trigger("show",null,p._ui(p.anchors[d.selected],p.panels[d.selected]))});this.load(d.selected)}a(window).bind("unload",function(){p.lis.add(p.anchors).unbind(".tabs");p.lis=p.anchors=p.panels=null})}else{d.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))}this.element[d.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");if(d.cookie){this._cookie(d.selected,d.cookie)}for(var g=0,m;(m=this.lis[g]);g++){a(m)[a.inArray(g,d.disabled)!=-1&&!a(m).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled")}if(d.cache===false){this.anchors.removeData("cache.tabs")}this.lis.add(this.anchors).unbind(".tabs");if(d.event!="mouseover"){var f=function(o,i){if(i.is(":not(.ui-state-disabled)")){i.addClass("ui-state-"+o)}};var j=function(o,i){i.removeClass("ui-state-"+o)};this.lis.bind("mouseover.tabs",function(){f("hover",a(this))});this.lis.bind("mouseout.tabs",function(){j("hover",a(this))});this.anchors.bind("focus.tabs",function(){f("focus",a(this).closest("li"))});this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var b,h;if(d.fx){if(a.isArray(d.fx)){b=d.fx[0];h=d.fx[1]}else{b=h=d.fx}}function e(i,o){i.css({display:""});if(a.browser.msie&&o.opacity){i[0].style.removeAttribute("filter")}}var k=h?function(i,o){a(i).closest("li").removeClass("ui-state-default").addClass("ui-tabs-selected ui-state-active");o.hide().removeClass("ui-tabs-hide").animate(h,h.duration||"normal",function(){e(o,h);p._trigger("show",null,p._ui(i,o[0]))})}:function(i,o){a(i).closest("li").removeClass("ui-state-default").addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");p._trigger("show",null,p._ui(i,o[0]))};var l=b?function(o,i){i.animate(b,b.duration||"normal",function(){p.lis.removeClass("ui-tabs-selected ui-state-active").addClass("ui-state-default");i.addClass("ui-tabs-hide");e(i,b);p.element.dequeue("tabs")})}:function(o,i,q){p.lis.removeClass("ui-tabs-selected ui-state-active").addClass("ui-state-default");i.addClass("ui-tabs-hide");p.element.dequeue("tabs")};this.anchors.bind(d.event+".tabs",function(){var o=this,r=a(this).closest("li"),i=p.panels.filter(":not(.ui-tabs-hide)"),q=a(p._sanitizeSelector(this.hash));if((r.hasClass("ui-tabs-selected")&&!d.collapsible)||r.hasClass("ui-state-disabled")||r.hasClass("ui-state-processing")||p._trigger("select",null,p._ui(this,q[0]))===false){this.blur();return false}d.selected=p.anchors.index(this);p.abort();if(d.collapsible){if(r.hasClass("ui-tabs-selected")){d.selected=-1;if(d.cookie){p._cookie(d.selected,d.cookie)}p.element.queue("tabs",function(){l(o,i)}).dequeue("tabs");this.blur();return false}else{if(!i.length){if(d.cookie){p._cookie(d.selected,d.cookie)}p.element.queue("tabs",function(){k(o,q)});p.load(p.anchors.index(this));this.blur();return false}}}if(d.cookie){p._cookie(d.selected,d.cookie)}if(q.length){if(i.length){p.element.queue("tabs",function(){l(o,i)})}p.element.queue("tabs",function(){k(o,q)});p.load(p.anchors.index(this))}else{throw"jQuery UI Tabs: Mismatching fragment identifier."}if(a.browser.msie){this.blur()}});this.anchors.bind("click.tabs",function(){return false})},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var c=a.data(this,"href.tabs");if(c){this.href=c}var d=a(this).unbind(".tabs");a.each(["href","load","cache"],function(e,f){d.removeData(f+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){if(a.data(this,"destroy.tabs")){a(this).remove()}else{a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}});if(b.cookie){this._cookie(null,b.cookie)}},add:function(e,d,c){if(c===undefined){c=this.anchors.length}var b=this,g=this.options,i=a(g.tabTemplate.replace(/#\{href\}/g,e).replace(/#\{label\}/g,d)),h=!e.indexOf("#")?e.replace("#",""):this._tabId(a("a",i)[0]);i.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var f=a("#"+h);if(!f.length){f=a(g.panelTemplate).attr("id",h).data("destroy.tabs",true)}f.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(c>=this.lis.length){i.appendTo(this.list);f.appendTo(this.list[0].parentNode)}else{i.insertBefore(this.lis[c]);f.insertBefore(this.panels[c])}g.disabled=a.map(g.disabled,function(k,j){return k>=c?++k:k});this._tabify();if(this.anchors.length==1){i.addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){b._trigger("show",null,b._ui(b.anchors[0],b.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[c],this.panels[c]))},remove:function(b){var d=this.options,e=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();if(e.hasClass("ui-tabs-selected")&&this.anchors.length>1){this.select(b+(b+1=b?--g:g});this._tabify();this._trigger("remove",null,this._ui(e.find("a")[0],c[0]))},enable:function(b){var c=this.options;if(a.inArray(b,c.disabled)==-1){return}this.lis.eq(b).removeClass("ui-state-disabled");c.disabled=a.grep(c.disabled,function(e,d){return e!=b});this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b]))},disable:function(c){var b=this,d=this.options;if(c!=d.selected){this.lis.eq(c).addClass("ui-state-disabled");d.disabled.push(c);d.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[c],this.panels[c]))}},select:function(b){if(typeof b=="string"){b=this.anchors.index(this.anchors.filter("[href$="+b+"]"))}else{if(b===null){b=-1}}if(b==-1&&this.options.collapsible){b=this.options.selected}this.anchors.eq(b).trigger(this.options.event+".tabs")},load:function(e){var c=this,g=this.options,b=this.anchors.eq(e)[0],d=a.data(b,"load.tabs");this.abort();if(!d||this.element.queue("tabs").length!==0&&a.data(b,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(e).addClass("ui-state-processing");if(g.spinner){var f=a("span",b);f.data("label.tabs",f.html()).html(g.spinner)}this.xhr=a.ajax(a.extend({},g.ajaxOptions,{url:d,success:function(i,h){a(c._sanitizeSelector(b.hash)).html(i);c._cleanup();if(g.cache){a.data(b,"cache.tabs",true)}c._trigger("load",null,c._ui(c.anchors[e],c.panels[e]));try{g.ajaxOptions.success(i,h)}catch(j){}c.element.dequeue("tabs")}}))},abort:function(){this.element.queue([]);this.panels.stop(false,true);if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup()},url:function(c,b){this.anchors.eq(c).removeData("cache.tabs").data("load.tabs",b)},length:function(){return this.anchors.length}});a.extend(a.ui.tabs,{version:"1.7.1",getter:"length",defaults:{ajaxOptions:null,cache:false,cookie:null,collapsible:false,disabled:[],event:"click",fx:null,idPrefix:"ui-tabs-",panelTemplate:"
    ",spinner:"Loading…",tabTemplate:'
  • #{label}
  • '}});a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(d,f){var b=this,g=this.options;var c=b._rotate||(b._rotate=function(h){clearTimeout(b.rotation);b.rotation=setTimeout(function(){var i=g.selected;b.select(++i + + + + + jQuery Context Menu Plugin Demo + + + + + + + + + + + + + +

    jQuery Context Menu Plugin Demo

    +

    + This plugin lets you add context menu functionality to your web applications. +

    + +

    + Tip: Try using your keyboard to make a selection. +

    + +

    + Back to the project page +

    + +

    Demo

    + +
    + Right click for the standard context menu +
    + +
    +
      +
    • Item 1
    • +
    • Item 2
    • +
    • Item 3
    • +
    • Item 4
    • +
    • Item 5
    • +
    • Item 6
    • +
    +
    + +
    +

    + + +

    + +

    + + +

    +
    + + + + + \ No newline at end of file Index: lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/cut.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/Attic/cut.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/door.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/Attic/door.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/page_white_copy.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/Attic/page_white_copy.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/page_white_delete.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/Attic/page_white_delete.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/page_white_edit.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/Attic/page_white_edit.png,v diff -u Binary files differ Index: lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/page_white_paste.png =================================================================== RCS file: /usr/local/cvsroot/lams_central/web/includes/javascript/jquery-ui/ui/plugins/images/Attic/page_white_paste.png,v diff -u Binary files differ Index: lams_common/build.xml =================================================================== RCS file: /usr/local/cvsroot/lams_common/build.xml,v diff -u -r1.66 -r1.67 --- lams_common/build.xml 17 Mar 2009 01:08:26 -0000 1.66 +++ lams_common/build.xml 1 Apr 2009 00:44:11 -0000 1.67 @@ -315,6 +315,8 @@ + + Index: lams_common/conf/hibernate/mappings/org/lamsfoundation/lams/presence/model/PresenceChatMessage.hbm.xml =================================================================== RCS file: /usr/local/cvsroot/lams_common/conf/hibernate/mappings/org/lamsfoundation/lams/presence/model/Attic/PresenceChatMessage.hbm.xml,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_common/conf/hibernate/mappings/org/lamsfoundation/lams/presence/model/PresenceChatMessage.hbm.xml 1 Apr 2009 00:44:11 -0000 1.1 @@ -0,0 +1,76 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + Index: lams_common/db/sql/create_presence_chat_tables.sql =================================================================== RCS file: /usr/local/cvsroot/lams_common/db/sql/create_presence_chat_tables.sql,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_common/db/sql/create_presence_chat_tables.sql 1 Apr 2009 00:44:11 -0000 1.1 @@ -0,0 +1,2 @@ +drop table if exists lams_presence_chat_msgs; +create table lams_presence_chat_msgs (uid bigint not null auto_increment, room_name varchar(255), from_user varchar(255), to_user varchar(255), date_sent datetime, message varchar(1023), primary key (uid))type=innodb; Index: lams_common/src/java/org/lamsfoundation/lams/commonContext.xml =================================================================== RCS file: /usr/local/cvsroot/lams_common/src/java/org/lamsfoundation/lams/commonContext.xml,v diff -u -r1.75 -r1.76 --- lams_common/src/java/org/lamsfoundation/lams/commonContext.xml 27 Mar 2009 18:29:38 -0000 1.75 +++ lams_common/src/java/org/lamsfoundation/lams/commonContext.xml 1 Apr 2009 00:44:11 -0000 1.76 @@ -52,6 +52,7 @@ classpath:org/lamsfoundation/lams/learningdesign/License.hbm.xml classpath:org/lamsfoundation/lams/learningdesign/ActivityEvaluation.hbm.xml + classpath:org/lamsfoundation/lams/lesson/LearnerProgress.hbm.xml classpath:org/lamsfoundation/lams/lesson/Lesson.hbm.xml @@ -67,6 +68,9 @@ classpath:org/lamsfoundation/lams/notebook/model/NotebookEntry.hbm.xml + + classpath:org/lamsfoundation/lams/presence/model/PresenceChatMessage.hbm.xml + classpath:org/lamsfoundation/lams/events/Event.hbm.xml classpath:org/lamsfoundation/lams/events/Subscription.hbm.xml @@ -244,6 +248,11 @@ + + + + + @@ -373,6 +382,11 @@ + + + + + Index: lams_common/src/java/org/lamsfoundation/lams/presence/dao/IPresenceChatMessageDAO.java =================================================================== RCS file: /usr/local/cvsroot/lams_common/src/java/org/lamsfoundation/lams/presence/dao/Attic/IPresenceChatMessageDAO.java,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_common/src/java/org/lamsfoundation/lams/presence/dao/IPresenceChatMessageDAO.java 1 Apr 2009 00:44:11 -0000 1.1 @@ -0,0 +1,42 @@ +/**************************************************************** + * Copyright (C) 2005 LAMS Foundation (http://lamsfoundation.org) + * ============================================================= + * License Information: http://lamsfoundation.org/licensing/lams/2.0/ + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2.0 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 + * USA + * + * http://www.gnu.org/licenses/gpl.txt + * **************************************************************** + */ + +/* $Id: IPresenceChatMessageDAO.java,v 1.1 2009/04/01 00:44:11 paulg Exp $ */ + +package org.lamsfoundation.lams.presence.dao; + +import java.util.List; + +import org.lamsfoundation.lams.presence.model.PresenceChatMessage; + +public interface IPresenceChatMessageDAO { + + void saveOrUpdate(PresenceChatMessage presenceChatMessage); + + PresenceChatMessage getMessageById(Long id); + + List getMessagesByRoomName(String roomName); + + List getMessagesByConversation(String from, String to); + +} Index: lams_common/src/java/org/lamsfoundation/lams/presence/dao/hibernate/PresenceChatMessageDAO.java =================================================================== RCS file: /usr/local/cvsroot/lams_common/src/java/org/lamsfoundation/lams/presence/dao/hibernate/Attic/PresenceChatMessageDAO.java,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_common/src/java/org/lamsfoundation/lams/presence/dao/hibernate/PresenceChatMessageDAO.java 1 Apr 2009 00:44:11 -0000 1.1 @@ -0,0 +1,68 @@ +/**************************************************************** + * Copyright (C) 2005 LAMS Foundation (http://lamsfoundation.org) + * ============================================================= + * License Information: http://lamsfoundation.org/licensing/lams/2.0/ + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2.0 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 + * USA + * + * http://www.gnu.org/licenses/gpl.txt + * **************************************************************** + */ + +/* $Id: PresenceChatMessageDAO.java,v 1.1 2009/04/01 00:44:11 paulg Exp $ */ + +package org.lamsfoundation.lams.presence.dao.hibernate; + +import java.util.List; + +import org.lamsfoundation.lams.dao.hibernate.BaseDAO; +import org.lamsfoundation.lams.notebook.model.NotebookEntry; +import org.lamsfoundation.lams.presence.dao.IPresenceChatMessageDAO; +import org.lamsfoundation.lams.presence.model.PresenceChatMessage; + +public class PresenceChatMessageDAO extends BaseDAO implements IPresenceChatMessageDAO { + + private static final String BY_MESSAGE_ID = "from " + PresenceChatMessage.class.getName() + + " where uid=? order by create_date desc"; + + private static final String BY_CONVERSATION = "from " + PresenceChatMessage.class.getName() + + " where from_user=? and to_user=? order by create_date asc"; + + private static final String BY_ROOM_NAME = "from " + NotebookEntry.class.getName() + + " where room_name=? order by create_date asc"; + + public void saveOrUpdate(PresenceChatMessage presenceChatMessage) { + this.getHibernateTemplate().saveOrUpdate(presenceChatMessage); + this.getHibernateTemplate().flush(); + } + + public PresenceChatMessage getMessageById(Long id) { + List list = (List)(getHibernateTemplate().find(BY_CONVERSATION, new Object[]{id})); + + if(!list.isEmpty()){ + return (PresenceChatMessage)list.get(0); + } + else return null; + } + + public List getMessagesByConversation(String from, + String to) { + return (List)(getHibernateTemplate().find(BY_CONVERSATION, new Object[]{from, to})); + } + + public List getMessagesByRoomName(String roomName) { + return (List)(getHibernateTemplate().find(BY_ROOM_NAME, new Object[]{roomName})); + } +} Index: lams_common/src/java/org/lamsfoundation/lams/presence/dto/PresenceChatMessageDTO.java =================================================================== RCS file: /usr/local/cvsroot/lams_common/src/java/org/lamsfoundation/lams/presence/dto/Attic/PresenceChatMessageDTO.java,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_common/src/java/org/lamsfoundation/lams/presence/dto/PresenceChatMessageDTO.java 1 Apr 2009 00:44:11 -0000 1.1 @@ -0,0 +1,112 @@ +/*************************************************************************** + * Copyright (C) 2005 LAMS Foundation (http://lamsfoundation.org) + * ============================================================= + * License Information: http://lamsfoundation.org/licensing/lams/2.0/ + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2.0 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 + * USA + * + * http://www.gnu.org/licenses/gpl.txt + * ***********************************************************************/ +/* $$Id: PresenceChatMessageDTO.java,v 1.1 2009/04/01 00:44:11 paulg Exp $$ */ +package org.lamsfoundation.lams.presence.dto; + +import java.util.Date; + +import org.lamsfoundation.lams.presence.model.PresenceChatMessage; + +public class PresenceChatMessageDTO +{ + public Long uid; + + private String roomName; + + private String from; + + private String to; + + private Date dateSent; + + private String message; + + public PresenceChatMessageDTO(Long uid, String roomName, String from, + String to, Date dateSent, String message) { + super(); + this.uid = uid; + this.roomName = roomName; + this.from = from; + this.to = to; + this.dateSent = dateSent; + this.message = message; + } + + public PresenceChatMessageDTO(PresenceChatMessage presenceChatMessage){ + this.uid = presenceChatMessage.getUid(); + this.roomName = presenceChatMessage.getRoomName(); + this.from = presenceChatMessage.getFrom(); + this.to = presenceChatMessage.getTo(); + this.dateSent = presenceChatMessage.getDateSent(); + this.message = presenceChatMessage.getMessage(); + } + + public Long getUid() { + return uid; + } + + public void setUid(Long uid) { + this.uid = uid; + } + + public String getRoomName() { + return roomName; + } + + public void setRoomName(String roomName) { + this.roomName = roomName; + } + + public String getFrom() { + return from; + } + + public void setFrom(String from) { + this.from = from; + } + + public String getTo() { + return to; + } + + public void setTo(String to) { + this.to = to; + } + + public Date getDateSent() { + return dateSent; + } + + public void setDateSent(Date dateSent) { + this.dateSent = dateSent; + } + + public String getMessage() { + return message; + } + + public void setMessage(String message) { + this.message = message; + } + + +} Index: lams_common/src/java/org/lamsfoundation/lams/presence/model/PresenceChatMessage.java =================================================================== RCS file: /usr/local/cvsroot/lams_common/src/java/org/lamsfoundation/lams/presence/model/PresenceChatMessage.java,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_common/src/java/org/lamsfoundation/lams/presence/model/PresenceChatMessage.java 1 Apr 2009 00:44:11 -0000 1.1 @@ -0,0 +1,137 @@ +/**************************************************************** + * Copyright (C) 2005 LAMS Foundation (http://lamsfoundation.org) + * ============================================================= + * License Information: http://lamsfoundation.org/licensing/lams/2.0/ + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2.0 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 + * USA + * + * http://www.gnu.org/licenses/gpl.txt + * **************************************************************** + */ + +/* $Id: PresenceChatMessage.java,v 1.1 2009/04/01 00:44:11 paulg Exp $ */ + +package org.lamsfoundation.lams.presence.model; + +import java.util.Date; + +import org.lamsfoundation.lams.presence.dto.PresenceChatMessageDTO; +import org.lamsfoundation.lams.usermanagement.User; + +/** + * @hibernate.class table="lams_presence_chat_msgs" + */ +public class PresenceChatMessage implements java.io.Serializable, Cloneable { + + private Long uid; + + private String roomName; + + private String from; + + private String to; + + private Date dateSent; + + private String message; + + public PresenceChatMessage(Long uid, String roomName, String from, + String to, Date dateSent, String message) { + super(); + this.uid = uid; + this.roomName = roomName; + this.from = from; + this.to = to; + this.dateSent = dateSent; + this.message = message; + } + + public PresenceChatMessage(PresenceChatMessageDTO presenceChatMessageDTO){ + this.uid = presenceChatMessageDTO.getUid(); + this.roomName = presenceChatMessageDTO.getRoomName(); + this.from = presenceChatMessageDTO.getFrom(); + this.to = presenceChatMessageDTO.getTo(); + this.dateSent = presenceChatMessageDTO.getDateSent(); + this.message = presenceChatMessageDTO.getMessage(); + } + + /** + * @hibernate.id generator-class="native" type="java.lang.Long" column="uid" + */ + public Long getUid() { + return uid; + } + + public void setUid(Long uid) { + this.uid = uid; + } + + /** + * @hibernate.property column="room_name" + */ + public String getRoomName() { + return roomName; + } + + public void setRoomName(String roomName) { + this.roomName = roomName; + } + + /** + * @hibernate.property column="from_user" + */ + public String getFrom() { + return from; + } + + public void setFrom(String from) { + this.from = from; + } + + /** + * @hibernate.property column="to_user" + */ + public String getTo() { + return to; + } + + public void setTo(String to) { + this.to = to; + } + + /** + * @hibernate.property column="date_sent" + */ + public Date getDateSent() { + return dateSent; + } + + public void setDateSent(Date dateSent) { + this.dateSent = dateSent; + } + + /** + * @hibernate.property column="message" + */ + public String getMessage() { + return message; + } + + public void setMessage(String message) { + this.message = message; + } + + +} Index: lams_common/src/java/org/lamsfoundation/lams/presence/service/IPresenceChatLoggerService.java =================================================================== RCS file: /usr/local/cvsroot/lams_common/src/java/org/lamsfoundation/lams/presence/service/Attic/IPresenceChatLoggerService.java,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_common/src/java/org/lamsfoundation/lams/presence/service/IPresenceChatLoggerService.java 1 Apr 2009 00:44:11 -0000 1.1 @@ -0,0 +1,48 @@ +/**************************************************************** + * Copyright (C) 2005 LAMS Foundation (http://lamsfoundation.org) + * ============================================================= + * License Information: http://lamsfoundation.org/licensing/lams/2.0/ + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2.0 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 + * USA + * + * http://www.gnu.org/licenses/gpl.txt + * **************************************************************** + */ + +/* $Id: IPresenceChatLoggerService.java,v 1.1 2009/04/01 00:44:11 paulg Exp $ */ + +package org.lamsfoundation.lams.presence.service; + +import java.util.Date; +import java.util.List; + +import org.lamsfoundation.lams.presence.model.PresenceChatMessage; +import org.lamsfoundation.lams.util.MessageService; + +public interface IPresenceChatLoggerService { + + PresenceChatMessage createPresenceChatMessage(String roomName, String from, String to, + Date dateSent, String message); + + PresenceChatMessage getMessageById(Long id); + + List getMessagesByRoomName(String roomName); + + List getMessagesByConversation(String from, String to); + + void saveOrUpdatePresenceChatMessage(PresenceChatMessage presenceChatMessage); + + MessageService getMessageService(); +} Index: lams_common/src/java/org/lamsfoundation/lams/presence/service/PresenceChatLoggerService.java =================================================================== RCS file: /usr/local/cvsroot/lams_common/src/java/org/lamsfoundation/lams/presence/service/Attic/PresenceChatLoggerService.java,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_common/src/java/org/lamsfoundation/lams/presence/service/PresenceChatLoggerService.java 1 Apr 2009 00:44:11 -0000 1.1 @@ -0,0 +1,84 @@ +/**************************************************************** + * Copyright (C) 2005 LAMS Foundation (http://lamsfoundation.org) + * ============================================================= + * License Information: http://lamsfoundation.org/licensing/lams/2.0/ + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2.0 + * as published by the Free Software Foundation. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 + * USA + * + * http://www.gnu.org/licenses/gpl.txt + * **************************************************************** + */ + +/* $Id: PresenceChatLoggerService.java,v 1.1 2009/04/01 00:44:11 paulg Exp $ */ + +package org.lamsfoundation.lams.presence.service; + +import java.util.Date; +import java.util.List; + +import org.apache.log4j.Logger; +import org.lamsfoundation.lams.presence.dao.IPresenceChatMessageDAO; +import org.lamsfoundation.lams.presence.model.PresenceChatMessage; +import org.lamsfoundation.lams.util.MessageService; + +public class PresenceChatLoggerService implements IPresenceChatLoggerService { + + private static Logger log = Logger.getLogger(PresenceChatLoggerService.class); + + private IPresenceChatMessageDAO presenceChatMessageDAO; + + protected MessageService messageService; + + public PresenceChatMessage createPresenceChatMessage(String roomName, String from, String to, + Date dateSent, String message) { + PresenceChatMessage presenceChatMessage = new PresenceChatMessage(null, roomName, from, to, + dateSent, message); + + saveOrUpdatePresenceChatMessage(presenceChatMessage); + return presenceChatMessage; + } + + public PresenceChatMessage getMessageById(Long id){ + return presenceChatMessageDAO.getMessageById(id); + } + + public List getMessagesByRoomName(String roomName){ + return presenceChatMessageDAO.getMessagesByRoomName(roomName); + } + + public List getMessagesByConversation(String from, String to){ + return presenceChatMessageDAO.getMessagesByConversation(from, to); + } + + public void saveOrUpdatePresenceChatMessage(PresenceChatMessage presenceChatMessage){ + presenceChatMessageDAO.saveOrUpdate(presenceChatMessage); + } + + public IPresenceChatMessageDAO getPresenceChatMessageDAO(){ + return this.presenceChatMessageDAO; + } + + public void setPresenceChatMessageDAO(IPresenceChatMessageDAO presenceChatMessageDAO){ + this.presenceChatMessageDAO = presenceChatMessageDAO; + } + + public MessageService getMessageService(){ + return this.messageService; + } + + public void setMessageService(MessageService messageService){ + this.messageService = messageService; + } +} Index: lams_flash/src/central/flash/lams_learner.fla =================================================================== RCS file: /usr/local/cvsroot/lams_flash/src/central/flash/lams_learner.fla,v diff -u -r1.11 -r1.12 Binary files differ Index: lams_flash/src/central/flash/main2.as =================================================================== RCS file: /usr/local/cvsroot/lams_flash/src/central/flash/main2.as,v diff -u -r1.6 -r1.7 --- lams_flash/src/central/flash/main2.as 27 Nov 2008 01:26:48 -0000 1.6 +++ lams_flash/src/central/flash/main2.as 1 Apr 2009 00:44:59 -0000 1.7 @@ -6,35 +6,11 @@ // Temp values to be removed / repplaced at deployment _global.myRoot = this; -if(StringUtils.isEmpty(lcId)){ - Debugger.log('lcId is not defined, actionscript will not be able to communicate with javascript',Debugger.CRITICAL,'main','ROOT'); -} - -if(StringUtils.isEmpty(presenceServerUrl)){ - _root.presenceServerUrl = "192.168.1.1"; - Debugger.log('presenceServerUrl is not defined, using defualt:'+_root.presenceServerUrl ,Debugger.CRITICAL,'main','ROOT'); -} - if(StringUtils.isEmpty(serverURL)){ _root.serverURL = "http://localhost:8080/lams/"; Debugger.log('serverURL is not defined, using defualt:'+_root.serverURL ,Debugger.CRITICAL,'main','ROOT'); } -if(StringUtils.isEmpty(userID)){ - _root.userID = 4; - Debugger.log('userID is not defined, using defualt:'+_root.userID ,Debugger.CRITICAL,'main','ROOT'); -} - -if(StringUtils.isEmpty(firstName)){ - _root.firstName = "firstName"; - Debugger.log('firstName is not defined, using defualt:'+_root.firstName ,Debugger.CRITICAL,'main','ROOT'); -} - -if(StringUtils.isEmpty(lastName)){ - _root.lastName = "lastName"; - Debugger.log('lastName is not defined, using defualt:'+_root.lastName ,Debugger.CRITICAL,'main','ROOT'); -} - if(StringUtils.isEmpty(mode)){ _root.mode = 1; Debugger.log('Mode is not defined, using defualt:'+_root.mode,Debugger.CRITICAL,'main','ROOT'); @@ -54,18 +30,10 @@ _root.langDate = "01-01-1970"; } -if(StringUtils.isEmpty(isIe)){ - _root.isIe = "false"; - Debugger.log('browser is not defined, using defualt:'+_root.isIe,Debugger.CRITICAL,'main','ROOT'); -} - -Debugger.log("PRESENCE: connection info from controlFrame - " + userID + " " + firstName + " " + lastName + " " + presenceServerUrl, Debugger.MED,'main','ROOT'); - //Set stage alignment to top left and prent scaling Stage.align = "TL"; Stage.scaleMode = "noScale"; - //Start the application, passing in the top level clip, i.e. _root var app:Application = Application.getInstance(); app.main(this); @@ -81,30 +49,5 @@ var success = receive_lc.connect("learnerProgress_lc_" + uniqueID); -//Declaration of proxy object for javascript integration kit -var proxy:JavaScriptProxy = new JavaScriptProxy(_root.lcId, this); -_root.proxy = proxy; - -function sendMessageToFlash(msg:String){ - Debugger.log("PRESENCE: from javascript - " + msg, Debugger.MED, 'sendMessageToFlash', 'ROOT'); -} - -function attemptRegistration(){ - Debugger.log("PRESENCE: registration caught in main", Debugger.MED, 'sendMessageToFlash', 'ROOT'); - app.getPresence().attemptRegistration(); -} - -function sendUsersToFlash(users:Array){ - Debugger.log('PRESENCE: ' + users, Debugger.MED, 'sendUsersToFlash', 'ROOT'); - - for (var i:Number = 0; i < users.length; i++) { - trace("1: " + users[i].nick); - users[i].nick = unescape(users[i].nick); - trace("2: " + users[i].nick); - } - - app.getPresence().setupDataGrid(users); -} - //Make app listener for stage resize events Stage.addListener(app); \ No newline at end of file Index: lams_flash/src/central/flash/org/lamsfoundation/lams/learner/Application.as =================================================================== RCS file: /usr/local/cvsroot/lams_flash/src/central/flash/org/lamsfoundation/lams/learner/Application.as,v diff -u -r1.11 -r1.12 --- lams_flash/src/central/flash/org/lamsfoundation/lams/learner/Application.as 6 Feb 2009 04:21:36 -0000 1.11 +++ lams_flash/src/central/flash/org/lamsfoundation/lams/learner/Application.as 1 Apr 2009 00:44:51 -0000 1.12 @@ -42,7 +42,6 @@ private var _lesson:Lesson; private var _header_mc:MovieClip; private var _scratchpad_mc:MovieClip; - private var _presence_mc:MovieClip; private var _reference_mc:MovieClip; private static var SHOW_DEBUGGER:Boolean = false; @@ -92,15 +91,13 @@ private var _lessonLoaded:Boolean; //Lesson loaded flag private var _headerLoaded:Boolean; private var _scratchpadLoaded:Boolean; - private var _presenceLoaded:Boolean; private var _referenceLoaded:Boolean; //Application instance is stored as a static in the application class private static var _instance:Application = null; private var _container_mc:MovieClip; //Main container private var _debugDialog:MovieClip; //Reference to the debug dialog - private var chatDialogs:Array; /** * Application - Constructor @@ -111,13 +108,11 @@ _lessonLoaded = false; _headerLoaded = false; _scratchpadLoaded = false; - _presenceLoaded = false; _referenceLoaded = false; _userDataLoaded = false; _module = Application.MODULE; - chatDialogs = new Array(); } /** @@ -226,9 +221,6 @@ _reference_mc = _container_mc.createChildAtDepth('LReference', DepthManager.kTop, {_visible:false, _x:REF_X, _y:REF_Y, _lessonModel:_lesson.model, _lessonController:_lesson.view.getController()}); _reference_mc.addEventListener('load',Proxy.create(this,UIElementLoaded)); - - _presence_mc = _container_mc.createChildAtDepth('LPresence', DepthManager.kTop, {_x:PRES_X, _y:PRES_Y, _lessonModel:_lesson.model, _lessonController:_lesson.view.getController()}); - _presence_mc.addEventListener('load',Proxy.create(this,UIElementLoaded)); _scratchpad_mc = _container_mc.createChildAtDepth('LScratchPad', DepthManager.kTop, {_x:SPAD_X, _y:SPAD_Y, _lessonModel:_lesson.model, _lessonController:_lesson.view.getController()}); _scratchpad_mc.addEventListener('load', Proxy.create(this, UIElementLoaded)); @@ -278,11 +270,6 @@ case 'Scratchpad' : _scratchpadLoaded = true; break; - case 'Presence' : - _presenceLoaded = true; - _presence_mc._visible = false; - Debugger.log('PRESENCE: presence loaded and set to not visible' ,Debugger.MED,'UIElementLoaded','Application'); - break; case 'Reference' : _referenceLoaded = true; _reference_mc.visible = false; @@ -291,7 +278,7 @@ } //If all of them are loaded set UILoad accordingly - if(_lessonLoaded && _headerLoaded && _scratchpadLoaded && _presenceLoaded && _referenceLoaded){ + if(_lessonLoaded && _headerLoaded && _scratchpadLoaded && _referenceLoaded){ _UILoaded=true; } @@ -327,14 +314,8 @@ var resizeHeight:Number; - if (_presence_mc._visible) { - Debugger.log('resizeHeight set to Presence height', Debugger.MED, 'onResize', 'Application'); - resizeHeight = LESSON_Y+_lesson.model.getPresenceHeight()+_lesson.model.getSpadHeight(); - } - else { - Debugger.log('resizeHeight set to Spad height', Debugger.MED, 'onResize', 'Application'); - resizeHeight = LESSON_Y+_lesson.model.getSpadHeight(); - } + Debugger.log('resizeHeight set to Spad height', Debugger.MED, 'onResize', 'Application'); + resizeHeight = LESSON_Y+_lesson.model.getSpadHeight(); Debugger.log('resizeHeight: ' + resizeHeight, Debugger.MED, 'onResize', 'Application'); @@ -343,21 +324,13 @@ someListener.onMouseUp = function () { _lesson.setSize(w,h-resizeHeight); _scratchpad_mc._y = h - _lesson.model.getSpadHeight(); - _presence_mc._y = h - _lesson.model.getSpadHeight() - _lesson.model.getPresenceHeight(); } Header(_header_mc).resize(w); _lesson.setSize(w,h-resizeHeight); _scratchpad_mc._y = h - _lesson.model.getSpadHeight(); - _presence_mc._y = h - _lesson.model.getSpadHeight() - _lesson.model.getPresenceHeight(); - - if (_presence_mc._visible) { - _reference_mc._y = h - _lesson.model.getSpadHeight() - _lesson.model.getPresenceHeight() - _lesson.model.getReferenceHeight(); - } else { - _reference_mc._y = h - _lesson.model.getSpadHeight() - _lesson.model.getReferenceHeight(); - } - + _reference_mc._y = h - _lesson.model.getSpadHeight() - _lesson.model.getReferenceHeight(); } /** @@ -435,10 +408,6 @@ return Scratchpad(_scratchpad_mc); } - public function getPresence():Presence{ - return Presence(_presence_mc) - } - public function getReference():Reference { return Reference(_reference_mc) } Index: lams_flash/src/central/flash/org/lamsfoundation/lams/learner/ls/LessonView.as =================================================================== RCS file: /usr/local/cvsroot/lams_flash/src/central/flash/org/lamsfoundation/lams/learner/ls/LessonView.as,v diff -u -r1.9 -r1.10 --- lams_flash/src/central/flash/org/lamsfoundation/lams/learner/ls/LessonView.as 6 Feb 2009 04:21:36 -0000 1.9 +++ lams_flash/src/central/flash/org/lamsfoundation/lams/learner/ls/LessonView.as 1 Apr 2009 00:44:51 -0000 1.10 @@ -156,13 +156,6 @@ // if export is available in model, make button available setLessonName(lm.name); Application.getInstance().getHeader().showExportButton(lm.learnerExportAvailable); - - // if presence is available in model, make the panel visible and connect - if(lm.learnerPresenceAvailable) { - Application.getInstance().getPresence().showPresence(lm.learnerPresenceAvailable); - Application.getInstance().getPresence().attemptConnection(); - } - break; case 'DESIGNMODEL' : lm.getLesson().finishedDesign = true; Index: lams_flash/src/central/flash/org/lamsfoundation/lams/wizard/steps/WizardLessonDetailsView.as =================================================================== RCS file: /usr/local/cvsroot/lams_flash/src/central/flash/org/lamsfoundation/lams/wizard/steps/WizardLessonDetailsView.as,v diff -u -r1.8 -r1.9 --- lams_flash/src/central/flash/org/lamsfoundation/lams/wizard/steps/WizardLessonDetailsView.as 28 Nov 2008 03:29:14 -0000 1.8 +++ lams_flash/src/central/flash/org/lamsfoundation/lams/wizard/steps/WizardLessonDetailsView.as 1 Apr 2009 00:44:50 -0000 1.9 @@ -149,7 +149,7 @@ summery_lbl.visible = true; learner_expp_cb.visible = true; learner_enpres_cb.visible = true; - learner_enim_cb.visible = false; + learner_enim_cb.visible = true; learner_enim_cb.enabled = false; schedule_cb.visible = true; schedule_time._visible = true; Index: lams_flash/src/central/flash/src/Main.as =================================================================== RCS file: /usr/local/cvsroot/lams_flash/src/central/flash/src/Main.as,v diff -u Binary files differ Index: lams_learning/web/lams_learner.swf =================================================================== RCS file: /usr/local/cvsroot/lams_learning/web/Attic/lams_learner.swf,v diff -u -r1.113 -r1.114 Binary files differ Index: lams_learning/web/mainflash.jsp =================================================================== RCS file: /usr/local/cvsroot/lams_learning/web/Attic/mainflash.jsp,v diff -u -r1.2 -r1.3 --- lams_learning/web/mainflash.jsp 16 Oct 2008 06:23:15 -0000 1.2 +++ lams_learning/web/mainflash.jsp 1 Apr 2009 00:44:23 -0000 1.3 @@ -18,41 +18,145 @@ http://www.gnu.org/licenses/gpl.txt --%> - + <%@ page language="java" pageEncoding="UTF-8" contentType="text/html;charset=utf-8" %> -<%@ taglib uri="tags-bean" prefix="bean"%> +<%@ page import="org.lamsfoundation.lams.util.Configuration" import="org.lamsfoundation.lams.util.ConfigurationKeys" %> <%@ taglib uri="tags-html" prefix="html"%> <%@ taglib uri="tags-core" prefix="c"%> <%@ taglib uri="tags-fmt" prefix="fmt" %> <%@ taglib uri="tags-lams" prefix="lams" %> - + + - + <fmt:message key="learner.title"/> + + + + + + + - - - - " name="contentFrame" scrolling="YES"> - &presenceUrl=&mode=" name="controlFrame" scrolling="NO"> - - - - - &presenceUrl=&mode=" name="controlFrame" scrolling="NO"> - " name="contentFrame" scrolling="YES"> - - - + - - <body> - <fmt:message key="message.activity.parallel.noFrames" /> - </body> - + <% + String clientVersion = Configuration.get(ConfigurationKeys.LEARNER_CLIENT_VERSION); + String serverLanguage = Configuration.get(ConfigurationKeys.SERVER_LANGUAGE); + String languageDate = Configuration.get(ConfigurationKeys.DICTIONARY_DATE_CREATED); + String jabberServer = Configuration.get(ConfigurationKeys.XMPP_DOMAIN); + %> + + ?userID=&firstName=&lastName=&serverURL=&presenceServerUrl=<%=jabberServer%>&build=<%=clientVersion%>&lang=&country=&langDate=<%=languageDate%>&theme=&lessonID=&uniqueID=&mode= + lams_learner + lams_learner.swf + +
    + + + +
    + + + <%@ include file="/includes/presenceChat.jsp" %> + + + +
    Index: lams_learning/web/mainnoflash.jsp =================================================================== RCS file: /usr/local/cvsroot/lams_learning/web/Attic/mainnoflash.jsp,v diff -u -r1.9 -r1.10 --- lams_learning/web/mainnoflash.jsp 25 Nov 2008 00:59:52 -0000 1.9 +++ lams_learning/web/mainnoflash.jsp 1 Apr 2009 00:44:23 -0000 1.10 @@ -29,89 +29,49 @@ - - - + + + + - <fmt:message key="learner.title"/> - - - - - - - - - - + <fmt:message key="learner.title"/> - - + + <%@ include file="/includes/presenceChat.jsp" %> + - - + Index: lams_learning/web/includes/presence.css =================================================================== RCS file: /usr/local/cvsroot/lams_learning/web/includes/Attic/presence.css,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_learning/web/includes/presence.css 1 Apr 2009 00:44:36 -0000 1.1 @@ -0,0 +1,76 @@ +/* +************************************************* +LAMS 2.0 +Date modified: 22/09/2006 + +************************************************* +Presence style +********************************************** */ + +#presenceUserListings { + margin: 5px; + padding: 2px; +} + +#presenceChat { + position: absolute; + width: 600px; + height: 300px; + right: 18px; + z-index: 10; +} + +#presenceChatTabs { + position: absolute; + bottom: 0; + left: 0; + width: 73%; + height: 260px; +} + +#presenceChatRoster { + position: absolute; + right: 0pt; + bottom: 0pt; + width: 25%; + height: 100%; +} + +.presenceName { + width:"100%"; +} + +.presenceName:hover { + width:"100%"; + background-color: #CBDBFF; + cursor: pointer; +} + +.presenceMessage { + padding-bottom: 4px; +} + +.presenceMessageFrom { + font-weight: bold; +} + +.presenceMessageEmote { + font-style: italic; + padding-bottom: 4px; +} + +.chatPanel { + width: 95%; + height: 80%; +} + +.messageArea { + width: 100%; + height: 80%; + overflow: auto; +} + +.sendArea { + style="width: 100%; + height: 20%; +} \ No newline at end of file Index: lams_learning/web/includes/presence.js =================================================================== RCS file: /usr/local/cvsroot/lams_learning/web/includes/Attic/presence.js,v diff -u -r1.6 -r1.7 --- lams_learning/web/includes/presence.js 27 Nov 2008 22:45:03 -0000 1.6 +++ lams_learning/web/includes/presence.js 1 Apr 2009 00:44:36 -0000 1.7 @@ -1,24 +1,96 @@ - -/* ******* Constants ******* */ -var GROUPCHAT_MSG = ""; -var PRIVATE_MSG = "private_message"; -var PALETTE = ["#0000FF", "#006699", "#0066FF", "#6633FF", "#00CCFF", "#009900", "#00CC33", "#339900", "#008080", "#66FF66", "#CC6600", "#FF6600", "#FF9900", "#CC6633", "#FF9933", "#990000", "#A50021", "#990033", "#CC3300", "#FF6666", "#330033", "#663399", "#6633CC", "#660099", "#FF00FF", "#999900", "#808000", "#FF9FF2", "#666633", "#292929", "#666666"]; -/* ******* Connection variables ******* */ +/******** Connection variables ******* */ var CONFERENCEROOM = ""; var XMPPDOMAIN = ""; var USERNAME = ""; var PASSWORD = ""; var NICK = ""; var RESOURCE = ""; -var FROMFLASH; + +/******** Other variables ******* */ +var groupChatInfo = {nick:"Group Chat", tag:"groupchat", blocked:false}; +var tabLabelsLocal = null; +var windowHeight; +var presenceShown = false; + +/* ******* HTML writer functions ******* */ +function createPrivateTabLabel(label, tag){ + return '
    ' + label + '
    '; +} + +function createPrivateTabContent(label, tag){ + return '

    '; +} + +function createPresenceListing(nick, tag){ + return '
    ' + nick + '
    '; +} + +function createContextMenu(tag){ + return ''; +} + /* ******* Helper Functions ******* */ -function getColour(nick) { - var charSum = 0; - for (var i = 0; i < nick.length; i++) { - charSum += nick.charCodeAt(i); +// resizes chat window +function resizeChat(){ + // refresh the window height + windowHeight = $(window).height() - 30; + + // if presence is shown + if(presenceShown){ + // set presence chat to maximized height + $("#presenceChat").css({'top': windowHeight - 270 + "px"}); } - return PALETTE[charSum % (PALETTE.length)]; + // otherwise + else{ + // set presence chat to minimized height + $("#presenceChat").css({'top': windowHeight + "px"}); + } } + +function getUserFromTag(tag){ + if(tag == groupChatInfo.tag){ + return groupChatInfo; + } + else{ + for(var i = 0; i < roster.users.length; i++){ + if(roster.users[i].tag == tag){ + return roster.users[i]; + } + } + } + + return null; +} + +function getUserFromLabel(label){ + if(label == groupChatInfo.nick){ + return groupChatInfo; + } + else{ + for(var i = 0; i < roster.users.length; i++){ + if(roster.users[i].nick == label){ + return roster.users[i]; + } + } + } + + return null; +} + +function getUserFromTabIndex(tabIndex){ + tabLabelsLocal = $(".ui-tabs-label"); + return getUserFromLabel(tabLabelsLocal[tabIndex].innerHTML); +} + +function addTab(nick, tag){ + // add a tab with the the nick specified + $("#presenceChatTabs").tabs('add' , '#' + tag, createPrivateTabLabel(nick, tag)); + // correct the holding div + $("#" + tag).attr("style", "width: 95%; height: 80%;"); + // add the content + $("#" + tag).html(createPrivateTabContent(nick, tag)); +} + function htmlEnc(str) { if (!str) { return null; @@ -31,50 +103,6 @@ return str; } -function correctPresenceName(o){ - var s = o.nick; - var newNick = new String(""); - for (var i = 0; i < s.length; i++) { - var char = s.charCodeAt(i); - if (char >= 192 && char <= 197) - newNick += "A"; - else if (char == 199) - newNick += "C"; - else if (char >= 200 && char <= 203) - newNick += "E"; - else if (char >= 204 && char <= 207) - newNick += "I"; - else if (char == 209) - newNick += "N"; - else if ((char >= 210 && char <= 214) || char == 216) - newNick += "O"; - else if (char >= 217 && char <= 220) - newNick += "U"; - else if (char == 221) - newNick += "Y"; - else if (char >= 224 && char <= 229) - newNick += "a"; - else if (char == 231) - newNick += "c"; - else if (char >= 232 && char <= 235) - newNick += "e"; - else if (char >= 236 && char <= 239) - newNick += "i"; - else if (char == 241) - newNick += "n"; - else if ((char >= 242 && char <= 246) || char == 240 || char == 248) - newNick += "o"; - else if (char >= 249 && char <= 252) - newNick += "u"; - else if (char == 253 || char == 255) - newNick += "y"; - else - newNick += s.charAt(i); - } - - o.nick = newNick; - return o; -} function correctPresenceRoomName(s){ s = s.replace(/ /g, "_"); @@ -83,7 +111,61 @@ return s; } -function createElem(name, attrs, style, text) { +function nickToTag(nick){ + return nick.replace(/ /g, "_"); +} + +function nickToMessageArea(nick){ + return nick.replace(/ /g, "_") + '_messageArea'; +} + +function getRosterUserByNick(nick) { + for (var i = 0; i < this.users.length; i++) { + if (this.users[i].nick == nick) { + return this.users[i]; + } + } + return null; +} + +function getRosterIndexByNick(nick) { + for (var i = 0; i < this.users.length; i++) { + if (this.users[i].nick == nick) { + return this.users[i]; + } + } + return null; +} + +function sortFunction(a, b){ + if (a.nick < b.nick){ + return -1; + } + if (a.nick > b.nick){ + return 1; + } + + return 0; +} + +function getTime(){ + var currentTime = new Date(); + var hours = currentTime.getHours(); + var minutes = currentTime.getMinutes(); + var seconds = currentTime.getSeconds(); + + if (minutes < 10){ + minutes = "0" + minutes; + } + + if (seconds < 10){ + seconds = "0" + seconds; + } + + return "(" + hours + ":" + minutes + ":" + seconds + ")"; +} + +function createElem(name, attrs, style, innerHTML) { var e = document.createElement(name); if (attrs) { for (var key in attrs) { @@ -93,7 +175,14 @@ if (key == "attrId") { e.id = attrs[key]; } else { - e.setAttribute(key, attrs[key]); + if(key == "onClick"){ + // for IE (attrId must have been set to e.id) + e.onclick = function() {handlePresenceLeftClick(e.id);}; + // for FF + e.setAttribute(key, attrs[key]); + } else { + e.setAttribute(key, attrs[key]); + } } } } @@ -103,93 +192,204 @@ e.style[key] = style[key]; } } - if (text) { - e.appendChild(document.createTextNode(text)); + if (innerHTML) { + //e.appendChild(document.createTextNode(text)); + e.innerHTML = innerHTML; } return e; } +function refreshContextMenu(tag, blocked){ + var contextMenu = $('#' + tag + '_contextMenu'); + + if(blocked){ + contextMenu.enableContextMenuItems('#allow'); + contextMenu.disableContextMenuItems('#block'); + } + else{ + contextMenu.enableContextMenuItems('#block'); + contextMenu.disableContextMenuItems('#allow'); + } +} + +function handleAllowBlockClick(tag, blocked){ + refreshContextMenu(tag, !blocked); + return !blocked; +} + +function addContextMenu(div, contextMenu){ + var myDiv = $("#" + div); + myDiv.contextMenu({ + menu: contextMenu + }, + function(action, el, pos) { + // get roster index from clicked div + var rosterIndex = $(el).attr('rosterIndex'); + + // get info + var user = roster.users[rosterIndex]; + var tag = user.tag; + var nick = user.nick; + var blocked = user.blocked; + + if(action == "allow" && blocked){ + roster.users[rosterIndex].blocked = handleAllowBlockClick(tag, blocked); + } + else if(action == "block" && !blocked){ + roster.users[rosterIndex].blocked = handleAllowBlockClick(tag, blocked); + } + }); +} + +/* ******* Click handlers ******* */ +function handleLeftScrollClick(){ + $("#presenceChatTabs").tabs('scrollLeft'); +} + +function handleRightScrollClick(){ + $("#presenceChatTabs").tabs('scrollRight'); +} + +function handlePresenceLeftClick(divName){ + var div = document.getElementById(divName); + var rosterIndex = div.getAttribute("rosterIndex"); + var user = roster.users[rosterIndex]; + var tag = user.tag; + var nick = user.nick; + + // if the clicked user is one's self + if(nick == NICK){ + // do nothing + } + // if the clicked user's tab is not already open, create it and select it + else if(document.getElementById(tag) == null){ + // add a tab + addTab(nick, tag); + // select the added tab + $("#presenceChatTabs").tabs('select' , tag); + } + // if the clicked user's tab is open + else{ + // make the sender's tab label unbold + $('#' + tag + '_tabLabel').html(nick); + + // select the tab + $("#presenceChatTabs").tabs('select' , tag); + } +} + +function handleCloseTabClick(label){ + tabLabelsLocal = $(".ui-tabs-label"); + for(var i = 0; i < tabLabelsLocal.length; i++){ + if(tabLabelsLocal[i].innerHTML == label){ + $("#presenceChatTabs").tabs('remove' , i); + } + } +} + +function handlePresenceClick() { + if(presenceShown){ + $("#presenceChat").animate({top: windowHeight + "px"}, 1000 ); + presenceShown = false; + } + else{ + $("#presenceChat").animate({top: windowHeight - 270 + "px"}, 1000 ); + presenceShown = true; + } +} + /* ******* Roster ******* */ function RosterUser(nick) { this.nick = nick; + this.tag = nickToTag(nick); this.status = "unavailable"; + this.blocked = false; + this.staff = false; } -function getRosterUserByNick(nick) { - for (var i = 0; i < this.users.length; i++) { - if (this.users[i].nick == nick) { - return this.users[i]; - } - } - return null; -} + function AddRosterUser(user) { this.users[this.users.length] = user; } + function UpdateRosterUser(user) { // TODO do we need this. } + function RemoveRosterUser() { } -function GetAllRosterUsers() { + +function GetAllRosterUsers() { return this.users; } -function CloneAndEncodeUser(user){ - var newUser = new Object(); - var newUserNick; - newUser.status = "" + user.status; - newUser.nick = "" + user.nick; - newUser.nick = encodeURI(newUser.nick); - return newUser; -} - function UpdateRosterDisplay() { - if(FROMFLASH){ - // send users to flash - var availableUsers = []; - - for (var i = 0; i < this.users.length; i++) { - if (this.users[i].status != "unavailable") { - availableUsers[availableUsers.length] = CloneAndEncodeUser(this.users[i]); - } + // sort users by name + this.users.sort(sortFunction); + var availableCount = 0; + + // get number available users (sorry) + for (var i = 0; i < this.users.length; i++) { + if (this.users[i].status != "unavailable") { + availableCount++; } - - flashProxy.call("sendUsersToFlash", availableUsers); } - else { - // send roster to no flash version - var rosterDiv = document.getElementById("roster"); - this.users.sort(sortFunction); - var availableCount = 0; - - // so sorry about this - for (var i = 0; i < this.users.length; i++) { - if (this.users[i].status != "unavailable") { - availableCount++; + + // update presenceTabLabel + var presenceTabLabelDiv = $("#presence_tabLabel"); + presenceTabLabelDiv.html("Users (" + availableCount + ")"); + + // update users in presence tab + // get rosterDiv + var rosterDiv = $("#presenceUserListings"); + // clear rosterDiv + rosterDiv.html(""); + + // if presence im is enabled + if(presenceImEnabled == "true"){ + // get rosterDiv + var contextMenus = $("#presenceContextMenus"); + // clear rosterDiv + contextMenus.html(""); + } + + // for all users + for (var i = 0; i < this.users.length; i++) { + // if available + if (this.users[i].status != "unavailable") { + // get nick + var nick = this.users[i].nick; + // get tag + var tag = this.users[i].tag; + // get blocked + var blocked = this.users[i].blocked; + + // create listing div name + var listingName = tag + "_listing"; + // create listing div + // note: attrId must be added to array before onClick + var listingDiv = createElem("div", {attrId:listingName, rosterIndex:i, onClick:"handlePresenceLeftClick('" + listingName + "');", attrClass:"presenceName"}, {}, createPresenceListing(nick, tag)); + // add the listing div + rosterDiv.append(listingDiv); + + // if presence im is enabled + if(presenceImEnabled == "true"){ + // if not oneself + if(nick != NICK){ + // create context menu div name + var contextMenuName = tag + "_contextMenu"; + // add the context menu + contextMenus.html(contextMenus.html() + createContextMenu(tag)); + // connect the context menu to the last added div + addContextMenu(listingName, contextMenuName); + // refresh the context menu + refreshContextMenu(tag, blocked); + } } + } - - var presenceString = presenceLabel + " (" + availableCount + ")"; - rosterDiv.innerHTML = "
    " + presenceString + "
    "; - - for (var i = 0; i < this.users.length; i++) { - if (this.users[i].status != "unavailable") { - var nick = this.users[i].nick; - var userDiv = createElem("div", {attrId:"user-" + i}, {width:"100%", color:"#0000FF"}, this.users[i].nick); - rosterDiv.appendChild(userDiv); - } - } } } -function sortFunction(a, b){ - if (a.nick < b.nick) - return -1; - if (a.nick > b.nick) - return 1; - return 0; -} - function Roster() { this.users = []; this.currentIndex = null; @@ -201,114 +401,169 @@ this.updateDisplay = UpdateRosterDisplay; this.getAllUsers = GetAllRosterUsers; } + var roster = new Roster(); -function selectUser(userDiv) { - if (MODE == "teacher") { - var newIndex = userDiv.id.substring(userDiv.id.indexOf("-") + 1, userDiv.id.length); - if (roster.currentIndex == newIndex) { - roster.currentIndex = null; - } else { - roster.currentIndex = newIndex; - } - - // update "send message to" display - var sendToUserSpan = document.getElementById("sendToUser"); - var sendToEveryoneSpan = document.getElementById("sendToEveryone"); - if (roster.currentIndex == null) { - sendToEveryoneSpan.style.display = "inline"; - sendToUserSpan.style.display = "none"; - } else { - sendToEveryoneSpan.style.display = "none"; - sendToUserSpan.style.display = "inline"; - var nick = roster.users[roster.currentIndex].nick; - var nickElem = createElem("span", null, {color:getColour(nick)}, nick); - sendToUserSpan.innerHTML = ""; // clear previous user name - sendToUserSpan.appendChild(nickElem); - } - roster.updateDisplay(); - } -} - /* ******* Chat functions ******* */ function setFocusOnTextarea() { document.forms[0].msg.focus(); } -function scrollMessageDisplay() { - var iRespDiv = document.getElementById("iResp"); - iRespDiv.scrollTop = iRespDiv.scrollHeight; -} -function generateMessageHTML(nick, message, type) { - var colour = getColour(nick); - var fromElem = createElem("div", {attrClass:"messageFrom"}, null, nick); - var msgElem = createElem("div", {attrClass:"message " + type}, {color:colour}, null); - msgElem.innerHTML = message; + +function generateMessageHTML(nick, message) { + var fromElem = createElem("div", {attrClass:"presenceMessageFrom"}, null, getTime() + " " + nick); + var msgElem = createElem("div", {attrClass:"presenceMessage"}, null, message); msgElem.insertBefore(fromElem, msgElem.firstChild); return msgElem; } -function updateMessageDisplay(htmlMessage) { - var iRespDiv = document.getElementById("iResp"); - iRespDiv.appendChild(htmlMessage); - iRespDiv.scrollTop = iRespDiv.scrollHeight; + +function generateEmoteHTML(nick, emote){ + return createElem("div", {attrClass:"presenceMessageEmote"}, null, getTime() + " " + nick + " " + emote); } +function updateMessageDisplay(div, htmlMessage) { + var messageArea = document.getElementById(div); + messageArea.appendChild(htmlMessage); + messageArea.scrollTop = messageArea.scrollHeight; +} + function sendMsg(aForm) { - if (aForm.msg.value === "") { - return false; // do not send empty messages. + // if messageInput in form is empty + if (aForm.messageInput.value === "") { + // send nothing + return false; } + + // creaet a new message object var aMsg = new JSJaCMessage(); - if (MODE == "teacher" && !(roster.currentIndex === null)) { - var toNick = roster.users[roster.currentIndex].nick; + + // prepare nick + var toNick = ""; + + // prepare user + var user = null; + + // if the form has a hidden sendTo input, it's a private message + if (aForm.sendTo) { + toNick = aForm.sendTo.value; + user = roster.getUserByNick(toNick); aMsg.setTo(CONFERENCEROOM + "/" + toNick); aMsg.setType("chat"); - var message = "[" + toNick + "] " + aForm.msg.value; - aMsg.setBody(message); + aMsg.setBody(aForm.messageInput.value); // apending the private message to the incoming window, // since the jabber server will not echo sent private messages. // TODO: need to check if this is correct behaviour if (!(NICK == toNick)) { - updateMessageDisplay(generateMessageHTML(NICK, message, PRIVATE_MSG)); + updateMessageDisplay(nickToMessageArea(toNick), generateMessageHTML(NICK, aForm.messageInput.value)); } - } else { + + // log message + $.get(lamsUrl + "PresenceChatLogger", {roomName:CONFERENCEROOM, from:NICK, to:toNick, dateSent:new Date(), message:aForm.messageInput.value}, null); + } + // otherwise, it's a group chat message + else { aMsg.setTo(CONFERENCEROOM); aMsg.setType("groupchat"); - aMsg.setBody(aForm.msg.value); + aMsg.setBody(aForm.messageInput.value); + + $.get(lamsUrl + "PresenceChatLogger", {roomName:CONFERENCEROOM, from:NICK, to:null, dateSent:new Date(), message:aForm.messageInput.value}, null); } - - // } + aMsg.setFrom(USERNAME + "@" + XMPPDOMAIN + "/" + RESOURCE); - con.send(aMsg); - aForm.msg.value = ""; + + // if groupchat or if user is available + if(user == null || user.status == "available"){ + // send message + con.send(aMsg); + } + // otherwise if not groupchat and user is unavailable + else if(user != null && user.status == "unavailable"){ + // generate the emote message and display it to user + var emoteMessage = generateEmoteHTML("Your", "previous message has not been sent because " + toNick + " is unavailable"); + updateMessageDisplay(nickToMessageArea(toNick), emoteMessage); + } + + aForm.messageInput.value = ""; + aForm.messageInput.focus(); return false; } /* ******* Event Handlers ******* */ function handleEvent(aJSJaCPacket) { document.getElementById("iResp").innerHTML += "IN (raw):
    " + htmlEnc(aJSJaCPacket.xml()) + "
    "; } + function handleMessage(aJSJaCPacket) { + // get nick var nick = aJSJaCPacket.getFrom().substring(aJSJaCPacket.getFrom().indexOf("/") + 1); + + // get message var message = htmlEnc(aJSJaCPacket.getBody()); + + // get type (private or group) var type = aJSJaCPacket.getType(); + + // prepare htmlMessage var htmlMessage; + + // get the tag from nick + var tag = nickToTag(nick); + + // if message is private chat if (type == "chat") { - htmlMessage = generateMessageHTML(nick, message, PRIVATE_MSG); - } else { + // get user from nick + var user = roster.getUserByNick(nick); + + // if sending user is not blocked + if(!user.blocked){ + // if the receiver doesn't have a tab with the sender open + if(document.getElementById(nickToMessageArea(nick)) == null){ + // add a tab + addTab(nick, tag); + } + + // get the selected tab + var selected = $("#presenceChatTabs").tabs().data('selected.tabs'); + + // if the selected tab is any other than sender's tab + if(getUserFromTabIndex(selected).tag != tag){ + // make the sender's tab label bold + $('#' + tag + '_tabLabel').html('' + nick + ''); + } + + // generate html + htmlMessage = generateMessageHTML(nick, message); + + // add the div to the sender's tab + updateMessageDisplay(nickToMessageArea(nick), htmlMessage); + } + } + // if message is groupchat + else { if (type == "groupchat") { - htmlMessage = generateMessageHTML(nick, message, GROUPCHAT_MSG); + // get the selected tab + var selected = $("#presenceChatTabs").tabs().data('selected.tabs'); + + // if the selected tab is any other than groupchat + if(selected != 0){ + // make the group chat label label bold + $('#groupchat_tabLabel').html('Group Chat'); + } + + htmlMessage = generateMessageHTML(nick, message); + updateMessageDisplay('groupchat_messageArea', htmlMessage); } else { - /* somethings wrong, dont add anything.*/ + // somethings wrong, dont add anything htmlMessage = ""; } } - updateMessageDisplay(htmlMessage); } + function handlePresence(presence) { - // debug statement for presence - //alert("presence"); + // get presence attributes var from = presence.getFrom(); var status = presence.getStatus(); var show = presence.getShow(); var type = presence.getType(); + // get x element for MUC var x; for (var i = 0; i < presence.getNode().getElementsByTagName("x").length; i++) { @@ -318,42 +573,118 @@ } } - // extract nick. + // extract nick var nick; if (from.indexOf("/") != -1) { nick = from.substring(from.indexOf("/") + 1); } + + // get user from nick var user = roster.getUserByNick(nick); + + // if user is new if (!user) { + // add use to roster user = new RosterUser(nick); roster.addUser(user); } + + // get tag + var tag = "" + user.tag; + + // if presence has a specific status, assign it if (show) { user.status = show; } else { if (type) { - if (type == "unavailable") { + // if type is unavailable + if (type == "unavailable") { + // set unavailable status user.status = "unavailable"; + + // if presence im is enabled (there is a chatbox) + if(presenceImEnabled == "true"){ + // get the selected tab + var selected = $("#presenceChatTabs").tabs().data('selected.tabs'); + + // if the selected tab is any other than groupchat + if(selected != 0){ + // make the group chat label bold + $('#groupchat_tabLabel').html('Group Chat'); + } + + // generate the emote message and display it to group chat + var emoteMessage = generateEmoteHTML(nick, "has gone offline"); + updateMessageDisplay('groupchat_messageArea', emoteMessage); + + // if the person who got disconnected has a tab open + if(document.getElementById(nickToMessageArea(nick)) != null){ + // get the selected tab + var selected = $("#presenceChatTabs").tabs().data('selected.tabs'); + + // if the selected tab is any other than sender's tab + if(getUserFromTabIndex(selected).tag != tag){ + // make the sender's tab label bold + $('#' + tag + '_tabLabel').html('' + nick + ''); + } + + // generate the emote message and display it to group chat + var emoteMessage = generateEmoteHTML(nick, "has gone offline"); + updateMessageDisplay(nickToMessageArea(nick), emoteMessage); + } + } } - } else { - // default: means presence is available. + } + // default: means presence is available + else { + // set status to available user.status = "available"; + + // if presence im is enabled (there is a chatbox) + if(presenceImEnabled == "true"){ + // get the selected tab + var selected = $("#presenceChatTabs").tabs().data('selected.tabs'); + + // if the selected tab is any other than groupchat + if(selected != 0){ + // make the group chat label label bold + $('#groupchat_tabLabel').html('Group Chat'); + } + + // generate the emote message and display it to group chat + var emoteMessage = generateEmoteHTML(nick, "has come online"); + updateMessageDisplay('groupchat_messageArea', emoteMessage); + + // if the person who got connected has a tab open + if(document.getElementById(nickToMessageArea(nick)) != null){ + // get the selected tab + var selected = $("#presenceChatTabs").tabs().data('selected.tabs'); + + // if the selected tab is any other than sender's tab + if(getUserFromTabIndex(selected).tag != tag){ + // make the sender's tab label bold + $('#' + tag + '_tabLabel').html('' + nick + ''); + } + + // generate the emote message and display it to group chat + var emoteMessage = generateEmoteHTML(nick, "has come online"); + updateMessageDisplay(nickToMessageArea(nick), emoteMessage); + } + } } } - if(FROMFLASH){ - // notify flash - flashProxy.call("sendMessageToFlash", "Presence handled"); - } - else { - // NoFlash equivalent - } - + // update the roster roster.updateDisplay(); } + function handleConnected() { - //debug statement for connecton - //alert("connected"); + // if presence im is enabled (there is a chatbox) + if(presenceImEnabled == "true"){ + // generate the emote message and display it to group chat + var emoteMessage = generateEmoteHTML("You", "have been connected to LAMS instant messaging"); + updateMessageDisplay('groupchat_messageArea', emoteMessage); + } // send presence var aPresence = new JSJaCPresence(); @@ -367,43 +698,36 @@ // set up roster roster = new Roster(); - - if(FROMFLASH){ - // notify flash - flashProxy.call("sendMessageToFlash", "Connected"); +} + +function handleDisconnected() { + // if presence im is enabled (there is a chatbox) + if(presenceImEnabled == "true"){ + // generate the emote message and display it to group chat + var emoteMessage = generateEmoteHTML("You", "have been disconnected from LAMS instant messaging"); + updateMessageDisplay('groupchat_messageArea', emoteMessage); } - else { - // NoFlash equivalent - } } + function handleError(e) { - if(FROMFLASH){ - // notify flash - flashProxy.call("sendMessageToFlash", "Code: " + e.getAttribute("code") + " Type: " + e.getAttribute("type")); - - switch(e.getAttribute("code")){ + switch(e.getAttribute("code")){ // unauthorized, try register case "401": - flashProxy.call("attemptRegistration"); + doRegistration(); break; - } } - else{ - switch(e.getAttribute("code")){ - // unauthorized, try register - case "401": - attemptRegistration(); - break; - } - } } -function breakPoint() { - var i = 0; +function handlePresenceRegistration(registrationInfo){ + // if registrationInfo exists, registration worked + if (registrationInfo) { + // attempt to re-login + doLogin(presenceUrl, userId, userId, userId, roomName, nickname, false); + } } - -/* ******* Init ******* */ -function doLogin(presenceServerUrl, userID, password, resource, chatroom, nickname, register, fromFlash) { + +/* ******* Connection function ******* */ +function doLogin(presenceServerUrl, userID, password, resource, chatroom, nickname, register) { try { // if register is set to false (first time login), store connection info, otherwise, just use it again if(!register) { @@ -413,7 +737,6 @@ XMPPDOMAIN = presenceServerUrl; NICK = unescape(nickname); CONFERENCEROOM = chatroom + "@conference." + presenceServerUrl; - FROMFLASH = fromFlash; // debug statement for connection information //alert(HTTPBASE + USERNAME + PASSWORD + RESOURCE + XMPPDOMAIN + NICK + CONFERENCEROOM + FROMFLASH); @@ -430,61 +753,39 @@ con.registerHandler("presence", handlePresence); con.registerHandler("iq", handleEvent); con.registerHandler("onconnect", handleConnected); + con.registerHandler("ondisconnect", handleDisconnected); con.registerHandler("onerror", handleError); // setup args for connect method oArgs = {domain:XMPPDOMAIN, username:USERNAME, resource:RESOURCE, pass:PASSWORD, register:register}; con.connect(oArgs); - - if(FROMFLASH){ - // notify flash - flashProxy.call("sendMessageToFlash", "Attempting connection"); - } - else { - // NoFlash equivalent - } } catch (e) { - flashProxy.call("sendMessageToFlash", e.toString()); + // error } finally { return false; } } -function getUsers() { - flashProxy.call("sendMessageToFlash", GetAllRosterUsers()); + +function doRegistration(){ + $.get(xmppServlet, {method: "createXmppId"}, handlePresenceRegistration); } + +/* function init() { - /* if (typeof (Debugger) == "function") { var oDbg = new Debugger(4, "simpleclient"); oDbg.start(); } doLogin(); - */ } + onload = init; +*/ + onunload = function () { if (typeof (con) != "undefined" && con.disconnect) { con.disconnect(); } -}; -/* ******* Helper functions ******* */ -function checkEnter(e) { //e is event object passed from function invocation - var characterCode; //literal character code will be stored in this variable - if (e && e.which) { //if which property of event object is supported (NN4) - e = e; - characterCode = e.which; //character code is contained in NN4's which property - } else { - e = event; - characterCode = e.keyCode; //character code is contained in IE's keyCode property - } - if (characterCode == 13) { //if generated character code is equal to ascii 13 (if enter key) - //document.forms[0].submit(); //submit the form - sendMsg(document.forms[0]); - return false; - } else { - return true; - } -} - +}; \ No newline at end of file Index: lams_learning/web/includes/presenceChat.jsp =================================================================== RCS file: /usr/local/cvsroot/lams_learning/web/includes/Attic/presenceChat.jsp,v diff -u --- /dev/null 1 Jan 1970 00:00:00 -0000 +++ lams_learning/web/includes/presenceChat.jsp 1 Apr 2009 00:44:36 -0000 1.1 @@ -0,0 +1,117 @@ + <%-- css --%> + + + + + <%-- javascript --%> + + + + + + + + + <%-- html --%> +
    + +
    +
    +
    +
    + +
    + +
    + +
    +
    +
    +
    +
    +
    +
    +
    +
    + + + + + +
    +
    +
    +
    +
    +
    + +
    +
    +
    \ No newline at end of file Index: lams_monitoring/web/lams_wizard.swf =================================================================== RCS file: /usr/local/cvsroot/lams_monitoring/web/Attic/lams_wizard.swf,v diff -u -r1.72 -r1.73 Binary files differ Index: lams_monitoring/web/lams_wizard_library.swf =================================================================== RCS file: /usr/local/cvsroot/lams_monitoring/web/Attic/lams_wizard_library.swf,v diff -u -r1.50 -r1.51 Binary files differ